NPASS Compound

Natural Product: NPC240070

Natural Product ID	NPC240070
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Antiaroside F
IUPAC Name	[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (3S,5R,8R,9S,10R,13R,14S,17R)-14-hydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-10-carboxylate
Synonyms	Antiaroside F
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1169851
PubChem CID	49799051
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001125] Steroid lactones [CHEMONTID:0001555] Cardenolides and derivatives [CHEMONTID:0001559] Cardenolide glycosides and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 102108 0 0 0 0 0 0 0 0999 V2000 5.7452 0.8212 -0.3831 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4700 -0.2356 -1.2236 C 0 0 1 0 0 0 0 0 0 0 0 0 7.3274 -1.0469 -0.3176 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9158 -2.4805 -0.3303 C 0 0 2 0 0 0 0 0 0 0 0 0 5.4137 -2.5553 -0.0560 C 0 0 2 0 0 0 0 0 0 0 0 0 4.6681 -1.7135 -1.0517 C 0 0 2 0 0 0 0 0 0 0 0 0 5.5311 -0.9880 -1.8598 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8392 -0.8373 -0.3915 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4995 -0.9977 -0.7291 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7546 -1.4356 0.4946 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0182 -0.2661 1.0547 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1083 0.1009 0.1168 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4168 0.2774 -1.2952 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0660 -0.7977 -2.2275 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5754 -0.8663 -2.3369 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1938 -0.5010 -0.9963 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2115 -0.8866 0.0570 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.9212 -1.1370 1.3433 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7130 -2.4342 1.0991 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7205 -2.2595 0.0243 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0908 -2.2057 0.7257 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8271 -3.3852 -0.9616 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7464 -2.7303 -2.0083 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3103 -1.2952 -2.0740 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5704 -1.0071 -0.7899 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.3142 -0.0074 -0.1156 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4683 -4.6100 -0.4195 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6480 -5.0720 -0.7642 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9205 -6.2885 -0.0127 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9678 -7.0151 -0.0815 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8324 -6.5179 0.7958 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8940 -5.5186 0.5791 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9243 0.2589 -1.3400 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6343 1.4209 0.5877 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7838 1.6371 0.9844 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2307 2.5348 0.5919 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2258 3.8041 1.0302 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5271 4.3368 2.2048 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.2600 5.5241 2.7563 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.3895 6.5226 1.6235 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.9927 5.8169 0.4391 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.3335 6.7701 -0.6744 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1412 7.7689 -0.1374 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1818 4.7656 0.0234 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1853 7.6058 1.9843 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4031 6.0417 3.8556 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7332 3.4127 3.2060 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1273 -2.1917 1.2469 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5506 -3.1367 0.7196 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6874 -0.9515 -0.6481 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4134 1.6994 -0.2126 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8429 1.2055 -0.8531 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4894 0.4530 0.6284 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0836 0.3726 -1.9480 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1682 -0.6874 0.7387 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1602 -3.0197 -1.2588 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1225 -3.6134 -0.1942 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0755 -2.4070 -1.7193 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4654 -1.8402 -1.4680 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4417 -1.7939 1.3113 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1057 -2.3126 0.2904 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7138 0.5979 1.0804 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5685 -0.4604 2.0495 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0896 1.2513 -1.7106 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3855 -1.7879 -2.0046 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3016 -0.5268 -3.2438 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8138 -1.8680 -2.6879 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9312 -0.1584 -3.1177 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2398 0.6200 -1.0335 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7966 -1.8886 -0.2681 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2443 -1.3805 2.1919 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6819 -0.4030 1.6278 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9781 -3.2046 0.7943 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1500 -2.7369 2.0779 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9189 -1.5954 1.6466 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8289 -1.6796 0.1105 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3940 -3.2055 1.0631 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8874 -3.6189 -1.4887 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7194 -3.2608 -2.9669 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8085 -2.7422 -1.6538 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6999 -1.1635 -2.9809 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2023 -0.6475 -2.2080 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7362 0.6115 -0.7347 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3683 -4.6842 -1.4773 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9847 -6.0253 0.1243 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5968 -4.9912 1.5136 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3076 1.1236 -0.7939 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2130 0.2677 -2.4079 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2905 3.7095 1.3274 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5277 4.7536 1.9219 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2847 5.2092 3.0456 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6007 6.9026 1.3326 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9520 5.3554 0.7705 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9788 6.1929 -1.3970 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4514 7.1680 -1.1910 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7567 8.0634 -0.8555 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7984 8.4672 1.6850 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0582 6.8706 4.1499 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1201 3.5280 3.9784 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7605 -2.6875 1.8351 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0293 -3.9487 0.4259 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0095 -0.1318 -0.1635 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 1 22 27 1 0 27 28 2 0 28 29 1 0 29 30 2 0 29 31 1 0 31 32 1 0 13 33 1 0 12 34 1 1 34 35 2 0 34 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 41 44 1 0 40 45 1 0 39 46 1 0 38 47 1 0 5 48 1 0 4 49 1 0 3 50 1 0 7 2 1 0 33 9 1 0 44 37 1 0 17 12 1 0 25 20 1 0 32 27 1 0 25 16 1 0 1 51 1 0 1 52 1 0 1 53 1 0 2 54 1 6 3 55 1 1 4 56 1 6 5 57 1 1 6 58 1 6 9 59 1 6 10 60 1 0 10 61 1 0 11 62 1 0 11 63 1 0 13 64 1 6 14 65 1 0 14 66 1 0 15 67 1 0 15 68 1 0 16 69 1 6 17 70 1 6 18 71 1 0 18 72 1 0 19 73 1 0 19 74 1 0 21 75 1 0 21 76 1 0 21 77 1 0 22 78 1 6 23 79 1 0 23 80 1 0 24 81 1 0 24 82 1 0 26 83 1 0 28 84 1 0 32 85 1 0 32 86 1 0 33 87 1 0 33 88 1 0 37 89 1 1 38 90 1 6 39 91 1 1 40 92 1 6 41 93 1 1 42 94 1 0 42 95 1 0 43 96 1 0 45 97 1 0 46 98 1 0 47 99 1 0 48100 1 0 49101 1 0 50102 1 0 M END

Standard InCHIKey	TZDYBTCOMXAYIA-BTBMPPRUSA-N
Standard InCHI	InChI=1S/C35H52O15/c1-15-24(38)26(40)28(42)30(47-15)48-18-5-9-34(32(44)50-31-29(43)27(41)25(39)22(13-36)49-31)17(12-18)3-4-21-20(34)6-8-33(2)19(7-10-35(21,33)45)16-11-23(37)46-14-16/h11,15,17-22,24-31,36,38-43,45H,3-10,12-14H2,1-2H3/t15-,17+,18-,19+,20-,21+,22+,24-,25+,26+,27-,28+,29+,30+,31-,33+,34+,35-/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)O[C@H]1CC[C@]2([C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@H](CC[C@]32O)C2=CC(=O)OC2)C1)C(=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	712.33	Volume:	677.965 ? Van der Waals volume.
Dense:	1.051	LogP:	-0.476 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.611 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-1.872 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	39.0
TPSA:	242.13 ? Topological Polar Surface Area.	H-Bond Acceptor:	15.0
H-Bond Donor:	8.0	Rings:	7.0
Heavy Atoms:	15.0

MedChem Properties

QED Drug-Likeness Score:	0.119	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.714	Fsp³:	0.886
MCE-18:	136.727 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.704	Fluc inhibitor:	0.004 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.015 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.134	Promiscuous compounds:	0.207

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.503	MDCK Permeability:	-5.13
Pgp-inhibitor:	0.0	Pgp-substrate:	0.892
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.661
20% Bioavailability (F20%):	0.248	30% Bioavailability (F30%):	0.99
50% Bioavailability (F50%):	0.994

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.051	MRP1:	0.082
Plasma Protein Binding (PPB):	62.548%	Volume Distribution (VD):	-0.402
Fu:	33.504% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.054
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.755	CYP3A4-substrate:	0.001
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.178
HLM stability:	0.022 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.927

Half-life (T1/2):

5.035

ADMET: Toxicity

hERG Blockers:	0.029	hERG Blockers (10um):	0.11
Human Hepatotoxicity (H-HT):	0.765	Drug-induced Liver Injury (DILI):	0.972
AMES Toxicity:	0.985	Rat Oral Acute Toxicity:	0.579
Maximum Recommended Daily Dose:	0.995	Skin Sensitization:	1.0
Carcinogencity:	0.701	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.713
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.987
Hematotoxicity:	0.912	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	1.0	RPMI-8226 Immunitoxicity:	0.888
A549 Cytotoxicity:	0.863	Hek293 Cytotoxicity:	0.959
BCF:	0.555 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.242 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.713 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.816 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8369	Antiaris toxicaria	Species	Moraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[20553004]
NPO8369	Antiaris toxicaria	Species	Moraceae	Eukaryota	latex	Xishuangbanna Tropical Botanical Garden, Chinese Academy of Sciences, Yunnan Province, China	2011-Mar	PMID[24033101]
NPO8369	Antiaris toxicaria	Species	Moraceae	Eukaryota	trunk bark	Yunnan, China	n.a.	PMID[24582402]
NPO8369	Antiaris toxicaria	Species	Moraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8369	Antiaris toxicaria	Species	Moraceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO8369	Antiaris toxicaria	Species	Moraceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO8369	Antiaris toxicaria	Species	Moraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	4
Ratio	2
ED50	10

Activity Type	# Activity
Cell line	7
Non-molecular	9

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT147	Cell line	SK-MEL-2	Homo sapiens	ED50	=	0.32	ug ml-1	PMID[21907583]
NPT308	Cell line	CAKI-1	Homo sapiens	ED50	=	1.2	ug ml-1	PMID[23634786]
NPT309	Cell line	1A9	Homo sapiens	ED50	=	0.97	ug ml-1	PMID[23634786]
NPT306	Cell line	PC-3	Homo sapiens	ED50	=	0.89	ug ml-1	PMID[24533857]
NPT83	Cell line	MCF7	Homo sapiens	ED50	=	1.3	ug ml-1	PMID[17844993]
NPT81	Cell line	A549	Homo sapiens	ED50	=	0.54	ug ml-1	PMID[17844993]
NPT91	Cell line	KB	Homo sapiens	ED50	=	1.8	ug ml-1	PMID[17850214]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	1.42	uM	PMID[20553004]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	3.17	uM	PMID[20553004]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	140.0	%	PMID[20553004]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	618.0	%	PMID[20553004]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Ratio	=	6.0	n.a.	PMID[20553004]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Ratio	=	5.8	n.a.	PMID[20553004]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	ED50	=	3.4	ug ml-1	PMID[24582402]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	ED50	=	4.5	ug ml-1	PMID[24582402]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	ED50	=	2.2	ug ml-1	PMID[24582402]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC240070 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	15556
0.1-0.2	29042
0.2-0.3	4064
0.3-0.4	977
0.4-0.5	59
0.5-0.6	76
0.6-0.7	60
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7927	Intermediate Similarity	NPC5311
0.7831	Intermediate Similarity	NPC76572
0.7831	Intermediate Similarity	NPC193382
0.7711	Intermediate Similarity	NPC77299
0.7711	Intermediate Similarity	NPC480906
0.7683	Intermediate Similarity	NPC99620
0.7619	Intermediate Similarity	NPC480914
0.75	Intermediate Similarity	NPC469750
0.7303	Intermediate Similarity	NPC30483
0.7303	Intermediate Similarity	NPC470897
0.7273	Intermediate Similarity	NPC480907
0.7222	Intermediate Similarity	NPC236973
0.7174	Intermediate Similarity	NPC486143
0.7174	Intermediate Similarity	NPC486142
0.7174	Intermediate Similarity	NPC486149
0.7033	Intermediate Similarity	NPC32177
0.7033	Intermediate Similarity	NPC292467
0.7033	Intermediate Similarity	NPC469756
0.7033	Intermediate Similarity	NPC275901
0.6989	Remote Similarity	NPC486135
0.6989	Remote Similarity	NPC486137
0.6977	Remote Similarity	NPC196429
0.6957	Remote Similarity	NPC188234
0.6957	Remote Similarity	NPC480910
0.6957	Remote Similarity	NPC480909
0.6915	Remote Similarity	NPC232785
0.6915	Remote Similarity	NPC486139
0.6842	Remote Similarity	NPC486146
0.6782	Remote Similarity	NPC84987
0.6735	Remote Similarity	NPC486144
0.6735	Remote Similarity	NPC486145
0.6735	Remote Similarity	NPC486147
0.6735	Remote Similarity	NPC486148
0.6705	Remote Similarity	NPC157376
0.6705	Remote Similarity	NPC142066
0.6705	Remote Similarity	NPC603972
0.6667	Remote Similarity	NPC329986
0.6667	Remote Similarity	NPC140092
0.6667	Remote Similarity	NPC99728
0.6667	Remote Similarity	NPC471353
0.6667	Remote Similarity	NPC87250
0.6667	Remote Similarity	NPC244402
0.6667	Remote Similarity	NPC50305
0.6632	Remote Similarity	NPC125077
0.6598	Remote Similarity	NPC486138
0.6598	Remote Similarity	NPC276838
0.6566	Remote Similarity	NPC486136
0.6517	Remote Similarity	NPC17896
0.6517	Remote Similarity	NPC469755
0.6517	Remote Similarity	NPC284406
0.6517	Remote Similarity	NPC197707
0.6517	Remote Similarity	NPC251866
0.6517	Remote Similarity	NPC480915
0.6436	Remote Similarity	NPC120390
0.6436	Remote Similarity	NPC74259
0.6436	Remote Similarity	NPC475419
0.64	Remote Similarity	NPC475590
0.6373	Remote Similarity	NPC474908
0.6373	Remote Similarity	NPC486134
0.6373	Remote Similarity	NPC486141
0.6304	Remote Similarity	NPC179412
0.6304	Remote Similarity	NPC471356
0.6292	Remote Similarity	NPC471633
0.6224	Remote Similarity	NPC469749
0.6196	Remote Similarity	NPC146456
0.619	Remote Similarity	NPC474423
0.6186	Remote Similarity	NPC475629
0.6154	Remote Similarity	NPC486150
0.6129	Remote Similarity	NPC305574
0.6087	Remote Similarity	NPC199428
0.6087	Remote Similarity	NPC109448
0.6087	Remote Similarity	NPC310341
0.6082	Remote Similarity	NPC32793
0.6082	Remote Similarity	NPC116075
0.6082	Remote Similarity	NPC486130
0.602	Remote Similarity	NPC231518
0.602	Remote Similarity	NPC486127
0.602	Remote Similarity	NPC488944
0.6	Remote Similarity	NPC72260
0.596	Remote Similarity	NPC208193
0.5918	Remote Similarity	NPC475556
0.5918	Remote Similarity	NPC311706
0.587	Remote Similarity	NPC309034
0.5851	Remote Similarity	NPC250556
0.5842	Remote Similarity	NPC146857
0.5816	Remote Similarity	NPC27363
0.5789	Remote Similarity	NPC483822
0.5745	Remote Similarity	NPC84949
0.5745	Remote Similarity	NPC480562
0.5745	Remote Similarity	NPC74945
0.5745	Remote Similarity	NPC31354
0.5745	Remote Similarity	NPC69576
0.5728	Remote Similarity	NPC476221
0.5728	Remote Similarity	NPC477709
0.5728	Remote Similarity	NPC486132
0.5728	Remote Similarity	NPC486131
0.5686	Remote Similarity	NPC247190
0.5684	Remote Similarity	NPC77319
0.5684	Remote Similarity	NPC471351
0.5684	Remote Similarity	NPC471355
0.5673	Remote Similarity	NPC479360
0.5673	Remote Similarity	NPC486128
0.5673	Remote Similarity	NPC479359
0.5673	Remote Similarity	NPC488943
0.5673	Remote Similarity	NPC488942
0.5625	Remote Similarity	NPC93883
0.5607	Remote Similarity	NPC117445
0.5607	Remote Similarity	NPC308262
0.5591	Remote Similarity	NPC473852
0.5579	Remote Similarity	NPC243196
0.5567	Remote Similarity	NPC471354
0.5567	Remote Similarity	NPC27507
0.5545	Remote Similarity	NPC264336
0.5545	Remote Similarity	NPC610296
0.5524	Remote Similarity	NPC488938
0.5524	Remote Similarity	NPC488937
0.5521	Remote Similarity	NPC83287
0.55	Remote Similarity	NPC40749
0.5484	Remote Similarity	NPC158344
0.5464	Remote Similarity	NPC9499
0.5464	Remote Similarity	NPC471360
0.5464	Remote Similarity	NPC469751
0.5464	Remote Similarity	NPC471361
0.5464	Remote Similarity	NPC86159
0.5464	Remote Similarity	NPC469752
0.5464	Remote Similarity	NPC469754
0.5464	Remote Similarity	NPC70542
0.5463	Remote Similarity	NPC486140
0.5463	Remote Similarity	NPC329675
0.5463	Remote Similarity	NPC194716
0.5446	Remote Similarity	NPC479353
0.5446	Remote Similarity	NPC479354
0.5429	Remote Similarity	NPC475219
0.5413	Remote Similarity	NPC486133
0.5392	Remote Similarity	NPC488941
0.5392	Remote Similarity	NPC488940
0.5368	Remote Similarity	NPC219085
0.5364	Remote Similarity	NPC488945
0.5364	Remote Similarity	NPC488946
0.5357	Remote Similarity	NPC286809
0.534	Remote Similarity	NPC59288
0.534	Remote Similarity	NPC55532
0.5319	Remote Similarity	NPC474418
0.5306	Remote Similarity	NPC484202
0.5273	Remote Similarity	NPC329784
0.5179	Remote Similarity	NPC488947
0.5175	Remote Similarity	NPC486152
0.5149	Remote Similarity	NPC173555
0.514	Remote Similarity	NPC479357
0.5114	Remote Similarity	NPC222875
0.5114	Remote Similarity	NPC25177
0.5102	Remote Similarity	NPC10823
0.5102	Remote Similarity	NPC480908
0.5094	Remote Similarity	NPC488939
0.5052	Remote Similarity	NPC486129

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC240070 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6203
0.1-0.2	2831
0.2-0.3	93
0.3-0.4	8
0.4-0.5	7
0.5-0.6	5
0.6-0.7	3
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6517	Remote Similarity	NPD7319	Approved
0.602	Remote Similarity	NPD8033	Approved
0.6	Remote Similarity	NPD8294	Phase 4
0.5851	Remote Similarity	NPD7507	Pre-clinical
0.5521	Remote Similarity	NPD7327	Approved
0.5521	Remote Similarity	NPD7328	Phase 4
0.534	Remote Similarity	NPD8377	Phase 4
0.5149	Remote Similarity	NPD8296	Phase 4

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data