Drug Information| Drug ID:   | NPD6098 |
| Drug Name:   | Anagestone Acetate |
| Molecular Formula:   | C24H36O3 |
| Canonical SMILES:   | CC(=O)O[C@@]1(CCC2[C@]1(C)CC[C@H]1[C@H]2C[C@@H](C2=CCCC[C@]12C)C)C(=O)C |
| Standard InCHI:   | "InChI=1S/C24H36O3/c1-15-14-18-20(22(4)11-7-6-8-19(15)22)9-12-23(5)21(18)10-13-24(23,16(2)25)27-17(3)26/h8,15,18,20-21H,6-7,9-14H2,1-5H3/t15-,18+,20-,21?,22-,23-,24-/m0/s1" |
| Standard InCHIKey:   | KDLNOQQQEBKBQM-HDFGVWRLSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD6098Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 372.27 |
| ALogP   | 0.8769 |
| MLogP   | 3.77 |
| XLogP   | 6.371 |
| HDA   | 3 |
| HBD   | 0 |
| Rotatable Bonds   | 8 |
| TPSA   | 43.37 |
| RO5 Violation   | 1 |