NPASS Compound

Natural Product: NPC486152

Natural Product ID	NPC486152
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	AYRCTGHTWRPKRK-ZRRSMNOASA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001125] Steroid lactones [CHEMONTID:0001555] Cardenolides and derivatives [CHEMONTID:0001559] Cardenolide glycosides and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 126133 0 0 0 0 0 0 0 0999 V2000 1.9068 1.1349 3.2459 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8935 1.0012 1.7570 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8932 -0.0399 1.2411 C 0 0 1 0 0 0 0 0 0 0 0 0 2.1231 -1.3055 0.9850 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9730 -1.5263 1.9446 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0376 -0.3418 1.9140 C 0 0 1 0 0 0 0 0 0 0 0 0 0.6213 0.7566 1.3137 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1166 -0.7078 1.2311 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2493 -0.6935 2.0018 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.0204 -1.9769 1.9920 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5222 -1.7389 1.9582 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8874 -1.2555 0.5857 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7929 -0.2916 0.1537 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2933 0.8022 -0.7323 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4022 0.4081 -1.6560 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5029 -0.3314 -0.9717 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.1871 -0.5267 0.5021 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3541 -1.2192 1.1207 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4652 -1.5512 0.1837 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9913 -0.4035 -0.6267 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.7963 -1.0220 -1.7775 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8049 0.5547 0.1787 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.9134 1.7311 0.5264 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8503 1.7488 -0.5436 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8129 0.3755 -1.1716 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.9864 0.5483 -2.5385 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0210 1.0632 -0.5023 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.2532 0.8767 -0.0695 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.1524 1.5138 -0.9909 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.4320 1.5498 -0.9087 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.4160 2.0901 -1.9941 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0563 1.8658 -1.7440 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1716 0.3713 1.3914 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8915 -2.4621 -0.3124 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1512 -2.5583 -1.3005 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7553 -3.5091 -0.0261 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3039 -2.6718 1.4431 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9459 -2.4300 0.9684 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8725 -3.0243 -0.2996 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3259 0.4410 0.0088 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6890 0.6830 -0.0648 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8574 2.1960 -0.2576 C 0 0 2 0 0 0 0 0 0 0 0 0 5.4733 2.4476 -1.6426 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8554 1.7956 -1.5781 C 0 0 2 0 0 0 0 0 0 0 0 0 6.6642 0.3792 -1.1004 C 0 0 2 0 0 0 0 0 0 0 0 0 7.4658 -0.5741 -1.9623 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7937 -0.2982 -2.0618 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5098 -0.3137 -0.8694 C 0 0 1 0 0 0 0 0 0 0 0 0 10.4868 -1.4669 -0.9932 C 0 0 1 0 0 0 0 0 0 0 0 0 11.6202 -1.4002 -0.0286 C 0 0 2 0 0 0 0 0 0 0 0 0 12.2418 -0.0197 -0.0964 C 0 0 1 0 0 0 0 0 0 0 0 0 11.1298 0.9634 0.2126 C 0 0 1 0 0 0 0 0 0 0 0 0 11.7190 2.3501 0.1805 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7506 3.3095 0.4731 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1299 0.8973 -0.7211 O 0 0 0 0 0 0 0 0 0 0 0 0 13.1934 0.0978 0.9121 O 0 0 0 0 0 0 0 0 0 0 0 0 12.6128 -2.2921 -0.4803 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7665 -2.6573 -0.7769 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3173 0.0028 -1.0698 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5606 2.5860 -0.6395 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7248 1.8497 -2.6257 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7379 2.7128 0.6908 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8691 1.4477 3.5650 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5514 2.0072 3.5662 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2183 0.2419 3.7963 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1728 2.0191 1.3478 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7064 -0.1574 1.9722 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6274 -1.1820 -0.0240 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3059 -1.8022 2.9672 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2745 -0.1309 2.9674 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0397 -0.3885 3.0530 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8002 -2.6203 1.1061 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8323 -2.5956 2.9182 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0064 -2.7155 2.1288 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8633 -1.0615 2.7622 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9866 -0.8883 -0.3275 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5129 1.6944 -0.1207 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4240 1.1055 -1.3860 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9293 -0.2021 -2.4805 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7725 1.3301 -2.1480 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6004 -1.3439 -1.4036 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0186 0.4766 0.9893 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0768 -2.1632 1.6401 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7830 -0.5660 1.9351 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3160 -1.9266 0.8175 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2259 -2.3913 -0.5022 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6840 -2.1456 -1.7532 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4156 -0.7109 -2.7657 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8815 -0.8584 -1.6404 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0952 0.0132 1.1179 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5292 2.6650 0.4877 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5268 1.6648 1.5464 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0880 2.5454 -1.2814 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8908 1.9749 -0.0780 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2993 0.1143 -3.0792 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5703 0.3356 0.8318 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4834 2.8172 -1.6291 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6786 1.2960 -2.6427 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5913 1.2400 1.0379 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9354 0.6991 2.1033 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1770 -4.0836 -0.7638 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1777 -2.3189 0.6276 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2185 -2.2820 -1.0747 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8329 -3.3086 -0.5440 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5907 -3.8719 -0.3847 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1668 0.4304 0.9007 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8804 2.7195 -0.2625 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6289 3.5216 -1.7538 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4050 1.8736 -2.5339 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0415 0.3128 -0.0610 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0498 -0.6385 -2.9885 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3817 -1.6195 -1.5439 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8851 -0.5435 0.0211 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9031 -1.4874 -2.0264 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3733 -1.7004 0.9916 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6488 0.0945 -1.1035 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7975 0.7459 1.2464 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6039 2.4338 0.8283 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0879 2.5749 -0.8620 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0006 2.8396 0.9107 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0467 0.4828 0.5814 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1040 -1.8916 -1.2573 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3568 -3.4382 -0.9474 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4692 3.5268 -0.9276 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2510 1.7207 -3.4489 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3643 3.5750 0.9989 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 22 27 1 0 27 28 2 0 28 29 1 0 29 30 2 0 29 31 1 0 31 32 1 0 13 33 1 0 12 34 1 6 34 35 2 0 34 36 1 0 5 37 1 0 4 38 1 0 38 39 1 0 3 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 52 55 1 0 51 56 1 0 50 57 1 0 49 58 1 0 45 59 1 0 44 60 1 0 43 61 1 0 42 62 1 0 7 2 1 0 33 9 1 0 59 41 1 0 17 12 1 0 25 20 1 0 32 27 1 0 55 48 1 0 25 16 1 0 1 63 1 0 1 64 1 0 1 65 1 0 2 66 1 6 3 67 1 1 4 68 1 6 5 69 1 1 6 70 1 1 9 71 1 1 10 72 1 0 10 73 1 0 11 74 1 0 11 75 1 0 13 76 1 6 14 77 1 0 14 78 1 0 15 79 1 0 15 80 1 0 16 81 1 6 17 82 1 1 18 83 1 0 18 84 1 0 19 85 1 0 19 86 1 0 21 87 1 0 21 88 1 0 21 89 1 0 22 90 1 1 23 91 1 0 23 92 1 0 24 93 1 0 24 94 1 0 26 95 1 0 28 96 1 0 32 97 1 0 32 98 1 0 33 99 1 0 33100 1 0 36101 1 0 37102 1 0 39103 1 0 39104 1 0 39105 1 0 41106 1 1 42107 1 6 43108 1 6 44109 1 6 45110 1 1 46111 1 0 46112 1 0 48113 1 1 49114 1 6 50115 1 1 51116 1 6 52117 1 1 53118 1 0 53119 1 0 54120 1 0 56121 1 0 57122 1 0 58123 1 0 60124 1 0 61125 1 0 62126 1 0 M END

Standard InCHIKey	AYRCTGHTWRPKRK-ZRRSMNOASA-N
Standard InCHI	InChI=1S/C42H64O20/c1-17-34(62-37-32(50)30(48)28(46)25(61-37)16-57-36-31(49)29(47)27(45)24(14-43)60-36)35(55-3)33(51)38(58-17)59-20-6-10-41(39(52)53)19(13-20)4-5-23-22(41)7-9-40(2)21(8-11-42(23,40)54)18-12-26(44)56-15-18/h12,17,19-25,27-38,43,45-51,54H,4-11,13-16H2,1-3H3,(H,52,53)/t17-,19-,20+,21-,22+,23-,24+,25-,27+,28-,29-,30+,31+,32-,33-,34-,35-,36+,37+,38-,40-,41-,42+/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)O[C@@H]1CC[C@@]2([C@@H](CC[C@H]3[C@H]2CC[C@@]2(C)[C@@H](CC[C@@]32O)C2=CC(=O)OC2)C1)C(=O)O)O)OC)O[C@@H]1[C@H]([C@@H]([C@H]([C@H](CO[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	888.4	Volume:	834.431 ? Van der Waals volume.
Dense:	1.065	LogP:	-1.385 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	-0.171 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-1.38 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	45.0
TPSA:	310.28 ? Topological Polar Surface Area.	H-Bond Acceptor:	20.0
H-Bond Donor:	10.0	Rings:	8.0
Heavy Atoms:	20.0

MedChem Properties

QED Drug-Likeness Score:	0.078	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.245	Fsp³:	0.905
MCE-18:	158.2 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.661	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.007 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.159	Promiscuous compounds:	0.218

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.518	MDCK Permeability:	-5.327
Pgp-inhibitor:	0.0	Pgp-substrate:	0.874
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.997
20% Bioavailability (F20%):	0.303	30% Bioavailability (F30%):	0.988
50% Bioavailability (F50%):	0.965

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.11
Plasma Protein Binding (PPB):	39.185%	Volume Distribution (VD):	-0.515
Fu:	49.967% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.122

Half-life (T1/2):

3.671

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.004
Human Hepatotoxicity (H-HT):	0.961	Drug-induced Liver Injury (DILI):	0.985
AMES Toxicity:	0.973	Rat Oral Acute Toxicity:	0.021
Maximum Recommended Daily Dose:	0.168	Skin Sensitization:	1.0
Carcinogencity:	0.778	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.026
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.854	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.966	RPMI-8226 Immunitoxicity:	0.374
A549 Cytotoxicity:	0.853	Hek293 Cytotoxicity:	0.437
BCF:	0.507 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.245 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.801 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.809 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8402	Thevetia peruviana	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[26714048]
NPO8402	Thevetia peruviana	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[39027575]
NPO8402	Thevetia peruviana	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8402	Thevetia peruviana	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	4

Activity Type	# Activity
Cell line	1
Non-molecular	2
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1312	Cell line	SW1990	Homo sapiens	IC50	>	10000.0	nM	PMID[26714048]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	>	10000.0	nM	PMID[26714048]
NPT27	Others	Unspecified	n.a.	IC50	>	10000.0	nM	PMID[26714048]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC486152 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	14223
0.1-0.2	30606
0.2-0.3	4222
0.3-0.4	655
0.4-0.5	71
0.5-0.6	45
0.6-0.7	21
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9368	High Similarity	NPC486140
0.8137	Intermediate Similarity	NPC329784
0.7374	Intermediate Similarity	NPC27363
0.7212	Intermediate Similarity	NPC486131
0.7143	Intermediate Similarity	NPC486128
0.7075	Intermediate Similarity	NPC486144
0.7075	Intermediate Similarity	NPC486145
0.7075	Intermediate Similarity	NPC486147
0.7075	Intermediate Similarity	NPC486136
0.7075	Intermediate Similarity	NPC486148
0.6961	Remote Similarity	NPC486151
0.6818	Remote Similarity	NPC486133
0.6635	Remote Similarity	NPC486130
0.6571	Remote Similarity	NPC486127
0.6549	Remote Similarity	NPC474423
0.6509	Remote Similarity	NPC486143
0.6509	Remote Similarity	NPC486135
0.6509	Remote Similarity	NPC486142
0.6509	Remote Similarity	NPC486137
0.6509	Remote Similarity	NPC486149
0.6449	Remote Similarity	NPC232785
0.6449	Remote Similarity	NPC486139
0.6415	Remote Similarity	NPC475629
0.6273	Remote Similarity	NPC486132
0.6195	Remote Similarity	NPC475419
0.6132	Remote Similarity	NPC30483
0.6132	Remote Similarity	NPC470897
0.6071	Remote Similarity	NPC479360
0.6071	Remote Similarity	NPC479359
0.6	Remote Similarity	NPC486134
0.6	Remote Similarity	NPC486141
0.5948	Remote Similarity	NPC486150
0.5913	Remote Similarity	NPC120390
0.5897	Remote Similarity	NPC488945
0.5897	Remote Similarity	NPC488946
0.5862	Remote Similarity	NPC474908
0.5862	Remote Similarity	NPC194716
0.5739	Remote Similarity	NPC475590
0.5565	Remote Similarity	NPC479357
0.5536	Remote Similarity	NPC231518
0.5536	Remote Similarity	NPC488944
0.5526	Remote Similarity	NPC329986
0.5526	Remote Similarity	NPC140092
0.5495	Remote Similarity	NPC236973
0.5495	Remote Similarity	NPC32177
0.5495	Remote Similarity	NPC469756
0.5495	Remote Similarity	NPC275901
0.5472	Remote Similarity	NPC5311
0.5472	Remote Similarity	NPC77299
0.5472	Remote Similarity	NPC480906
0.5446	Remote Similarity	NPC188234
0.5446	Remote Similarity	NPC480910
0.5446	Remote Similarity	NPC480909
0.5421	Remote Similarity	NPC480914
0.5391	Remote Similarity	NPC486146
0.5385	Remote Similarity	NPC488943
0.5385	Remote Similarity	NPC488942
0.5377	Remote Similarity	NPC84987
0.5345	Remote Similarity	NPC486138
0.5345	Remote Similarity	NPC276838
0.5263	Remote Similarity	NPC610296
0.5259	Remote Similarity	NPC146857
0.5225	Remote Similarity	NPC480907
0.5207	Remote Similarity	NPC329675
0.5175	Remote Similarity	NPC32793
0.5175	Remote Similarity	NPC116075
0.5175	Remote Similarity	NPC240070
0.5124	Remote Similarity	NPC74259
0.5088	Remote Similarity	NPC292467
0.5086	Remote Similarity	NPC125077
0.5081	Remote Similarity	NPC488947
0.5043	Remote Similarity	NPC475556
0.5043	Remote Similarity	NPC469749
0.5043	Remote Similarity	NPC479353
0.5043	Remote Similarity	NPC479354
0.5043	Remote Similarity	NPC311706

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC486152 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	5196
0.1-0.2	3840
0.2-0.3	98
0.3-0.4	9
0.4-0.5	6
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5536	Remote Similarity	NPD8033	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data