NPASS drugs

Drug Information

Drug ID:	NPD4623
Drug Name:	Gestodene
Molecular Formula:	C21H26O2
Canonical SMILES:	C#C[C@]1(O)C=C[C@@H]2[C@]1(CC)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12
Standard InCHI:	InChI=1S/C21H26O2/c1-3-20-11-9-17-16-8-6-15(22)13-14(16)5-7-18(17)19(20)10-12-21(20,23)4-2/h2,10,12-13,16-19,23H,3,5-9,11H2,1H3/t16-,17+,18+,19-,20-,21-/m0/s1
Standard InCHIKey:	SIGSPDASOTUPFS-XUDSTZEESA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	DrugBank

Structural Similarity Between NPASS Natural Products and NPD4623

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	115
0.1-0.2	796
0.2-0.3	3056
0.3-0.4	9094
0.4-0.5	8527
0.5-0.6	5355
0.6-0.7	3009
0.7-0.8	885
0.8-0.85	50
0.85-0.9	3
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	0.8765	NPC471409
High Similarity	0.8765	NPC275494
High Similarity	0.8554	NPC476809
Intermediate Similarity	0.8434	NPC170394
Intermediate Similarity	0.8415	NPC266193
Intermediate Similarity	0.8415	NPC257666
Intermediate Similarity	0.8391	NPC194417
Intermediate Similarity	0.8372	NPC476412
Intermediate Similarity	0.8353	NPC193347
Intermediate Similarity	0.8333	NPC475806

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD4623 OpenBabel08211705262D 24 27 0 0 1 0 0 0 0 0999 V2000 1.7309 -0.8814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7228 -1.6221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8426 -0.4859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0003 -0.9719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5279 3.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0546 1.9452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6853 2.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2125 1.4587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5279 0.4864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8414 1.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6852 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8414 0.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2126 3.4046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3705 2.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0546 2.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3705 1.9452 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5279 1.4588 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6853 1.9452 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8426 1.4588 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8426 0.4865 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9227 3.4190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8417 -0.4859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7661 -0.1856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 2 4 3 0 0 0 0 3 20 1 0 0 0 0 5 7 1 0 0 0 0 5 14 1 0 0 0 0 6 8 1 0 0 0 0 6 15 1 0 0 0 0 9 11 1 0 0 0 0 10 12 2 0 0 0 0 10 19 1 0 0 0 0 11 20 1 0 0 0 0 12 21 1 0 0 0 0 13 14 2 0 0 0 0 13 15 1 0 0 0 0 14 16 1 0 0 0 0 15 22 2 0 0 0 0 16 8 1 6 0 0 0 16 17 1 0 0 0 0 17 9 1 1 0 0 0 17 18 1 0 0 0 0 18 7 1 6 0 0 0 18 19 1 0 0 0 0 19 20 1 1 0 0 0 20 21 1 6 0 0 0 21 4 1 6 0 0 0 21 23 1 0 0 0 0 23 24 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank	DB06730
ChEMBL	CHEMBL1213583
IUPHAR/BPS
PharmaGKB	PA165958397
KEGG Drug
PubChem CID
ChEBI	135323
CAS Number	60282-87-3

Drug Properties

Molecular Weight	310.19
ALogP	0.4753
MLogP	3.55
XLogP	3.659
HDA	2
HBD	1
Rotatable Bonds	3
TPSA	37.3
RO5 Violation	0