NPASS drugs

Drug Information

Drug ID:	NPD5694
Drug Name:	Megestrol acetate
Molecular Formula:	C23H30O4
Canonical SMILES:	O=C1CC[C@]2(C(=C1)C=C[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@]2(OC(=O)C)C(=O)C)C)C
Standard InCHI:	"InChI=1S/C23H30O4/c1-14(24)23(27-15(2)25)12-9-20-18-6-5-16-13-17(26)7-10-21(16,3)19(18)8-11-22(20,23)4/h5-6,13,18-20H,7-12H2,1-4H3/t18-,19+,20+,21+,22+,23+/m1/s1"
Standard InCHIKey:	URXWVWVPMJSAJD-KOORYGTMSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	DrugBank

Structural Similarity Between NPASS Natural Products and NPD5694

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	84981
0.1-0.2	120619
0.2-0.3	5846
0.3-0.4	264
0.4-0.5	16
0.5-0.6	10
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6207	NPC317959
Remote Similarity	0.6207	NPC600298
Remote Similarity	0.5517	NPC248176
Remote Similarity	0.5517	NPC502700
Remote Similarity	0.5517	NPC592653
Remote Similarity	0.5333	NPC266021
Remote Similarity	0.5333	NPC216738
Remote Similarity	0.5246	NPC121270
Remote Similarity	0.5231	NPC305039
Remote Similarity	0.5231	NPC612001
Remote Similarity	0.5161	NPC219379
Remote Similarity	0.5079	NPC34664

Drug Structure

NPD5694 OpenBabel08211708292D 27 30 0 0 1 0 0 0 0 0999 V2000 0.9243 1.2730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4895 0.8355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3719 -0.9364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8428 0.5222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5297 -3.4052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6867 -2.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0569 -1.9445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5289 -0.4859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8413 -1.4596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2144 -1.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6858 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8416 -0.4869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2150 -3.4047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0003 0.9723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7668 0.1852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3725 -2.9183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0572 -2.9178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6864 -1.9455 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5292 -1.4586 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8433 -1.4591 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.3722 -1.9450 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8431 -0.4864 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.7230 1.6227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9686 -0.7659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9271 -3.4196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8422 0.4859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 14 1 0 0 0 0 2 15 1 0 0 0 0 4 22 1 0 0 0 0 5 6 2 0 0 0 0 5 16 1 0 0 0 0 7 10 1 0 0 0 0 7 17 1 0 0 0 0 8 11 1 0 0 0 0 8 19 1 0 0 0 0 9 12 1 0 0 0 0 9 20 1 0 0 0 0 10 21 1 0 0 0 0 11 22 1 0 0 0 0 12 23 1 0 0 0 0 13 16 2 0 0 0 0 13 17 1 0 0 0 0 14 24 2 0 0 0 0 15 25 2 0 0 0 0 15 27 1 0 0 0 0 16 21 1 0 0 0 0 17 26 2 0 0 0 0 18 6 1 1 0 0 0 18 19 1 0 0 0 0 18 20 1 0 0 0 0 19 21 1 6 0 0 0 20 22 1 6 0 0 0 21 3 1 6 0 0 0 22 23 1 1 0 0 0 23 14 1 6 0 0 0 23 27 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000861
DrugBank	DB00351
ChEMBL	CHEMBL1201139
IUPHAR/BPS
PharmaGKB	PA450351
KEGG Drug	D00952
PubChem CID	0
ChEBI	6723
CAS Number	595-33-5

Drug Properties

Molecular Weight	370.21
ALogP	1.1174
MLogP	3.55
XLogP	3.657
HDA	4
HBD	0
Rotatable Bonds	7
TPSA	60.44
RO5 Violation	0