49 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
8 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC97245
Formula: C26H40O6
Ingredient ID: NPC97245
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC(=O)OCC1CC23CC1CCC3C1(C(CC2)C(CCC1)(COC(=O)C(C)C)C(=O)O)C |
| Standard InCHI | InChI=1S/C26H40O6/c1-16(2)22(28)32-15-26(23(29)30)10-5-9-24(4)20-7-6-18-12-25(20,11-8-21(24)26)13-19(18)14-31-17(3)27/h16,18-21H,5-15H2,1-4H3,(H,29,30) |
| Standard InCHIKey | MBXIJWMIPXCEQF-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5321306 |
| Plant-Ingredient Association Reference |
Database: TCMID [25292] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
  |
Ingredient ID: NPC93241
Formula: C18H12O3
Ingredient ID: NPC93241
| Common Name | Tanshinone I |
| IUPAC Name | 1,6-dimethylnaphtho[1,2-g][1]benzofuran-10,11-dione |
| Canonical SMILES | Cc1coc2c1C(=O)C(=O)c1c2ccc2c1cccc2C |
| Standard InCHI | InChI=1S/C18H12O3/c1-9-4-3-5-12-11(9)6-7-13-15(12)17(20)16(19)14-10(2)8-21-18(13)14/h3-8H,1-2H3 |
| Standard InCHIKey | AIGAZQPHXLWMOJ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 114917 ZINC ID: ZINC000002558154 ChEMBL ID: CHEMBL363535 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC93241] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Stauntonia obovatifoliola | Stauntonia | Lardizabalaceae | |
| Euphorbia sancta | Euphorbia | Euphorbiaceae | |
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Senecio madagascariensis | Senecio | Asteraceae |
|
| Asphodeline tenuior | Asphodeline | Asphodelaceae | |
| Glycyrrhiza triphylla | Glycyrrhiza | Fabaceae | |
| Delphinium cyphoplectrum | Delphinium | Ranunculaceae | |
| Glycine falcata | Glycine | Fabaceae | |
| Iris hoogiana | Iris | Iridaceae | |
| Bothriocline longipes | Bothriocline | Asteraceae |
|
| Aquilaria sinensis | Aquilaria | Thymelaeaceae |
|
| Salvia trijuga | Salvia | Lamiaceae |
|
| Angelica decursiva | Angelica | Apiaceae |
|
| Salvia castanea | Salvia | Lamiaceae |
|
| Prunella vulgaris | Prunella | Lamiaceae |
|
| Salvia yunnanensis | Salvia | Lamiaceae |
|
| Amaranthus hybr | Amaranthus | Amaranthaceae |
|
| Salvia prionitis | Salvia | Lamiaceae |
|
| Combretum indicum | Combretum | Combretaceae |
|
| Notholaena dealbata | Notholaena | Pteridaceae | |
| Picradeniopsis pringlei | Picradeniopsis | Asteraceae | |
| Artemisia siversiana | Artemisia | Asteraceae | |
| Uvaria klaineana | Uvaria | Annonaceae |
|
| Viburnum sieboldi | Viburnum | Adoxaceae |
|
| Amentotaxus yunnanensis | Amentotaxus | Taxaceae |
|
| Vicia sativa | Vicia | Fabaceae |
|
| Salvia przewalskii | Salvia | Lamiaceae |
|
| Salvia digitaloides | Salvia | Lamiaceae |
|
| Euphorbia retusa | Euphorbia | Euphorbiaceae | |
| Camptothecium lutescens | Camptothecium | Brachytheciaceae | |
| Metzgeria pubescens | Metzgeria | Metzgeriaceae | |
| Dioscorea communis | Dioscorea | Dioscoreaceae |
|
| Salvia przewalskll | Salvia | Lamiaceae | |
| Deguelia hatschbachii | Deguelia | Fabaceae | |
| Peucedanum praeruptorum | Peucedanum | Apiaceae |
|
| Salvia miltiorrhiza | Salvia | Lamiaceae |
|
| Agathosma thymifolia | Agathosma | Rutaceae |
Ingredient ID: NPC89693
Formula: C25H30O13
Ingredient ID: NPC89693
| Common Name | n.a. |
| IUPAC Name | [(1aS,1bS,2S,5aR,6S,6aS)-1a-(hydroxymethyl)-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,5a,6,6a-tetrahydro-1bH-oxireno[5,6]cyclopenta[1,3-c]pyran-6-yl] (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@@H]2OC=C[C@@H]3[C@H]2[C@@]2(CO)O[C@H]2[C@H]3OC(=O)/C=C/c2ccc(c(c2)O)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C25H30O13/c1-33-14-4-2-11(8-13(14)28)3-5-16(29)36-21-12-6-7-34-23(17(12)25(10-27)22(21)38-25)37-24-20(32)19(31)18(30)15(9-26)35-24/h2-8,12,15,17-24,26-28,30-32H,9-10H2,1H3/b5-3+/t12-,15-,17-,18-,19+,20-,21+,22+,23+,24+,25-/m1/s1 |
| Standard InCHIKey | LRHHPZILMPIMIY-GGKKSNITSA-N |
| Ingredient External Links |
PubChem CID: 12002015 ZINC ID: ZINC000038139762 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC89693] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC88148
Formula: C41H62O10
Ingredient ID: NPC88148
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC[C@@H]([C@H]1O[C@@]2(C=C[C@@H]1C)O[C@@H]1C/C=C(C)/[C@@H](O[C@H]3C[C@H](OC)[C@H]([C@@H](O3)C)O)[C@@H](C)/C=C/C=C(/[C@]3([C@H](C(=O)O[C@H](C2)C1)C=C(C)[C@H](C3)O)O)C)C |
| Standard InCHI | InChI=1S/C41H62O10/c1-10-23(2)38-26(5)16-17-40(51-38)21-31-19-30(50-40)15-14-25(4)37(49-35-20-34(46-9)36(43)29(8)47-35)24(3)12-11-13-28(7)41(45)22-33(42)27(6)18-32(41)39(44)48-31/h11-14,16-18,23-24,26,29-38,42-43,45H,10,15,19-22H2,1-9H3/b12-11+,25-14+,28-13+/t23-,24-,26-,29-,30+,31-,32-,33-,34-,35-,36-,37-,38+,40+,41+/m0/s1 |
| Standard InCHIKey | FNONCEYEEZGWOE-QCTYMVHNSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD86693] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC86412
Formula: C6H14O6
Ingredient ID: NPC86412
| Common Name | Mannitol |
| IUPAC Name | (2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol |
| Canonical SMILES | OC[C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
| Standard InCHI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5-,6-/m1/s1 |
| Standard InCHIKey | FBPFZTCFMRRESA-KVTDHHQDSA-N |
| Ingredient External Links |
PubChem CID: 6251 ChEMBL ID: CHEMBL689 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC86412] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cistanche deserticola | Cistanche | Orobanchaceae |
|
| Allium tuberosum | Allium | Amaryllidaceae |
|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Centella asiatica | Centella | Apiaceae |
|
| Juncus effusus | Juncus | Juncaceae |
|
| Crataegus pinnatifida | Crataegus | Rosaceae |
|
| Conyza canadensis | Conyza | Asteraceae |
|
| Coreopsis fasciculata | Coreopsis | Asteraceae | |
| Cneorum pulverulentum | Cneorum | Rutaceae |
|
| Carum carvi | Carum | Apiaceae |
 |
| Balanophora harlandii | Balanophora | Balanophoraceae | |
| Changium smyrnioides | Changium | Apiaceae |
|
| Selinum carvifolium | Selinum | Apiaceae | |
| Rhamnus japonica | Rhamnus | Rhamnaceae |
|
| Fraxinus ornus | Fraxinus | Oleaceae |
 |
| Selaginella tamariscina | Selaginella | Selaginellaceae |
|
| Kandelia candel | Kandelia | Rhizophoraceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Angelica decursiva | Angelica | Apiaceae |
|
| Malus pumila | Malus | Rosaceae |
|
| Thuja plicata | Thuja | Cupressaceae |
|
| Trichosanthes kirilowii maxim | Trichosanthes | Cucurbitaceae | |
| Diospyros verrucosa | Diospyros | Ebenaceae |
|
| Polemonium caeruleum | Polemonium | Polemoniaceae |
|
| Ligustrum lucidum | Ligustrum | Oleaceae |
|
| Crepis foetida | Crepis | Asteraceae |
|
| Cirsium japonicum | Cirsium | Asteraceae |
|
| Dorstenia lindeniana | Dorstenia | Moraceae | |
| Dioscoreophyllum cumminsii | Dioscoreophyllum | Menispermaceae |
|
| Athanasia crithmifolia | Athanasia | Asteraceae | |
| Phytolacca acinosa | Phytolacca | Phytolaccaceae |
|
| Garcinia hombroniana | Garcinia | Clusiaceae |
|
| Cardiospermum halicacabum | Cardiospermum | Sapindaceae |
|
| Combretum indicum | Combretum | Combretaceae |
|
| Aglaia elaeagnoidea | Aglaia | Meliaceae |
|
| Punica granatum | Punica | Lythraceae |
|
| Platycodon grandiflorus | Platycodon | Campanulaceae |
|
| Urtica triangularis | Urtica | Urticaceae |
|
| Strychnos ledermannii | Strychnos | Loganiaceae | |
| Pouzolzia occidentalis | Pouzolzia | Urticaceae | |
| Centaurea nigrescens | Centaurea | Asteraceae |
|
| Piper arboreum | Piper | Piperaceae |
|
| Perovskia abrotanoides | Salvia | Lamiaceae |
|
| Parastrephia lepidophylla | Parastrephia | Asteraceae | |
| Photinia serratifolia | Photinia | Rosaceae |
|
| Phlogacanthus thyrsiflorus | Phlogacanthus | Acanthaceae |
|
| Euphorbia segetalis | Euphorbia | Euphorbiaceae | |
| Sidastrum acuminatum | Sidastrum | Malvaceae | |
| Syncolostemon parviflorus | Syncolostemon | Lamiaceae | |
| Aristolochia elegans | Aristolochia | Aristolochiaceae | |
| Penstemon secundiflorus | Penstemon | Plantaginaceae | |
| Cuphea carthagenensis | Cuphea | Lythraceae | |
| Ozoroa insignis | Ozoroa | Anacardiaceae |
|
| Ruta microcarpa | Ruta | Rutaceae |
|
| Crinum defixum | Crinum | Amaryllidaceae |
|
| Orobanche coerulescens | Orobanche | Orobanchaceae |
|
| Polygala glomerata | Polygala | Polygalaceae |
|
| Hedera rhombea | Hedera | Araliaceae |
|
| Hansenia weberbaueriana | Hansenia | Apiaceae | |
| Zanthoxylum monophyllum | Zanthoxylum | Rutaceae | |
| Angylocalyx oligophyllus | Angylocalyx | Fabaceae | |
| Salvia mirzayanii | Salvia | Lamiaceae | |
| Tricalysia okelensis | Tricalysia | Rubiaceae |
|
| Euphorbia biglandulosa | Euphorbia | Euphorbiaceae | |
| Abutilon indicum | Abutilon | Malvaceae |
|
| Taxus cuspidata | Taxus | Taxaceae |
|
| Polyalthia nemoralis | Polyalthia | Annonaceae |
|
| Tetraneuris acaulis | Tetraneuris | Asteraceae | |
| Capsella bursa-pastoris | Capsella | Brassicaceae |
|
| Orobanche pycnostachya | Orobanche | Orobanchaceae | |
| Cardamine pinnata | Cardamine | Brassicaceae | |
| Codonocarpus australis | Codonocarpus | Gyrostemonaceae | |
| Schizonepeta multifida | Schizonepeta | Lamiaceae | |
| Swertia japonica | Swertia | Gentianaceae |
|
| Quercus serrata | Quercus | Fagaceae |
|
| Crateva nurvala | Crateva | Capparaceae |
|
| Tamarix gallica | Tamarix | Tamaricaceae |
|
| Polygala amara | Polygala | Polygalaceae |
|
| Stephania sutchuenensis | Stephania | Menispermaceae | |
| Unonopsis glaucopetala | Unonopsis | Annonaceae | |
| Rubus rosa | Rubus | Rosaceae |
|
| Pleogyne cunninghamii | Pleogyne | Menispermaceae | |
| Pyrola decorata | Pyrola | Ericaceae |
|
| Pleogyne cunninghami | Pleogyne | Menispermaceae | |
| Euonymus nanoides | Euonymus | Celastraceae | |
| Selaginella pulvinata | Selaginella | Selaginellaceae |
|
| Cerbera dilatata | Cerbera | Apocynaceae | |
| Achillea clypeolata | Achillea | Asteraceae | |
| Bridelia ferruginea | Bridelia | Phyllanthaceae |
|
| Berberis julianae | Berberis | Berberidaceae |
|
| Zieria smithii | Zieria | Rutaceae | |
| Bystropogon origanifolius | Bystropogon | Lamiaceae | |
| Astragalus gummifer | Astragalus | Fabaceae |
|
| Coptis teeta | Coptis | Ranunculaceae |
|
| Origanum vulgare | Origanum | Lamiaceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Triglochin maritima | Triglochin | Juncaginaceae |
|
| Lupinus cosentinii | Lupinus | Fabaceae | |
| Rheum maximowiczii | Rheum | Polygonaceae |
|
| Morinda citrifolia | Morinda | Rubiaceae |
|
| Peucedanum praeruptorum | Peucedanum | Apiaceae |
|
| Hypericum perforatum | Hypericum | Hypericaceae |
|
| Prunus armeniaca | Prunus | Rosaceae |
|
| Viburnum davidii | Viburnum | Adoxaceae | |
| Agathosma scaberula | Agathosma | Rutaceae | |
| Typha angustata | Typha | Typhaceae |
|
| Eupatorium fortunei turcz | Eupatorium | Asteraceae | |
| Jacobaea subalpina | Jacobaea | Asteraceae | |
| Phedimus kamtschaticus | Phedimus | Crassulaceae |
|
| Dolichos lablab l | Dolichos | Fabaceae | |
| Cistanche tubulosa | Cistanche | Orobanchaceae |
|
| Brandisia hancei | Brandisia | Orobanchaceae |
|
| Commelina communis | Commelina | Commelinaceae |
|
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
| Vaccaria hispanica | Vaccaria | Caryophyllaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
| Gardenia jasminoides | Gardenia | Rubiaceae |
|
| Cichorium intybus | Cichorium | Asteraceae |
|
Ingredient ID: NPC85505
Formula: C49H74O14
Ingredient ID: NPC85505
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@H](O[C@H]2[C@@H](C)/C=C/C=C/3CO[C@H]4[C@]3(O)[C@@H](C=C([C@H]4OC)C)C(=O)O[C@H]3C[C@@H](C/C=C/2C)O[C@]2(C3)C=C[C@@H]([C@H](O2)[C@H](CC)C)C)O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C |
| Standard InCHI | InChI=1S/C49H74O14/c1-12-26(2)43-29(5)18-19-48(63-43)24-35-21-34(62-48)17-16-28(4)42(60-40-23-38(54-10)45(32(8)58-40)61-39-22-37(53-9)41(50)31(7)57-39)27(3)14-13-15-33-25-56-46-44(55-11)30(6)20-36(47(51)59-35)49(33,46)52/h13-16,18-20,26-27,29,31-32,34-46,50,52H,12,17,21-25H2,1-11H3/b14-13+,28-16+,33-15+/t26-,27-,29-,31-,32-,34+,35-,36-,37-,38-,39-,40-,41-,42-,43+,44+,45-,46+,48+,49+/m0/s1 |
| Standard InCHIKey | AFSHKCWTGFDXJR-SQOHEDJBSA-N |
| Ingredient External Links |
PubChem CID: 9832706 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD207795] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC78994
Formula: C48H72O13
Ingredient ID: NPC78994
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@H](O[C@H]2[C@@H](C)/C=C/C=C(C)/c3cc(O)c(cc3C(=O)O[C@H]3C[C@@H](C/C=C/2C)O[C@]2(C3)C[C@H](O)[C@@H]([C@H](O2)[C@H](CC)C)C)C)O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C |
| Standard InCHI | InChI=1S/C48H72O13/c1-12-25(2)45-30(7)38(50)24-48(61-45)23-34-19-33(60-48)17-16-28(5)44(27(4)15-13-14-26(3)35-20-37(49)29(6)18-36(35)47(52)57-34)58-42-22-40(54-11)46(32(9)56-42)59-41-21-39(53-10)43(51)31(8)55-41/h13-16,18,20,25,27,30-34,38-46,49-51H,12,17,19,21-24H2,1-11H3/b15-13+,26-14+,28-16+/t25-,27-,30-,31-,32-,33+,34-,38-,39-,40-,41-,42-,43-,44-,45+,46-,48-/m0/s1 |
| Standard InCHIKey | ZRYHPEOHTDJRCY-BTKKCQBZSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD127239] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC75724
Formula: C19H20O2
Ingredient ID: NPC75724
| Common Name | Sibiriquinone A |
| IUPAC Name | 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-1,4-dione |
| Canonical SMILES | CC(C1=CC(=O)c2c(C1=O)ccc1c2C=CCC1(C)C)C |
| Standard InCHI | InChI=1S/C19H20O2/c1-11(2)14-10-16(20)17-12-6-5-9-19(3,4)15(12)8-7-13(17)18(14)21/h5-8,10-11H,9H2,1-4H3 |
| Standard InCHIKey | QLYRTJYMSVNUFC-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 10039317 ZINC ID: ZINC000014614473 ChEMBL ID: CHEMBL388964 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC75724] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Salvia miltiorrhiza | Salvia | Lamiaceae |
|
Ingredient ID: NPC74637
Formula: C41H62O11
Ingredient ID: NPC74637
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC[C@@H]([C@H]1O[C@]2(O[C@@H]3C/C=C(C)/[C@@H](O[C@H]4C[C@H](OC)[C@H]([C@@H](O4)C)O)[C@@H](C)/C=C/C=C(/[C@]4([C@H](C(=O)O[C@H](C2)C3)C=C(C)C(=O)C4)O)C)C[C@@H]([C@@H]1C)O)C |
| Standard InCHI | InChI=1S/C41H62O11/c1-10-22(2)38-27(7)33(43)20-40(52-38)19-30-17-29(51-40)15-14-24(4)37(50-35-18-34(47-9)36(44)28(8)48-35)23(3)12-11-13-26(6)41(46)21-32(42)25(5)16-31(41)39(45)49-30/h11-14,16,22-23,27-31,33-38,43-44,46H,10,15,17-21H2,1-9H3/b12-11+,24-14+,26-13+/t22-,23-,27-,28-,29+,30-,31-,33-,34-,35-,36-,37-,38+,40-,41+/m0/s1 |
| Standard InCHIKey | MCZBRPIPDMZWDL-SBOYCXMOSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD143467] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC7283
Formula: C49H74O14
Ingredient ID: NPC7283
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@@H]1C[C@H](O[C@H]2[C@@H](C)/C=C/C=C/3CO[C@H]4[C@@]3(O)[C@@H](C=C([C@@H]4OC)C)C(=O)O[C@H]3C[C@@H](C/C=C/2C)O[C@@]2(C3)C=C[C@@H]([C@H](O2)[C@H](CC)C)C)O[C@@H]([C@H]1O[C@H]1C[C@@H](OC)[C@@H]([C@H](O1)C)O)C |
| Standard InCHI | InChI=1S/C49H74O14/c1-12-26(2)43-29(5)18-19-48(63-43)24-35-21-34(62-48)17-16-28(4)42(60-40-23-38(54-10)45(32(8)58-40)61-39-22-37(53-9)41(50)31(7)57-39)27(3)14-13-15-33-25-56-46-44(55-11)30(6)20-36(47(51)59-35)49(33,46)52/h13-16,18-20,26-27,29,31-32,34-46,50,52H,12,17,21-25H2,1-11H3/b14-13+,28-16+,33-15+/t26-,27-,29-,31+,32+,34+,35-,36-,37+,38+,39-,40-,41+,42-,43+,44-,45+,46+,48-,49-/m0/s1 |
| Standard InCHIKey | AFSHKCWTGFDXJR-NBHOAJIMSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD133226] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC69096
Formula: C48H74O14
Ingredient ID: NPC69096
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@H](O[C@H]2[C@@H](C)/C=C/C=C/3CO[C@H]4[C@]3(O)[C@@H](C=C([C@H]4O)C)C(=O)O[C@H]3C[C@@H](C/C=C/2C)O[C@]2(C3)CC[C@@H]([C@@H](O2)[C@H](CC)C)C)O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C |
| Standard InCHI | InChI=1S/C48H74O14/c1-11-25(2)43-28(5)17-18-47(62-43)23-34-20-33(61-47)16-15-27(4)42(26(3)13-12-14-32-24-55-45-40(49)29(6)19-35(46(51)58-34)48(32,45)52)59-39-22-37(54-10)44(31(8)57-39)60-38-21-36(53-9)41(50)30(7)56-38/h12-15,19,25-26,28,30-31,33-45,49-50,52H,11,16-18,20-24H2,1-10H3/b13-12+,27-15+,32-14+/t25-,26-,28-,30-,31-,33+,34-,35-,36-,37-,38-,39-,40+,41-,42-,43-,44-,45+,47+,48+/m0/s1 |
| Standard InCHIKey | AZSNMRSAGSSBNP-LFOOHIAMSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD71662] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC6048
Formula: C48H72O15
Ingredient ID: NPC6048
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@H](O[C@H]2[C@@H](C)/C=C/C=C/3CO[C@H]4[C@]3(O)[C@@H](C=C(C4=O)C)C(=O)O[C@H]3C[C@@H](C/C=C/2C)O[C@]2(C3)C[C@H](O)[C@@H]([C@H](O2)[C@H](CC)C)C)O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C |
| Standard InCHI | InChI=1S/C48H72O15/c1-11-24(2)43-28(6)35(49)22-47(63-43)21-33-18-32(62-47)16-15-26(4)42(25(3)13-12-14-31-23-56-45-40(50)27(5)17-34(46(52)59-33)48(31,45)53)60-39-20-37(55-10)44(30(8)58-39)61-38-19-36(54-9)41(51)29(7)57-38/h12-15,17,24-25,28-30,32-39,41-45,49,51,53H,11,16,18-23H2,1-10H3/b13-12+,26-15+,31-14+/t24-,25-,28-,29-,30-,32+,33-,34-,35-,36-,37-,38-,39-,41-,42-,43+,44-,45+,47-,48+/m0/s1 |
| Standard InCHIKey | KTEKSHMTSRFZPC-ZZZOEGKHSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD29894] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC59930
Formula: C48H72O14
Ingredient ID: NPC59930
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@@H](O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C)O[C@H]1[C@@H](C)/C=C/C=C/2CO[C@H]3[C@]2(O)[C@@H](C=C([C@H]3OC)C)C(=O)O[C@H]2C[C@@H](C/C=C/1C)O[C@]1(C2)C=C[C@@H]([C@@H](O1)C(C)C)C |
| Standard InCHI | InChI=1S/C48H72O14/c1-25(2)41-28(5)17-18-47(62-41)23-34-20-33(61-47)16-15-27(4)42(59-39-22-37(53-10)44(31(8)57-39)60-38-21-36(52-9)40(49)30(7)56-38)26(3)13-12-14-32-24-55-45-43(54-11)29(6)19-35(46(50)58-34)48(32,45)51/h12-15,17-19,25-26,28,30-31,33-45,49,51H,16,20-24H2,1-11H3/b13-12+,27-15+,32-14+/t26-,28-,30-,31-,33+,34-,35-,36-,37-,38-,39-,40-,41-,42-,43+,44-,45+,47+,48+/m0/s1 |
| Standard InCHIKey | MNRHCELBXZARFX-QYXPVUGDSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD67538] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC59272
Formula: C49H76O15
Ingredient ID: NPC59272
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@@H]1C[C@H](O[C@H]2[C@@H](C)/C=C/C=C/3CO[C@@H]4[C@@]3(O)[C@@H](C=C([C@@H]4OC)C)C(=O)O[C@@H]3C[C@H](C/C=C/2C)O[C@@]2(C3)C[C@H](O)[C@@H]([C@@H](O2)[C@H](CC)C)C)O[C@@H]([C@@H]1O[C@@H]1C[C@H](OC)[C@H]([C@H](O1)C)O)C |
| Standard InCHI | InChI=1S/C49H76O15/c1-12-25(2)43-29(6)36(50)23-48(64-43)22-34-19-33(63-48)17-16-27(4)42(61-40-21-38(55-10)45(31(8)59-40)62-39-20-37(54-9)41(51)30(7)58-39)26(3)14-13-15-32-24-57-46-44(56-11)28(5)18-35(47(52)60-34)49(32,46)53/h13-16,18,25-26,29-31,33-46,50-51,53H,12,17,19-24H2,1-11H3/b14-13+,27-16+,32-15+/t25-,26-,29-,30+,31+,33-,34+,35-,36-,37-,38+,39+,40-,41-,42-,43-,44-,45-,46-,48+,49-/m0/s1 |
| Standard InCHIKey | JVGWUGTWQIAGHJ-YMXFOPIBSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD54565] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC53028
Formula: C7H14O7
Ingredient ID: NPC53028
| Common Name | n.a. |
| IUPAC Name | (3S,4R,5R,6R)-1,3,4,5,6,7-hexahydroxyheptan-2-one |
| Canonical SMILES | OC[C@H]([C@H]([C@H]([C@@H](C(=O)CO)O)O)O)O |
| Standard InCHI | InChI=1S/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3,5-10,12-14H,1-2H2/t3-,5-,6-,7-/m1/s1 |
| Standard InCHIKey | HSNZZMHEPUFJNZ-SHUUEZRQSA-N |
| Ingredient External Links |
PubChem CID: 5459879 |
| Plant-Ingredient Association Reference |
Database: TCMID [13498] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Chrozophora prostrata | Chrozophora | Euphorbiaceae |
|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Phedimus aizoon | Phedimus | Crassulaceae | |
| Fraxinus ornus | Fraxinus | Oleaceae |
|
| Neopicrorhiza scrophulariiflora | Neopicrorhiza | Plantaginaceae | |
| Medicago sativa | Medicago | Fabaceae |
|
| Ligustrum lucidum | Ligustrum | Oleaceae |
|
| Punica granatum | Punica | Lythraceae |
|
| Aloe microstigma | Aloe | Asphodelaceae | |
| Eriobotrya japonica | Eriobotrya | Rosaceae |
|
| Capsella bursa-pastoris | Capsella | Brassicaceae |
|
| Tamarix gallica | Tamarix | Tamaricaceae |
|
| Typha angustata | Typha | Typhaceae |
|
| Cocos nucifera | Cocos | Arecaceae |
|
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
| Papaver somniferum | Papaver | Papaveraceae |
|
Ingredient ID: NPC4558
Formula: C35H52O7
Ingredient ID: NPC4558
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC[C@@H]([C@H]1O[C@]2(C=C[C@@H]1C)C[C@@H]1C[C@H](O2)C/C=C(C)/[C@@H](O)[C@@H](C)/C=C/C=C(/[C@]2([C@H](C(=O)O1)C=C(C)[C@H](C2)OC)O)C)C |
| Standard InCHI | InChI=1S/C35H52O7/c1-9-21(2)32-24(5)15-16-34(42-32)19-28-18-27(41-34)14-13-23(4)31(36)22(3)11-10-12-26(7)35(38)20-30(39-8)25(6)17-29(35)33(37)40-28/h10-13,15-17,21-22,24,27-32,36,38H,9,14,18-20H2,1-8H3/b11-10+,23-13+,26-12+/t21-,22-,24-,27+,28-,29-,30-,31-,32+,34+,35+/m0/s1 |
| Standard InCHIKey | FESJRKLWENAEBD-IYUMCDNJSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD97215] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC42648
Formula: C35H48O7
Ingredient ID: NPC42648
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C[C@H]1[C@@H](O)C[C@@]2(O[C@@H]1C1CCCCC1)C[C@@H]1C[C@H](O2)C/C=C(C)/[C@@H](O)[C@@H](C)/C=C/C=C/c2c(C(=O)O1)cc(C)c(c2)O |
| Standard InCHI | InChI=1S/C35H48O7/c1-21-10-8-9-13-26-17-30(36)23(3)16-29(26)34(39)40-28-18-27(15-14-22(2)32(21)38)41-35(19-28)20-31(37)24(4)33(42-35)25-11-6-5-7-12-25/h8-10,13-14,16-17,21,24-25,27-28,31-33,36-38H,5-7,11-12,15,18-20H2,1-4H3/b10-8+,13-9+,22-14+/t21-,24-,27+,28-,31-,32-,33-,35-/m0/s1 |
| Standard InCHIKey | LMCIBZKHUIIKIJ-AMJYOPDRSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD201658] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC31870
Formula: C44H68O11
Ingredient ID: NPC31870
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@H](O[C@@H]2C(=CC[C@@H]3C[C@H](OC(=O)[C@@H]4[C@@](C(=CC=C[C@@H]2C)C)(O)C[C@H](OC)C(=C4)C)C[C@@]2(O3)C[C@H](O)[C@@H]([C@H](O2)C2CCCCC2)C)C)O[C@H]([C@@H]1O)C |
| Standard InCHI | InChI=1S/C44H68O11/c1-25-13-12-14-28(4)44(48)24-37(50-8)27(3)19-34(44)42(47)52-33-20-32(18-17-26(2)40(25)53-38-21-36(49-7)39(46)30(6)51-38)54-43(22-33)23-35(45)29(5)41(55-43)31-15-10-9-11-16-31/h12-14,17,19,25,29-41,45-46,48H,9-11,15-16,18,20-24H2,1-8H3/t25-,29-,30-,32+,33-,34+,35-,36-,37-,38-,39-,40-,41-,43-,44+/m0/s1 |
| Standard InCHIKey | CUJFGSBWDMADEI-SNCDAFNHSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD212265] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC310582
Formula: C49H74O14
Ingredient ID: NPC310582
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@H](O[C@H]2[C@@H](C)/C=C/C=C/3CO[C@H]4[C@]3(O)[C@@H](C=C([C@H]4OC)C)C(=O)O[C@H]3C[C@@H](C/C=C/2C)O[C@]2(C3)C=C[C@@H]([C@@H](O2)[C@H](CC)C)C)O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C |
| Standard InCHI | InChI=1S/C49H74O14/c1-12-26(2)43-29(5)18-19-48(63-43)24-35-21-34(62-48)17-16-28(4)42(60-40-23-38(54-10)45(32(8)58-40)61-39-22-37(53-9)41(50)31(7)57-39)27(3)14-13-15-33-25-56-46-44(55-11)30(6)20-36(47(51)59-35)49(33,46)52/h13-16,18-20,26-27,29,31-32,34-46,50,52H,12,17,21-25H2,1-11H3/b14-13+,28-16+,33-15+/t26-,27-,29-,31-,32-,34+,35-,36-,37-,38-,39-,40-,41-,42-,43-,44+,45-,46+,48+,49+/m0/s1 |
| Standard InCHIKey | AFSHKCWTGFDXJR-FSGZSHNRSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD9958] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC308250
Formula: C48H70O14
Ingredient ID: NPC308250
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@H](O[C@H]2[C@@H](C)/C=C/C=C/3CO[C@H]4[C@]3(O)[C@@H](C=C(C4=O)C)C(=O)O[C@H]3C[C@@H](C/C=C/2C)O[C@]2(C3)C=C[C@@H]([C@H](O2)[C@H](CC)C)C)O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C |
| Standard InCHI | InChI=1S/C48H70O14/c1-11-25(2)43-28(5)17-18-47(62-43)23-34-20-33(61-47)16-15-27(4)42(26(3)13-12-14-32-24-55-45-40(49)29(6)19-35(46(51)58-34)48(32,45)52)59-39-22-37(54-10)44(31(8)57-39)60-38-21-36(53-9)41(50)30(7)56-38/h12-15,17-19,25-26,28,30-31,33-39,41-45,50,52H,11,16,20-24H2,1-10H3/b13-12+,27-15+,32-14+/t25-,26-,28-,30-,31-,33+,34-,35-,36-,37-,38-,39-,41-,42-,43+,44-,45+,47+,48+/m0/s1 |
| Standard InCHIKey | OREMDKVSTHGUST-WNNKMZGNSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD57829] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC300314
Formula: C22H30O13
Ingredient ID: NPC300314
| Common Name | n.a. |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
| Canonical SMILES | OC[C@H]1O[C@@]([C@H]([C@@H]1O)O)(CO)O[C@H]1O[C@H](COC(=O)/C=C/c2ccc(cc2)OC)[C@H]([C@@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C22H30O13/c1-31-12-5-2-11(3-6-12)4-7-15(25)32-9-14-16(26)18(28)19(29)21(33-14)35-22(10-24)20(30)17(27)13(8-23)34-22/h2-7,13-14,16-21,23-24,26-30H,8-10H2,1H3/b7-4+/t13-,14-,16-,17-,18+,19-,20+,21-,22+/m1/s1 |
| Standard InCHIKey | OXZQUECTKHRQJG-GMXQQWTBSA-N |
| Ingredient External Links |
PubChem CID: 6326023 ZINC ID: ZINC000070457442 |
| Plant-Ingredient Association Reference |
Database: TCMID [19853] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
Ingredient ID: NPC292838
Formula: C48H74O14
Ingredient ID: NPC292838
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@@H](O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C)O[C@H]1[C@@H](C)/C=C/C=C/2CO[C@H]3[C@]2(O)[C@@H](C=C([C@H]3OC)C)C(=O)O[C@H]2C[C@@H](C/C=C/1C)O[C@]1(C2)CC[C@@H]([C@@H](O1)C(C)C)C |
| Standard InCHI | InChI=1S/C48H74O14/c1-25(2)41-28(5)17-18-47(62-41)23-34-20-33(61-47)16-15-27(4)42(59-39-22-37(53-10)44(31(8)57-39)60-38-21-36(52-9)40(49)30(7)56-38)26(3)13-12-14-32-24-55-45-43(54-11)29(6)19-35(46(50)58-34)48(32,45)51/h12-15,19,25-26,28,30-31,33-45,49,51H,16-18,20-24H2,1-11H3/b13-12+,27-15+,32-14+/t26-,28-,30-,31-,33+,34-,35-,36-,37-,38-,39-,40-,41-,42-,43+,44-,45+,47+,48+/m0/s1 |
| Standard InCHIKey | HVTWWKHJKYTJON-QYXPVUGDSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD196442] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC289588
Formula: C47H70O14
Ingredient ID: NPC289588
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@@H](O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C)O[C@H]1[C@@H](C)/C=C/C=C/2CO[C@H]3[C@]2(O)[C@@H](C=C([C@H]3O)C)C(=O)O[C@H]2C[C@@H](C/C=C/1C)O[C@]1(C2)C=C[C@@H]([C@H](O1)C(C)C)C |
| Standard InCHI | InChI=1S/C47H70O14/c1-24(2)41-27(5)16-17-46(61-41)22-33-19-32(60-46)15-14-26(4)42(25(3)12-11-13-31-23-54-44-39(48)28(6)18-34(45(50)57-33)47(31,44)51)58-38-21-36(53-10)43(30(8)56-38)59-37-20-35(52-9)40(49)29(7)55-37/h11-14,16-18,24-25,27,29-30,32-44,48-49,51H,15,19-23H2,1-10H3/b12-11+,26-14+,31-13+/t25-,27-,29-,30-,32+,33-,34-,35-,36-,37-,38-,39+,40-,41+,42-,43-,44+,46+,47+/m0/s1 |
| Standard InCHIKey | ZFUKERYTFURFGA-PVVXTEPVSA-N |
| Ingredient External Links |
PubChem CID: 6858005 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD22283] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC253133
Formula: C21H18O13
Ingredient ID: NPC253133
| Common Name | n.a. |
| IUPAC Name | (2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-[3,5,8-trihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid |
| Canonical SMILES | OC(=O)[C@H]1O[C@@H](Oc2cc(O)c3c(c2O)oc(c(c3=O)O)c2ccc(cc2)O)[C@@H]([C@@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C21H18O13/c22-7-3-1-6(2-4-7)17-14(27)12(25)10-8(23)5-9(11(24)18(10)33-17)32-21-16(29)13(26)15(28)19(34-21)20(30)31/h1-5,13,15-16,19,21-24,26-29H,(H,30,31)/t13-,15+,16-,19+,21-/m1/s1 |
| Standard InCHIKey | UTWXOPWIRPTNAK-DUXBYYHXSA-N |
| Ingredient External Links |
PubChem CID: 5319842 |
| Plant-Ingredient Association Reference |
Database: TCMID [14864] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
Ingredient ID: NPC247219
Formula: C35H46O6
Ingredient ID: NPC247219
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C[C@H]1C=C[C@@]2(O[C@@H]1C1CCCCC1)C[C@@H]1C[C@H](O2)C/C=C(C)/[C@@H](O)[C@@H](C)/C=C/C=C/c2c(C(=O)O1)cc(C)c(c2)O |
| Standard InCHI | InChI=1S/C35H46O6/c1-22-10-8-9-13-27-19-31(36)25(4)18-30(27)34(38)39-29-20-28(15-14-23(2)32(22)37)40-35(21-29)17-16-24(3)33(41-35)26-11-6-5-7-12-26/h8-10,13-14,16-19,22,24,26,28-29,32-33,36-37H,5-7,11-12,15,20-21H2,1-4H3/b10-8+,13-9+,23-14+/t22-,24-,28+,29-,32-,33-,35+/m0/s1 |
| Standard InCHIKey | GRVQPMQMSRMJNS-KGHUUUROSA-N |
| Ingredient External Links |
PubChem CID: 45276503 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD201657] Database: NPASS [NPC247219] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC238861
Formula: C19H20O3
Ingredient ID: NPC238861
| Common Name | 1,6,6-Trimethyl-2,7,8,9-Tetrahydro-1H-Naphtho[1,2-G][1]Benzofuran-10,11-Dione |
| IUPAC Name | 1,6,6-trimethyl-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione |
| Canonical SMILES | CC1COC2=C1C(=O)C(=O)c1c2ccc2c1CCCC2(C)C |
| Standard InCHI | InChI=1S/C19H20O3/c1-10-9-22-18-12-6-7-13-11(5-4-8-19(13,2)3)15(12)17(21)16(20)14(10)18/h6-7,10H,4-5,8-9H2,1-3H3 |
| Standard InCHIKey | GVKKJJOMQCNPGB-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 496348 ChEMBL ID: CHEMBL1518673 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC238861] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Salvia trijuga | Salvia | Lamiaceae |
|
| Salvia castanea | Salvia | Lamiaceae |
|
| Salvia yunnanensis | Salvia | Lamiaceae |
|
| Salvia prionitis | Salvia | Lamiaceae |
|
| Salvia przewalskii | Salvia | Lamiaceae |
|
| Salvia digitaloides | Salvia | Lamiaceae |
|
| Salvia przewalskll | Salvia | Lamiaceae | |
| Salvia miltiorrhiza | Salvia | Lamiaceae |
|
Ingredient ID: NPC219372
Formula: C33H44O7
Ingredient ID: NPC219372
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC[C@@H]([C@H]1O[C@@]2(C[C@@H]3C[C@H](O2)C/C=C(C)/[C@@H](O)[C@@H](C)/C=C/C=C/c2c(C(=O)O3)cc(C)c(c2)O)CC(=O)[C@@H]1C)C |
| Standard InCHI | InChI=1S/C33H44O7/c1-7-19(2)31-23(6)29(35)18-33(40-31)17-26-16-25(39-33)13-12-21(4)30(36)20(3)10-8-9-11-24-15-28(34)22(5)14-27(24)32(37)38-26/h8-12,14-15,19-20,23,25-26,30-31,34,36H,7,13,16-18H2,1-6H3/b10-8+,11-9+,21-12+/t19-,20-,23-,25+,26-,30-,31+,33-/m0/s1 |
| Standard InCHIKey | SHOVZLDBGGWSPT-QSMJSWNASA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD201655] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC216341
Formula: C27H30O14
Ingredient ID: NPC216341
| Common Name | n.a. |
| IUPAC Name | 7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)chromen-4-one |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2ccc3c(c2)oc(cc3=O)c2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C27H30O14/c1-10-20(32)22(34)24(36)26(37-10)41-25-23(35)21(33)19(9-28)40-27(25)38-12-3-4-13-15(30)8-17(39-18(13)7-12)11-2-5-14(29)16(31)6-11/h2-8,10,19-29,31-36H,9H2,1H3/t10-,19+,20-,21+,22+,23-,24+,25+,26-,27+/m0/s1 |
| Standard InCHIKey | YYKZZPUWJLNPMU-POFBTZLFSA-N |
| Ingredient External Links |
PubChem CID: 16724248 |
| Plant-Ingredient Association Reference |
Database: TCMID [13142] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Lonicera japonica | Lonicera | Caprifoliaceae |
|
| Chrysanthemum x morifolium | Chrysanthemum | Asteraceae |
|
| Capsella bursa-pastoris | Capsella | Brassicaceae |
|
| Pteris multifida | Pteris | Pteridaceae |
|
| Citrus aurantium | Citrus | Rutaceae |
|
Ingredient ID: NPC198091
Formula: C43H62O10
Ingredient ID: NPC198091
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@@H](O[C@H]([C@@H]1O)C)O[C@H]1[C@@H](C)C=CC=C(C)c2cc(O)c(cc2C(=O)O[C@H]2C[C@@H](CC=C1C)O[C@]1(C2)C[C@H](O)[C@@H]([C@H](O1)C1CCCCC1)C)C |
| Standard InCHI | InChI=1S/C43H62O10/c1-24-12-11-13-25(2)40(51-38-21-37(48-7)39(46)29(6)49-38)26(3)16-17-31-19-32(50-42(47)34-18-27(4)35(44)20-33(24)34)22-43(52-31)23-36(45)28(5)41(53-43)30-14-9-8-10-15-30/h11-13,16,18,20,25,28-32,36-41,44-46H,8-10,14-15,17,19,21-23H2,1-7H3/t25-,28-,29-,31+,32-,36-,37-,38-,39-,40-,41-,43-/m0/s1 |
| Standard InCHIKey | FKSXGBQOMKYWGH-RNMRQEHISA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD210084] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC197966
Formula: C48H74O15
Ingredient ID: NPC197966
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@H](O[C@H]2[C@@H](C)/C=C/C=C/3CO[C@H]4[C@]3(O)[C@@H](C=C([C@H]4O)C)C(=O)O[C@H]3C[C@@H](C/C=C/2C)O[C@]2(C3)C[C@H](O)[C@@H]([C@H](O2)[C@H](CC)C)C)O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C |
| Standard InCHI | InChI=1S/C48H74O15/c1-11-24(2)43-28(6)35(49)22-47(63-43)21-33-18-32(62-47)16-15-26(4)42(25(3)13-12-14-31-23-56-45-40(50)27(5)17-34(46(52)59-33)48(31,45)53)60-39-20-37(55-10)44(30(8)58-39)61-38-19-36(54-9)41(51)29(7)57-38/h12-15,17,24-25,28-30,32-45,49-51,53H,11,16,18-23H2,1-10H3/b13-12+,26-15+,31-14+/t24-,25-,28-,29-,30-,32+,33-,34-,35-,36-,37-,38-,39-,40+,41-,42-,43+,44-,45+,47-,48+/m0/s1 |
| Standard InCHIKey | CWGATOJEFAKFBK-PDVFGPFMSA-N |
| Ingredient External Links |
PubChem CID: 6441103 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD9511] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC196368
Formula: C49H76O14
Ingredient ID: NPC196368
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@H](O[C@H]2[C@@H](C)/C=C/C=C/3CO[C@H]4[C@]3(O)[C@@H](C=C([C@H]4OC)C)C(=O)O[C@H]3C[C@@H](C/C=C/2C)O[C@]2(C3)CC[C@@H]([C@@H](O2)[C@H](CC)C)C)O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C |
| Standard InCHI | InChI=1S/C49H76O14/c1-12-26(2)43-29(5)18-19-48(63-43)24-35-21-34(62-48)17-16-28(4)42(60-40-23-38(54-10)45(32(8)58-40)61-39-22-37(53-9)41(50)31(7)57-39)27(3)14-13-15-33-25-56-46-44(55-11)30(6)20-36(47(51)59-35)49(33,46)52/h13-16,20,26-27,29,31-32,34-46,50,52H,12,17-19,21-25H2,1-11H3/b14-13+,28-16+,33-15+/t26-,27-,29-,31-,32-,34+,35-,36-,37-,38-,39-,40-,41-,42-,43-,44+,45-,46+,48+,49+/m0/s1 |
| Standard InCHIKey | IFVXVTAOFPRCBD-FSGZSHNRSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD166960] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC195400
Formula: C47H72O15
Ingredient ID: NPC195400
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@H](O[C@H]2[C@@H](C)/C=C/C=C/3CO[C@H]4[C@]3(O)[C@@H](C=C([C@H]4O)C)C(=O)O[C@H]3C[C@@H](C/C=C/2C)O[C@]2(C3)C[C@H](O)[C@@H]([C@H](O2)C(C)C)C)O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C |
| Standard InCHI | InChI=1S/C47H72O15/c1-23(2)41-27(6)34(48)21-46(62-41)20-32-17-31(61-46)15-14-25(4)42(24(3)12-11-13-30-22-55-44-39(49)26(5)16-33(45(51)58-32)47(30,44)52)59-38-19-36(54-10)43(29(8)57-38)60-37-18-35(53-9)40(50)28(7)56-37/h11-14,16,23-24,27-29,31-44,48-50,52H,15,17-22H2,1-10H3/b12-11+,25-14+,30-13+/t24-,27-,28-,29-,31+,32-,33-,34-,35-,36-,37-,38-,39+,40-,41+,42-,43-,44+,46-,47+/m0/s1 |
| Standard InCHIKey | ZPAKHHSWIYDSBJ-YAGODIQJSA-N |
| Ingredient External Links |
PubChem CID: 11953974 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD35530] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC192065
Formula: C6H14O6
Ingredient ID: NPC192065
| Common Name | Alexitol Sodium |
| IUPAC Name | hexane-1,2,3,4,5,6-hexol |
| Canonical SMILES | OCC(C(C(C(CO)O)O)O)O |
| Standard InCHI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2 |
| Standard InCHIKey | FBPFZTCFMRRESA-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 453 ChEMBL ID: CHEMBL16105 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC192065] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Fraxinus ornus | Fraxinus | Oleaceae |
|
| Selaginella tamariscina | Selaginella | Selaginellaceae |
|
| Eucommia ulmoides | Eucommia | Eucommiaceae |
|
| Ligustrum lucidum | Ligustrum | Oleaceae |
|
| Punica granatum | Punica | Lythraceae |
|
| Orobanche coerulescens | Orobanche | Orobanchaceae |
|
| Eriobotrya japonica | Eriobotrya | Rosaceae |
|
| Orobanche pycnostachya | Orobanche | Orobanchaceae | |
| Selaginella pulvinata | Selaginella | Selaginellaceae |
|
| Euonymus alatus | Euonymus | Celastraceae |
|
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Hypericum perforatum | Hypericum | Hypericaceae |
|
| Cocos nucifera | Cocos | Arecaceae |
|
| Rehmannia glutinosa | Rehmannia | Orobanchaceae |
|
Ingredient ID: NPC189142
Formula: C21H20O11
Ingredient ID: NPC189142
| Common Name | Galuteolin |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2cc(O)c3c(c2)oc(cc3=O)c2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C21H20O11/c22-7-16-18(27)19(28)20(29)21(32-16)30-9-4-12(25)17-13(26)6-14(31-15(17)5-9)8-1-2-10(23)11(24)3-8/h1-6,16,18-25,27-29H,7H2/t16-,18-,19+,20-,21-/m1/s1 |
| Standard InCHIKey | PEFNSGRTCBGNAN-QNDFHXLGSA-N |
| Ingredient External Links |
PubChem CID: 5280637 ZINC ID: ZINC000004096258 ChEMBL ID: CHEMBL233929 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC189142] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Myrsine capitellata | Myrsine | Primulaceae |
|
| Othonna sedifolia | Othonna | Asteraceae | |
| Ipomoea muricata | Ipomoea | Convolvulaceae |
|
| Glechoma longituba | Glechoma | Lamiaceae |
|
| Fragaria x ananassa | Fragaria | Rosaceae |
|
| Aristolochia maxima | Aristolochia | Aristolochiaceae |
|
| Chrysanthemum sinense | Chrysanthemum | Asteraceae | |
| Ixeris chinensis | Ixeris | Asteraceae |
|
| Artemisia hanseniana | Artemisia | Asteraceae | |
| Flacourtia jangomas | Flacourtia | Salicaceae |
|
| Carpobrotus edulis | Carpobrotus | Aizoaceae |
|
| Adenia volkensii | Adenia | Passifloraceae |
|
| Asplenium normale | Asplenium | Aspleniaceae | |
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Sideritis trojana | Sideritis | Lamiaceae | |
| Polygonum cuspidatum | Polygonum | Polygonaceae |
|
| Centrolobium tomentosum | Centrolobium | Fabaceae | |
| Pterocarpus officinalis | Pterocarpus | Fabaceae |
|
| Kopsia grandifolia | Kopsia | Apocynaceae | |
| Vernonia lanuginosa | Vernonia | Asteraceae | |
| Betula mandshurica | Betula | Betulaceae |
|
| Onobrychis arenaria | Onobrychis | Fabaceae | |
| Calycanthus floridus | Calycanthus | Calycanthaceae |
|
| Markhamia stipulata | Markhamia | Bignoniaceae |
|
| Psilostrophe cooperi | Psilostrophe | Asteraceae | |
| Eria mollis | Eria | Orchidaceae | |
| Agrimonia eupatoria | Agrimonia | Rosaceae |
|
| Achillea collina | Achillea | Asteraceae | |
| Ledebouria socialis | Ledebouria | Hyacinthaceae | |
| Dysoxylum cumingianum | Dysoxylum | Meliaceae | |
| Trifolium alexandrinum | Trifolium | Fabaceae |
 |
| Adenia globosa | Adenia | Passifloraceae | |
| Baccharis angustifolia | Baccharis | Asteraceae | |
| Trachelospermum jasminoides | Trachelospermum | Apocynaceae |
|
| Hypericum reflexum | Hypericum | Hypericaceae | |
| Psychotria stachyoides | Psychotria | Rubiaceae | |
| Lycopus europaeus | Lycopus | Lamiaceae |
|
| Vinca minor | Vinca | Apocynaceae |
|
| Dodonaea viscosa | Dodonaea | Sapindaceae |
|
| Dipterocarpus dyeri | Dipterocarpus | Dipterocarpaceae | |
| Aglaia grandis | Aglaia | Meliaceae |
|
| Mikania obtusata | Mikania | Asteraceae | |
| Osteospermum fruticosum | Osteospermum | Asteraceae | |
| Catunaregam tomentosa | Catunaregam | Rubiaceae |
|
| Liriodendron tulipifera | Liriodendron | Magnoliaceae |
|
| Artemisia rupestris | Artemisia | Asteraceae |
|
| Fritillaria cirrhosa | Fritillaria | Liliaceae |
|
| Biebersteinia orphanidis | Biebersteinia | Biebersteiniaceae | |
| Sideritis tragoriganum | Sideritis | Lamiaceae | |
| Ipomoea cairica | Ipomoea | Convolvulaceae |
|
| Jasminum officinale | Jasminum | Oleaceae |
|
| Teucrium yemense | Teucrium | Lamiaceae | |
| Neobalanocarpus heimii | Neobalanocarpus | Dipterocarpaceae | |
| Iris pallasii | Iris | Iridaceae | |
| Taraxacum platycarpum | Taraxacum | Asteraceae |
|
| Aconitum tasiromontanum | Aconitum | Ranunculaceae | |
| Ceanothus velutinus | Ceanothus | Rhamnaceae |
|
| Bergenia purpurascens | Bergenia | Saxifragaceae |
|
| Mentha canadensis | Mentha | Lamiaceae |
|
| Garcinia scortechinii | Garcinia | Clusiaceae | |
| Apollonias barbujana | Apollonias | Lauraceae | |
| Dendriopoterium menendezii | Dendriopoterium | Rosaceae | |
| Solanum jamaicense | Solanum | Solanaceae | |
| Chlorophytum borivilianum | Chlorophytum | Asparagaceae |
|
| Adansonia grandidieri | Adansonia | Malvaceae |
|
| Physalis alkekengi | Physalis | Solanaceae |
|
| Aphyllocladus denticulatus | Aphyllocladus | Asteraceae | |
| Cedronella canariensis | Cedronella | Lamiaceae |
|
| Bassia muricata | Bassia | Chenopodiaceae |
|
| Vitex negundo | Vitex | Lamiaceae |
|
| Lippia carviodora | Lippia | Verbenaceae |
|
| Trachelospermum asiaticum | Trachelospermum | Apocynaceae |
|
| Ceratophyllum submersum | Ceratophyllum | Ceratophyllaceae | |
| Senecio nemorensis | Senecio | Asteraceae |
|
| Brucea javanica | Brucea | Simaroubaceae |
|
| Senecio subdentatus | Senecio | Asteraceae | |
| Polygala myrtifolia | Polygala | Polygalaceae | |
| Myrica nana | Myrica | Myricaceae | |
| Lonicera japonica | Lonicera | Caprifoliaceae |
|
| Aconitum seravschanicum | Aconitum | Ranunculaceae | |
| Boswellia carterii | Boswellia | Burseraceae |
|
| Sideritis soluta | Sideritis | Lamiaceae | |
| Habropetalum dawei | Habropetalum | Dioncophyllaceae | |
| Dracocephalum kotschyi | Dracocephalum | Lamiaceae |
|
| Ligularia platyglossa | Ligularia | Asteraceae |
|
| Humata pectinata | Humata | Davalliaceae | |
| Rhodiola krylovii | Rhodiola | Crassulaceae | |
| Taraxacum borealisinense | Taraxacum | Asteraceae | |
| Scutellaria barbata | Scutellaria | Lamiaceae |
|
| Rapanea myricoides | Rapanea | Primulaceae | |
| Crataegus sinaica | Crataegus | Rosaceae |
|
| Capsicum annuum | Capsicum | Solanaceae |
|
| Malus asiatica | Malus | Rosaceae |
|
| Isodon lophanthoides | Isodon | Lamiaceae |
|
| Lonicera macranthoides | Lonicera | Caprifoliaceae |
|
| Artemisia vachanica | Artemisia | Asteraceae | |
| Lasiocephalus ovatus | Lasiocephalus | Asteraceae | |
| Montrouziera sphaeroidea | Montrouziera | Clusiaceae | |
| Cotoneaster orbicularis | Cotoneaster | Rosaceae | |
| Bischofia trifoliata | Bischofia | Phyllanthaceae | |
| Prunella vulgaris | Prunella | Lamiaceae |
|
| Pimpinella saxifraga | Pimpinella | Apiaceae |
|
| Caragana tibetica | Caragana | Fabaceae |
|
| Macrotyloma axillare | Macrotyloma | Fabaceae | |
| Inula britannica | Inula | Asteraceae |
|
| Trigonostemon reidioides | Trigonostemon | Euphorbiaceae |
|
| Euphorbia ferganensis | Euphorbia | Euphorbiaceae | |
| Arachniodes dimorphophylla | Arachniodes | Dryopteridaceae | |
| Fragaria vesca | Fragaria | Rosaceae |
|
| Agrimonia pilosa | Agrimonia | Rosaceae |
|
| Oreosolen wattii | Oreosolen | Scrophulariaceae | |
| Mosla chinensis | Mosla | Lamiaceae |
|
| Physalis edulis | Physalis | Solanaceae | |
| Merendera sobolifera | Merendera | Colchicaceae | |
| Ligustrum lucidum | Ligustrum | Oleaceae |
|
| Saussurea involucrata | Saussurea | Asteraceae |
|
| Discaria crenata | Discaria | Rhamnaceae | |
| Pinus mugo | Pinus | Pinaceae |
|
| Catananche caerulea | Catananche | Asteraceae | |
| Gleditsia caspica | Gleditsia | Fabaceae |
|
| Cirsium japonicum | Cirsium | Asteraceae |
|
| Dracocephalum tanguticum | Dracocephalum | Lamiaceae | |
| Eclipta prostrata | Eclipta | Asteraceae |
|
| Chrysanthemum x morifolium | Chrysanthemum | Asteraceae |
|
| Cephalaria ambrosioides | Cephalaria | Caprifoliaceae | |
| Lasianthus fordii | Lasianthus | Rubiaceae | |
| Hydrocotyle ranunculoides | Hydrocotyle | Araliaceae |
|
| Angelica keiskei | Angelica | Apiaceae |
|
| Plantago major | Plantago | Plantaginaceae |
|
| Lonicera hypoglauca | Lonicera | Caprifoliaceae |
|
| Boronia ternata | Boronia | Rutaceae | |
| Elsholtzia ciliata | Elsholtzia | Lamiaceae |
|
| Buxus hyrcana | Buxus | Buxaceae |
|
| Lycopus lucidus | Lycopus | Lamiaceae |
|
| Chrysanthemum indicum | Chrysanthemum | Asteraceae |
|
| Morinda morindoides | Morinda | Rubiaceae |
|
| Tropaeolum speciosum | Tropaeolum | Tropaeolaceae | |
| Justicia secunda | Justicia | Acanthaceae | |
| Lens culinaris | Lens | Fabaceae |
|
| Populus ussuriensis | Populus | Salicaceae |
|
| Calicotome villosa | Calicotome | Fabaceae |
|
| Mentha arvensis | Mentha | Lamiaceae |
|
| Marrubium vulgare | Marrubium | Lamiaceae |
|
| Strychnos camptoneura | Strychnos | Loganiaceae | |
| Taraxacum coreanum | Taraxacum | Asteraceae | |
| Cinnamomum kotoense | Cinnamomum | Lauraceae | |
| Abies veitchii | Abies | Pinaceae | |
| Zanthoxylum ailanthoides | Zanthoxylum | Rutaceae |
|
| Epidendrum rigidum | Epidendrum | Orchidaceae | |
| Ainsliaea macrocephala | Ainsliaea | Asteraceae | |
| Dicoma anomala | Dicoma | Asteraceae |
|
| Cytisus ratisbonensis | Cytisus | Fabaceae | |
| Luculia pinceana | Luculia | Rubiaceae | |
| Marrubium cylleneum | Marrubium | Lamiaceae | |
| Vellozia nivea | Vellozia | Velloziaceae | |
| Buxus microphylla | Buxus | Buxaceae |
|
| Pityrogramma ebenea | Pityrogramma | Pteridaceae | |
| Casearia membranacea | Casearia | Salicaceae |
|
| Lonicera fulvotomentosa | Lonicera | Caprifoliaceae |
|
| Galeopsis tetrahit | Galeopsis | Lamiaceae |
|
| Conospermum teretifolium | Conospermum | Proteaceae | |
| Nepeta cataria | Nepeta | Lamiaceae |
|
| Bistorta vivipara | Bistorta | Polygonaceae |
|
| Spirodela polyrhiza | Spirodela | Araceae | |
| Cirsium wallichii | Cirsium | Asteraceae |
|
| Persicaria orientalis | Persicaria | Polygonaceae |
|
| Solanum bahamense | Solanum | Solanaceae | |
| Glechoma grandis | Glechoma | Lamiaceae |
|
| Aster sedifolius | Aster | Asteraceae | |
| Sigesbeckia pubescens | Sigesbeckia | Asteraceae | |
| Tinospora smilacina | Tinospora | Menispermaceae |
|
| Artemisia annua | Artemisia | Asteraceae |
|
| Taraxacum officinale | Taraxacum | Asteraceae |
|
| Tinospora crispa | Tinospora | Menispermaceae |
|
| Tetrapanax papyrifer | Tetrapanax | Araliaceae |
|
| Pteris multifida | Pteris | Pteridaceae |
|
| Taraxacum mongolicum | Taraxacum | Asteraceae |
|
| Swertia swertopsis | Swertia | Gentianaceae | |
| Premna tomentosa | Premna | Lamiaceae |
|
| Sagittaria sagittifolia | Sagittaria | Alismataceae |
|
| Cunonia macrophylla | Cunonia | Cunoniaceae |
|
| Tsuga chinensis | Tsuga | Pinaceae |
|
| Taxus brevifolia | Taxus | Taxaceae |
|
| Virgilia divaricata | Virgilia | Fabaceae | |
| Entada rheedei | Entada | Fabaceae |
|
| Humulus japonicus | Humulus | Cannabaceae |
|
| Aucuba chinensis | Aucuba | Garryaceae | |
| Utricularia australis | Utricularia | Lentibulariaceae | |
| Amsinckia tessellata | Amsinckia | Boraginaceae | |
| Carica dodecaphylla | Carica | Caricaceae | |
| Citrus tangerina | Citrus | Rutaceae |
|
| Sarcomelicope argyrophylla | Sarcomelicope | Rutaceae | |
| Crocus minimus | Crocus | Iridaceae |
|
| Curculigo pilosa | Curculigo | Hypoxidaceae |
|
| Sideritis euboea | Sideritis | Lamiaceae | |
| Osteospermum muricatum | Osteospermum | Asteraceae | |
| Centaurea huber-morathii | Centaurea | Asteraceae | |
| Sisyrinchium californicum | Sisyrinchium | Iridaceae | |
| Saussurea amara | Saussurea | Asteraceae | |
| Lysiana subfalcata | Lysiana | Loranthaceae |
|
| Haplophyllum ramosissimum | Haplophyllum | Rutaceae | |
| Peperomia vulcanica | Peperomia | Piperaceae |
|
| Sorbus tianschanica | Sorbus | Rosaceae |
|
| Platycarya strobilacea | Platycarya | Juglandaceae |
|
| Helichrysum mixtum | Helichrysum | Asteraceae | |
| Cynometra lujae | Cynometra | Fabaceae | |
| Aspalathus linearis | Aspalathus | Fabaceae |
|
| Eupatorium areolare | Eupatorium | Asteraceae | |
| Stephania elegans | Stephania | Menispermaceae |
|
| Pygeum topengii | Pygeum | Rosaceae | |
| Olea europaea | Olea | Oleaceae |
|
| Isodon rubescens | Isodon | Lamiaceae | |
| Prunus mume | Prunus | Rosaceae |
|
| Sigesbeckia glabrescens | Sigesbeckia | Asteraceae |
|
| Leptactina senegambica | Leptactina | Rubiaceae | |
| Aglaia elliptica | Aglaia | Meliaceae |
|
| Brickellia vernicosa | Brickellia | Asteraceae | |
| Macaranga peltata | Macaranga | Euphorbiaceae |
|
| Samadera indica | Samadera | Simaroubaceae |
|
| Echinopsis radix | Echinopsis | Cactaceae | |
| Chrysanthemum morifolium | Chrysanthemum | Asteraceae |
|
| Lavandula vera | Lavandula | Lamiaceae |
|
| Helichrysum nitens | Helichrysum | Asteraceae | |
| Aconitum leucostomum | Aconitum | Ranunculaceae |
|
| Nelumbo nucifera | Nelumbo | Nelumbonaceae |
|
| Rheedia acuminata | Rheedia | Clusiaceae |
|
| Acacia aulacocarpa | Acacia | Fabaceae | |
| Bunias orientalis | Bunias | Brassicaceae |
|
| Aspidosperma subincanum | Aspidosperma | Apocynaceae |
|
| Aquilegia ecalcarata | Aquilegia | Ranunculaceae |
|
| Phlomoides rotata | Phlomoides | Lamiaceae | |
| Lippia sidoides | Lippia | Verbenaceae | |
| Lonicera confusa | Lonicera | Caprifoliaceae |
|
| Alangium ridleyi | Alangium | Cornaceae |
|
| Portulaca oleracea | Portulaca | Portulacaceae |
|
| Hedysarum denticulatum | Hedysarum | Fabaceae | |
| Persea mexicana | Persea | Lauraceae | |
| Trichosanthes rosthornii | Trichosanthes | Cucurbitaceae |
|
| Ardisia neriifolia | Ardisia | Primulaceae | |
| Psiadia dentata | Psiadia | Asteraceae | |
| Codonopsis radix | Codonopsis | Campanulaceae | |
| Veratrum grandiflorum | Veratrum | Melanthiaceae |
|
| Centaurea hermannii | Centaurea | Asteraceae | |
| Zanthoxylum myriacanthum | Zanthoxylum | Rutaceae |
|
| Peritassa compta | Peritassa | Celastraceae | |
| Eupatorium argentinum | Eupatorium | Asteraceae | |
| Lawsonia inermis | Lawsonia | Lythraceae |
|
| Strychnos ligustrina | Strychnos | Loganiaceae |
|
| Castanea crenata | Castanea | Fagaceae |
|
| Anaphalis araneosa | Anaphalis | Asteraceae | |
| Phebalium whitei | Phebalium | Rutaceae | |
| Bhesa nitidissima | Bhesa | Centroplacaceae | |
| Globularia davisiana | Globularia | Plantaginaceae | |
| Psorothamnus spinosus | Psorothamnus | Fabaceae | |
| Euphorbia humifusa | Euphorbia | Euphorbiaceae |
|
| Rumex nepalensis | Rumex | Polygonaceae |
|
| Ligularia songarica | Ligularia | Asteraceae | |
| Rosa agrestis | Rosa | Rosaceae | |
| Vitis betulifolia | Vitis | Vitaceae |
|
| Cryptocarya aschersoniana | Cryptocarya | Lauraceae | |
| Viguiera stenoloba | Viguiera | Asteraceae | |
| Humulus scandens | Humulus | Cannabaceae |
|
| Dolichos lablab l | Dolichos | Fabaceae | |
| Juniperus brevifolia | Juniperus | Cupressaceae | |
| Rothmannia wittii | Rothmannia | Rubiaceae |
|
| Kali turgidum | Kali | Chenopodiaceae |
|
| Vatica diospyroides | Vatica | Dipterocarpaceae | |
| Gardenia tubifera | Gardenia | Rubiaceae |
|
| Mollugo spergula | Mollugo | Molluginaceae |
|
| Corydalis calliantha | Corydalis | Papaveraceae | |
| Colchicum robustum | Colchicum | Colchicaceae | |
| Crataegus monogyna | Crataegus | Rosaceae |
|
| Panax innovans | Panax | Araliaceae | |
| Ranzania japonica | Ranzania | Berberidaceae | |
| Veronica kellereri | Veronica | Plantaginaceae | |
| Guatteria boliviana | Guatteria | Annonaceae | |
| Brandisia hancei | Brandisia | Orobanchaceae |
|
| Impatiens edgeworthii | Impatiens | Balsaminaceae | |
| Salvia urolepis | Salvia | Lamiaceae | |
| Artemisia kurramensis | Artemisia | Asteraceae | |
| Buphthalmum salicifolium | Buphthalmum | Asteraceae | |
| Blumea mollis | Blumea | Asteraceae |
|
| Episcia cupreata | Episcia | Gesneriaceae | |
| Enceliopsis argophylla | Enceliopsis | Asteraceae | |
| Anemone flaccida | Anemone | Ranunculaceae |
|
| Pithecellobium clypearia | Pithecellobium | Fabaceae |
|
| Perilla frutescens | Perilla | Lamiaceae |
|
| Schizonepeta tenuifolia | Schizonepeta | Lamiaceae |
|
| Euphorbia clarkeana | Euphorbia | Euphorbiaceae | |
| Inula japonica | Inula | Asteraceae |
|
| Nicotiana affinis | Nicotiana | Solanaceae | |
| Jasonia candicans | Jasonia | Asteraceae | |
| Annona rensoniana | Annona | Annonaceae | |
| Senecio sandersonii | Senecio | Asteraceae | |
| Gardenia jasminoides | Gardenia | Rubiaceae |
|
| Parablechnum minus | Parablechnum | Blechnaceae | |
| Miliusa velutina | Miliusa | Annonaceae |
|
| Garcinia quaesita | Garcinia | Clusiaceae |
|
Ingredient ID: NPC184610
Formula: C33H46O7
Ingredient ID: NPC184610
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC[C@@H]([C@H]1O[C@@]2(C[C@@H]3C[C@H](O2)C/C=C(C)/[C@@H](O)[C@@H](C)/C=C/C=C/c2c(C(=O)O3)cc(C)c(c2)O)C[C@@H]([C@@H]1C)O)C |
| Standard InCHI | InChI=1S/C33H46O7/c1-7-19(2)31-23(6)29(35)18-33(40-31)17-26-16-25(39-33)13-12-21(4)30(36)20(3)10-8-9-11-24-15-28(34)22(5)14-27(24)32(37)38-26/h8-12,14-15,19-20,23,25-26,29-31,34-36H,7,13,16-18H2,1-6H3/b10-8+,11-9+,21-12+/t19-,20-,23-,25+,26-,29-,30-,31+,33-/m0/s1 |
| Standard InCHIKey | JFIXFPOXRZPCCA-CFQHKURLSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD201656] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC183353
Formula: C48H74O14
Ingredient ID: NPC183353
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@H](O[C@H]2[C@@H](C)/C=C/C=C/3CO[C@H]4[C@]3(O)[C@@H](C=C([C@H]4O)C)C(=O)O[C@H]3C[C@@H](C/C=C/2C)O[C@]2(C3)CC[C@@H]([C@H](O2)[C@H](CC)C)C)O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C |
| Standard InCHI | InChI=1S/C48H74O14/c1-11-25(2)43-28(5)17-18-47(62-43)23-34-20-33(61-47)16-15-27(4)42(26(3)13-12-14-32-24-55-45-40(49)29(6)19-35(46(51)58-34)48(32,45)52)59-39-22-37(54-10)44(31(8)57-39)60-38-21-36(53-9)41(50)30(7)56-38/h12-15,19,25-26,28,30-31,33-45,49-50,52H,11,16-18,20-24H2,1-10H3/b13-12+,27-15+,32-14+/t25-,26-,28-,30-,31-,33+,34-,35-,36-,37-,38-,39-,40+,41-,42-,43+,44-,45+,47+,48+/m0/s1 |
| Standard InCHIKey | AZSNMRSAGSSBNP-XPNPUAGNSA-N |
| Ingredient External Links |
PubChem CID: 6321424 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD106285] Database: NPASS [NPC183353] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC170880
Formula: C48H72O14
Ingredient ID: NPC170880
| Common Name | Abamectin Component B1A |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@H](O[C@H]2[C@@H](C)/C=C/C=C/3CO[C@H]4[C@]3(O)[C@@H](C=C([C@H]4O)C)C(=O)O[C@H]3C[C@@H](C/C=C/2C)O[C@]2(C3)C=C[C@@H]([C@H](O2)[C@H](CC)C)C)O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C |
| Standard InCHI | InChI=1S/C48H72O14/c1-11-25(2)43-28(5)17-18-47(62-43)23-34-20-33(61-47)16-15-27(4)42(26(3)13-12-14-32-24-55-45-40(49)29(6)19-35(46(51)58-34)48(32,45)52)59-39-22-37(54-10)44(31(8)57-39)60-38-21-36(53-9)41(50)30(7)56-38/h12-15,17-19,25-26,28,30-31,33-45,49-50,52H,11,16,20-24H2,1-10H3/b13-12+,27-15+,32-14+/t25-,26-,28-,30-,31-,33+,34-,35-,36-,37-,38-,39-,40+,41-,42-,43+,44-,45+,47+,48+/m0/s1 |
| Standard InCHIKey | RRZXIRBKKLTSOM-XPNPUAGNSA-N |
| Ingredient External Links |
PubChem CID: 6434889 ChEMBL ID: CHEMBL1630577 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD61235] Database: NPASS [NPC170880] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC163649
Formula: C19H22O3
Ingredient ID: NPC163649
| Common Name | n.a. |
| IUPAC Name | (1R)-1,6,6-trimethyl-2,3a,7,8,9,11a-hexahydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione |
| Canonical SMILES | C[C@H]1COC2C1C(=O)C(=O)c1c2ccc2c1CCCC2(C)C |
| Standard InCHI | InChI=1S/C19H22O3/c1-10-9-22-18-12-6-7-13-11(5-4-8-19(13,2)3)15(12)17(21)16(20)14(10)18/h6-7,10,14,18H,4-5,8-9H2,1-3H3/t10-,14?,18?/m0/s1 |
| Standard InCHIKey | IJSBKZLSTIFYIE-FPKDZHNTSA-N |
| Ingredient External Links |
PubChem CID: 25181389 |
| Plant-Ingredient Association Reference |
Database: TCMID [4291] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Aquilaria sinensis | Aquilaria | Thymelaeaceae |
|
| Salvia trijuga | Salvia | Lamiaceae |
|
| Salvia castanea | Salvia | Lamiaceae |
|
| Salvia yunnanensis | Salvia | Lamiaceae |
|
| Salvia prionitis | Salvia | Lamiaceae |
|
| Salvia przewalskii | Salvia | Lamiaceae |
|
| Salvia digitaloides | Salvia | Lamiaceae |
|
| Sagittaria sagittifolia | Sagittaria | Alismataceae |
|
| Salvia miltiorrhiza | Salvia | Lamiaceae |
|
| Dacrycarpus imbricatus | Dacrycarpus | Podocarpaceae |
Ingredient ID: NPC15528
Formula: C42H64O10
Ingredient ID: NPC15528
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC[C@@H]([C@H]1O[C@@]2(C=C[C@@H]1C)O[C@@H]1C/C=C(C)/[C@@H](O[C@H]3C[C@H](OC)[C@H]([C@@H](O3)C)O)[C@@H](C)/C=C/C=C(/[C@]3([C@H](C(=O)O[C@H](C2)C1)C=C(C)[C@H](C3)OC)O)C)C |
| Standard InCHI | InChI=1S/C42H64O10/c1-11-24(2)39-27(5)17-18-41(52-39)22-32-20-31(51-41)16-15-26(4)38(50-36-21-34(46-9)37(43)30(8)48-36)25(3)13-12-14-29(7)42(45)23-35(47-10)28(6)19-33(42)40(44)49-32/h12-15,17-19,24-25,27,30-39,43,45H,11,16,20-23H2,1-10H3/b13-12+,26-15+,29-14+/t24-,25-,27-,30-,31+,32-,33-,34-,35-,36-,37-,38-,39+,41+,42+/m0/s1 |
| Standard InCHIKey | CAJDUHQNQRQATN-MAMUBCSZSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD102433] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC153216
Formula: C21H28O12
Ingredient ID: NPC153216
| Common Name | n.a. |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-phenylprop-2-enoate |
| Canonical SMILES | OC[C@H]1O[C@@]([C@H]([C@@H]1O)O)(CO)O[C@H]1O[C@H](COC(=O)/C=C/c2ccccc2)[C@H]([C@@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C21H28O12/c22-8-12-16(26)19(29)21(10-23,32-12)33-20-18(28)17(27)15(25)13(31-20)9-30-14(24)7-6-11-4-2-1-3-5-11/h1-7,12-13,15-20,22-23,25-29H,8-10H2/b7-6+/t12-,13-,15-,16-,17+,18-,19+,20-,21+/m1/s1 |
| Standard InCHIKey | ASHAUBLELZYXKD-ZJKHXSAOSA-N |
| Ingredient External Links |
PubChem CID: 6326022 ZINC ID: ZINC000070457445 |
| Plant-Ingredient Association Reference |
Database: TCMID [19852] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Polygala sibirica | Polygala | Polygalaceae |
|
Ingredient ID: NPC149686
Formula: C49H76O15
Ingredient ID: NPC149686
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@H](O[C@H]2[C@@H](C)/C=C/C=C/3CO[C@H]4[C@]3(O)[C@@H](C=C([C@H]4OC)C)C(=O)O[C@H]3C[C@@H](C/C=C/2C)O[C@]2(C3)C[C@@H](O)[C@@H]([C@@H](O2)[C@H](CC)C)C)O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C |
| Standard InCHI | InChI=1S/C49H76O15/c1-12-25(2)43-29(6)36(50)23-48(64-43)22-34-19-33(63-48)17-16-27(4)42(61-40-21-38(55-10)45(31(8)59-40)62-39-20-37(54-9)41(51)30(7)58-39)26(3)14-13-15-32-24-57-46-44(56-11)28(5)18-35(47(52)60-34)49(32,46)53/h13-16,18,25-26,29-31,33-46,50-51,53H,12,17,19-24H2,1-11H3/b14-13+,27-16+,32-15+/t25-,26-,29-,30-,31-,33+,34-,35-,36+,37-,38-,39-,40-,41-,42-,43-,44+,45-,46+,48-,49+/m0/s1 |
| Standard InCHIKey | JVGWUGTWQIAGHJ-OICWQPLASA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD130654] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC147479
Formula: C48H72O14
Ingredient ID: NPC147479
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@H](O[C@H]2[C@@H](C)/C=C/C=C/3CO[C@H]4[C@]3(O)[C@@H](C=C([C@H]4O)C)C(=O)O[C@H]3C[C@@H](C/C=C/2C)O[C@]2(C3)C=C[C@@H]([C@@H](O2)[C@H](CC)C)C)O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C |
| Standard InCHI | InChI=1S/C48H72O14/c1-11-25(2)43-28(5)17-18-47(62-43)23-34-20-33(61-47)16-15-27(4)42(26(3)13-12-14-32-24-55-45-40(49)29(6)19-35(46(51)58-34)48(32,45)52)59-39-22-37(54-10)44(31(8)57-39)60-38-21-36(53-9)41(50)30(7)56-38/h12-15,17-19,25-26,28,30-31,33-45,49-50,52H,11,16,20-24H2,1-10H3/b13-12+,27-15+,32-14+/t25-,26-,28-,30-,31-,33+,34-,35-,36-,37-,38-,39-,40+,41-,42-,43-,44-,45+,47+,48+/m0/s1 |
| Standard InCHIKey | RRZXIRBKKLTSOM-LFOOHIAMSA-N |
| Ingredient External Links |
PubChem CID: 59310708 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD20666] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC138631
Formula: C41H60O10
Ingredient ID: NPC138631
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC[C@@H]([C@H]1O[C@@]2(C=C[C@@H]1C)O[C@@H]1C/C=C(C)/[C@@H](O[C@H]3C[C@H](OC)[C@H]([C@@H](O3)C)O)[C@@H](C)/C=C/C=C(/[C@]3([C@H](C(=O)O[C@H](C2)C1)C=C(C)C(=O)C3)O)C)C |
| Standard InCHI | InChI=1S/C41H60O10/c1-10-23(2)38-26(5)16-17-40(51-38)21-31-19-30(50-40)15-14-25(4)37(49-35-20-34(46-9)36(43)29(8)47-35)24(3)12-11-13-28(7)41(45)22-33(42)27(6)18-32(41)39(44)48-31/h11-14,16-18,23-24,26,29-32,34-38,43,45H,10,15,19-22H2,1-9H3/b12-11+,25-14+,28-13+/t23-,24-,26-,29-,30+,31-,32-,34-,35-,36-,37-,38+,40+,41+/m0/s1 |
| Standard InCHIKey | IYBATDVJOWONSJ-YNBDWAATSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD122516] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC134882
Formula: C19H22O2
Ingredient ID: NPC134882
| Common Name | Sibiriquinone B |
| IUPAC Name | 8,8-dimethyl-2-propan-2-yl-6,7-dihydro-5H-phenanthrene-1,4-dione |
| Canonical SMILES | CC(C1=CC(=O)c2c(C1=O)ccc1c2CCCC1(C)C)C |
| Standard InCHI | InChI=1S/C19H22O2/c1-11(2)14-10-16(20)17-12-6-5-9-19(3,4)15(12)8-7-13(17)18(14)21/h7-8,10-11H,5-6,9H2,1-4H3 |
| Standard InCHIKey | MRPWFJPXXDIFAE-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 9971020 ZINC ID: ZINC000014614474 ChEMBL ID: CHEMBL227074 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC134882] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Salvia miltiorrhiza | Salvia | Lamiaceae |
|
Ingredient ID: NPC131302
Formula: C47H68O14
Ingredient ID: NPC131302
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1C[C@H](O[C@H]2[C@@H](C)/C=C/C=C/3CO[C@H]4[C@]3(O)[C@@H](C=C(C4=O)C)C(=O)O[C@H]3C[C@@H](C/C=C/2C)O[C@]2(C3)C=C[C@@H]([C@H](O2)C(C)C)C)O[C@H]([C@@H]1O[C@H]1C[C@H](OC)[C@H]([C@@H](O1)C)O)C |
| Standard InCHI | InChI=1S/C47H68O14/c1-24(2)41-27(5)16-17-46(61-41)22-33-19-32(60-46)15-14-26(4)42(25(3)12-11-13-31-23-54-44-39(48)28(6)18-34(45(50)57-33)47(31,44)51)58-38-21-36(53-10)43(30(8)56-38)59-37-20-35(52-9)40(49)29(7)55-37/h11-14,16-18,24-25,27,29-30,32-38,40-44,49,51H,15,19-23H2,1-10H3/b12-11+,26-14+,31-13+/t25-,27-,29-,30-,32+,33-,34-,35-,36-,37-,38-,40-,41+,42-,43-,44+,46+,47+/m0/s1 |
| Standard InCHIKey | WCXULYIAZPKYRQ-FOHZVXMDSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD107991] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC122814
Formula: C50H74O14
Ingredient ID: NPC122814
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@@H]1C[C@@H](O[C@@H]([C@H]1O[C@H]1C[C@@H](OC)[C@@H]([C@H](O1)C)O)C)O[C@H]1[C@@H](C)/C=C/C=C/2CO[C@H]3[C@@]2(O)[C@@H](C=C([C@@H]3O)C)C(=O)O[C@H]2C[C@@H](C/C=C/1C)O[C@@]1(C2)C=C[C@@H]([C@H](O1)C1CCCCC1)C |
| Standard InCHI | InChI=1S/C50H74O14/c1-27-13-12-16-34-26-57-47-42(51)30(4)21-37(50(34,47)54)48(53)60-36-22-35(63-49(25-36)20-19-29(3)45(64-49)33-14-10-9-11-15-33)18-17-28(2)44(27)61-41-24-39(56-8)46(32(6)59-41)62-40-23-38(55-7)43(52)31(5)58-40/h12-13,16-17,19-21,27,29,31-33,35-47,51-52,54H,9-11,14-15,18,22-26H2,1-8H3/b13-12+,28-17+,34-16+/t27-,29-,31+,32+,35+,36-,37-,38+,39+,40-,41-,42-,43+,44-,45-,46+,47+,49-,50-/m0/s1 |
| Standard InCHIKey | QLFZZSKTJWDQOS-MRRBQMOBSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD78160] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
Ingredient ID: NPC110560
Formula: C33H44O6
Ingredient ID: NPC110560
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC[C@@H]([C@H]1O[C@]2(C=C[C@@H]1C)C[C@@H]1C[C@H](O2)C/C=C(C)/[C@@H](O)[C@@H](C)/C=C/C=C/c2c(C(=O)O1)cc(C)c(c2)O)C |
| Standard InCHI | InChI=1S/C33H44O6/c1-7-20(2)31-23(5)14-15-33(39-31)19-27-18-26(38-33)13-12-22(4)30(35)21(3)10-8-9-11-25-17-29(34)24(6)16-28(25)32(36)37-27/h8-12,14-17,20-21,23,26-27,30-31,34-35H,7,13,18-19H2,1-6H3/b10-8+,11-9+,22-12+/t20-,21-,23-,26+,27-,30-,31+,33+/m0/s1 |
| Standard InCHIKey | SDBGKPBIPDFPFL-IQZMWPTLSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD201654] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Veronicastrum sibiricum | Veronicastrum | Plantaginaceae |
|
| Veratrum nigrum | Veratrum | Melanthiaceae |
|
