Drug Information| Drug ID:   | NPD5654 |
| Drug Name:   | Chlormadinone Acetate |
| Molecular Formula:   | C23H29ClO4 |
| Canonical SMILES:   | O=C1CC[C@]2(C(=C1)C(=C[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@]2(OC(=O)C)C(=O)C)C)Cl)C |
| Standard InCHI:   | "InChI=1S/C23H29ClO4/c1-13(25)23(28-14(2)26)10-7-18-16-12-20(24)19-11-15(27)5-8-21(19,3)17(16)6-9-22(18,23)4/h11-12,16-18H,5-10H2,1-4H3/t16-,17+,18+,21-,22+,23+/m1/s1" |
| Standard InCHIKey:   | QMBJSIBWORFWQT-DFXBJWIESA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | ChEMBL |
  Structural Similarity Between NPASS Natural Products and NPD5654Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| TTD   | |
| DrugBank   | |
| ChEMBL   | |
| IUPHAR/BPS   | |
| PharmaGKB   | |
| KEGG Drug   | |
| PubChem CID   | 0 |
| ChEBI   | |
| CAS Number   |
| Molecular Weight   | 404.18 |
| ALogP   | 1.4861 |
| MLogP   | 3.44 |
| XLogP   | 3.39 |
| HDA   | 4 |
| HBD   | 0 |
| Rotatable Bonds   | 8 |
| TPSA   | 60.44 |
| RO5 Violation   | 0 |