NPASS Compound

Natural Product: NPC486148

Natural Product ID	NPC486148
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	GZVMBXDQUQRICT-SONXKMIKSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001125] Steroid lactones [CHEMONTID:0001555] Cardenolides and derivatives [CHEMONTID:0001559] Cardenolide glycosides and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 126133 0 0 0 0 0 0 0 0999 V2000 1.3982 0.2570 -3.3463 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9955 -0.1863 -2.0525 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9165 0.8116 -1.4077 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2904 1.0795 -0.0131 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8832 1.5755 -0.2487 C 0 0 2 0 0 0 0 0 0 0 0 0 0.1412 0.4347 -0.9067 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0015 -0.6346 -1.1820 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9366 0.1106 -0.1320 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1481 0.1509 -0.7644 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9795 -1.0775 -0.6846 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7571 -1.2148 0.6056 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7650 -0.1136 0.8291 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5745 0.4366 2.2214 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4129 0.9945 -0.1570 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2296 2.2146 -0.0360 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6965 1.9778 0.1399 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0929 0.6638 0.6777 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.1697 -0.4864 0.5533 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7207 -1.5418 1.4954 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9456 -2.1087 0.8262 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9867 -1.0224 0.6193 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.7099 -0.8682 1.9292 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8993 -1.5374 -0.4610 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.5465 -0.8094 -1.7344 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4121 0.1426 -1.4158 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4401 0.2359 0.0771 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.3059 1.2971 0.4245 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.3514 -1.3902 -0.1779 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.1661 -2.4237 -0.0573 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.5070 -1.9553 0.2104 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.5620 -2.6595 0.3899 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.4523 -0.5739 0.2408 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1310 -0.1591 0.0120 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9525 1.2961 -0.1622 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8073 2.6882 -1.0463 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0778 1.9066 0.7385 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5851 1.3019 1.8749 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1777 0.3722 -1.1419 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2178 1.2077 -1.5337 C 0 0 2 0 0 0 0 0 0 0 0 0 6.0864 0.6861 -2.6091 C 0 0 2 0 0 0 0 0 0 0 0 0 7.1438 1.7675 -2.8848 C 0 0 1 0 0 0 0 0 0 0 0 0 8.0086 1.9602 -1.6544 C 0 0 2 0 0 0 0 0 0 0 0 0 7.2364 1.6646 -0.3886 C 0 0 2 0 0 0 0 0 0 0 0 0 7.7314 0.4219 0.3013 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1197 0.4211 0.4281 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6226 -0.7084 1.0298 C 0 0 1 0 0 0 0 0 0 0 0 0 10.6966 -1.2964 0.1576 C 0 0 1 0 0 0 0 0 0 0 0 0 11.9529 -1.5675 0.9579 C 0 0 2 0 0 0 0 0 0 0 0 0 11.5925 -2.2206 2.2785 C 0 0 1 0 0 0 0 0 0 0 0 0 10.5326 -1.4437 3.0124 C 0 0 1 0 0 0 0 0 0 0 0 0 10.9740 -1.0454 4.3877 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4076 -2.1778 5.1141 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1061 -0.3299 2.2896 O 0 0 0 0 0 0 0 0 0 0 0 0 11.2810 -3.5659 2.1412 O 0 0 0 0 0 0 0 0 0 0 0 0 12.6681 -0.4016 1.1370 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1909 -2.4438 -0.4447 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9033 1.6737 -0.4760 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6126 3.2131 -1.6419 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9054 1.4523 -4.0057 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4106 0.5556 -3.8418 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0633 1.2921 -3.3878 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0464 -0.0137 -4.2327 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4732 -0.3740 -3.5035 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6288 -1.0877 -2.2919 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8373 1.7681 -1.9606 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2311 0.0908 0.4694 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4550 1.7973 0.7526 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2604 0.7206 -1.9244 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0075 0.4083 -1.8577 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6167 -1.1565 -1.5901 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3549 -2.0234 -0.7287 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9984 -1.2157 1.4202 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2051 -2.2164 0.5938 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7566 1.5021 2.3291 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3049 -0.0701 2.9209 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5753 0.1223 2.6426 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6405 0.5261 -1.1642 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8592 2.8370 0.8041 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0472 2.8384 -0.9463 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1431 2.7800 0.7685 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1702 2.1159 -0.8664 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3383 0.7654 1.7829 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1920 -0.9609 -0.4640 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0257 -1.0267 2.4363 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0386 -2.3564 1.6964 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4171 -2.9199 1.3823 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6259 -2.4324 -0.2070 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8466 0.1961 2.2158 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1365 -1.3561 2.7423 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6579 -1.4353 1.8474 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6679 -2.6228 -0.6886 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4064 -0.2298 -2.1453 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2060 -1.4716 -2.5524 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4512 -0.1459 -1.8318 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6655 1.1524 -1.8480 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0022 1.7671 1.2408 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.9069 -3.4865 -0.1372 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1443 0.4940 -0.9070 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7957 0.4395 0.8904 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7882 2.2075 -0.7529 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6320 1.5076 0.8775 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1282 2.7898 -1.3461 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2166 0.4137 1.6534 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2893 2.0497 2.3332 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8121 1.1038 2.6448 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6740 2.1040 -1.9880 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6589 -0.2321 -2.3786 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6709 2.7523 -3.0801 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8180 1.2051 -1.7215 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5288 2.5124 0.3154 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2774 0.4186 1.3357 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4017 -0.5184 -0.1540 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7726 -1.3838 1.2400 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9288 -0.5789 -0.6623 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5766 -2.2682 0.3701 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5213 -2.1757 2.9117 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6529 -2.1055 3.1340 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1252 -0.5948 4.9708 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7896 -0.2894 4.3913 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6691 -2.8366 5.0422 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3188 -3.6700 1.9299 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1940 0.3285 0.6683 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4651 -2.1292 -1.0592 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2387 3.8274 -0.9694 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1159 2.2511 -4.5446 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7382 1.2917 -3.8545 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 1 12 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 1 21 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 6 23 28 1 0 28 29 2 0 29 30 1 0 30 31 2 0 30 32 1 0 32 33 1 0 14 34 1 0 5 35 1 0 4 36 1 0 36 37 1 0 3 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 50 53 1 0 49 54 1 0 48 55 1 0 47 56 1 0 43 57 1 0 42 58 1 0 41 59 1 0 40 60 1 0 7 2 1 0 34 9 1 0 57 39 1 0 18 12 1 0 26 21 1 0 33 28 1 0 53 46 1 0 26 17 1 0 1 61 1 0 1 62 1 0 1 63 1 0 2 64 1 6 3 65 1 6 4 66 1 1 5 67 1 1 6 68 1 6 9 69 1 6 10 70 1 0 10 71 1 0 11 72 1 0 11 73 1 0 13 74 1 0 13 75 1 0 13 76 1 0 14 77 1 6 15 78 1 0 15 79 1 0 16 80 1 0 16 81 1 0 17 82 1 1 18 83 1 6 19 84 1 0 19 85 1 0 20 86 1 0 20 87 1 0 22 88 1 0 22 89 1 0 22 90 1 0 23 91 1 6 24 92 1 0 24 93 1 0 25 94 1 0 25 95 1 0 27 96 1 0 29 97 1 0 33 98 1 0 33 99 1 0 34100 1 0 34101 1 0 35102 1 0 37103 1 0 37104 1 0 37105 1 0 39106 1 6 40107 1 1 41108 1 6 42109 1 6 43110 1 1 44111 1 0 44112 1 0 46113 1 1 47114 1 6 48115 1 6 49116 1 1 50117 1 1 51118 1 0 51119 1 0 52120 1 0 54121 1 0 55122 1 0 56123 1 0 58124 1 0 59125 1 0 60126 1 0 M END

Standard InCHIKey	GZVMBXDQUQRICT-SONXKMIKSA-N
Standard InCHI	InChI=1S/C42H66O18/c1-18-35(60-38-33(50)31(48)29(46)26(59-38)17-55-37-32(49)30(47)28(45)25(15-43)58-37)36(53-4)34(51)39(56-18)57-21-7-10-40(2)20(14-21)5-6-24-23(40)8-11-41(3)22(9-12-42(24,41)52)19-13-27(44)54-16-19/h13,18,20-26,28-39,43,45-52H,5-12,14-17H2,1-4H3/t18-,20-,21-,22+,23-,24+,25+,26-,28+,29-,30-,31+,32+,33-,34+,35-,36-,37+,38+,39-,40-,41+,42-/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@H](CC[C@]32O)C2=CC(=O)OC2)C1)O)OC)O[C@@H]1[C@H]([C@@H]([C@H]([C@H](CO[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	858.42	Volume:	819.487 ? Van der Waals volume.
Dense:	1.048	LogP:	0.118 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.813 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.597 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	44.0
TPSA:	272.98 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	9.0	Rings:	8.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.092	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.089	Fsp³:	0.929
MCE-18:	154.815 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.692	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.009 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.177	Promiscuous compounds:	0.275

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.361	MDCK Permeability:	-5.236
Pgp-inhibitor:	0.0	Pgp-substrate:	0.795
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.454
20% Bioavailability (F20%):	0.158	30% Bioavailability (F30%):	0.934
50% Bioavailability (F50%):	0.976

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.039
Plasma Protein Binding (PPB):	59.541%	Volume Distribution (VD):	-0.447
Fu:	33.868% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.008
BSEP inhibitor:	0.069

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.019	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.022	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.004
HLM stability:	0.015 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.193

Half-life (T1/2):

3.91

ADMET: Toxicity

hERG Blockers:	0.016	hERG Blockers (10um):	0.097
Human Hepatotoxicity (H-HT):	0.696	Drug-induced Liver Injury (DILI):	0.973
AMES Toxicity:	0.973	Rat Oral Acute Toxicity:	0.3
Maximum Recommended Daily Dose:	0.956	Skin Sensitization:	1.0
Carcinogencity:	0.388	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.286
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.996
Hematotoxicity:	0.84	Drug-induced Nephrotoxicity:	0.995
Genotoxicity:	0.997	RPMI-8226 Immunitoxicity:	0.851
A549 Cytotoxicity:	0.771	Hek293 Cytotoxicity:	0.956
BCF:	0.816 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.359 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.854 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.967 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8402	Thevetia peruviana	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[26714048]
NPO8402	Thevetia peruviana	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[39027575]
NPO8402	Thevetia peruviana	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8402	Thevetia peruviana	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	4

Activity Type	# Activity
Cell line	1
Non-molecular	2
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1312	Cell line	SW1990	Homo sapiens	IC50	>	10000.0	nM	PMID[26714048]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	10000.0	nM	PMID[26714048]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	6560.0	nM	PMID[26714048]
NPT27	Others	Unspecified	n.a.	IC50	>	10000.0	nM	PMID[26714048]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC486148 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	15141
0.1-0.2	29441
0.2-0.3	3919
0.3-0.4	1107
0.4-0.5	111
0.5-0.6	43
0.6-0.7	47
0.7-0.8	1
0.8-0.85	12
0.85-0.9	6
0.9-0.95	4
0.95-1	3

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC486144
1.0	High Similarity	NPC486145
1.0	High Similarity	NPC486147
0.9302	High Similarity	NPC486143
0.9302	High Similarity	NPC486142
0.9302	High Similarity	NPC486149
0.914	High Similarity	NPC474423
0.8901	High Similarity	NPC486136
0.8837	High Similarity	NPC30483
0.8837	High Similarity	NPC470897
0.871	High Similarity	NPC475419
0.8587	High Similarity	NPC479360
0.8587	High Similarity	NPC479359
0.8421	Intermediate Similarity	NPC486134
0.8421	Intermediate Similarity	NPC486141
0.8316	Intermediate Similarity	NPC120390
0.8242	Intermediate Similarity	NPC486135
0.8242	Intermediate Similarity	NPC486137
0.8229	Intermediate Similarity	NPC474908
0.8152	Intermediate Similarity	NPC232785
0.8152	Intermediate Similarity	NPC486139
0.8105	Intermediate Similarity	NPC475590
0.8061	Intermediate Similarity	NPC488945
0.8061	Intermediate Similarity	NPC488946
0.8023	Intermediate Similarity	NPC5311
0.7935	Intermediate Similarity	NPC231518
0.7935	Intermediate Similarity	NPC488944
0.7912	Intermediate Similarity	NPC236973
0.7895	Intermediate Similarity	NPC479357
0.7895	Intermediate Similarity	NPC486131
0.7812	Intermediate Similarity	NPC486128
0.7684	Intermediate Similarity	NPC486146
0.7449	Intermediate Similarity	NPC488943
0.7449	Intermediate Similarity	NPC488942
0.7426	Intermediate Similarity	NPC486133
0.7426	Intermediate Similarity	NPC486150
0.7368	Intermediate Similarity	NPC475629
0.734	Intermediate Similarity	NPC292467
0.7263	Intermediate Similarity	NPC479353
0.7263	Intermediate Similarity	NPC479354
0.7263	Intermediate Similarity	NPC486130
0.7228	Intermediate Similarity	NPC74259
0.7191	Intermediate Similarity	NPC99620
0.7188	Intermediate Similarity	NPC488941
0.7188	Intermediate Similarity	NPC488940
0.7188	Intermediate Similarity	NPC486127
0.7075	Intermediate Similarity	NPC486152
0.7033	Intermediate Similarity	NPC77299
0.7033	Intermediate Similarity	NPC480906
0.6979	Remote Similarity	NPC32177
0.6979	Remote Similarity	NPC469756
0.6979	Remote Similarity	NPC275901
0.697	Remote Similarity	NPC329986
0.697	Remote Similarity	NPC140092
0.6957	Remote Similarity	NPC480914
0.6952	Remote Similarity	NPC488947
0.6907	Remote Similarity	NPC188234
0.6832	Remote Similarity	NPC486132
0.6827	Remote Similarity	NPC194716
0.6735	Remote Similarity	NPC480910
0.6735	Remote Similarity	NPC240070
0.6735	Remote Similarity	NPC480909
0.6733	Remote Similarity	NPC486138
0.6733	Remote Similarity	NPC276838
0.6667	Remote Similarity	NPC480907
0.6596	Remote Similarity	NPC199428
0.6596	Remote Similarity	NPC109448
0.6596	Remote Similarity	NPC76572
0.6596	Remote Similarity	NPC310341
0.6596	Remote Similarity	NPC193382
0.6538	Remote Similarity	NPC479358
0.6509	Remote Similarity	NPC486140
0.6436	Remote Similarity	NPC125077
0.6327	Remote Similarity	NPC72260
0.6316	Remote Similarity	NPC469750
0.6286	Remote Similarity	NPC488938
0.6286	Remote Similarity	NPC488937
0.6277	Remote Similarity	NPC471633
0.6275	Remote Similarity	NPC208193
0.625	Remote Similarity	NPC84949
0.625	Remote Similarity	NPC480562
0.625	Remote Similarity	NPC74945
0.625	Remote Similarity	NPC31354
0.625	Remote Similarity	NPC69576
0.6216	Remote Similarity	NPC286809
0.6211	Remote Similarity	NPC84987
0.6204	Remote Similarity	NPC117445
0.6204	Remote Similarity	NPC308262
0.6154	Remote Similarity	NPC146857
0.6139	Remote Similarity	NPC40749
0.6117	Remote Similarity	NPC55532
0.6078	Remote Similarity	NPC32793
0.6078	Remote Similarity	NPC116075
0.6042	Remote Similarity	NPC196429
0.6019	Remote Similarity	NPC610296
0.6	Remote Similarity	NPC488939
0.596	Remote Similarity	NPC484202
0.596	Remote Similarity	NPC93883
0.596	Remote Similarity	NPC305574
0.5909	Remote Similarity	NPC329675
0.5888	Remote Similarity	NPC475219
0.5769	Remote Similarity	NPC475556
0.5769	Remote Similarity	NPC311706
0.5755	Remote Similarity	NPC469749
0.57	Remote Similarity	NPC250556
0.5657	Remote Similarity	NPC157376
0.5657	Remote Similarity	NPC142066
0.5657	Remote Similarity	NPC603972
0.5644	Remote Similarity	NPC483822
0.5644	Remote Similarity	NPC471353
0.5612	Remote Similarity	NPC99728
0.5612	Remote Similarity	NPC87250
0.5612	Remote Similarity	NPC244402
0.5612	Remote Similarity	NPC50305
0.5575	Remote Similarity	NPC329784
0.5566	Remote Similarity	NPC264336
0.5556	Remote Similarity	NPC247190
0.55	Remote Similarity	NPC479356
0.55	Remote Similarity	NPC17896
0.55	Remote Similarity	NPC469755
0.55	Remote Similarity	NPC284406
0.55	Remote Similarity	NPC479355
0.55	Remote Similarity	NPC197707
0.55	Remote Similarity	NPC251866
0.55	Remote Similarity	NPC480915
0.537	Remote Similarity	NPC59288
0.534	Remote Similarity	NPC179412
0.534	Remote Similarity	NPC471356
0.5333	Remote Similarity	NPC173555
0.5294	Remote Similarity	NPC243196
0.5288	Remote Similarity	NPC193893
0.52	Remote Similarity	NPC158344
0.5196	Remote Similarity	NPC99080
0.5189	Remote Similarity	NPC5883
0.5179	Remote Similarity	NPC476221
0.5179	Remote Similarity	NPC477709
0.5149	Remote Similarity	NPC473852
0.5098	Remote Similarity	NPC219085
0.5096	Remote Similarity	NPC146456

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC486148 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6251
0.1-0.2	2798
0.2-0.3	80
0.3-0.4	5
0.4-0.5	8
0.5-0.6	6
0.6-0.7	1
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7935	Intermediate Similarity	NPD8033	Approved
0.6327	Remote Similarity	NPD8294	Phase 4
0.581	Remote Similarity	NPD8377	Phase 4
0.57	Remote Similarity	NPD7507	Pre-clinical
0.55	Remote Similarity	NPD7319	Approved
0.5392	Remote Similarity	NPD8335	Phase 4
0.5333	Remote Similarity	NPD8296	Phase 4
0.5048	Remote Similarity	NPD8380	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data