NPASS Compound

Natural Product: NPC486150

Natural Product ID	NPC486150
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	UUHPKSYVONCTBB-ATQMHFOGSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001125] Steroid lactones [CHEMONTID:0001555] Cardenolides and derivatives [CHEMONTID:0001559] Cardenolide glycosides and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 130137 0 0 0 0 0 0 0 0999 V2000 1.8775 -2.1319 -2.7510 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4470 -1.0971 -1.7491 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5678 -0.3607 -1.0818 C 0 0 1 0 0 0 0 0 0 0 0 0 1.8692 0.3478 0.1244 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9398 1.3382 -0.5784 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1253 0.5749 -1.2789 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4419 -0.2909 -2.2044 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9136 -0.2149 -0.4723 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2401 -0.0638 -0.5411 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.6785 0.6053 0.7871 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0581 1.1798 0.5621 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0173 0.0508 0.4161 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1598 -0.5701 1.7890 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9065 -1.7386 2.0089 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5765 -1.0300 -0.4926 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1644 -0.7969 -1.9050 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6687 -0.9894 -1.8439 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1860 -0.6414 -0.4528 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3975 0.5405 0.0057 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.0791 1.3449 1.0517 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2056 0.6911 1.7619 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1806 -0.0576 0.8821 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.4982 -1.3667 1.5813 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4180 0.7504 0.6130 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.3790 1.1898 -0.8223 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0580 0.7302 -1.3942 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6681 -0.3977 -0.4737 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2728 -1.5605 -0.9569 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.6952 0.0698 0.9531 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.5013 0.5115 1.9113 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.6496 -0.3518 2.0034 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.6606 -0.3010 2.7759 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.5045 -1.3395 1.0570 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.3191 -1.1071 0.3508 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1127 -1.2560 -0.6745 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4917 2.3632 0.2470 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8091 3.7005 0.1022 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5601 4.0286 -0.8438 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3099 4.7648 1.0031 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7911 0.9581 0.9394 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6660 0.3757 2.2220 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5749 -1.1144 -0.5623 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8192 -0.5388 -0.9144 C 0 0 2 0 0 0 0 0 0 0 0 0 5.7014 -1.4953 -1.6698 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9767 -0.7605 -1.9972 C 0 0 1 0 0 0 0 0 0 0 0 0 7.1708 0.4805 -1.1864 C 0 0 2 0 0 0 0 0 0 0 0 0 6.6637 0.4170 0.1856 C 0 0 2 0 0 0 0 0 0 0 0 0 7.4957 -0.1286 1.2825 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7312 0.2424 1.5514 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8092 -0.0111 0.7812 C 0 0 1 0 0 0 0 0 0 0 0 0 10.5420 1.2744 0.4337 C 0 0 1 0 0 0 0 0 0 0 0 0 11.8027 1.4860 1.2542 C 0 0 2 0 0 0 0 0 0 0 0 0 12.7619 0.3201 1.0060 C 0 0 1 0 0 0 0 0 0 0 0 0 11.9067 -0.9323 0.7662 C 0 0 1 0 0 0 0 0 0 0 0 0 12.6243 -2.1867 1.2036 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8078 -2.3740 0.5185 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7405 -0.8208 1.4979 O 0 0 0 0 0 0 0 0 0 0 0 0 13.6062 0.6017 -0.0323 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5608 1.6504 2.5972 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8487 1.3515 -0.9302 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4092 -0.2026 0.3011 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5105 1.5778 -1.8475 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0644 -1.6161 -2.0457 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0637 -1.9355 -2.8010 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4486 -1.6835 -3.6029 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5420 -2.9023 -2.3106 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9922 -2.6878 -3.1272 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9728 -1.7044 -0.9120 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9040 0.4938 -1.7199 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2629 -0.4186 0.6152 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5964 1.8346 -1.3553 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7228 1.2887 -1.8979 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5855 0.7065 -1.2936 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6824 -0.2065 1.5403 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9379 1.3743 1.0141 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2671 1.8155 1.4591 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9997 1.8050 -0.3609 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4957 0.0068 2.6385 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0276 -2.0291 -0.2130 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7458 -1.5814 -2.5576 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8639 0.1840 -2.3105 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9269 -2.0141 -2.1544 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1226 -0.2835 -2.5490 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9801 -1.4961 0.1990 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1881 1.2571 -0.8509 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3442 1.6655 1.8415 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4602 2.3363 0.6596 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8169 1.5109 2.2493 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8709 0.0733 2.6298 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6679 -1.5326 2.3328 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4103 -1.3278 2.1834 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4105 -2.2439 0.9041 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3146 1.6920 1.2183 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5282 2.2937 -0.9454 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1868 0.6596 -1.4086 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1640 0.3742 -2.4434 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3383 1.5664 -1.4217 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6634 -2.3183 -1.0128 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3433 1.3743 2.5328 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6364 -0.7929 -0.6909 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6757 -2.0109 0.2888 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9764 -1.7088 -1.7039 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8176 -2.0977 -0.0024 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0915 5.5433 1.1837 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6410 5.2334 0.6094 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0241 4.3878 2.0049 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6456 0.5433 2.5916 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7410 -0.7330 2.0466 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4622 0.6989 2.8917 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5846 0.3484 -1.5254 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9082 -2.3796 -1.0288 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8410 -0.4042 -3.0716 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2220 0.8227 -1.2041 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4717 1.5159 0.4938 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8880 0.0285 2.2649 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4504 -1.2888 1.2593 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5525 -0.5941 -0.1127 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8595 2.1149 0.6681 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2991 2.3908 0.8623 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3216 0.1534 1.9312 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6462 -0.9557 -0.3074 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9023 -3.0225 1.0396 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7520 -2.1369 2.3149 H 0 0 0 0 0 0 0 0 0 0 0 0 13.6799 -3.1749 -0.0605 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0920 0.5950 -0.8770 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6835 1.3131 2.9082 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3174 2.1910 -1.1400 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7157 1.5383 -2.8131 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9401 -2.3027 -1.3435 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3324 -2.8477 -3.0716 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 1 13 14 2 0 12 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 1 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 6 24 29 1 0 29 30 2 0 30 31 1 0 31 32 2 0 31 33 1 0 33 34 1 0 15 35 1 0 5 36 1 0 36 37 1 0 37 38 2 0 37 39 1 0 4 40 1 0 40 41 1 0 3 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 54 57 1 0 53 58 1 0 52 59 1 0 51 60 1 0 47 61 1 0 46 62 1 0 45 63 1 0 44 64 1 0 7 2 1 0 35 9 1 0 61 43 1 0 19 12 1 0 27 22 1 0 34 29 1 0 57 50 1 0 27 18 1 0 1 65 1 0 1 66 1 0 1 67 1 0 2 68 1 1 3 69 1 6 4 70 1 1 5 71 1 6 6 72 1 6 9 73 1 6 10 74 1 0 10 75 1 0 11 76 1 0 11 77 1 0 13 78 1 0 15 79 1 1 16 80 1 0 16 81 1 0 17 82 1 0 17 83 1 0 18 84 1 1 19 85 1 6 20 86 1 0 20 87 1 0 21 88 1 0 21 89 1 0 23 90 1 0 23 91 1 0 23 92 1 0 24 93 1 1 25 94 1 0 25 95 1 0 26 96 1 0 26 97 1 0 28 98 1 0 30 99 1 0 34100 1 0 34101 1 0 35102 1 0 35103 1 0 39104 1 0 39105 1 0 39106 1 0 41107 1 0 41108 1 0 41109 1 0 43110 1 6 44111 1 1 45112 1 6 46113 1 1 47114 1 1 48115 1 0 48116 1 0 50117 1 6 51118 1 1 52119 1 6 53120 1 1 54121 1 6 55122 1 0 55123 1 0 56124 1 0 58125 1 0 59126 1 0 60127 1 0 62128 1 0 63129 1 0 64130 1 0 M END

Standard InCHIKey	UUHPKSYVONCTBB-ATQMHFOGSA-N
Standard InCHI	InChI=1S/C44H66O20/c1-19-36(64-40-35(54)33(52)31(50)28(63-40)17-58-39-34(53)32(51)30(49)27(15-45)62-39)37(56-4)38(60-20(2)47)41(59-19)61-23-7-11-43(18-46)22(14-23)5-6-26-25(43)8-10-42(3)24(9-12-44(26,42)55)21-13-29(48)57-16-21/h13,18-19,22-28,30-41,45,49-55H,5-12,14-17H2,1-4H3/t19-,22-,23+,24-,25+,26-,27+,28-,30+,31-,32-,33+,34+,35-,36-,37+,38-,39+,40+,41-,42-,43-,44+/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)O[C@@H]1CC[C@]2(C=O)[C@@H](CC[C@H]3[C@H]2CC[C@@]2(C)[C@@H](CC[C@@]32O)C2=CC(=O)OC2)C1)OC(=O)C)OC)O[C@@H]1[C@H]([C@@H]([C@H]([C@H](CO[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	914.41	Volume:	866.387 ? Van der Waals volume.
Dense:	1.055	LogP:	-0.431 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.326 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.404 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	46.0
TPSA:	296.12 ? Topological Polar Surface Area.	H-Bond Acceptor:	20.0
H-Bond Donor:	8.0	Rings:	8.0
Heavy Atoms:	20.0

MedChem Properties

QED Drug-Likeness Score:	0.063	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.314	Fsp³:	0.886
MCE-18:	156.53 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.815	Fluc inhibitor:	0.001 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.181	Promiscuous compounds:	0.315

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.212	MDCK Permeability:	-5.271
Pgp-inhibitor:	0.0	Pgp-substrate:	0.938
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.814
20% Bioavailability (F20%):	0.166	30% Bioavailability (F30%):	0.989
50% Bioavailability (F50%):	0.993

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.054
Plasma Protein Binding (PPB):	39.741%	Volume Distribution (VD):	-0.554
Fu:	54.547% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.002
BSEP inhibitor:	0.001

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.03	CYP3A4-substrate:	0.001
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.648
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.264

Half-life (T1/2):

3.479

ADMET: Toxicity

hERG Blockers:	0.007	hERG Blockers (10um):	0.019
Human Hepatotoxicity (H-HT):	0.932	Drug-induced Liver Injury (DILI):	0.966
AMES Toxicity:	0.987	Rat Oral Acute Toxicity:	0.037
Maximum Recommended Daily Dose:	0.388	Skin Sensitization:	1.0
Carcinogencity:	0.807	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.011
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.997
Hematotoxicity:	0.825	Drug-induced Nephrotoxicity:	0.998
Genotoxicity:	0.983	RPMI-8226 Immunitoxicity:	0.523
A549 Cytotoxicity:	0.953	Hek293 Cytotoxicity:	0.825
BCF:	0.475 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.356 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.192 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.243 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO8402	Thevetia peruviana	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[26714048]
NPO8402	Thevetia peruviana	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[39027575]
NPO8402	Thevetia peruviana	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO8402	Thevetia peruviana	Species	Apocynaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	4

Activity Type	# Activity
Cell line	1
Non-molecular	2
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT1312	Cell line	SW1990	Homo sapiens	IC50	>	10000.0	nM	PMID[26714048]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	>	10000.0	nM	PMID[26714048]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	9530.0	nM	PMID[26714048]
NPT27	Others	Unspecified	n.a.	IC50	>	10000.0	nM	PMID[26714048]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC486150 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	15828
0.1-0.2	28968
0.2-0.3	3977
0.3-0.4	876
0.4-0.5	79
0.5-0.6	64
0.6-0.7	42
0.7-0.8	0
0.8-0.85	1
0.85-0.9	2
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9222	High Similarity	NPC486138
0.9222	High Similarity	NPC276838
0.8842	High Similarity	NPC486134
0.8842	High Similarity	NPC486141
0.8105	Intermediate Similarity	NPC486146
0.7812	Intermediate Similarity	NPC232785
0.7812	Intermediate Similarity	NPC486139
0.7582	Intermediate Similarity	NPC480914
0.7551	Intermediate Similarity	NPC329986
0.7551	Intermediate Similarity	NPC140092
0.7426	Intermediate Similarity	NPC486144
0.7426	Intermediate Similarity	NPC486145
0.7426	Intermediate Similarity	NPC486147
0.7426	Intermediate Similarity	NPC486136
0.7426	Intermediate Similarity	NPC486148
0.7333	Intermediate Similarity	NPC488947
0.7292	Intermediate Similarity	NPC30483
0.7292	Intermediate Similarity	NPC470897
0.7282	Intermediate Similarity	NPC475419
0.7212	Intermediate Similarity	NPC474908
0.7143	Intermediate Similarity	NPC188234
0.7009	Intermediate Similarity	NPC474423
0.7	Intermediate Similarity	NPC125077
0.6923	Remote Similarity	NPC479358
0.6887	Remote Similarity	NPC194716
0.6832	Remote Similarity	NPC486143
0.6832	Remote Similarity	NPC486135
0.6832	Remote Similarity	NPC486142
0.6832	Remote Similarity	NPC486137
0.6832	Remote Similarity	NPC486149
0.6762	Remote Similarity	NPC475590
0.6737	Remote Similarity	NPC469750
0.6667	Remote Similarity	NPC486128
0.6667	Remote Similarity	NPC488938
0.6667	Remote Similarity	NPC488937
0.6571	Remote Similarity	NPC486131
0.6562	Remote Similarity	NPC5311
0.6562	Remote Similarity	NPC77299
0.6562	Remote Similarity	NPC480906
0.6535	Remote Similarity	NPC292467
0.6355	Remote Similarity	NPC479360
0.6355	Remote Similarity	NPC479359
0.633	Remote Similarity	NPC120390
0.6306	Remote Similarity	NPC488945
0.6306	Remote Similarity	NPC488946
0.6238	Remote Similarity	NPC480907
0.6226	Remote Similarity	NPC146857
0.6226	Remote Similarity	NPC488939
0.6226	Remote Similarity	NPC247190
0.6216	Remote Similarity	NPC486133
0.6214	Remote Similarity	NPC236973
0.6214	Remote Similarity	NPC32177
0.6214	Remote Similarity	NPC469756
0.6214	Remote Similarity	NPC275901
0.6182	Remote Similarity	NPC74259
0.6154	Remote Similarity	NPC480910
0.6154	Remote Similarity	NPC240070
0.6154	Remote Similarity	NPC480909
0.61	Remote Similarity	NPC250556
0.6095	Remote Similarity	NPC475629
0.6095	Remote Similarity	NPC486127
0.6095	Remote Similarity	NPC610296
0.6	Remote Similarity	NPC76572
0.6	Remote Similarity	NPC193382
0.6	Remote Similarity	NPC486130
0.5948	Remote Similarity	NPC486152
0.5859	Remote Similarity	NPC99620
0.5849	Remote Similarity	NPC32793
0.5849	Remote Similarity	NPC116075
0.5841	Remote Similarity	NPC329675
0.5818	Remote Similarity	NPC479357
0.58	Remote Similarity	NPC84987
0.5794	Remote Similarity	NPC231518
0.5794	Remote Similarity	NPC488944
0.5766	Remote Similarity	NPC488943
0.5766	Remote Similarity	NPC488942
0.5743	Remote Similarity	NPC480915
0.5728	Remote Similarity	NPC93883
0.5688	Remote Similarity	NPC469749
0.5676	Remote Similarity	NPC476221
0.5676	Remote Similarity	NPC477709
0.5676	Remote Similarity	NPC486132
0.5577	Remote Similarity	NPC179412
0.5577	Remote Similarity	NPC471356
0.549	Remote Similarity	NPC196429
0.5437	Remote Similarity	NPC17896
0.5437	Remote Similarity	NPC469755
0.5437	Remote Similarity	NPC284406
0.5437	Remote Similarity	NPC197707
0.5437	Remote Similarity	NPC251866
0.5431	Remote Similarity	NPC486140
0.5431	Remote Similarity	NPC117445
0.5431	Remote Similarity	NPC308262
0.5429	Remote Similarity	NPC483822
0.5429	Remote Similarity	NPC305574
0.5413	Remote Similarity	NPC475556
0.5413	Remote Similarity	NPC311706
0.5315	Remote Similarity	NPC208193
0.5273	Remote Similarity	NPC479353
0.5273	Remote Similarity	NPC479354
0.5254	Remote Similarity	NPC329784
0.5243	Remote Similarity	NPC471633
0.5238	Remote Similarity	NPC199428
0.5238	Remote Similarity	NPC84949
0.5238	Remote Similarity	NPC109448
0.5238	Remote Similarity	NPC480562
0.5238	Remote Similarity	NPC74945
0.5238	Remote Similarity	NPC310341
0.5238	Remote Similarity	NPC31354
0.5238	Remote Similarity	NPC69576
0.5225	Remote Similarity	NPC488941
0.5225	Remote Similarity	NPC488940
0.5207	Remote Similarity	NPC286809
0.5192	Remote Similarity	NPC219085
0.5185	Remote Similarity	NPC72260
0.5179	Remote Similarity	NPC59288
0.5143	Remote Similarity	NPC6108
0.5143	Remote Similarity	NPC157376
0.5143	Remote Similarity	NPC89514
0.5143	Remote Similarity	NPC142066
0.5143	Remote Similarity	NPC603972
0.514	Remote Similarity	NPC471353
0.513	Remote Similarity	NPC475219
0.5096	Remote Similarity	NPC99728
0.5096	Remote Similarity	NPC87250
0.5096	Remote Similarity	NPC244402
0.5096	Remote Similarity	NPC50305
0.5094	Remote Similarity	NPC243196
0.5094	Remote Similarity	NPC10823

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC486150 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6420
0.1-0.2	2647
0.2-0.3	63
0.3-0.4	7
0.4-0.5	8
0.5-0.6	4
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.61	Remote Similarity	NPD7507	Pre-clinical
0.5794	Remote Similarity	NPD8033	Approved
0.5437	Remote Similarity	NPD7319	Approved
0.5185	Remote Similarity	NPD8294	Phase 4
0.5044	Remote Similarity	NPD8377	Phase 4

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data