NPASS Compound

Natural Product: NPC479358

Natural Product ID	NPC479358
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	HJHDSFDATQMYRD-RMIFSNECSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 133140 0 0 0 0 0 0 0 0999 V2000 -2.5868 -2.8217 -1.1498 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9824 -1.7785 -0.2281 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8127 -1.7529 1.0369 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.8082 -1.5002 2.1837 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8646 -0.4637 1.6061 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0735 -1.2731 0.7253 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6960 -2.2054 0.0544 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7874 -0.5547 -0.1524 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1707 -0.5719 -0.0001 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9354 -1.2591 -1.0602 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5396 -0.3660 -2.0863 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2767 0.8267 -1.5531 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3567 1.7659 -2.7734 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5531 1.5564 -0.4526 C 0 0 2 0 0 0 0 0 0 0 0 0 4.5171 2.3010 0.4614 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7871 2.7505 -0.1488 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4790 1.7910 -1.0707 C 0 0 2 0 0 0 0 0 0 0 0 0 5.6886 0.5291 -1.1333 C 0 0 2 0 0 0 0 0 0 0 0 0 6.3784 -0.5638 -1.8732 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6365 -0.8581 -1.0741 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5690 0.3250 -0.9775 C 0 0 2 0 0 0 0 0 0 0 0 0 9.3237 0.3544 -2.2926 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4033 0.0828 0.2285 C 0 0 2 0 0 0 0 0 0 0 0 0 9.7485 1.4826 0.6781 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3306 2.0955 0.6246 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9207 1.6509 -0.7665 C 0 0 2 0 0 0 0 0 0 0 0 0 8.6269 2.5779 -1.5939 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5344 -0.8413 0.1733 C 0 0 2 0 0 0 0 0 0 0 0 0 11.0776 -0.9348 1.6291 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1059 0.1108 1.6417 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7872 0.4849 2.6224 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2219 0.6519 0.3512 O 0 0 0 0 0 0 0 0 0 0 0 0 11.7803 -0.4145 -0.5124 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5843 0.7984 0.3530 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2030 0.3216 2.5474 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3245 1.7023 2.6176 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0763 2.2215 1.7697 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3585 2.5606 3.6008 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1323 -2.7145 2.3072 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2170 -3.2560 3.5656 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7321 -0.7348 1.0929 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0652 -1.1841 1.2390 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.6293 -0.7286 2.5691 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0567 -1.2173 2.6506 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.5983 -1.6919 1.3204 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.1403 -0.7084 0.2664 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6728 0.6703 0.4583 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0406 0.7970 0.5087 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7245 0.4202 -0.6205 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.7951 -0.5707 -0.2580 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.1249 -0.1697 -0.8497 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.9880 0.2434 -2.2843 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.7764 1.1403 -2.4638 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.2166 2.3105 -3.3307 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1789 3.1989 -3.5698 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3106 1.5664 -1.2283 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8020 -0.9141 -3.0652 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.6501 0.8560 -0.0864 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.4481 -1.8594 -0.6979 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7557 -0.6255 0.2083 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2262 -2.9705 0.9981 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8510 -0.2091 3.2146 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9647 -1.3339 3.6393 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6093 -2.5254 -1.4576 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9683 -2.7922 -2.0965 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5324 -3.8433 -0.7187 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0275 -0.8256 -0.7805 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2819 -2.7475 1.1412 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2897 -1.1762 3.1014 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4788 0.2272 0.9912 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6836 -1.8636 1.4632 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3039 -1.2399 0.9259 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3370 -2.0185 -1.6193 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7715 -1.8831 -0.6202 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1400 -0.9858 -2.7741 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6664 -0.0342 -2.7407 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3701 1.7783 -3.2961 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4954 2.7943 -2.4033 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1457 1.5104 -3.4672 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9876 2.3909 -0.9681 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6593 1.7583 1.4231 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9600 3.2324 0.7840 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4594 2.9951 0.7462 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6991 3.7795 -0.6261 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3994 2.2518 -2.1041 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6095 0.1676 -0.0572 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7986 -1.5097 -1.8137 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5768 -0.3614 -2.9237 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1691 -1.6814 -1.5587 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3333 -1.1880 -0.0670 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0258 1.2088 -2.3727 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7095 -0.6149 -2.6075 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5457 0.6029 -3.0917 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7048 -0.3024 1.0434 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1516 1.5510 1.6955 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3568 1.9798 -0.1029 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4182 3.2048 0.6977 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7795 1.6145 1.4309 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2201 2.6347 -2.4761 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2105 -1.8671 -0.0521 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2635 -0.7019 2.3330 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4839 -1.9535 1.8051 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5246 -1.2576 -0.3698 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7447 -0.1444 -1.5508 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0077 0.7892 1.4204 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6774 1.4751 0.5240 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7876 3.4275 3.0332 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1730 2.0433 4.1433 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4156 2.9444 4.3076 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2568 -3.4590 3.8705 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6536 -4.2257 3.5659 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7425 -2.6186 4.3424 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0079 -2.2842 1.2328 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4967 0.3440 2.6914 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1694 -2.1049 3.3405 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6949 -1.6233 1.3970 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4844 -1.0925 -0.7151 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2733 1.1858 1.3573 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2615 1.2825 -0.4015 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0164 0.0498 -1.3950 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9483 -0.6559 0.8515 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7841 -1.0639 -0.8217 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9240 0.7747 -2.5710 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9924 0.5986 -3.0331 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1204 2.7945 -2.9206 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5114 1.8677 -4.3043 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2440 4.0156 -3.0121 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8703 -0.6424 -4.0326 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3769 0.4754 0.4768 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0617 -1.7616 -1.6177 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9601 -2.9842 0.0288 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7380 -0.5345 3.4952 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2582 -2.2785 3.6917 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 6 12 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 6 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 6 23 28 1 0 28 29 1 0 29 30 1 0 30 31 2 0 30 32 1 0 32 33 1 0 14 34 1 0 5 35 1 0 35 36 1 0 36 37 2 0 36 38 1 0 4 39 1 0 39 40 1 0 3 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 53 56 1 0 52 57 1 0 51 58 1 0 50 59 1 0 46 60 1 0 45 61 1 0 44 62 1 0 43 63 1 0 7 2 1 0 34 9 1 0 60 42 1 0 18 12 1 0 26 21 1 0 33 28 1 0 56 49 1 0 26 17 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 6 3 68 1 1 4 69 1 1 5 70 1 6 6 71 1 1 9 72 1 1 10 73 1 0 10 74 1 0 11 75 1 0 11 76 1 0 13 77 1 0 13 78 1 0 13 79 1 0 14 80 1 6 15 81 1 0 15 82 1 0 16 83 1 0 16 84 1 0 17 85 1 6 18 86 1 1 19 87 1 0 19 88 1 0 20 89 1 0 20 90 1 0 22 91 1 0 22 92 1 0 22 93 1 0 23 94 1 1 24 95 1 0 24 96 1 0 25 97 1 0 25 98 1 0 27 99 1 0 28100 1 6 29101 1 0 29102 1 0 33103 1 0 33104 1 0 34105 1 0 34106 1 0 38107 1 0 38108 1 0 38109 1 0 40110 1 0 40111 1 0 40112 1 0 42113 1 6 43114 1 1 44115 1 1 45116 1 1 46117 1 6 47118 1 0 47119 1 0 49120 1 6 50121 1 1 51122 1 6 52123 1 6 53124 1 6 54125 1 0 54126 1 0 55127 1 0 57128 1 0 58129 1 0 59130 1 0 61131 1 0 62132 1 0 63133 1 0 M END

Standard InCHIKey	HJHDSFDATQMYRD-RMIFSNECSA-N
Standard InCHI	InChI=1S/C44H70O19/c1-19-36(63-40-35(53)33(51)31(49)28(62-40)18-57-39-34(52)32(50)30(48)27(16-45)61-39)37(55-5)38(59-20(2)46)41(58-19)60-23-8-11-42(3)22(15-23)6-7-26-25(42)9-12-43(4)24(10-13-44(26,43)54)21-14-29(47)56-17-21/h19,21-28,30-41,45,48-54H,6-18H2,1-5H3/t19-,21+,22+,23-,24+,25-,26+,27+,28+,30+,31+,32-,33-,34+,35+,36-,37+,38+,39+,40-,41-,42-,43+,44-/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]1CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@H](CC[C@]32O)[C@@H]2CC(=O)OC2)C1)OC(=O)C)OC)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	902.45	Volume:	862.87 ? Van der Waals volume.
Dense:	1.046	LogP:	0.482 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.357 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.993 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	45.0
TPSA:	279.05 ? Topological Polar Surface Area.	H-Bond Acceptor:	19.0
H-Bond Donor:	8.0	Rings:	8.0
Heavy Atoms:	19.0

MedChem Properties

QED Drug-Likeness Score:	0.095	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.203	Fsp³:	0.955
MCE-18:	157.581 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.664	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.267	Promiscuous compounds:	0.528

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.943	MDCK Permeability:	-5.136
Pgp-inhibitor:	0.004	Pgp-substrate:	0.962
PAMPA:	0.996 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.257
20% Bioavailability (F20%):	0.387	30% Bioavailability (F30%):	0.998
50% Bioavailability (F50%):	0.996

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.256
Plasma Protein Binding (PPB):	54.014%	Volume Distribution (VD):	-0.576
Fu:	44.425% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.013
BSEP inhibitor:	0.002

ADMET: Metabolism

CYP1A2-inhibitor:	0.928	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.12	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.582	CYP3A4-substrate:	0.002
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.196
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.8

Half-life (T1/2):

3.925

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.016
Human Hepatotoxicity (H-HT):	0.574	Drug-induced Liver Injury (DILI):	0.973
AMES Toxicity:	0.966	Rat Oral Acute Toxicity:	0.002
Maximum Recommended Daily Dose:	0.003	Skin Sensitization:	1.0
Carcinogencity:	0.239	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.999
Hematotoxicity:	0.575	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.179	RPMI-8226 Immunitoxicity:	0.144
A549 Cytotoxicity:	0.324	Hek293 Cytotoxicity:	0.137
BCF:	0.525 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.22 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.679 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.743 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40948	Vallaris glabra	Species	n.a.	n.a.	Leaves	n.a.	n.a.	PMID[29072457]
NPO40948	Vallaris glabra	Species	n.a.	n.a.	Stems	n.a.	n.a.	PMID[31820973]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	4

Activity Type	# Activity
Cell line	4

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT139	Cell line	HT-29	Homo sapiens	IC50	>	10000.0	nM	PMID[31820973]
NPT91	Cell line	KB	Homo sapiens	IC50	>	10000.0	nM	PMID[31820973]
NPT165	Cell line	HeLa	Homo sapiens	IC50	>	10000.0	nM	PMID[31820973]
NPT189	Cell line	Vero	Chlorocebus aethiops	IC50	>	10000.0	nM	PMID[31820973]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC479358 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20496
0.1-0.2	24797
0.2-0.3	3379
0.3-0.4	1006
0.4-0.5	125
0.5-0.6	26
0.6-0.7	19
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.828	Intermediate Similarity	NPC479357
0.7857	Intermediate Similarity	NPC486134
0.7857	Intermediate Similarity	NPC486141
0.7634	Intermediate Similarity	NPC479353
0.7634	Intermediate Similarity	NPC479354
0.7282	Intermediate Similarity	NPC488947
0.7143	Intermediate Similarity	NPC486146
0.6923	Remote Similarity	NPC486150
0.6602	Remote Similarity	NPC488938
0.6602	Remote Similarity	NPC488937
0.6538	Remote Similarity	NPC486144
0.6538	Remote Similarity	NPC486145
0.6538	Remote Similarity	NPC486147
0.6538	Remote Similarity	NPC486148
0.6471	Remote Similarity	NPC488939
0.6415	Remote Similarity	NPC475419
0.6364	Remote Similarity	NPC30483
0.6364	Remote Similarity	NPC470897
0.6355	Remote Similarity	NPC474908
0.6286	Remote Similarity	NPC479360
0.6286	Remote Similarity	NPC479359
0.625	Remote Similarity	NPC486138
0.625	Remote Similarity	NPC276838
0.6239	Remote Similarity	NPC488945
0.6239	Remote Similarity	NPC488946
0.6182	Remote Similarity	NPC474423
0.5962	Remote Similarity	NPC486143
0.5962	Remote Similarity	NPC486142
0.5962	Remote Similarity	NPC486149
0.5938	Remote Similarity	NPC479351
0.5938	Remote Similarity	NPC479352
0.5926	Remote Similarity	NPC475590
0.578	Remote Similarity	NPC486136
0.5714	Remote Similarity	NPC231518
0.5714	Remote Similarity	NPC488944
0.5688	Remote Similarity	NPC488943
0.5688	Remote Similarity	NPC488942
0.5673	Remote Similarity	NPC292467
0.5657	Remote Similarity	NPC5311
0.5536	Remote Similarity	NPC120390
0.5421	Remote Similarity	NPC488941
0.5421	Remote Similarity	NPC488940
0.5398	Remote Similarity	NPC74259
0.5377	Remote Similarity	NPC236973
0.5229	Remote Similarity	NPC486135
0.5229	Remote Similarity	NPC486137
0.5182	Remote Similarity	NPC232785
0.5182	Remote Similarity	NPC486139
0.5133	Remote Similarity	NPC486128
0.5086	Remote Similarity	NPC194716
0.5044	Remote Similarity	NPC475219
0.5044	Remote Similarity	NPC486131

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC479358 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6946
0.1-0.2	2118
0.2-0.3	68
0.3-0.4	13
0.4-0.5	4
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5714	Remote Similarity	NPD8033	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data