NPASS drugs

Drug Information

Drug ID:	NPD4223
Drug Name:	Norethandrolone
Molecular Formula:	C20H30O2
Canonical SMILES:	CC[C@]1(O)CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12
Standard InCHI:	"InChI=1S/C20H30O2/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h12,15-18,22H,3-11H2,1-2H3/t15-,16+,17+,18-,19-,20-/m0/s1"
Standard InCHIKey:	ZDHCJEIGTNNEMY-XGXHKTLJSA-N
Max Developmental Stage:	Phase 3
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD4223

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	71333
0.1-0.2	127722
0.2-0.3	12223
0.3-0.4	401
0.4-0.5	51
0.5-0.6	8
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6226	NPC321187
Remote Similarity	0.6226	NPC599870
Remote Similarity	0.5636	NPC28159
Remote Similarity	0.5536	NPC144258
Remote Similarity	0.5536	NPC611417
Remote Similarity	0.5439	NPC106675
Remote Similarity	0.5254	NPC310010
Remote Similarity	0.5254	NPC326627
Remote Similarity	0.5254	NPC600483
Remote Similarity	0.5167	NPC108896

Drug Structure

NPD4223 OpenBabel08211704332D 23 26 0 0 1 0 0 0 0 0999 V2000 -0.7209 1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8403 0.5207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0003 0.9695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5224 -3.3953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0422 -1.9389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6818 -2.9103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2022 -1.4539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5215 -0.4845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8389 -1.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6809 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8392 -0.4855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2027 -3.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3627 -2.9098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0425 -2.9093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3624 -1.9394 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5218 -1.4544 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6815 -1.9398 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8409 -1.4548 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8406 -0.4850 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9109 -3.4102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8397 0.4845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7616 0.1846 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 2 19 1 0 0 0 0 4 6 1 0 0 0 0 4 13 1 0 0 0 0 5 7 1 0 0 0 0 5 14 1 0 0 0 0 8 10 1 0 0 0 0 9 11 1 0 0 0 0 9 18 1 0 0 0 0 10 19 1 0 0 0 0 11 20 1 0 0 0 0 12 13 2 0 0 0 0 12 14 1 0 0 0 0 13 15 1 0 0 0 0 14 21 2 0 0 0 0 15 7 1 1 0 0 0 15 16 1 0 0 0 0 16 8 1 6 0 0 0 16 17 1 0 0 0 0 17 6 1 1 0 0 0 17 18 1 0 0 0 0 18 19 1 6 0 0 0 19 20 1 1 0 0 0 20 3 1 1 0 0 0 20 22 1 0 0 0 0 22 23 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	302.22
ALogP	-0.0512
MLogP	3.44
XLogP	3.998
HDA	2
HBD	1
Rotatable Bonds	4
TPSA	37.3
RO5 Violation	0