NPASS Compound

Natural Product: NPC195560

Natural Product ID	NPC195560
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Namonin D
IUPAC Name	n.a.
Synonyms	Namonin D
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL504150
PubChem CID	11147371
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 135143 0 0 0 0 0 0 0 0999 V2000 -8.0942 -2.5840 1.9175 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3551 -2.6492 0.8327 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6543 -3.8872 0.4082 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3191 -3.6129 0.2855 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9800 -2.4306 -0.3141 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2410 -1.5845 0.6678 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5918 -2.0714 2.0840 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8095 -1.9373 0.4330 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8424 -3.0193 -0.6250 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6613 -2.7678 -1.5419 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8705 -1.7679 -0.8165 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0130 -0.8383 -1.6017 C 0 0 2 0 0 0 0 0 0 0 0 0 0.7384 -1.5945 -2.6616 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6358 -0.5972 -3.3411 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1327 0.4292 -2.6836 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0130 1.3691 -3.4279 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3485 1.3501 -2.7254 C 0 0 2 0 0 0 0 0 0 0 0 0 4.3735 0.3740 -1.5900 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2490 0.5577 -0.5825 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9055 0.7429 -1.2525 C 0 0 1 0 0 0 0 0 0 0 0 0 1.5088 2.1946 -1.0884 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8698 -0.1249 -0.6100 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0303 0.6677 0.3255 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1550 -0.1152 0.8885 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9507 -0.8903 -0.1612 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5886 0.0010 -1.1624 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6070 1.5657 0.2768 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8757 1.1169 1.5650 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2872 1.3550 1.9589 C 0 0 1 0 0 0 0 0 0 0 0 0 5.3674 2.4673 2.9863 C 0 0 2 0 0 0 0 0 0 0 0 0 4.3028 3.5174 2.8258 C 0 0 2 0 0 0 0 0 0 0 0 0 2.9249 2.9196 2.6934 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9630 1.5464 2.5117 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5843 4.4168 1.7810 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5896 3.1223 2.7810 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8860 0.2090 2.4734 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0091 -0.1646 1.7301 C 0 0 1 0 0 0 0 0 0 0 0 0 8.1941 -0.2901 2.6640 C 0 0 1 0 0 0 0 0 0 0 0 0 9.3107 -1.0374 1.9811 C 0 0 1 0 0 0 0 0 0 0 0 0 9.0765 -0.9127 0.4741 C 0 0 2 0 0 0 0 0 0 0 0 0 7.8070 -1.7048 0.2076 C 0 0 2 0 0 0 0 0 0 0 0 0 7.3924 -1.4394 -1.2234 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8138 -1.3959 1.1139 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1690 -1.4332 -0.2450 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8510 -0.6183 -1.1366 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4734 0.5782 -1.2828 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0100 -1.0753 -1.9369 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5336 -0.5146 2.3457 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7098 0.9242 3.0756 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8047 2.6188 -2.3665 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0070 -2.7555 -1.2917 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1154 -1.7264 -1.0239 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.1994 -1.4468 -0.0200 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.3645 -0.9661 -0.5621 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7446 0.2828 -0.2124 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.0232 1.1866 -1.4234 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.1587 2.5676 -0.8767 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.2560 2.6066 0.1343 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.3281 1.4169 1.0303 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.7730 1.2905 1.4915 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9803 0.2207 0.4348 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.4528 2.8368 -0.5560 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4891 3.4677 -1.9113 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0516 1.0482 -2.3959 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5183 -2.5973 -2.0450 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5797 -1.6576 2.1756 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2141 -3.4402 2.5388 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1125 -4.2711 -0.5442 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7575 -4.6751 1.1905 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4959 -0.5296 0.6621 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3546 -1.4316 2.5414 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8013 -3.1436 2.1058 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6575 -1.9170 2.7012 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3096 -2.2961 1.3634 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7936 -4.0253 -0.1638 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9450 -2.5510 -2.5677 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0649 -3.7268 -1.5888 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3257 -2.2311 0.0259 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5828 -0.0479 -2.1295 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0073 -1.9841 -3.3732 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3720 -2.4015 -2.2445 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8780 -0.7262 -4.3873 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1722 1.0522 -4.4779 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5834 2.3889 -3.4849 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1394 0.9762 -3.4499 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4330 -0.6815 -1.9354 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3087 0.5630 -1.0206 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2442 -0.4202 -0.0086 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4054 2.4182 -0.0040 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2647 2.9057 -1.4587 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5814 2.4345 -1.6522 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3557 -0.9042 0.0122 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4385 1.5832 -0.1195 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5756 1.0147 1.2159 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8452 0.5457 1.4090 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7704 -0.8929 1.6043 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6392 0.2787 -0.9708 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5797 -0.3847 -2.2047 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0513 0.9957 -1.2094 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7334 -0.0059 1.5281 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8736 1.6430 1.0394 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2780 2.0193 3.9894 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3129 4.1255 3.7536 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4189 3.4739 1.8798 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3384 3.1083 3.6129 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1600 3.9695 1.1287 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1103 3.1860 3.6207 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1326 0.5708 0.9403 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8328 -0.8929 3.5408 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2561 -2.1435 2.1987 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9408 0.1452 0.1748 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0721 -2.7891 0.2484 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4587 -0.3757 -1.4665 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1648 -1.9481 -1.8596 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4243 -1.9074 -1.4701 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0229 -0.4964 -2.9042 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9605 -2.1662 -2.1383 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9371 -0.7844 -1.4063 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9494 -1.1136 3.0445 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0965 1.3724 2.2762 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2538 2.6159 -1.4869 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7223 -0.7867 -1.4448 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7934 -0.6446 0.6439 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0661 0.8081 0.5034 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9931 0.8994 -1.8919 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1798 2.9050 -0.4786 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1016 3.5068 0.7707 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7179 1.5370 1.9626 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2912 2.2655 1.5220 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2986 0.7113 0.6767 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8807 0.7025 2.4097 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5745 3.8315 -0.6841 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3774 3.3162 -2.2798 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2447 0.2082 -2.8835 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1873 -2.1018 -2.5797 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 2 3 1 0 3 4 1 0 5 4 1 1 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 19 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 31 34 1 0 30 35 1 0 29 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 41 43 1 0 40 44 1 0 44 45 1 0 45 46 2 0 45 47 1 0 39 48 1 0 38 49 1 0 17 50 1 0 9 51 1 0 5 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 59 61 1 0 58 62 1 0 57 63 1 0 56 64 1 0 52 65 1 0 53 2 1 0 61 55 1 0 51 5 1 0 25 8 1 0 33 28 1 0 43 37 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 66 1 0 1 67 1 0 3 68 1 0 3 69 1 0 6 70 1 1 7 71 1 0 7 72 1 0 7 73 1 0 8 74 1 1 9 75 1 1 10 76 1 0 10 77 1 0 11 78 1 1 12 79 1 6 13 80 1 0 13 81 1 0 14 82 1 0 16 83 1 0 16 84 1 0 17 85 1 6 18 86 1 0 18 87 1 0 19 88 1 1 21 89 1 0 21 90 1 0 21 91 1 0 22 92 1 1 23 93 1 0 23 94 1 0 24 95 1 0 24 96 1 0 26 97 1 0 26 98 1 0 26 99 1 0 28100 1 6 29101 1 6 30102 1 1 31103 1 1 32104 1 0 32105 1 0 34106 1 0 35107 1 0 37108 1 6 38109 1 1 39110 1 1 40111 1 1 41112 1 6 42113 1 0 42114 1 0 42115 1 0 47116 1 0 47117 1 0 47118 1 0 48119 1 0 49120 1 0 50121 1 0 52122 1 6 53123 1 1 55124 1 1 56125 1 6 57126 1 1 58127 1 1 59128 1 1 60129 1 0 60130 1 0 60131 1 0 62132 1 0 63133 1 0 64134 1 0 65135 1 0 M END

Standard InCHIKey	BGDNIBDSZSTUIB-COAKQQMCSA-N
Standard InCHI	InChI=1S/C46H70O19/c1-17-15-58-46(40(56)37(17)63-41-35(54)33(52)31(50)19(3)59-41)18(2)30-28(65-46)14-26-24-9-8-22-12-23(48)13-29(45(22,7)25(24)10-11-44(26,30)6)62-43-39(32(51)27(49)16-57-43)64-42-36(55)34(53)38(20(4)60-42)61-21(5)47/h8,18-20,23-43,48-56H,1,9-16H2,2-7H3/t18-,19+,20-,23+,24+,25-,26-,27-,28-,29+,30-,31-,32-,33-,34-,35+,36+,37-,38-,39+,40-,41-,42-,43-,44-,45-,46-/m0/s1
SMILES	C=C1CO[C@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC=C6C[C@H](C[C@H]([C@]6(C)[C@H]5CC[C@]34C)O[C@H]3[C@@H]([C@H]([C@H](CO3)O)O)O[C@H]3[C@@H]([C@@H]([C@H]([C@H](C)O3)OC(=O)C)O)O)O)O2)[C@H]([C@H]1O[C@H]1[C@@H]([C@H]([C@H]([C@@H](C)O1)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	926.45	Volume:	886.269 ? Van der Waals volume.
Dense:	1.045	LogP:	2.046 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.77 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.071 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	50.0
TPSA:	282.21 ? Topological Polar Surface Area.	H-Bond Acceptor:	19.0
H-Bond Donor:	9.0	Rings:	9.0
Heavy Atoms:	19.0

MedChem Properties

QED Drug-Likeness Score:	0.113	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.092	Fsp³:	0.891
MCE-18:	239.69 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.679	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.25	Promiscuous compounds:	0.251

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.936	MDCK Permeability:	-5.176
Pgp-inhibitor:	0.0	Pgp-substrate:	0.998
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.011
20% Bioavailability (F20%):	0.265	30% Bioavailability (F30%):	0.975
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.051
Plasma Protein Binding (PPB):	43.813%	Volume Distribution (VD):	-0.442
Fu:	43.0% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.265
BSEP inhibitor:	0.023

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.607	CYP3A4-substrate:	0.972
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.778
HLM stability:	0.004 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.346

Half-life (T1/2):

3.582

ADMET: Toxicity

hERG Blockers:	0.009	hERG Blockers (10um):	0.105
Human Hepatotoxicity (H-HT):	0.505	Drug-induced Liver Injury (DILI):	0.966
AMES Toxicity:	0.867	Rat Oral Acute Toxicity:	0.02
Maximum Recommended Daily Dose:	0.106	Skin Sensitization:	1.0
Carcinogencity:	0.004	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.029
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.677	Drug-induced Nephrotoxicity:	0.946
Genotoxicity:	0.033	RPMI-8226 Immunitoxicity:	0.7
A549 Cytotoxicity:	0.458	Hek293 Cytotoxicity:	0.673
BCF:	0.878 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.443 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.119 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.086 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8452	Dracaena angustifolia	Species	Asparagaceae	Eukaryota	roots and rhizomes	n.a.	n.a.	PMID[11575942]
NPO8452	Dracaena angustifolia	Species	Asparagaceae	Eukaryota	stems	Xishuangbanna, Yunnan, China	2005-JUL	PMID[20718450]
NPO8452	Dracaena angustifolia	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8452	Dracaena angustifolia	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	3

Activity Type	# Activity
Cell line	1
Non-molecular	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT453	Cell line	HT-1080	Homo sapiens	IC50	=	21600.0	nM	PubChem BioAssay data set
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	97400.0	nM	PMID[11575942]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	42400.0	nM	PMID[11575942]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC195560 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22866
0.1-0.2	23691
0.2-0.3	2738
0.3-0.4	479
0.4-0.5	53
0.5-0.6	12
0.6-0.7	10
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8866	High Similarity	NPC11548
0.8476	Intermediate Similarity	NPC229962
0.781	Intermediate Similarity	NPC160888
0.7478	Intermediate Similarity	NPC198325
0.7345	Intermediate Similarity	NPC479532
0.7333	Intermediate Similarity	NPC51154
0.7288	Intermediate Similarity	NPC233391
0.7203	Intermediate Similarity	NPC207243
0.7009	Intermediate Similarity	NPC112274
0.6822	Remote Similarity	NPC70204
0.6822	Remote Similarity	NPC475670
0.6589	Remote Similarity	NPC202261
0.646	Remote Similarity	NPC473633
0.6429	Remote Similarity	NPC475403
0.6283	Remote Similarity	NPC476085
0.6165	Remote Similarity	NPC106589
0.6147	Remote Similarity	NPC475431
0.6	Remote Similarity	NPC306131
0.6	Remote Similarity	NPC200802
0.5917	Remote Similarity	NPC475487
0.5854	Remote Similarity	NPC50689
0.5798	Remote Similarity	NPC475247
0.5798	Remote Similarity	NPC294129
0.5625	Remote Similarity	NPC43842
0.562	Remote Similarity	NPC148965
0.5615	Remote Similarity	NPC295133
0.536	Remote Similarity	NPC63609
0.5268	Remote Similarity	NPC13190
0.5221	Remote Similarity	NPC257207
0.5143	Remote Similarity	NPC473923
0.5047	Remote Similarity	NPC473476

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC195560 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7496
0.1-0.2	1602
0.2-0.3	44
0.3-0.4	8
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data