NPASS Compound

Natural Product: NPC486134

Natural Product ID	NPC486134
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	ILSCMGXPNCDKNU-WCHWCZMCSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001125] Steroid lactones [CHEMONTID:0001555] Cardenolides and derivatives [CHEMONTID:0001559] Cardenolide glycosides and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 131138 0 0 0 0 0 0 0 0999 V2000 -1.6964 -1.4795 3.0469 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5561 -0.7117 1.7514 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8536 -0.4161 1.0685 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7088 0.7973 0.2201 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2827 1.0234 -0.2890 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3006 0.9739 0.8544 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.9023 0.4919 2.0097 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7083 0.0881 0.5112 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9512 0.6958 0.4464 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9789 0.1422 1.3720 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7958 -0.9857 0.8133 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5095 -0.6839 -0.4553 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3738 -1.8544 -1.4070 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8816 0.5681 -1.0834 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3676 0.6081 -2.4919 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8495 0.7019 -2.5757 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6319 -0.0441 -1.5657 C 0 0 2 0 0 0 0 0 0 0 0 0 5.9602 -0.3060 -0.2530 C 0 0 2 0 0 0 0 0 0 0 0 0 6.7636 -1.3512 0.4649 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2433 -1.2198 0.2204 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6947 0.1697 -0.1428 C 0 0 2 0 0 0 0 0 0 0 0 0 10.1364 0.0860 -0.5840 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6373 1.1259 1.0299 C 0 0 2 0 0 0 0 0 0 0 0 0 8.1978 2.4340 0.4865 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5020 2.1668 -0.8446 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8863 0.7782 -1.2467 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5735 0.8497 -2.4707 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9718 1.2786 1.7136 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7268 2.3452 1.8507 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9488 2.0230 2.5869 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8632 2.8603 2.8709 O 0 0 0 0 0 0 0 0 0 0 0 0 11.8813 0.6941 2.8787 O 0 0 0 0 0 0 0 0 0 0 0 0 10.6617 0.1762 2.4582 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3921 0.5230 -1.0165 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9219 0.1182 -1.3042 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.5976 0.4841 -2.6020 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6233 1.6958 -2.9080 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2206 -0.4924 -3.6454 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1243 1.9117 0.9414 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1322 2.6292 0.2756 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3132 -1.5284 0.4301 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4735 -2.1077 0.8097 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.3854 -3.5466 1.2500 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2064 -4.4816 0.3589 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6331 -3.9709 0.2511 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6625 -2.4623 0.4581 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.9517 -1.8825 -0.0177 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9576 -0.5329 0.2716 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1438 0.1156 -0.1211 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.6869 0.8422 1.0724 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.9691 1.5568 0.7321 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.0599 1.6786 -0.7700 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.7482 1.9549 -1.4237 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.3120 3.3656 -1.0699 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1345 3.6758 -1.7433 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7922 1.0406 -1.0719 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.7090 0.5619 -1.3332 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0176 2.8476 1.2714 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9879 -0.0472 2.1197 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5245 -1.8914 -0.1148 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4845 -4.6419 1.1185 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5606 -4.5566 -0.8572 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9104 -3.7371 2.5540 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9532 -0.8100 3.8943 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4873 -2.2353 2.9096 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7433 -2.0234 3.2124 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8463 -1.2894 1.0914 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6124 -0.1869 1.8653 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3266 0.7854 -0.7188 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2552 2.0407 -0.7157 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1300 1.9642 1.0352 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7994 1.7662 0.6965 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6389 0.9744 1.7151 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4611 -0.2457 2.2759 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4345 -1.3928 1.6233 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0527 -1.8167 0.6100 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5289 -2.7917 -0.8329 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3577 -1.8731 -1.8158 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1370 -1.8245 -2.2053 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2362 1.4661 -0.5374 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9851 -0.2462 -3.0885 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9152 1.5295 -2.9629 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1240 1.7771 -2.6637 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1219 0.2844 -3.5939 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9977 -0.9979 -1.9725 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9552 0.5933 0.4250 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4569 -2.3447 0.0797 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5126 -1.3443 1.5543 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7482 -1.5108 1.1602 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6034 -1.9293 -0.5524 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8124 0.7841 -0.0544 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1973 0.3671 -1.6583 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5145 -0.9739 -0.5561 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9190 0.7663 1.8123 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0049 3.1499 0.2416 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5156 2.9702 1.1881 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7977 2.9154 -1.6286 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4313 2.3315 -0.6840 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5110 1.7327 -2.8643 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4707 3.3463 1.4681 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0208 -0.1488 3.3274 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8791 -0.6723 1.7900 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9774 1.3622 -1.5759 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9830 -0.4148 -1.4444 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0717 -0.6164 -4.3202 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6901 -0.0775 -4.1495 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0890 -1.4206 -3.1384 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9755 1.9429 0.1399 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7793 3.1435 -0.6282 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4736 3.4064 1.0090 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8507 -1.5331 1.7046 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3475 -3.9231 1.3012 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2492 -5.4828 0.8231 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9671 -4.1582 -0.7887 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6129 -2.3036 1.5601 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7637 -2.4175 0.5539 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1493 -2.1031 -1.0768 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8499 -0.5920 -0.5781 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9659 1.5738 1.4447 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8485 0.9559 1.0520 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7544 2.5366 -1.0235 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8917 1.9424 -2.5328 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1084 4.0535 -1.4168 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1122 3.4901 0.0114 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2190 4.5481 -2.1753 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1745 0.0405 -0.6256 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3511 2.7821 2.2056 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1943 -0.5757 2.3765 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6537 -4.0741 1.9120 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3353 -5.4730 -1.1514 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6300 -4.6483 2.8101 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 6 12 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 6 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 6 23 28 1 0 28 29 2 0 29 30 1 0 30 31 2 0 30 32 1 0 32 33 1 0 14 34 1 0 5 35 1 0 35 36 1 0 36 37 2 0 36 38 1 0 4 39 1 0 39 40 1 0 3 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 53 56 1 0 52 57 1 0 51 58 1 0 50 59 1 0 46 60 1 0 45 61 1 0 44 62 1 0 43 63 1 0 7 2 1 0 34 9 1 0 60 42 1 0 18 12 1 0 26 21 1 0 33 28 1 0 56 49 1 0 26 17 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 6 3 68 1 1 4 69 1 6 5 70 1 6 6 71 1 1 9 72 1 1 10 73 1 0 10 74 1 0 11 75 1 0 11 76 1 0 13 77 1 0 13 78 1 0 13 79 1 0 14 80 1 1 15 81 1 0 15 82 1 0 16 83 1 0 16 84 1 0 17 85 1 6 18 86 1 1 19 87 1 0 19 88 1 0 20 89 1 0 20 90 1 0 22 91 1 0 22 92 1 0 22 93 1 0 23 94 1 1 24 95 1 0 24 96 1 0 25 97 1 0 25 98 1 0 27 99 1 0 29100 1 0 33101 1 0 33102 1 0 34103 1 0 34104 1 0 38105 1 0 38106 1 0 38107 1 0 40108 1 0 40109 1 0 40110 1 0 42111 1 1 43112 1 1 44113 1 1 45114 1 6 46115 1 1 47116 1 0 47117 1 0 49118 1 6 50119 1 1 51120 1 1 52121 1 1 53122 1 6 54123 1 0 54124 1 0 55125 1 0 57126 1 0 58127 1 0 59128 1 0 61129 1 0 62130 1 0 63131 1 0 M END

Standard InCHIKey	ILSCMGXPNCDKNU-WCHWCZMCSA-N
Standard InCHI	InChI=1S/C44H68O19/c1-19-36(63-40-35(53)33(51)31(49)28(62-40)18-57-39-34(52)32(50)30(48)27(16-45)61-39)37(55-5)38(59-20(2)46)41(58-19)60-23-8-11-42(3)22(15-23)6-7-26-25(42)9-12-43(4)24(10-13-44(26,43)54)21-14-29(47)56-17-21/h14,19,22-28,30-41,45,48-54H,6-13,15-18H2,1-5H3/t19-,22-,23-,24+,25-,26+,27+,28-,30+,31-,32-,33+,34+,35-,36-,37+,38-,39+,40+,41-,42-,43+,44-/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@H](CC[C@]32O)C2=CC(=O)OC2)C1)OC(=O)C)OC)O[C@@H]1[C@H]([C@@H]([C@H]([C@H](CO[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	900.44	Volume:	860.233 ? Van der Waals volume.
Dense:	1.047	LogP:	0.292 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.937 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.594 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	45.0
TPSA:	279.05 ? Topological Polar Surface Area.	H-Bond Acceptor:	19.0
H-Bond Donor:	8.0	Rings:	8.0
Heavy Atoms:	19.0

MedChem Properties

QED Drug-Likeness Score:	0.094	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.166	Fsp³:	0.909
MCE-18:	156.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.791	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.007 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.18	Promiscuous compounds:	0.385

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.157	MDCK Permeability:	-5.238
Pgp-inhibitor:	0.002	Pgp-substrate:	0.732
PAMPA:	0.999 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.433
20% Bioavailability (F20%):	0.223	30% Bioavailability (F30%):	0.986
50% Bioavailability (F50%):	0.991

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	0.111
Plasma Protein Binding (PPB):	56.595%	Volume Distribution (VD):	-0.493
Fu:	38.579% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.016
BSEP inhibitor:	0.087

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.036	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.273	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.115
HLM stability:	0.003 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.261

Half-life (T1/2):

3.639

ADMET: Toxicity

hERG Blockers:	0.01	hERG Blockers (10um):	0.065
Human Hepatotoxicity (H-HT):	0.716	Drug-induced Liver Injury (DILI):	0.99
AMES Toxicity:	0.983	Rat Oral Acute Toxicity:	0.348
Maximum Recommended Daily Dose:	0.965	Skin Sensitization:	1.0
Carcinogencity:	0.559	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.281
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.993
Hematotoxicity:	0.902	Drug-induced Nephrotoxicity:	0.997
Genotoxicity:	0.999	RPMI-8226 Immunitoxicity:	0.849
A549 Cytotoxicity:	0.876	Hek293 Cytotoxicity:	0.965
BCF:	0.5 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.401 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.177 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.197 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8402	Thevetia peruviana	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[26714048]
NPO8402	Thevetia peruviana	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[39027575]
NPO8402	Thevetia peruviana	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8402	Thevetia peruviana	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	4

Activity Type	# Activity
Cell line	1
Non-molecular	2
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1312	Cell line	SW1990	Homo sapiens	IC50	>	10000.0	nM	PMID[26714048]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	>	10000.0	nM	PMID[26714048]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	10000.0	nM	PMID[26714048]
NPT27	Others	Unspecified	n.a.	IC50	>	10000.0	nM	PMID[26714048]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC486134 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	15732
0.1-0.2	28599
0.2-0.3	4034
0.3-0.4	1253
0.4-0.5	99
0.5-0.6	55
0.6-0.7	50
0.7-0.8	0
0.8-0.85	11
0.85-0.9	1
0.9-0.95	1
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC486141
0.9213	High Similarity	NPC486146
0.8842	High Similarity	NPC486150
0.8421	Intermediate Similarity	NPC486144
0.8421	Intermediate Similarity	NPC486145
0.8421	Intermediate Similarity	NPC486147
0.8421	Intermediate Similarity	NPC486148
0.8333	Intermediate Similarity	NPC30483
0.8333	Intermediate Similarity	NPC470897
0.8283	Intermediate Similarity	NPC488947
0.8247	Intermediate Similarity	NPC475419
0.8163	Intermediate Similarity	NPC474908
0.8105	Intermediate Similarity	NPC486138
0.8105	Intermediate Similarity	NPC276838
0.7921	Intermediate Similarity	NPC474423
0.7857	Intermediate Similarity	NPC479358
0.7789	Intermediate Similarity	NPC486143
0.7789	Intermediate Similarity	NPC486142
0.7789	Intermediate Similarity	NPC486149
0.7677	Intermediate Similarity	NPC475590
0.7576	Intermediate Similarity	NPC488938
0.7576	Intermediate Similarity	NPC488937
0.7556	Intermediate Similarity	NPC5311
0.75	Intermediate Similarity	NPC486136
0.7474	Intermediate Similarity	NPC292467
0.7228	Intermediate Similarity	NPC479360
0.7228	Intermediate Similarity	NPC479359
0.7184	Intermediate Similarity	NPC120390
0.7143	Intermediate Similarity	NPC488945
0.7143	Intermediate Similarity	NPC488946
0.7113	Intermediate Similarity	NPC236973
0.71	Intermediate Similarity	NPC488939
0.7019	Intermediate Similarity	NPC74259
0.69	Remote Similarity	NPC486135
0.69	Remote Similarity	NPC486137
0.6832	Remote Similarity	NPC232785
0.6832	Remote Similarity	NPC486139
0.6774	Remote Similarity	NPC99620
0.6731	Remote Similarity	NPC486128
0.6636	Remote Similarity	NPC194716
0.6635	Remote Similarity	NPC479357
0.6635	Remote Similarity	NPC486131
0.6634	Remote Similarity	NPC231518
0.6634	Remote Similarity	NPC488944
0.6632	Remote Similarity	NPC77299
0.6632	Remote Similarity	NPC480906
0.6602	Remote Similarity	NPC329986
0.6602	Remote Similarity	NPC140092
0.6598	Remote Similarity	NPC93883
0.6571	Remote Similarity	NPC488943
0.6571	Remote Similarity	NPC488942
0.6562	Remote Similarity	NPC480914
0.6373	Remote Similarity	NPC240070
0.63	Remote Similarity	NPC480907
0.6275	Remote Similarity	NPC32177
0.6275	Remote Similarity	NPC469756
0.6275	Remote Similarity	NPC275901
0.6273	Remote Similarity	NPC486133
0.6224	Remote Similarity	NPC76572
0.6224	Remote Similarity	NPC193382
0.6214	Remote Similarity	NPC188234
0.6214	Remote Similarity	NPC480910
0.6214	Remote Similarity	NPC480909
0.6154	Remote Similarity	NPC475629
0.6154	Remote Similarity	NPC486127
0.6095	Remote Similarity	NPC125077
0.6082	Remote Similarity	NPC471633
0.6061	Remote Similarity	NPC199428
0.6061	Remote Similarity	NPC84949
0.6061	Remote Similarity	NPC109448
0.6061	Remote Similarity	NPC480562
0.6061	Remote Similarity	NPC74945
0.6061	Remote Similarity	NPC310341
0.6061	Remote Similarity	NPC31354
0.6061	Remote Similarity	NPC69576
0.6058	Remote Similarity	NPC479353
0.6058	Remote Similarity	NPC479354
0.6058	Remote Similarity	NPC486130
0.6036	Remote Similarity	NPC117445
0.6036	Remote Similarity	NPC308262
0.6	Remote Similarity	NPC488941
0.6	Remote Similarity	NPC488940
0.6	Remote Similarity	NPC486152
0.5981	Remote Similarity	NPC146857
0.5981	Remote Similarity	NPC247190
0.598	Remote Similarity	NPC72260
0.596	Remote Similarity	NPC469750
0.5943	Remote Similarity	NPC208193
0.5913	Remote Similarity	NPC286809
0.5872	Remote Similarity	NPC475219
0.5859	Remote Similarity	NPC84987
0.5849	Remote Similarity	NPC610296
0.5784	Remote Similarity	NPC484202
0.5727	Remote Similarity	NPC486132
0.57	Remote Similarity	NPC196429
0.5648	Remote Similarity	NPC55532
0.5614	Remote Similarity	NPC329675
0.5607	Remote Similarity	NPC32793
0.5607	Remote Similarity	NPC116075
0.5514	Remote Similarity	NPC40749
0.5481	Remote Similarity	NPC483822
0.5481	Remote Similarity	NPC305574
0.5478	Remote Similarity	NPC486140
0.5463	Remote Similarity	NPC475556
0.5463	Remote Similarity	NPC311706
0.5455	Remote Similarity	NPC469749
0.534	Remote Similarity	NPC157376
0.534	Remote Similarity	NPC17896
0.534	Remote Similarity	NPC469755
0.534	Remote Similarity	NPC284406
0.534	Remote Similarity	NPC197707
0.534	Remote Similarity	NPC251866
0.534	Remote Similarity	NPC142066
0.534	Remote Similarity	NPC480915
0.534	Remote Similarity	NPC603972
0.5333	Remote Similarity	NPC471353
0.5327	Remote Similarity	NPC488935
0.5327	Remote Similarity	NPC488936
0.5299	Remote Similarity	NPC329784
0.5294	Remote Similarity	NPC99728
0.5294	Remote Similarity	NPC87250
0.5294	Remote Similarity	NPC244402
0.5294	Remote Similarity	NPC50305
0.5238	Remote Similarity	NPC250556
0.5175	Remote Similarity	NPC476221
0.5175	Remote Similarity	NPC477709
0.5143	Remote Similarity	NPC243196
0.5048	Remote Similarity	NPC479356
0.5048	Remote Similarity	NPC479355
0.5048	Remote Similarity	NPC99080
0.5047	Remote Similarity	NPC179412
0.5047	Remote Similarity	NPC471356
0.5046	Remote Similarity	NPC103534
0.5046	Remote Similarity	NPC44899
0.5046	Remote Similarity	NPC173555
0.5046	Remote Similarity	NPC5883
0.5046	Remote Similarity	NPC304260
0.5046	Remote Similarity	NPC29639

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC486134 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6393
0.1-0.2	2657
0.2-0.3	79
0.3-0.4	7
0.4-0.5	6
0.5-0.6	7
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6634	Remote Similarity	NPD8033	Approved
0.598	Remote Similarity	NPD8294	Phase 4
0.5794	Remote Similarity	NPD8377	Phase 4
0.534	Remote Similarity	NPD7319	Approved
0.5238	Remote Similarity	NPD7507	Pre-clinical
0.5094	Remote Similarity	NPD8335	Phase 4
0.5047	Remote Similarity	NPD8380	Approved
0.5046	Remote Similarity	NPD8296	Phase 4

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data