Natural Product: NPC72260| Natural Product ID | NPC72260 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| Digitoxin |
| IUPAC Name | 3-[(3S,5R,8R,9S,10S,13R,14S,17R)-3-[(2R,4S,5S,6R)-5-[(2S,4S,5S,6R)-5-[(2S,4S,5S,6R)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-14-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
| Synonyms | Crystodigin; Digimerck; Digitoxin; Digitoxoside; Nativelle Digitaline |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL254219 |
| PubChem CID |
441207 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | WDJUZGPOPHTGOT-XUDUSOBPSA-N |
| Standard InCHI | InChI=1S/C41H64O13/c1-20-36(46)29(42)16-34(49-20)53-38-22(3)51-35(18-31(38)44)54-37-21(2)50-33(17-30(37)43)52-25-8-11-39(4)24(15-25)6-7-28-27(39)9-12-40(5)26(10-13-41(28,40)47)23-14-32(45)48-19-23/h14,20-22,24-31,33-38,42-44,46-47H,6-13,15-19H2,1-5H3/t20-,21-,22-,24-,25+,26-,27+,28-,29+,30+,31+,33+,34+,35+,36-,37-,38-,39+,40-,41+/m1/s1 |
| SMILES | O=C1OCC(=C1)[C@H]1CC[C@]2([C@]1(C)CC[C@H]1[C@H]2CC[C@H]2[C@]1(C)CC[C@@H](C2)O[C@H]1C[C@H](O)[C@@H]([C@H](O1)C)O[C@H]1C[C@H](O)[C@@H]([C@H](O1)C)O[C@H]1C[C@H](O)[C@@H]([C@H](O1)C)O)O |
  Calculated Properties| Molecular Weight:   | 764.43 | Volume:   | 758.24 Van der Waals volume.
|
| Dense:   | 1.008 | LogP:   | 2.132 The logarithm of the n-octanol/water distribution coefficients.
|
| logD7.4:   | 2.849 The logarithm of the n-octanol/water distribution coefficient at pH=7.4.
|
LogS:   | -4.312 The logarithm of aqueous solubility value.
|
| Rotatable Bonds:   | 7.0 | Rigid Bonds:   | 44.0 |
| TPSA:   | 182.83 Topological Polar Surface Area.
|
H-Bond Acceptor:   | 13.0 |
| H-Bond Donor:   | 5.0 | Rings:   | 8.0 |
| Heavy Atoms:   | 13.0 |
| QED Drug-Likeness Score:   | 0.188 | GASA:   | 1.0 GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
|
| Synthetic Accessibility Score:   | 5.984 | Fsp3:   | 0.927 |
| MCE-18:   | 147.443 MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.
|
Lipinski Rule-of-5:   | Accepted |
| Pfizer Rule:   | Rejected | GSK Rule:   | Accepted |
| Golden Triangle Rule:   | Accepted | BMS Rule:   | 0 |
| Chelating Alert:   | 0 | PAINS Alert:   | 0 |
| Colloidal aggregators:   | 0.86 | Fluc inhibitor:   | 0.002 The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
|
| Blue fluorescence:   | 0.014 The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1
|
Green fluorescence:   | 0.0 The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
|
| Reactive compounds:   | 0.249 | Promiscuous compounds:   | 0.676 |
| Caco-2 Permeability:   | -5.645 | MDCK Permeability:   | -5.239 |
| Pgp-inhibitor:   | 0.045 | Pgp-substrate:   | 0.984 |
| PAMPA:   |
1.0 The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).
|
Human Intestinal Absorption (HIA):   | 0.001 |
| 20% Bioavailability (F20%):   | 0.175 | 30% Bioavailability (F30%):   | 0.06 |
| 50% Bioavailability (F50%):   | 0.891 |
| Blood-Brain-Barrier Penetration (BBB):   | 0.0 | MRP1:   | 0.925 |
| Plasma Protein Binding (PPB):   | 61.657% | Volume Distribution (VD):   | -0.575 |
| Fu: |
32.45% The fraction unbound in plasms.
|
OATP1B1 inhibitor:   | 0.995 |
| OATP1B3 inhibitor:   | 0.571 | BCRP inhibitor:   | 0.032 |
| BSEP inhibitor:   | 0.98 |
| CYP1A2-inhibitor:   | 0.015 | CYP1A2-substrate:   | 0.0 |
| CYP2C19-inhibitor:   | 0.697 | CYP2C19-substrate:   | 0.0 |
| CYP2C9-inhibitor:   | 0.0 | CYP2C9-substrate:   | 0.0 |
| CYP2D6-inhibitor:   | 0.0 | CYP2D6-substrate:   | 0.0 |
| CYP3A4-inhibitor:   | 1.0 | CYP3A4-substrate:   | 1.0 |
| CYP2B6-substrate:   | 0.0 | CYP2C8-inhibitor:   | 0.913 |
| HLM stability:   |
0.273 Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.
|
| Clearance (CL):   | 1.946 | Half-life (T1/2):   | 4.383 |
| hERG Blockers:   | 0.137 | hERG Blockers (10um):   | 0.868 |
| Human Hepatotoxicity (H-HT):   | 0.591 | Drug-induced Liver Injury (DILI):   | 0.998 |
| AMES Toxicity:   | 0.992 | Rat Oral Acute Toxicity:   | 0.998 |
| Maximum Recommended Daily Dose:   | 1.0 | Skin Sensitization:   | 1.0 |
| Carcinogencity:   | 0.883 | Eye Corrosion:   | 0.0 |
| Eye Irritation:   | 0.0 | Respiratory Toxicity:   | 0.999 |
| Drug-induced Neurotoxicity:   | 0.018 | Ototoxicity:   | 0.967 |
| Hematotoxicity:   | 0.938 | Drug-induced Nephrotoxicity:   | 0.989 |
| Genotoxicity:   | 1.0 | RPMI-8226 Immunitoxicity:   | 0.937 |
| A549 Cytotoxicity:   | 0.987 | Hek293 Cytotoxicity:   | 0.995 |
| BCF:   |
0.529 Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].
|
IGC50:   |
3.288 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
|
| LC50DM:   |
4.879 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].
|
LC50FM:   |
4.054 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].
|
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1007/s00253-012-4489-y] |
| NPO17774 | Hemerocallis fulva | Species | Xanthorrhoeaceae | Eukaryota | Flowers | n.a. | n.a. | DOI[10.1016/j.lwt.2014.11.023] |
| NPO22245 | Digitalis lanata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1016/S0176-1617(89)80112-9] |
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1093/oxfordjournals.pcp.a076462] |
| NPO11021 | Moringa oleifera | Species | Moringaceae | Eukaryota | n.a. | leaf | n.a. |
PMID[24024688] |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | n.a. | leaf | n.a. |
PMID[25340465] |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[25340465] |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[25577087] |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[30827604] |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[37331322] |
| NPO11021 | Moringa oleifera | Species | Moringaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[38194794] |
| NPO11021 | Moringa oleifera | Species | Moringaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[38195615] |
| NPO11021 | Moringa oleifera | Species | Moringaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[38681233] |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[38719900] |
| NPO11021 | Moringa oleifera | Species | Moringaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[38731845] |
| NPO11021 | Moringa oleifera | Species | Moringaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[39553766] |
| NPO11021 | Moringa oleifera | Species | Moringaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[39723058] |
| NPO11021 | Moringa oleifera | Species | Moringaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[7798960] |
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[9834166] |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[Article] |
| NPO12474 | Cordyline fruticosa | Species | Asparagaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO1551 | Luffa aegyptiaca | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO18180 | Erysimum repandum | Species | Brassicaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO13401 | Phoenix canariensis | Species | Arecaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO27168 | Atropa belladona | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO18930 | Rubus coreanus | Species | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO11021 | Moringa oleifera | Species | Moringaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO22245 | Digitalis lanata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | Leaf | n.a. | n.a. | Database[FooDB] |
| NPO1551 | Luffa aegyptiaca | Species | Cucurbitaceae | Eukaryota | Leaf | n.a. | n.a. | Database[FooDB] |
| NPO11021 | Moringa oleifera | Species | Moringaceae | Eukaryota | Leaf | n.a. | n.a. | Database[FooDB] |
| NPO11021 | Moringa oleifera | Species | Moringaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | Plant | n.a. | n.a. | Database[FooDB] |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | Fruit | n.a. | n.a. | Database[FooDB] |
| NPO1551 | Luffa aegyptiaca | Species | Cucurbitaceae | Eukaryota | Fruit | n.a. | n.a. | Database[FooDB] |
| NPO11021 | Moringa oleifera | Species | Moringaceae | Eukaryota | Seed | n.a. | n.a. | Database[FooDB] |
| NPO1551 | Luffa aegyptiaca | Species | Cucurbitaceae | Eukaryota | Seed | n.a. | n.a. | Database[FooDB] |
| NPO11021 | Moringa oleifera | Species | Moringaceae | Eukaryota | Fruit | n.a. | n.a. | Database[FooDB] |
| NPO11021 | Moringa oleifera | Species | Moringaceae | Eukaryota | Shoot | n.a. | n.a. | Database[FooDB] |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO1551 | Luffa aegyptiaca | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO13401 | Phoenix canariensis | Species | Arecaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO17774 | Hemerocallis fulva | Species | Xanthorrhoeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO22245 | Digitalis lanata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO19015 | Begonia glabra | Species | Begoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | n.a. | n.a. | Database[Phenol-Explorer] | |
| NPO13401 | Phoenix canariensis | Species | Arecaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO22245 | Digitalis lanata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO1551 | Luffa aegyptiaca | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO19015 | Begonia glabra | Species | Begoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO17774 | Hemerocallis fulva | Species | Xanthorrhoeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO19015 | Begonia glabra | Species | Begoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO17774 | Hemerocallis fulva | Species | Xanthorrhoeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO22245 | Digitalis lanata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO18930 | Rubus coreanus | Species | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO17774 | Hemerocallis fulva | Species | Xanthorrhoeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO1551 | Luffa aegyptiaca | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO22245 | Digitalis lanata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO11021 | Moringa oleifera | Species | Moringaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2345 | Coriandrum sativum | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO18930 | Rubus coreanus | Species | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO1551 | Luffa aegyptiaca | Species | Cucurbitaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO17774 | Hemerocallis fulva | Species | Xanthorrhoeaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO17635 | Aria arguta | Species | Rosaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO22245 | Digitalis lanata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO18180 | Erysimum repandum | Species | Brassicaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO19015 | Begonia glabra | Species | Begoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13401 | Phoenix canariensis | Species | Arecaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO12474 | Cordyline fruticosa | Species | Asparagaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO19441 | Strychnos splendens | Species | Loganiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO19175 | Iguana iguana | Species | Iguanidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO19093 | Streptomyces aburaviensis | Species | Streptomycetaceae | Bacteria | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO27168 | Atropa belladona | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO11021 | Moringa oleifera | n.a. | n.a. | 0.47 | n.a. | n.a. | % |
PMID[38195615] |
| NPO2345 | Coriandrum sativum | Methanol extract | Seeds | 3.01 | n.a. | n.a. | % |
PMID[37331322] |
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | Potency | n.a. | 425.3 | nM | PubChem BioAssay data set |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | Potency | n.a. | 1883.4 | nM | PubChem BioAssay data set |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | Potency | n.a. | 123.8 | nM | PubChem BioAssay data set |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | Potency | n.a. | 122.7 | nM | PubChem BioAssay data set |
| NPT152 | Individual protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 595.5 | nM | PubChem BioAssay data set |
| NPT152 | Individual protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 173.4 | nM | PubChem BioAssay data set |
| NPT106 | Individual protein | Peroxisome proliferator-activated receptor delta | Homo sapiens | Potency | n.a. | 105.9 | nM | PubChem BioAssay data set |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | Potency | n.a. | 24.7 | nM | PubChem BioAssay data set |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | Potency | n.a. | 42.5 | nM | PubChem BioAssay data set |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | Potency | n.a. | 154.5 | nM | PubChem BioAssay data set |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | Potency | n.a. | 266 | nM | PubChem BioAssay data set |
| NPT106 | Individual protein | Peroxisome proliferator-activated receptor delta | Homo sapiens | Potency | n.a. | 595.5 | nM | PubChem BioAssay data set |
| NPT106 | Individual protein | Peroxisome proliferator-activated receptor delta | Homo sapiens | Potency | n.a. | 277.2 | nM | PubChem BioAssay data set |
| NPT163 | Individual protein | Nuclear factor NF-kappa-B p105 subunit | Homo sapiens | Potency | n.a. | 84.9 | nM | PubChem BioAssay data set |
| NPT163 | Individual protein | Nuclear factor NF-kappa-B p105 subunit | Homo sapiens | Potency | n.a. | 12.4 | nM | PubChem BioAssay data set |
| NPT152 | Individual protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 16.4 | nM | PubChem BioAssay data set |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | Potency | n.a. | 112.2 | nM | PubChem BioAssay data set |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | Potency | n.a. | 50.1 | nM | PubChem BioAssay data set |
| NPT106 | Individual protein | Peroxisome proliferator-activated receptor delta | Homo sapiens | Potency | n.a. | 316.2 | nM | PubChem BioAssay data set |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | Potency | n.a. | 2238.7 | nM | PubChem BioAssay data set |
| NPT106 | Individual protein | Peroxisome proliferator-activated receptor delta | Homo sapiens | Potency | n.a. | 251.2 | nM | PubChem BioAssay data set |
| NPT154 | Individual protein | Mothers against decapentaplegic homolog 3 | Homo sapiens | Potency | n.a. | 1258.9 | nM | PubChem BioAssay data set |
| NPT198 | Individual protein | Vitamin D receptor | Homo sapiens | Potency | n.a. | 562.3 | nM | PubChem BioAssay data set |
| NPT249 | Individual protein | Glucocorticoid receptor | Homo sapiens | Potency | n.a. | 354.8 | nM | PubChem BioAssay data set |
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | n.a. | 66.8 | nM | PubChem BioAssay data set |
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | n.a. | 65.1 | nM | PubChem BioAssay data set |
| NPT152 | Individual protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 544.8 | nM | PubChem BioAssay data set |
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | n.a. | 206.0 | nM | PubChem BioAssay data set |
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | n.a. | 1059.3 | nM | PubChem BioAssay data set |
| NPT1249 | Individual protein | Canalicular multispecific organic anion transporter 2 | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT1028 | Individual protein | Multidrug resistance-associated protein 4 | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT145 | Individual protein | Mu opioid receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT246 | Individual protein | Dopamine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2769 | Individual protein | Thromboxane A2 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT228 | Individual protein | Norepinephrine transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT291 | Individual protein | Serotonin 2b (5-HT2b) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT261 | Individual protein | Monoamine oxidase A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT222 | Individual protein | Alpha-2a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT242 | Individual protein | Dopamine D1 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT153 | Individual protein | Androgen Receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT262 | Individual protein | Muscarinic acetylcholine receptor M1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1788 | Individual protein | Alpha-1a adrenergic receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT263 | Individual protein | Muscarinic acetylcholine receptor M2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT30 | Individual protein | Cyclooxygenase-1 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT244 | Individual protein | Dopamine D3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT2761 | Individual protein | Phosphodiesterase 4A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT295 | Individual protein | Serotonin transporter | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT108 | Individual protein | Estrogen receptor alpha | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT204 | Individual protein | Acetylcholinesterase | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT218 | Individual protein | Adenosine A3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1478 | Individual protein | Vascular endothelial growth factor receptor 2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT483 | Individual protein | Prelamin-A/C | Homo sapiens | Potency | = | 1122.0 | nM | PubChem BioAssay data set |
| NPT483 | Individual protein | Prelamin-A/C | Homo sapiens | Potency | = | 707.9 | nM | PubChem BioAssay data set |
| NPT537 | Individual protein | Ras-related protein Rab-9A | Homo sapiens | Potency | = | 223.9 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 1584.9 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 1122.0 | nM | PubChem BioAssay data set |
| NPT531 | Individual protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 2511.9 | nM | PubChem BioAssay data set |
| NPT540 | Individual protein | Bile acid receptor FXR | Homo sapiens | Potency | n.a. | 446.7 | nM | PubChem BioAssay data set |
| NPT72 | Individual protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Inhibition | = | 66.85 | % | PMID[23571415] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | < | 10000.0 | nM | PMID[22961681] |
| NPT713 | Individual protein | Bile salt export pump | Homo sapiens | IC50 | = | 31000.0 | nM | PMID[23956101] |
| NPT987 | Individual protein | Histamine H3 receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT3811 | Individual protein | Sodium/potassium-transporting ATPase alpha-1 chain | Canis lupus familiaris | IC50 | = | 8.0 | nM | PMID[9154966] |
| NPT791 | Individual protein | Cruzipain | Trypanosoma cruzi | Potency | = | 1995.3 | nM | PubChem BioAssay data set |
| NPT791 | Individual protein | Cruzipain | Trypanosoma cruzi | Potency | = | 3981.1 | nM | PubChem BioAssay data set |
| NPT791 | Individual protein | Cruzipain | Trypanosoma cruzi | Potency | = | 2818.4 | nM | PubChem BioAssay data set |
| NPT538 | Individual protein | Niemann-Pick C1 protein | Homo sapiens | Potency | = | 251.2 | nM | PubChem BioAssay data set |
| NPT99 | Individual protein | Peroxisome proliferator-activated receptor gamma | Homo sapiens | Potency | n.a. | 316.2 | nM | PubChem BioAssay data set |
| NPT67 | Individual protein | Cholinesterase | Equus caballus | Inhibition | = | -0.78 | % | PMID[23062825] |
| NPT73 | Individual protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | Inhibition | = | 56.48 | % | PMID[23571415] |
| NPT612 | Individual protein | Canalicular multispecific organic anion transporter 1 | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[23956101] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 16.02 | % | DOI[10.6019/CHEMBL4495564] |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 23.91 | % | DOI[10.6019/CHEMBL4495564] |
| NPT542 | Individual protein | Progesterone receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT98 | Individual protein | HERG | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 14125.4 | nM | PubChem BioAssay data set |
| NPT51 | Individual protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 7079.5 | nM | PubChem BioAssay data set |
| NPT37 | Individual protein | Signal transducer and activator of transcription 1-alpha/beta | Homo sapiens | IC50 | > | 55700.0 | nM | PubChem BioAssay data set |
| NPT46 | Individual protein | Thyroid hormone receptor beta-1 | Homo sapiens | Potency | n.a. | 70.8 | nM | PubChem BioAssay data set |
| NPT445 | Individual protein | Peripheral myelin protein 22 | Rattus norvegicus | Potency | n.a. | 10181.5 | nM | PubChem BioAssay data set |
| NPT752 | Individual protein | Solute carrier organic anion transporter family member 1A1 | Rattus norvegicus | Activity | = | 29.0 | % | PMID[8786566] |
| NPT66 | Individual protein | Acetylcholinesterase | Electrophorus electricus | Inhibition | = | -1.83 | % | PMID[23062825] |
| NPT861 | Individual protein | Isocitrate dehydrogenase [NADP] cytoplasmic | Homo sapiens | Potency | n.a. | 206.0 | nM | PubChem BioAssay data set |
| NPT5104 | Individual protein | Phosphodiesterase 3A | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT92 | Individual protein | Serotonin 1a (5-HT1a) receptor | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT74 | Individual protein | Proto-oncogene c-JUN | Homo sapiens | Potency | n.a. | 301.1 | nM | PubChem BioAssay data set |
| NPT74 | Individual protein | Proto-oncogene c-JUN | Homo sapiens | Potency | n.a. | 155.9 | nM | PubChem BioAssay data set |
| NPT604 | Individual protein | Serum albumin | Homo sapiens | Log K' | = | 0.13 | n.a. | PMID[11728183] |
| NPT604 | Individual protein | Serum albumin | Homo sapiens | Log B/F | = | 3.222 | n.a. | PMID[7381857] |
| NPT604 | Individual protein | Serum albumin | Homo sapiens | Binding | = | 96.6 | % | PMID[10821711] |
| NPT2890 | Protein complex | Sodium/potassium-transporting ATPase | Homo sapiens | IC50 | = | 8.0 | nM | PMID[8421289] |
| NPT536 | Nucleic acid | microRNA 21 | Homo sapiens | Potency | = | 104.0 | nM | PubChem BioAssay data set |
| NPT38 | Individual protein | Signal transducer and activator of transcription 3 | Homo sapiens | IC50 | = | 700.0 | nM | PubChem BioAssay data set |
| NPT539 | Individual protein | Cellular tumor antigen p53 | Homo sapiens | Potency | = | 31.6 | nM | PubChem BioAssay data set |
| NPT64 | Individual protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 145.8 | nM | PubChem BioAssay data set |
| NPT546 | Individual protein | Retinoid X receptor alpha | Homo sapiens | Potency | n.a. | 22.4 | nM | PubChem BioAssay data set |
| NPT546 | Individual protein | Retinoid X receptor alpha | Homo sapiens | Potency | n.a. | 25.1 | nM | PubChem BioAssay data set |
| NPT3812 | Individual protein | Solute carrier organic anion transporter family member 4C1 | Homo sapiens | IC50 | = | 120.0 | nM | PMID[14993604] |
| NPT670 | Individual protein | Thrombin | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT398 | Cell line | UACC-62 | Homo sapiens | IC50 | = | 33.5 | nM | PMID[16309315] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 10.2 | nM | PMID[16309315] |
| NPT384 | Cell line | TK-10 | Homo sapiens | IC50 | = | 3.2 | nM | PMID[16309315] |
| NPT111 | Cell line | K562 | Homo sapiens | IC50 | = | 6.4 | nM | PMID[16309315] |
| NPT384 | Cell line | TK-10 | Homo sapiens | Activity | = | 52.1 | % | PMID[16309315] |
| NPT384 | Cell line | TK-10 | Homo sapiens | Activity | = | 41.3 | % | PMID[16309315] |
| NPT384 | Cell line | TK-10 | Homo sapiens | Activity | = | 6.6 | % | PMID[16309315] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 440.0 | nM | PMID[16309329] |
| NPT90 | Cell line | DU-145 | Homo sapiens | IC50 | = | 440.0 | nM | PMID[16309329] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 440.0 | nM | PMID[16309329] |
| NPT395 | Cell line | SF-268 | Homo sapiens | IC50 | = | 440.0 | nM | PMID[16309329] |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | IC50 | = | 440.0 | nM | PMID[16309329] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 440.0 | nM | PMID[16309329] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 440.0 | nM | PMID[16309329] |
| NPT378 | Cell line | NCI/ADR-RES | Homo sapiens | IC50 | = | 440.0 | nM | PMID[16309329] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Activity | = | 2.91 | n.a. | PMID[19894733] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | Activity | = | 2.74 | n.a. | PMID[19894733] |
| NPT393 | Cell line | HCT-116 | Homo sapiens | IC50 | = | 740.0 | nM | PMID[19894733] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 4070.0 | nM | PMID[19894733] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 357.0 | nM | PMID[21643465] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | GI50 | = | 10.7 | nM | PMID[21643465] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 20.0 | nM | PMID[21421322] |
| NPT71 | Cell line | HEK293 | Homo sapiens | Potency | n.a. | 206.0 | nM | PubChem BioAssay data set |
| NPT368 | Cell line | SN12C | Homo sapiens | GI50 | n.a. | 10.0 | nM | PubChem BioAssay data set |
| NPT367 | Cell line | MDA-N | Homo sapiens | GI50 | n.a. | 25.59 | nM | PubChem BioAssay data set |
| NPT370 | Cell line | NCI-H23 | Homo sapiens | GI50 | n.a. | 18.54 | nM | PubChem BioAssay data set |
| NPT371 | Cell line | UO-31 | Homo sapiens | GI50 | n.a. | 41.4 | nM | PubChem BioAssay data set |
| NPT369 | Cell line | ACHN | Homo sapiens | GI50 | n.a. | 14.96 | nM | PubChem BioAssay data set |
| NPT116 | Cell line | HL-60 | Homo sapiens | GI50 | n.a. | 21.23 | nM | PubChem BioAssay data set |
| NPT372 | Cell line | HOP-92 | Homo sapiens | GI50 | n.a. | 42.17 | nM | PubChem BioAssay data set |
| NPT90 | Cell line | DU-145 | Homo sapiens | GI50 | n.a. | 21.18 | nM | PubChem BioAssay data set |
| NPT374 | Cell line | SF-539 | Homo sapiens | GI50 | n.a. | 12.33 | nM | PubChem BioAssay data set |
| NPT375 | Cell line | Malme-3M | Homo sapiens | GI50 | n.a. | 27.99 | nM | PubChem BioAssay data set |
| NPT373 | Cell line | SK-MEL-5 | Homo sapiens | GI50 | n.a. | 21.23 | nM | PubChem BioAssay data set |
| NPT376 | Cell line | A498 | Homo sapiens | GI50 | n.a. | 47.86 | nM | PubChem BioAssay data set |
| NPT111 | Cell line | K562 | Homo sapiens | GI50 | n.a. | 24.55 | nM | PubChem BioAssay data set |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | GI50 | n.a. | 17.22 | nM | PubChem BioAssay data set |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | GI50 | n.a. | 64.86 | nM | PubChem BioAssay data set |
| NPT379 | Cell line | HOP-62 | Homo sapiens | GI50 | n.a. | 19.95 | nM | PubChem BioAssay data set |
| NPT380 | Cell line | U-251 | Homo sapiens | GI50 | n.a. | 33.96 | nM | PubChem BioAssay data set |
| NPT378 | Cell line | NCI/ADR-RES | Homo sapiens | GI50 | n.a. | 28.31 | nM | PubChem BioAssay data set |
| NPT382 | Cell line | OVCAR-5 | Homo sapiens | GI50 | n.a. | 54.33 | nM | PubChem BioAssay data set |
| NPT381 | Cell line | OVCAR-8 | Homo sapiens | GI50 | n.a. | 38.9 | nM | PubChem BioAssay data set |
| NPT383 | Cell line | SNB-19 | Homo sapiens | GI50 | n.a. | 74.99 | nM | PubChem BioAssay data set |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | GI50 | n.a. | 129.12 | nM | PubChem BioAssay data set |
| NPT385 | Cell line | SR | Homo sapiens | GI50 | n.a. | 33.81 | nM | PubChem BioAssay data set |
| NPT323 | Cell line | SW-620 | Homo sapiens | GI50 | n.a. | 29.58 | nM | PubChem BioAssay data set |
| NPT384 | Cell line | TK-10 | Homo sapiens | GI50 | n.a. | 25.18 | nM | PubChem BioAssay data set |
| NPT455 | Cell line | NCI-H522 | Homo sapiens | GI50 | n.a. | 10.0 | nM | PubChem BioAssay data set |
| NPT387 | Cell line | M14 | Homo sapiens | GI50 | n.a. | 60.26 | nM | PubChem BioAssay data set |
| NPT386 | Cell line | KM12 | Homo sapiens | GI50 | n.a. | 55.34 | nM | PubChem BioAssay data set |
| NPT389 | Cell line | RPMI-8226 | Homo sapiens | GI50 | n.a. | 29.17 | nM | PubChem BioAssay data set |
| NPT388 | Cell line | NCI-H322M | Homo sapiens | GI50 | n.a. | 38.28 | nM | PubChem BioAssay data set |
| NPT456 | Cell line | OVCAR-4 | Homo sapiens | GI50 | n.a. | 19.91 | nM | PubChem BioAssay data set |
| NPT457 | Cell line | BT-549 | Homo sapiens | GI50 | n.a. | 18.88 | nM | PubChem BioAssay data set |
| NPT390 | Cell line | LOX IMVI | Homo sapiens | GI50 | n.a. | 21.53 | nM | PubChem BioAssay data set |
| NPT147 | Cell line | SK-MEL-2 | Homo sapiens | GI50 | n.a. | 64.12 | nM | PubChem BioAssay data set |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | n.a. | 15.7 | nM | PubChem BioAssay data set |
| NPT391 | Cell line | HCC 2998 | Homo sapiens | GI50 | n.a. | 170.61 | nM | PubChem BioAssay data set |
| NPT392 | Cell line | SNB-75 | Homo sapiens | GI50 | n.a. | 67.61 | nM | PubChem BioAssay data set |
| NPT148 | Cell line | HCT-15 | Homo sapiens | GI50 | n.a. | 30.48 | nM | PubChem BioAssay data set |
| NPT395 | Cell line | SF-268 | Homo sapiens | GI50 | n.a. | 24.1 | nM | PubChem BioAssay data set |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | n.a. | 16.48 | nM | PubChem BioAssay data set |
| NPT394 | Cell line | EKVX | Homo sapiens | GI50 | n.a. | 28.58 | nM | PubChem BioAssay data set |
| NPT83 | Cell line | MCF7 | Homo sapiens | GI50 | n.a. | 41.3 | nM | PubChem BioAssay data set |
| NPT306 | Cell line | PC-3 | Homo sapiens | GI50 | n.a. | 33.04 | nM | PubChem BioAssay data set |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | GI50 | n.a. | 44.98 | nM | PubChem BioAssay data set |
| NPT396 | Cell line | T47D | Homo sapiens | GI50 | n.a. | 48.87 | nM | PubChem BioAssay data set |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | GI50 | n.a. | 17.22 | nM | PubChem BioAssay data set |
| NPT398 | Cell line | UACC-62 | Homo sapiens | GI50 | n.a. | 57.94 | nM | PubChem BioAssay data set |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | GI50 | n.a. | 48.53 | nM | PubChem BioAssay data set |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | GI50 | n.a. | 18.41 | nM | PubChem BioAssay data set |
| NPT458 | Cell line | IGROV-1 | Homo sapiens | GI50 | n.a. | 36.48 | nM | PubChem BioAssay data set |
| NPT399 | Cell line | SF-295 | Homo sapiens | GI50 | n.a. | 25.82 | nM | PubChem BioAssay data set |
| NPT402 | Cell line | Hs-578T | Homo sapiens | GI50 | n.a. | 37.76 | nM | PubChem BioAssay data set |
| NPT403 | Cell line | UACC-257 | Homo sapiens | GI50 | n.a. | 58.21 | nM | PubChem BioAssay data set |
| NPT401 | Cell line | 786-0 | Homo sapiens | GI50 | n.a. | 26.61 | nM | PubChem BioAssay data set |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | GI50 | n.a. | 19.86 | nM | PubChem BioAssay data set |
| NPT405 | Cell line | NCI-H226 | Homo sapiens | GI50 | n.a. | 63.53 | nM | PubChem BioAssay data set |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | GI50 | n.a. | 92.04 | nM | PubChem BioAssay data set |
| NPT139 | Cell line | HT-29 | Homo sapiens | GI50 | n.a. | 33.81 | nM | PubChem BioAssay data set |
| NPT407 | Cell line | COLO 205 | Homo sapiens | GI50 | n.a. | 50.12 | nM | PubChem BioAssay data set |
| NPT406 | Cell line | RXF 393 | Homo sapiens | GI50 | n.a. | 17.54 | nM | PubChem BioAssay data set |
| NPT859 | Cell line | HFF | Homo sapiens | Inhibition | = | 50.0 | % | PMID[24900847] |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | IC50 | = | 117.1 | nM | PMID[28234008] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 67.6 | nM | PMID[28234008] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 482.0 | nM | PMID[28234008] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | = | 43.3 | nM | PMID[28234008] |
| NPT1992 | Cell line | KURAMOCHI | Homo sapiens | IC50 | = | 5911.0 | nM | PMID[28234008] |
| NPT456 | Cell line | OVCAR-4 | Homo sapiens | IC50 | = | 425.6 | nM | PMID[28234008] |
| NPT382 | Cell line | OVCAR-5 | Homo sapiens | IC50 | = | 321.0 | nM | PMID[28234008] |
| NPT381 | Cell line | OVCAR-8 | Homo sapiens | IC50 | = | 71.5 | nM | PMID[28234008] |
| NPT139 | Cell line | HT-29 | Homo sapiens | IC50 | = | 68.0 | nM | PMID[32096998] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 480.0 | nM | PMID[32096998] |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | IC50 | = | 120.0 | nM | PMID[32096998] |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | IC50 | = | 43.0 | nM | PMID[32096998] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 relative | = | 100.0 | nM | ECBD screening data for assay EOS300108 |
| NPT859 | Cell line | HFF | Homo sapiens | CC50 | = | 2800.0 | nM | PMID[24900847] |
| NPT859 | Cell line | HFF | Homo sapiens | CC50 | = | 6000.0 | nM | PMID[24900847] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | > | 50000.0 | nM | DOI[10.1101/2020.03.20.999730] |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 4147.5 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 4775.5 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 6573.3 | nM | PubChem BioAssay data set |
| NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Potency | n.a. | 15101.4 | nM | PubChem BioAssay data set |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | < | 230.0 | nM | DOI[10.1101/2020.03.20.999730] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Hit score | = | -0.2851 | n.a. | DOI[10.1101/2020.04.21.054387] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -0.28 | % | DOI[10.6019/CHEMBL4495565] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 20000.0 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 19952.62 | nM | DOI[10.6019/CHEMBL4651402] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 440.0 | nM | PMID[16309329] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 1.71 | n.a. | PMID[19894733] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 410.0 | nM | PMID[19894733] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 100.0 | nM | PMID[19894733] |
| NPT29392 | Protein complex | Gamma-aminobutyric acid receptor subunit alpha-1/alpha-2/beta-2/gamma-2 | Homo sapiens | AC50 | > | 30000.0 | nM | PMID[37468498] |
| NPT1750 | Organism | Human herpesvirus 5 | Human herpesvirus 5 | EC50 | = | 23.3 | nM | PMID[24900847] |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 84.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 268.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 8.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 118.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 55.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 298.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 173.4 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 19.6 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 477.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 98.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 7.7 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 59.6 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 123.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 84.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 97.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 50.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 56.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 94.4 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 31.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 548.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 3757.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 87.7 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 19451.7 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 391.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 1344.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 6 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 10.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 53.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 22 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 95.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 105.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 13.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 1508.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 439.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 30.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 174.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 425.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 5530.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 33.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 24.7 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 218.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 473.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 17.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 42.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 308.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 33491.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 15.6 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 196.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 12.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 47.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 388.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 33.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 7.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 421.6 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 375.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 86.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 301.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 169.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 39.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 106.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 62.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 21.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 311 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 26832.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 5482.2 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 11 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 110.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 553.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 337.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 134.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 16785.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Kd | = | 28000.0 | nM | PMID[10821711] |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | IC50 ratio | = | 0.3 | n.a. | PMID[12109909] |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | IC50 ratio | = | 8.0 | n.a. | PMID[12109909] |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | IC50 ratio | = | 1.7 | n.a. | PMID[12109909] |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | IC50 ratio | = | 10.0 | n.a. | PMID[12109909] |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | Relative Ki | = | 1.0 | n.a. | PMID[12109909] |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | Kd | = | 0.6 | nM | PMID[12109909] |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | Ki | = | 0.1 | nM | PMID[12109909] |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | Ki | = | 0.2 | nM | PMID[12109909] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 2800.0 | n.a. | PMID[2089119] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 0.3 | n.a. | PMID[19894733] |
| NPT2 | Others | Unspecified | n.a. | Potency | = | 6309.6 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 58.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 225.0 | nM | DrugMatrix in vitro pharmacology data |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 145.8 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 7079.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 100.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 2.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 89.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 3162.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 700.0 | nM | PMID[141522] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 240.0 | nM | PMID[141522] |
| NPT2 | Others | Unspecified | n.a. | AC50 | n.a. | 8912.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 103.11 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 39810.7 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 11.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | AC50 | n.a. | 1412.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | AC50 | n.a. | 707.9 | nM | PubChem BioAssay data set |
| NPT22036 | Cell line | HL | Homo sapiens | Activity | = | 0.1 | % | PMID[29043803] |
| NPT2 | Others | Unspecified | n.a. | Ratio CC50/EC50 | = | 120.0 | n.a. | PMID[24900847] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT393 | Cell line | HCT-116 | Homo sapiens | Survival | = | 4.0 | % | PMID[19894733] |
| NPT139 | Cell line | HT-29 | Homo sapiens | Survival | = | 28.0 | % | PMID[19894733] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Survival | = | 2.0 | % | PMID[19894733] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | Log B/F | = | 0.258 | n.a. | PMID[7381857] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | Delta F75 | = | 0.00000016 | M l-1 | PMID[7143360] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 72.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 37500.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 375.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 87.5 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 140.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 27500000.0 | nM | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 95.83 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 685.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 284.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 1.6 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1566.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 101.83 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 9.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 103.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.22 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 137.67 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 1.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 54300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 8.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASO | = | 0.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 13.67 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 10069.5 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 50.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 516.83 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BASOLE | = | 0.0 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.17 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5440000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 33.88 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 132300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 10650.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 94.67 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 24.37 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 390500.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 62.38 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 0.67 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 4.5 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBCNUC | = | 0.33 | /100WBC | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 414500.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 68.83 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 41200.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 492.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 83.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 37000000.0 | nM | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 98.67 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 565.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 167.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 1.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1575.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 104.83 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 10.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 104.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.46 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 143.87 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 1.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 57200.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 8.5 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 20.67 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 11518.33 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 47.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 614.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5610000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 34.25 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 133800.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 12200.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 94.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 23.83 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 390800.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 61.03 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONOLE | = | 0.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 5.17 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBCNUC | = | 0.0 | /100WBC | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 941830.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 72.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 37700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 495.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 95.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 120.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 25670000.0 | nM | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 96.33 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 706.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 398.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1466.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 188.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 11.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 101.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.78 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 137.9 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 55700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 5.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 39.67 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 11912.33 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 73.33 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 641.33 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5700000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 35.6 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 137700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 12670.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 93.67 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 24.13 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 387000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 62.33 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 5.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 661330.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 84.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 41000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 531.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 83.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 106.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 34670000.0 | nM | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 98.33 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 766.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 231.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1540.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 122.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 101.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.23 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 142.43 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 2.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 58300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 4.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOS | = | 0.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 9184.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 19.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 697.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | EOSLE | = | 0.0 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5650000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 35.27 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 136300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 9900.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 93.0 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 24.2 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 62.47 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 6.67 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 833000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 73.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 38000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 350.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 101.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 116.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 23330000.0 | nM | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 96.0 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 613.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 274.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 1.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | GLUC | = | 1473.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 153.0 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LIPASE | = | 10.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PHOS | = | 90.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.47 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 137.1 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BILI | = | 2.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 53300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 6.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 10747.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 27.33 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTSG | = | 592.33 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5510000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 33.6 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 134000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 11370.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 24.33 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 399000.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 448000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALT | = | 67.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALB | = | 40300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | ALP | = | 389.33 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | AST | = | 88.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | BUN | = | 146.7 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CO2 | = | 35000000.0 | nM | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHLORIDE | = | 99.67 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CHOL | = | 573.3 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CK | = | 199.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | CREAT | = | 1.5 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LDH | = | 157.67 | U.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | POTASSIUM | = | 5.37 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | SODIUM | = | 144.23 | mEq.L-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PROT | = | 56700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | URATE | = | 5.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYM | = | 7671.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MONO | = | 21.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | RBC | = | 5280000.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HCT | = | 33.33 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | HGB | = | 129700.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | WBC | = | 8330.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | LYMLE | = | 92.0 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCH | = | 24.53 | pg | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCHC | = | 389300.0 | ug.mL-1 | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | MCV | = | 63.0 | fL | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | NEUTLE | = | 7.67 | % | DOI[10.6019/CHEMBL3885881] |
| NPT29 | Organism | Rattus norvegicus | Rattus norvegicus | PLAT | = | 1052330.0 | cells.uL-1 | DOI[10.6019/CHEMBL3885881] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|---|---|---|---|---|---|
| Homo sapiens | Zone of skin | log Kp | = | -8.34 | n.a. | PMID[17827020] |
| Homo sapiens | n.a. | Fu | = | 0.066 | n.a. | PMID[18426954] |
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|---|---|---|---|---|---|
| - | Mus musculus | LD50 | = | 10.0 | mg.kg-1 | PMID[27983842] |
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC72260 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Natural Product ID |
|---|---|---|
| 0.9054 | High Similarity | NPC471633 |
| 0.8395 | Intermediate Similarity | NPC173555 |
| 0.8375 | Intermediate Similarity | NPC193893 |
| 0.7907 | Intermediate Similarity | NPC55532 |
| 0.7625 | Intermediate Similarity | NPC99620 |
| 0.7609 | Intermediate Similarity | NPC120390 |
| 0.7609 | Intermediate Similarity | NPC74259 |
| 0.7582 | Intermediate Similarity | NPC475590 |
| 0.7195 | Intermediate Similarity | NPC473852 |
| 0.7143 | Intermediate Similarity | NPC84949 |
| 0.7143 | Intermediate Similarity | NPC480562 |
| 0.7143 | Intermediate Similarity | NPC74945 |
| 0.7143 | Intermediate Similarity | NPC31354 |
| 0.7143 | Intermediate Similarity | NPC69576 |
| 0.7111 | Intermediate Similarity | NPC125077 |
| 0.7024 | Intermediate Similarity | NPC5311 |
| 0.6966 | Remote Similarity | NPC236973 |
| 0.6923 | Remote Similarity | NPC208193 |
| 0.6867 | Remote Similarity | NPC474418 |
| 0.6782 | Remote Similarity | NPC93883 |
| 0.6744 | Remote Similarity | NPC199428 |
| 0.6744 | Remote Similarity | NPC109448 |
| 0.6744 | Remote Similarity | NPC310341 |
| 0.6739 | Remote Similarity | NPC486143 |
| 0.6739 | Remote Similarity | NPC486142 |
| 0.6739 | Remote Similarity | NPC486149 |
| 0.6632 | Remote Similarity | NPC475219 |
| 0.6628 | Remote Similarity | NPC469750 |
| 0.6591 | Remote Similarity | NPC484202 |
| 0.6552 | Remote Similarity | NPC76572 |
| 0.6552 | Remote Similarity | NPC193382 |
| 0.6484 | Remote Similarity | NPC30483 |
| 0.6484 | Remote Similarity | NPC470897 |
| 0.6465 | Remote Similarity | NPC117445 |
| 0.6465 | Remote Similarity | NPC474908 |
| 0.6465 | Remote Similarity | NPC308262 |
| 0.6436 | Remote Similarity | NPC474423 |
| 0.6421 | Remote Similarity | NPC486146 |
| 0.6413 | Remote Similarity | NPC292467 |
| 0.6364 | Remote Similarity | NPC475419 |
| 0.6344 | Remote Similarity | NPC475556 |
| 0.6344 | Remote Similarity | NPC311706 |
| 0.6327 | Remote Similarity | NPC486144 |
| 0.6327 | Remote Similarity | NPC486145 |
| 0.6327 | Remote Similarity | NPC486147 |
| 0.6327 | Remote Similarity | NPC486148 |
| 0.6136 | Remote Similarity | NPC196429 |
| 0.6067 | Remote Similarity | NPC77299 |
| 0.6067 | Remote Similarity | NPC480906 |
| 0.6064 | Remote Similarity | NPC32177 |
| 0.6064 | Remote Similarity | NPC469756 |
| 0.6064 | Remote Similarity | NPC275901 |
| 0.6044 | Remote Similarity | NPC483822 |
| 0.6 | Remote Similarity | NPC188234 |
| 0.6 | Remote Similarity | NPC240070 |
| 0.6 | Remote Similarity | NPC480914 |
| 0.6 | Remote Similarity | NPC608063 |
| 0.598 | Remote Similarity | NPC486134 |
| 0.598 | Remote Similarity | NPC486141 |
| 0.5955 | Remote Similarity | NPC484211 |
| 0.5918 | Remote Similarity | NPC329986 |
| 0.5918 | Remote Similarity | NPC140092 |
| 0.5889 | Remote Similarity | NPC99080 |
| 0.5889 | Remote Similarity | NPC480915 |
| 0.5876 | Remote Similarity | NPC486135 |
| 0.5876 | Remote Similarity | NPC486137 |
| 0.5843 | Remote Similarity | NPC99728 |
| 0.5843 | Remote Similarity | NPC87250 |
| 0.5843 | Remote Similarity | NPC244402 |
| 0.5843 | Remote Similarity | NPC50305 |
| 0.5842 | Remote Similarity | NPC329636 |
| 0.5816 | Remote Similarity | NPC232785 |
| 0.5816 | Remote Similarity | NPC486139 |
| 0.5761 | Remote Similarity | NPC250556 |
| 0.5745 | Remote Similarity | NPC480907 |
| 0.5714 | Remote Similarity | NPC157376 |
| 0.5714 | Remote Similarity | NPC17896 |
| 0.5714 | Remote Similarity | NPC469755 |
| 0.5714 | Remote Similarity | NPC284406 |
| 0.5714 | Remote Similarity | NPC197707 |
| 0.5714 | Remote Similarity | NPC251866 |
| 0.5714 | Remote Similarity | NPC142066 |
| 0.5714 | Remote Similarity | NPC603972 |
| 0.5699 | Remote Similarity | NPC179412 |
| 0.5699 | Remote Similarity | NPC471356 |
| 0.5699 | Remote Similarity | NPC471353 |
| 0.5699 | Remote Similarity | NPC305574 |
| 0.5684 | Remote Similarity | NPC103534 |
| 0.5684 | Remote Similarity | NPC44899 |
| 0.5684 | Remote Similarity | NPC304260 |
| 0.5684 | Remote Similarity | NPC29639 |
| 0.5679 | Remote Similarity | NPC268829 |
| 0.5679 | Remote Similarity | NPC295110 |
| 0.5673 | Remote Similarity | NPC329675 |
| 0.5612 | Remote Similarity | NPC231518 |
| 0.5612 | Remote Similarity | NPC488944 |
| 0.5545 | Remote Similarity | NPC486138 |
| 0.5545 | Remote Similarity | NPC276838 |
| 0.5543 | Remote Similarity | NPC479356 |
| 0.5543 | Remote Similarity | NPC479355 |
| 0.5534 | Remote Similarity | NPC486136 |
| 0.551 | Remote Similarity | NPC480910 |
| 0.551 | Remote Similarity | NPC480909 |
| 0.5437 | Remote Similarity | NPC488943 |
| 0.5437 | Remote Similarity | NPC488942 |
| 0.5413 | Remote Similarity | NPC286809 |
| 0.5376 | Remote Similarity | NPC34390 |
| 0.5376 | Remote Similarity | NPC484210 |
| 0.5361 | Remote Similarity | NPC488935 |
| 0.5361 | Remote Similarity | NPC5883 |
| 0.5361 | Remote Similarity | NPC488936 |
| 0.5288 | Remote Similarity | NPC479360 |
| 0.5288 | Remote Similarity | NPC479359 |
| 0.5269 | Remote Similarity | NPC84987 |
| 0.5263 | Remote Similarity | NPC180079 |
| 0.5253 | Remote Similarity | NPC40749 |
| 0.5213 | Remote Similarity | NPC477580 |
| 0.52 | Remote Similarity | NPC32793 |
| 0.52 | Remote Similarity | NPC116075 |
| 0.5185 | Remote Similarity | NPC486150 |
| 0.5158 | Remote Similarity | NPC152615 |
| 0.5158 | Remote Similarity | NPC10823 |
| 0.5149 | Remote Similarity | NPC475629 |
| 0.5146 | Remote Similarity | NPC146857 |
| 0.5143 | Remote Similarity | NPC488938 |
| 0.5143 | Remote Similarity | NPC488937 |
| 0.5138 | Remote Similarity | NPC488945 |
| 0.5138 | Remote Similarity | NPC488946 |
| 0.5106 | Remote Similarity | NPC309034 |
| 0.5104 | Remote Similarity | NPC77319 |
| 0.5104 | Remote Similarity | NPC471351 |
| 0.5104 | Remote Similarity | NPC471355 |
| 0.51 | Remote Similarity | NPC27363 |
| 0.5059 | Remote Similarity | NPC196931 |
| 0.5059 | Remote Similarity | NPC480913 |
| 0.5054 | Remote Similarity | NPC158344 |
| 0.5053 | Remote Similarity | NPC6108 |
| 0.5053 | Remote Similarity | NPC89514 |
| 0.5052 | Remote Similarity | NPC277374 |
| 0.505 | Remote Similarity | NPC479353 |
| 0.505 | Remote Similarity | NPC479354 |
| 0.505 | Remote Similarity | NPC486130 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC72260 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| 1.0 | High Similarity | NPD8294 | Phase 4 |
| 0.8395 | Intermediate Similarity | NPD8296 | Phase 4 |
| 0.8333 | Intermediate Similarity | NPD8377 | Phase 4 |
| 0.7381 | Intermediate Similarity | NPD8380 | Approved |
| 0.7262 | Intermediate Similarity | NPD8335 | Phase 4 |
| 0.7033 | Intermediate Similarity | NPD8378 | Pre-clinical |
| 0.7033 | Intermediate Similarity | NPD8379 | Approved |
| 0.5761 | Remote Similarity | NPD7507 | Pre-clinical |
| 0.5714 | Remote Similarity | NPD7319 | Approved |
| 0.5612 | Remote Similarity | NPD8033 | Approved |
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
