Drug Information| Drug ID:   | NPD5693 |
| Drug Name:   | "Nestorone transdermal spray, Acrux" |
| Molecular Formula:   | C23H30O4 |
| Canonical SMILES:   | CC(=O)O[C@]1(C(=O)C)C(=C)C[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12 |
| Standard InCHI:   | "InChI=1S/C23H30O4/c1-13-11-21-20-7-5-16-12-17(26)6-8-18(16)19(20)9-10-22(21,4)23(13,14(2)24)27-15(3)25/h12,18-21H,1,5-11H2,2-4H3/t18-,19+,20+,21-,22-,23-/m0/s1" |
| Standard InCHIKey:   | CKFBRGLGTWAVLG-GOMYTPFNSA-N |
| Max Developmental Stage:   | Phase 4 |
| Max Developmental Stage Source:   | TTD |
  Structural Similarity Between NPASS Natural Products and NPD5693Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
| Molecular Weight   | 370.21 |
| ALogP   | 0.6326 |
| MLogP   | 3.55 |
| XLogP   | 3.109 |
| HDA   | 4 |
| HBD   | 0 |
| Rotatable Bonds   | 6 |
| TPSA   | 60.44 |
| RO5 Violation   | 0 |