NPASS drugs

Drug Information

Drug ID:	NPD4138
Drug Name:	Norethindrone
Molecular Formula:	C20H26O2
Canonical SMILES:	C#C[C@]1(O)CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12
Standard InCHI:	"InChI=1S/C20H26O2/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h1,12,15-18,22H,4-11H2,2H3/t15-,16+,17+,18-,19-,20-/m0/s1"
Standard InCHIKey:	VIKNJXKGJWUCNN-XGXHKTLJSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD4138

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	73894
0.1-0.2	127500
0.2-0.3	9959
0.3-0.4	350
0.4-0.5	26
0.5-0.6	8
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.5893	NPC321187
Remote Similarity	0.5893	NPC599870
Remote Similarity	0.5424	NPC150506
Remote Similarity	0.5424	NPC609519
Remote Similarity	0.5345	NPC28159
Remote Similarity	0.5254	NPC144258
Remote Similarity	0.5254	NPC611417
Remote Similarity	0.5167	NPC106675

Drug Structure

NPD4138 OpenBabel08211704332D 23 26 0 0 1 0 0 0 0 0999 V2000 -0.7209 1.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8403 0.5207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0003 0.9695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5224 -3.3953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0422 -1.9389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6818 -2.9103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2022 -1.4539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5215 -0.4845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8389 -1.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6809 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8392 -0.4855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2027 -3.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3627 -2.9098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0425 -2.9093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3624 -1.9394 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5218 -1.4544 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6815 -1.9398 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8409 -1.4548 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8406 -0.4850 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9108 -3.4104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8397 0.4845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7616 0.1846 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 3 0 0 0 0 2 19 1 0 0 0 0 4 6 1 0 0 0 0 4 13 1 0 0 0 0 5 7 1 0 0 0 0 5 14 1 0 0 0 0 8 10 1 0 0 0 0 9 11 1 0 0 0 0 9 18 1 0 0 0 0 10 19 1 0 0 0 0 11 20 1 0 0 0 0 12 13 2 0 0 0 0 12 14 1 0 0 0 0 13 15 1 0 0 0 0 14 21 2 0 0 0 0 15 7 1 1 0 0 0 15 16 1 0 0 0 0 16 8 1 6 0 0 0 16 17 1 0 0 0 0 17 6 1 1 0 0 0 17 18 1 0 0 0 0 18 19 1 6 0 0 0 19 20 1 1 0 0 0 20 3 1 1 0 0 0 20 22 1 0 0 0 0 22 23 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP001212
DrugBank	DB00717
ChEMBL	CHEMBL1162
IUPHAR/BPS	2880
PharmaGKB	PA450651
KEGG Drug	D00182
PubChem CID	6230
ChEBI	7627
CAS Number	68-22-4

Drug Properties

Molecular Weight	298.19
ALogP	0.9504
MLogP	3.44
XLogP	3.244
HDA	2
HBD	1
Rotatable Bonds	2
TPSA	37.3
RO5 Violation	0