NPASS drugs

Drug Information

Drug ID:	NPD5208
Drug Name:	"Progestin (Transdermal Patch, Female Contraception), Watson Pharmaceuticals; Norethindrone Acetate"
Molecular Formula:	C22H28O3
Canonical SMILES:	C#C[C@@]1(CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12)OC(=O)C
Standard InCHI:	"InChI=1S/C22H28O3/c1-4-22(25-14(2)23)12-10-20-19-7-5-15-13-16(24)6-8-17(15)18(19)9-11-21(20,22)3/h1,13,17-20H,5-12H2,2-3H3/t17-,18+,19+,20-,21-,22-/m0/s1"
Standard InCHIKey:	IMONTRJLAWHYGT-ZCPXKWAGSA-N
Max Developmental Stage:	Phase 4
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD5208

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	81657
0.1-0.2	123782
0.2-0.3	6050
0.3-0.4	240
0.4-0.5	8
0.5-0.6	3
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity: Tc>=0.85; Intermediate Similarity: 0.7 <= Tc < 0.85; Remote Similarity: 0.5 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.5484	NPC108896
Remote Similarity	0.5424	NPC321187
Remote Similarity	0.5424	NPC599870

Drug Structure

NPD5208 OpenBabel08211706322D 25 28 0 0 1 0 0 0 0 0999 V2000 -0.7225 1.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4877 0.8349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8422 0.5218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0003 0.9716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5279 -3.4027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0532 -1.9431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6854 -2.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2114 -1.4571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5271 -0.4856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8407 -1.4585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6846 0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8410 -0.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2119 -3.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7655 0.1850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3701 -2.9162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0535 -2.9157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3698 -1.9436 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5273 -1.4575 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6852 -1.9441 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8427 -1.4580 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8424 -0.4860 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.9672 -0.7654 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9238 -3.4178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8416 0.4855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 4 3 0 0 0 0 2 14 1 0 0 0 0 3 21 1 0 0 0 0 5 7 1 0 0 0 0 5 15 1 0 0 0 0 6 8 1 0 0 0 0 6 16 1 0 0 0 0 9 11 1 0 0 0 0 10 12 1 0 0 0 0 10 20 1 0 0 0 0 11 21 1 0 0 0 0 12 22 1 0 0 0 0 13 15 2 0 0 0 0 13 16 1 0 0 0 0 14 23 2 0 0 0 0 14 25 1 0 0 0 0 15 17 1 0 0 0 0 16 24 2 0 0 0 0 17 8 1 1 0 0 0 17 18 1 0 0 0 0 18 9 1 6 0 0 0 18 19 1 0 0 0 0 19 7 1 1 0 0 0 19 20 1 0 0 0 0 20 21 1 6 0 0 0 21 22 1 1 0 0 0 22 4 1 1 0 0 0 22 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB015302
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	0
ChEBI
CAS Number

Drug Properties

Molecular Weight	340.2
ALogP	1.3295
MLogP	3.55
XLogP	3.984
HDA	3
HBD	0
Rotatable Bonds	4
TPSA	43.37
RO5 Violation	0