Natural Product: NPC295110| Natural Product ID | NPC295110 |
|
Common Name
The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
| Digitoxigenin |
| IUPAC Name | 3-[(3S,5R,8R,9S,10S,13R,14S,17R)-3,14-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
| Synonyms | Digitoxigenin; Digoxigenin; Uzarigenin |
| Synthetic Gene Cluster | n.a. |
| ChEMBL Identifier | CHEMBL1453 |
| PubChem CID |
4369270 |
| Chemical Classification |
|
The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.
Chemical Representations
| Standard InCHIKey | XZTUSOXSLKTKJQ-CESUGQOBSA-N |
| Standard InCHI | InChI=1S/C23H34O4/c1-21-8-5-16(24)12-15(21)3-4-19-18(21)6-9-22(2)17(7-10-23(19,22)26)14-11-20(25)27-13-14/h11,15-19,24,26H,3-10,12-13H2,1-2H3/t15-,16+,17-,18+,19-,21+,22-,23+/m1/s1 |
| SMILES | C[C@]12CC[C@@H](C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@H](CC[C@]12O)C1=CC(=O)OC1)O |
  Calculated Properties
  Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1007/s00253-012-4489-y] |
| NPO22245 | Digitalis lanata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1016/S0176-1617(89)80112-9] |
| NPO13325 | Plantago lanceolata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1038/ncomms4886] |
| NPO26266 | Isodon japonicus | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1039/C39730000707] |
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1093/oxfordjournals.pcp.a076462] |
| NPO1071 | Parerythropodium fulvum | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[11277760] |
| NPO32958 | Streptocaulon juventas | Species | Apocynaceae | Eukaryota | n.a. | Vietnamese | n.a. |
PMID[14640513] |
| NPO10021 | Nerium oleander | Species | Apocynaceae | Eukaryota | leaves | Niigata City, Niigata Province, Japan | 2000-Nov |
PMID[15730243] |
| NPO9165 | Asclepias curassavica | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[16252914] |
| NPO10021 | Nerium oleander | Species | Apocynaceae | Eukaryota | leaves | n.a. | n.a. |
PMID[16933868] |
| NPO30295 | Calotropis gigantea | Species | Apocynaceae | Eukaryota | leaves | n.a. | n.a. |
PMID[16933890] |
| NPO10021 | Nerium oleander | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[17253842] |
| NPO10021 | Nerium oleander | Species | Apocynaceae | Eukaryota | stems and twigs | Niigata City, Niigata Province, Japan | 2001-NOV |
PMID[17595134] |
| NPO10021 | Nerium oleander | Species | Apocynaceae | Eukaryota | stems and twigs | n.a. | n.a. |
PMID[17595134] |
| NPO26266 | Isodon japonicus | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[18491868] |
| NPO30295 | Calotropis gigantea | Species | Apocynaceae | Eukaryota | n.a. | root | n.a. |
PMID[19052526] |
| NPO9165 | Asclepias curassavica | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[19251412] |
| NPO3936 | Malva sylvestris | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[19731587] |
| NPO3447 | Beaumontia murtonii | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28598616] |
| NPO40841 | Eugenia operculata | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[28598616] |
| NPO30295 | Calotropis gigantea | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28817274] |
| NPO10021 | Nerium oleander | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[29693393] |
| NPO32958 | Streptocaulon juventas | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31120251] |
| NPO30295 | Calotropis gigantea | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31967821] |
| NPO30295 | Calotropis gigantea | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[32649211] |
| NPO9165 | Asclepias curassavica | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[37375900] |
| NPO3936 | Malva sylvestris | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[37726667] |
| NPO3936 | Malva sylvestris | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[39382805] |
| NPO32604 | asclepias fructicosa | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[3981544] |
| NPO10021 | Nerium oleander | Species | Apocynaceae | Eukaryota | Leaves; Stems | n.a. | n.a. |
PMID[9214727] |
| NPO30295 | Calotropis gigantea | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[9548837] |
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[9834166] |
| NPO2342 | Cytisus scoparius | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO22245 | Digitalis lanata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO30295 | Calotropis gigantea | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO8545 | Hyssopus officinalis | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO6190 | Angelica archangelica | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO2518 | Crinum kirkii | Species | Amaryllidaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO10021 | Nerium oleander | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO2361 | Aconitum brevicalcaratum | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO3146 | Ammodendron conollyi | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO351 | Cirsium dipsacolepis | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO6377 | Cocculus diversifolius | Species | Menispermaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO1607 | Croton rhamnifolius | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO5980 | Eria subsessilis | Species | Orchidaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO5591 | Fucus spiralis | Species | Fucaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO2747 | Hypericum triquetrifolium | Species | Hypericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO26266 | Isodon japonicus | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO8472 | Knightia deplanchei | Species | Proteaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO3936 | Malva sylvestris | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO3664 | Mesembryanthemum anatomicum | Species | Aizoaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO6520 | Myrica multiflora | Species | Myricaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO4082 | Ophiarthrum elegans | Species | Ophiocomidae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO1071 | Parerythropodium fulvum | Species | n.a. | n.a. | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO13325 | Plantago lanceolata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO8840 | Ptilidium ciliare | Species | Ptilidiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO7097 | Rhynchosporium orthosporum | Species | n.a. | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO20132 | Scutellaria seleriana | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO6974 | Solanum racemigerum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO5197 | Streptomyces eurythermus | Species | Streptomycetaceae | Bacteria | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO715 | Teucrium pestalozzae | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO6776 | Trifolium apertum | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO15583 | Tripodanthus acutifolius | Species | Loranthaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO1308 | Veronica pectinata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO8585 | Verpa digitaliformis | Species | Morchellaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO4253 | Viguiera annua | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO9165 | Asclepias curassavica | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO9296 | Lonicera periclymenum | Species | Caprifoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[COCONUT] |
| NPO8545 | Hyssopus officinalis | Species | Lamiaceae | Eukaryota | Flower | n.a. | n.a. | Database[FooDB] |
| NPO8545 | Hyssopus officinalis | Species | Lamiaceae | Eukaryota | Leaf | n.a. | n.a. | Database[FooDB] |
| NPO8545 | Hyssopus officinalis | Species | Lamiaceae | Eukaryota | Plant | n.a. | n.a. | Database[FooDB] |
| NPO8545 | Hyssopus officinalis | Species | Lamiaceae | Eukaryota | Shoot | n.a. | n.a. | Database[FooDB] |
| NPO8545 | Hyssopus officinalis | Species | Lamiaceae | Eukaryota | n.a. | n.a. | Database[FooDB] | |
| NPO6520 | Myrica multiflora | Species | Myricaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO2342 | Cytisus scoparius | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO22245 | Digitalis lanata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO13325 | Plantago lanceolata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO6190 | Angelica archangelica | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO2747 | Hypericum triquetrifolium | Species | Hypericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO9165 | Asclepias curassavica | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO10021 | Nerium oleander | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO3664 | Mesembryanthemum anatomicum | Species | Aizoaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO3936 | Malva sylvestris | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
| NPO8545 | Hyssopus officinalis | Species | Lamiaceae | Eukaryota | n.a. | n.a. | Database[Phenol-Explorer] | |
| NPO6190 | Angelica archangelica | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO2342 | Cytisus scoparius | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO10021 | Nerium oleander | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO22245 | Digitalis lanata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO13325 | Plantago lanceolata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO3936 | Malva sylvestris | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO2518 | Crinum kirkii | Species | Amaryllidaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO9165 | Asclepias curassavica | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO6520 | Myrica multiflora | Species | Myricaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO3664 | Mesembryanthemum anatomicum | Species | Aizoaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO2747 | Hypericum triquetrifolium | Species | Hypericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
| NPO22245 | Digitalis lanata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO2342 | Cytisus scoparius | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO6190 | Angelica archangelica | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
| NPO22245 | Digitalis lanata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
| NPO15583 | Tripodanthus acutifolius | Species | Loranthaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO1071 | Parerythropodium fulvum | Species | n.a. | n.a. | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO351 | Cirsium dipsacolepis | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO5197 | Streptomyces eurythermus | Species | Streptomycetaceae | Bacteria | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6776 | Trifolium apertum | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2361 | Aconitum brevicalcaratum | Species | Ranunculaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4082 | Ophiarthrum elegans | Species | Ophiocomidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2342 | Cytisus scoparius | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO8840 | Ptilidium ciliare | Species | Ptilidiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO26266 | Isodon japonicus | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO5591 | Fucus spiralis | Species | Fucaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO20132 | Scutellaria seleriana | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2747 | Hypericum triquetrifolium | Species | Hypericaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO715 | Teucrium pestalozzae | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO8472 | Knightia deplanchei | Species | Proteaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO3936 | Malva sylvestris | Species | Malvaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO3664 | Mesembryanthemum anatomicum | Species | Aizoaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO8585 | Verpa digitaliformis | Species | Morchellaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6377 | Cocculus diversifolius | Species | Menispermaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO7097 | Rhynchosporium orthosporum | Species | n.a. | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6974 | Solanum racemigerum | Species | Solanaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO13325 | Plantago lanceolata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO1607 | Croton rhamnifolius | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6520 | Myrica multiflora | Species | Myricaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO5980 | Eria subsessilis | Species | Orchidaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO9165 | Asclepias curassavica | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO3146 | Ammodendron conollyi | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO2518 | Crinum kirkii | Species | Amaryllidaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4253 | Viguiera annua | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO1308 | Veronica pectinata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO10021 | Nerium oleander | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO22245 | Digitalis lanata | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO6190 | Angelica archangelica | Species | Apiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO4443 | Digitalis purpurea | Species | Plantaginaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO3447 | Beaumontia murtonii | Species | Apocynaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO9296 | Lonicera periclymenum | Species | Caprifoliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
| NPO8545 | Hyssopus officinalis | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration| Organism ID | Organism Name | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
|---|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Biological Activity
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT152 | Individual protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 259.3 | nM | PubChem BioAssay data set |
| NPT135 | Individual protein | Chromobox protein homolog 1 | Homo sapiens | Potency | n.a. | 70794.6 | nM | PubChem BioAssay data set |
| NPT154 | Individual protein | Mothers against decapentaplegic homolog 3 | Homo sapiens | Potency | n.a. | 11220.2 | nM | PubChem BioAssay data set |
| NPT210 | Individual protein | Thyroid stimulating hormone receptor | Homo sapiens | Potency | n.a. | 477.5 | nM | PubChem BioAssay data set |
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | n.a. | 163.6 | nM | PubChem BioAssay data set |
| NPT10 | Individual protein | Geminin | Homo sapiens | Potency | n.a. | 6513.1 | nM | PubChem BioAssay data set |
| NPT101 | Individual protein | Glucagon-like peptide 1 receptor | Homo sapiens | Potency | n.a. | 501.2 | nM | PubChem BioAssay data set |
| NPT1283 | Individual protein | Paired box protein Pax-8 | Homo sapiens | AC50 | = | 1380.0 | nM | PubChem BioAssay data set |
| NPT152 | Individual protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 206.0 | nM | PubChem BioAssay data set |
| NPT537 | Individual protein | Ras-related protein Rab-9A | Homo sapiens | Potency | = | 1258.9 | nM | PubChem BioAssay data set |
| NPT3811 | Individual protein | Sodium/potassium-transporting ATPase alpha-1 chain | Canis lupus familiaris | IC50 | = | 500.0 | nM | PMID[10882359] |
| NPT538 | Individual protein | Niemann-Pick C1 protein | Homo sapiens | Potency | = | 1258.9 | nM | PubChem BioAssay data set |
| NPT7 | Individual protein | Thioredoxin reductase 1, cytoplasmic | Rattus norvegicus | Potency | n.a. | 89125.1 | nM | PubChem BioAssay data set |
| NPT20556 | Single protein | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 2.594 | % | DOI[10.6019/CHEMBL4495564] |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | 18.85 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT692 | Individual protein | Histone deacetylase 6 | Homo sapiens | Inhibition | = | -6.4 | % | HDAC6 screening dataset using tau-based substrate in an enzymatic assay yields selective inhibitors and activators |
| NPT3969 | Individual protein | Potassium-transporting ATPase alpha chain 2 | Homo sapiens | IC50 | = | 80.0 | nM | PMID[9685243] |
| NPT902 | Individual protein | UDP-glucuronosyltransferase 1A4 | Homo sapiens | Activity | = | 0.0 | pm/min/mg | PMID[10836148] |
| NPT861 | Individual protein | Isocitrate dehydrogenase [NADP] cytoplasmic | Homo sapiens | Potency | n.a. | 517.4 | nM | PubChem BioAssay data set |
| NPT29454 | Single protein | Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 | Homo sapiens | Inhibition | = | -17.77 | % | PMID[38318365] |
| NPT2890 | Protein complex | Sodium/potassium-transporting ATPase | Homo sapiens | IC50 | = | 500.0 | nM | PMID[12904068] |
| NPT2890 | Protein complex | Sodium/potassium-transporting ATPase | Homo sapiens | IC50 | = | 63.0 | nM | PMID[11689068] |
| NPT2890 | Protein complex | Sodium/potassium-transporting ATPase | Homo sapiens | IC50 | = | 250.0 | nM | PMID[11754591] |
| NPT2890 | Protein complex | Sodium/potassium-transporting ATPase | Homo sapiens | IC50 | = | 8.0 | nM | PMID[8421289] |
| NPT2890 | Protein complex | Sodium/potassium-transporting ATPase | Homo sapiens | IC50 | = | 120.0 | nM | PMID[3020248] |
| NPT2890 | Protein complex | Sodium/potassium-transporting ATPase | Homo sapiens | IC50 | = | 20.0 | nM | PMID[1895297] |
| NPT64 | Individual protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 517.1 | nM | PubChem BioAssay data set |
| NPT5 | Individual protein | Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 | Homo sapiens | Potency | n.a. | 4466.8 | nM | PubChem BioAssay data set |
| NPT64 | Individual protein | ATPase family AAA domain-containing protein 5 | Homo sapiens | Potency | n.a. | 1122.0 | nM | PubChem BioAssay data set |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT1475 | Cell line | WI-38 VA13 | Homo sapiens | IC50 | = | 1900000.0 | nM | PMID[17595134] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 18000000.0 | nM | PMID[17595134] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 620.0 | nM | PMID[17595134] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | > | 316000.0 | nM | PMID[17595134] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 0.24 | ug.mL-1 | PMID[16252914] |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | IC50 | = | 1.9 | ug.mL-1 | PMID[16252914] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 1.69 | ug.mL-1 | PMID[16252914] |
| NPT65 | Cell line | HepG2 | Homo sapiens | IC50 | = | 0.12 | ug.mL-1 | PMID[16252914] |
| NPT384 | Cell line | TK-10 | Homo sapiens | IC50 | = | 76.5 | nM | PMID[16309315] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 194.4 | nM | PMID[16309315] |
| NPT398 | Cell line | UACC-62 | Homo sapiens | IC50 | = | 348.8 | nM | PMID[16309315] |
| NPT453 | Cell line | HT-1080 | Homo sapiens | IC50 | = | 1500.0 | nM | PMID[14640513] |
| NPT91 | Cell line | KB | Homo sapiens | IC50 | = | 9610.0 | nM | PMID[16933890] |
| NPT639 | Cell line | NCI-H187 | Homo sapiens | IC50 | = | 9770.0 | nM | PMID[16933890] |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 600.0 | nM | PMID[21421322] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | IC50 | < | 50.0 | nM | PubChem BioAssay data set |
| NPT65 | Cell line | HepG2 | Homo sapiens | Potency | n.a. | 707.9 | nM | PubChem BioAssay data set |
| NPT367 | Cell line | MDA-N | Homo sapiens | GI50 | n.a. | 168.27 | nM | PubChem BioAssay data set |
| NPT368 | Cell line | SN12C | Homo sapiens | GI50 | n.a. | 34.91 | nM | PubChem BioAssay data set |
| NPT369 | Cell line | ACHN | Homo sapiens | GI50 | n.a. | 12.47 | nM | PubChem BioAssay data set |
| NPT370 | Cell line | NCI-H23 | Homo sapiens | GI50 | n.a. | 33.81 | nM | PubChem BioAssay data set |
| NPT371 | Cell line | UO-31 | Homo sapiens | GI50 | n.a. | 116.95 | nM | PubChem BioAssay data set |
| NPT116 | Cell line | HL-60 | Homo sapiens | GI50 | n.a. | 52.36 | nM | PubChem BioAssay data set |
| NPT372 | Cell line | HOP-92 | Homo sapiens | GI50 | n.a. | 188.36 | nM | PubChem BioAssay data set |
| NPT374 | Cell line | SF-539 | Homo sapiens | GI50 | n.a. | 35.65 | nM | PubChem BioAssay data set |
| NPT90 | Cell line | DU-145 | Homo sapiens | GI50 | n.a. | 39.99 | nM | PubChem BioAssay data set |
| NPT373 | Cell line | SK-MEL-5 | Homo sapiens | GI50 | n.a. | 44.67 | nM | PubChem BioAssay data set |
| NPT375 | Cell line | Malme-3M | Homo sapiens | GI50 | n.a. | 61.52 | nM | PubChem BioAssay data set |
| NPT376 | Cell line | A498 | Homo sapiens | GI50 | n.a. | 125.31 | nM | PubChem BioAssay data set |
| NPT111 | Cell line | K562 | Homo sapiens | GI50 | n.a. | 53.58 | nM | PubChem BioAssay data set |
| NPT112 | Cell line | MOLT-4 | Homo sapiens | GI50 | n.a. | 10.0 | nM | PubChem BioAssay data set |
| NPT377 | Cell line | OVCAR-3 | Homo sapiens | GI50 | n.a. | 36.73 | nM | PubChem BioAssay data set |
| NPT378 | Cell line | NCI/ADR-RES | Homo sapiens | GI50 | n.a. | 114.82 | nM | PubChem BioAssay data set |
| NPT379 | Cell line | HOP-62 | Homo sapiens | GI50 | n.a. | 39.99 | nM | PubChem BioAssay data set |
| NPT380 | Cell line | U-251 | Homo sapiens | GI50 | n.a. | 199.07 | nM | PubChem BioAssay data set |
| NPT381 | Cell line | OVCAR-8 | Homo sapiens | GI50 | n.a. | 147.23 | nM | PubChem BioAssay data set |
| NPT382 | Cell line | OVCAR-5 | Homo sapiens | GI50 | n.a. | 590.2 | nM | PubChem BioAssay data set |
| NPT82 | Cell line | MDA-MB-231 | Homo sapiens | GI50 | n.a. | 774.46 | nM | PubChem BioAssay data set |
| NPT383 | Cell line | SNB-19 | Homo sapiens | GI50 | n.a. | 851.14 | nM | PubChem BioAssay data set |
| NPT385 | Cell line | SR | Homo sapiens | GI50 | n.a. | 53.09 | nM | PubChem BioAssay data set |
| NPT384 | Cell line | TK-10 | Homo sapiens | GI50 | n.a. | 94.41 | nM | PubChem BioAssay data set |
| NPT323 | Cell line | SW-620 | Homo sapiens | GI50 | n.a. | 118.3 | nM | PubChem BioAssay data set |
| NPT455 | Cell line | NCI-H522 | Homo sapiens | GI50 | n.a. | 10.0 | nM | PubChem BioAssay data set |
| NPT386 | Cell line | KM12 | Homo sapiens | GI50 | n.a. | 712.85 | nM | PubChem BioAssay data set |
| NPT387 | Cell line | M14 | Homo sapiens | GI50 | n.a. | 225.94 | nM | PubChem BioAssay data set |
| NPT388 | Cell line | NCI-H322M | Homo sapiens | GI50 | n.a. | 169.04 | nM | PubChem BioAssay data set |
| NPT389 | Cell line | RPMI-8226 | Homo sapiens | GI50 | n.a. | 75.68 | nM | PubChem BioAssay data set |
| NPT456 | Cell line | OVCAR-4 | Homo sapiens | GI50 | n.a. | 66.22 | nM | PubChem BioAssay data set |
| NPT390 | Cell line | LOX IMVI | Homo sapiens | GI50 | n.a. | 54.7 | nM | PubChem BioAssay data set |
| NPT457 | Cell line | BT-549 | Homo sapiens | GI50 | n.a. | 37.24 | nM | PubChem BioAssay data set |
| NPT147 | Cell line | SK-MEL-2 | Homo sapiens | GI50 | n.a. | 320.63 | nM | PubChem BioAssay data set |
| NPT391 | Cell line | HCC 2998 | Homo sapiens | GI50 | n.a. | 234.96 | nM | PubChem BioAssay data set |
| NPT81 | Cell line | A549 | Homo sapiens | GI50 | n.a. | 18.32 | nM | PubChem BioAssay data set |
| NPT392 | Cell line | SNB-75 | Homo sapiens | GI50 | n.a. | 299.23 | nM | PubChem BioAssay data set |
| NPT393 | Cell line | HCT-116 | Homo sapiens | GI50 | n.a. | 25.12 | nM | PubChem BioAssay data set |
| NPT148 | Cell line | HCT-15 | Homo sapiens | GI50 | n.a. | 101.39 | nM | PubChem BioAssay data set |
| NPT395 | Cell line | SF-268 | Homo sapiens | GI50 | n.a. | 36.73 | nM | PubChem BioAssay data set |
| NPT394 | Cell line | EKVX | Homo sapiens | GI50 | n.a. | 87.3 | nM | PubChem BioAssay data set |
| NPT306 | Cell line | PC-3 | Homo sapiens | GI50 | n.a. | 148.94 | nM | PubChem BioAssay data set |
| NPT146 | Cell line | SK-OV-3 | Homo sapiens | GI50 | n.a. | 110.66 | nM | PubChem BioAssay data set |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | GI50 | n.a. | 16.79 | nM | PubChem BioAssay data set |
| NPT396 | Cell line | T47D | Homo sapiens | GI50 | n.a. | 291.74 | nM | PubChem BioAssay data set |
| NPT398 | Cell line | UACC-62 | Homo sapiens | GI50 | n.a. | 359.75 | nM | PubChem BioAssay data set |
| NPT400 | Cell line | MDA-MB-435 | Homo sapiens | GI50 | n.a. | 217.27 | nM | PubChem BioAssay data set |
| NPT308 | Cell line | CAKI-1 | Homo sapiens | GI50 | n.a. | 35.73 | nM | PubChem BioAssay data set |
| NPT458 | Cell line | IGROV-1 | Homo sapiens | GI50 | n.a. | 66.83 | nM | PubChem BioAssay data set |
| NPT399 | Cell line | SF-295 | Homo sapiens | GI50 | n.a. | 47.32 | nM | PubChem BioAssay data set |
| NPT402 | Cell line | Hs-578T | Homo sapiens | GI50 | n.a. | 67.3 | nM | PubChem BioAssay data set |
| NPT401 | Cell line | 786-0 | Homo sapiens | GI50 | n.a. | 44.67 | nM | PubChem BioAssay data set |
| NPT403 | Cell line | UACC-257 | Homo sapiens | GI50 | n.a. | 303.39 | nM | PubChem BioAssay data set |
| NPT404 | Cell line | CCRF-CEM | Homo sapiens | GI50 | n.a. | 29.72 | nM | PubChem BioAssay data set |
| NPT405 | Cell line | NCI-H226 | Homo sapiens | GI50 | n.a. | 1273.5 | nM | PubChem BioAssay data set |
| NPT139 | Cell line | HT-29 | Homo sapiens | GI50 | n.a. | 208.93 | nM | PubChem BioAssay data set |
| NPT170 | Cell line | SK-MEL-28 | Homo sapiens | GI50 | n.a. | 568.85 | nM | PubChem BioAssay data set |
| NPT407 | Cell line | COLO 205 | Homo sapiens | GI50 | n.a. | 439.54 | nM | PubChem BioAssay data set |
| NPT406 | Cell line | RXF 393 | Homo sapiens | GI50 | n.a. | 14.45 | nM | PubChem BioAssay data set |
| NPT83 | Cell line | MCF7 | Homo sapiens | IC50 | = | 9100.0 | nM | PMID[22316168] |
| NPT396 | Cell line | T47D | Homo sapiens | IC50 | = | 2530.0 | nM | PMID[22316168] |
| NPT134 | Cell line | SK-BR-3 | Homo sapiens | IC50 | = | 4420.0 | nM | PMID[22316168] |
| NPT402 | Cell line | Hs-578T | Homo sapiens | IC50 | = | 1022.0 | nM | PMID[22316168] |
| NPT402 | Cell line | Hs-578T | Homo sapiens | IC50 | = | 92300.0 | nM | PMID[22316168] |
| NPT81 | Cell line | A549 | Homo sapiens | IC50 | = | 1680.0 | nM | PMID[30798081] |
| NPT180 | Cell line | HCT-8 | Homo sapiens | IC50 | = | 2480.0 | nM | PMID[30798081] |
| NPT858 | Cell line | LNCaP | Homo sapiens | IC50 | = | 3700.0 | nM | PMID[30798081] |
| NPT306 | Cell line | PC-3 | Homo sapiens | IC50 | = | 2410.0 | nM | PMID[30798081] |
| NPT397 | Cell line | NCI-H460 | Homo sapiens | IC50 | = | 920.0 | nM | PMID[30798081] |
| NPT171 | Cell line | MRC5 | Homo sapiens | IC50 | = | 1160.0 | nM | PMID[30798081] |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | n.a. | 1450.0 | nM | PubChem BioAssay data set |
| NPT189 | Cell line | Vero | Chlorocebus aethiops | CC50 | = | 27540.0 | nM | PMID[30798081] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition index | = | 0.2572 | n.a. | DOI[10.1101/2020.04.03.023846] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 60.03 | % | DOI[10.21203/rs.3.rs-23951/v1] |
| NPT20555 | Organism | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -0.17 | % | DOI[10.6019/CHEMBL4495565] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | Activity | = | 60.0 | % | PMID[9341924] |
| NPT20529 | Non-molecular | NON-PROTEIN TARGET | n.a. | IC50 | = | 8950.0 | nM | PMID[16933890] |
| NPT2858 | Tissue | Left atrium | Cavia porcellus | Activity | = | 130.0 | % | PMID[146738] |
| NPT2254 | Organism | Schistosoma mansoni | Schistosoma mansoni | In vitro activity | n.a. | n.a. | n.a. | Using ChEMBL to complement schistosome drug discovery |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | IC50 ratio | = | 1800.0 | n.a. | PMID[12109909] |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | IC50 ratio | = | 16.0 | n.a. | PMID[12109909] |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | IC50 ratio | = | 14.0 | n.a. | PMID[12109909] |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | Relative Ki | = | 2.0 | n.a. | PMID[12109909] |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | Ki | = | 1000.0 | nM | PMID[12109909] |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | Ki | = | 880.0 | nM | PMID[12109909] |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | IC50 ratio | = | 4900.0 | n.a. | PMID[12109909] |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | IC50 ratio | = | 4.1 | n.a. | PMID[12109909] |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | IC50 ratio | = | 6.7 | n.a. | PMID[12109909] |
| NPT897 | Others | Monoclonal antibody (mAb) | n.a. | IC50 ratio | = | 3.6 | n.a. | PMID[12109909] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 117.0 | nM | PMID[6321733] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 63.1 | nM | DOI[10.1016/S0960-894X(97)00039-5] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.00087 | ug.mL-1 | PMID[12459012] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 0.0092 | ug.mL-1 | PMID[12459012] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 86.0 | % | PMID[17595134] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 74.0 | % | PMID[17595134] |
| NPT2 | Others | Unspecified | n.a. | Activity | = | 66.0 | % | PMID[17595134] |
| NPT2 | Others | Unspecified | n.a. | Ratio IC50 | = | 23000.0 | n.a. | PMID[2089119] |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 231.1 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | AC50 | = | 467.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 2059.6 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | < | 160.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | > | 80000.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 3530.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 670.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | AC50 | = | 233.9 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 199.5 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 794.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 631.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 1995.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 259.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 35481.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 1122.0 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | Potency | n.a. | 366.3 | nM | PubChem BioAssay data set |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 350.0 | nM | PMID[222907] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 60.0 | % | PMID[146738] |
| NPT2 | Others | Unspecified | n.a. | Inhibition | = | 0.0 | % | PMID[146738] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 460.0 | nM | PMID[141522] |
| NPT2 | Others | Unspecified | n.a. | IC50 | = | 500.0 | nM | PMID[141522] |
| NPT2 | Others | Unspecified | n.a. | ID50 | = | 0.096 | umol | PMID[214561] |
| NPT2 | Others | Unspecified | n.a. | ID50 | = | 0.035 | umol | PMID[214561] |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | Increase (Emax) | = | 200.0 | % | PMID[11754591] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | Emax | = | 3.0 | uM | PMID[9341924] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | EC50 | = | 570.0 | nM | PMID[10882359] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | Dose | = | 0.38 | uM | PMID[3950906] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | Dose | = | 0.64 | uM | PMID[3950906] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | Dose | = | 2.5 | uM | PMID[3950906] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | Emax | = | 200.0 | % | PMID[9341924] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | EC50 | = | 600.0 | nM | PMID[9341924] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | Delta F75 | = | 0.0000011 | M l-1 | PMID[7143360] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | Relative ionotropic activity | = | 1.0 | n.a. | PMID[3981544] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | Relative ionotropic activity | = | 1.2 | n.a. | PMID[3981544] |
| NPT938 | Organism | Cavia porcellus | Cavia porcellus | EC50 | = | 57.0 | nM | PMID[11689068] |
Experimental ADME
| Experiment Model | Experiment Tissue | ADME Type | ADME Relation | ADME Value | ADME Unit | Reference |
|---|
Experimental Toxicity
| Experiment Model | Experiment Organism | Toxicity Type | Toxicity Relation | Toxicity Value | Toxicity Unit | Reference |
|---|
Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria
| Hepatotoxicity | Carcinogenicity | Mutagenicity | Cardiotoxicity | Respiratory Toxicity | Eye Irritation | Endocrine Disruption |
|---|---|---|---|---|---|---|
|
|
|
|
|
|
|
Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]
  Chemically structural similarityTop-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)
Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.
●  The left chart: Distribution of similarity level between NPC295110 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.5 or Top200).
| Similarity Score | Similarity Level | Natural Product ID |
|---|---|---|
| 1.0 | High Similarity | NPC268829 |
| 0.8 | Intermediate Similarity | NPC222875 |
| 0.8 | Intermediate Similarity | NPC25177 |
| 0.7833 | Intermediate Similarity | NPC160583 |
| 0.7833 | Intermediate Similarity | NPC189588 |
| 0.7797 | Intermediate Similarity | NPC220217 |
| 0.7377 | Intermediate Similarity | NPC187302 |
| 0.697 | Remote Similarity | NPC119855 |
| 0.6719 | Remote Similarity | NPC196931 |
| 0.6719 | Remote Similarity | NPC480913 |
| 0.6667 | Remote Similarity | NPC97487 |
| 0.6462 | Remote Similarity | NPC10232 |
| 0.6418 | Remote Similarity | NPC196471 |
| 0.6364 | Remote Similarity | NPC72772 |
| 0.6216 | Remote Similarity | NPC99620 |
| 0.6216 | Remote Similarity | NPC471633 |
| 0.6053 | Remote Similarity | NPC5311 |
| 0.5974 | Remote Similarity | NPC199428 |
| 0.5974 | Remote Similarity | NPC84949 |
| 0.5974 | Remote Similarity | NPC109448 |
| 0.5974 | Remote Similarity | NPC480562 |
| 0.5974 | Remote Similarity | NPC74945 |
| 0.5974 | Remote Similarity | NPC310341 |
| 0.5974 | Remote Similarity | NPC31354 |
| 0.5974 | Remote Similarity | NPC69576 |
| 0.5823 | Remote Similarity | NPC484202 |
| 0.5823 | Remote Similarity | NPC93883 |
| 0.5821 | Remote Similarity | NPC186668 |
| 0.5679 | Remote Similarity | NPC72260 |
| 0.5584 | Remote Similarity | NPC473852 |
| 0.5542 | Remote Similarity | NPC30483 |
| 0.5542 | Remote Similarity | NPC470897 |
| 0.5513 | Remote Similarity | NPC196429 |
| 0.5476 | Remote Similarity | NPC236973 |
| 0.5476 | Remote Similarity | NPC292467 |
| 0.5443 | Remote Similarity | NPC469750 |
| 0.5443 | Remote Similarity | NPC77299 |
| 0.5443 | Remote Similarity | NPC480906 |
| 0.5443 | Remote Similarity | NPC480915 |
| 0.5375 | Remote Similarity | NPC76572 |
| 0.5375 | Remote Similarity | NPC193382 |
| 0.5375 | Remote Similarity | NPC480914 |
| 0.5309 | Remote Similarity | NPC253456 |
| 0.5309 | Remote Similarity | NPC159338 |
| 0.5309 | Remote Similarity | NPC88668 |
| 0.5309 | Remote Similarity | NPC250556 |
| 0.5303 | Remote Similarity | NPC481201 |
| 0.5301 | Remote Similarity | NPC329905 |
| 0.5301 | Remote Similarity | NPC488161 |
| 0.5301 | Remote Similarity | NPC16569 |
| 0.5287 | Remote Similarity | NPC486143 |
| 0.5287 | Remote Similarity | NPC55532 |
| 0.5287 | Remote Similarity | NPC486142 |
| 0.5287 | Remote Similarity | NPC486149 |
| 0.5244 | Remote Similarity | NPC483822 |
| 0.5244 | Remote Similarity | NPC277374 |
| 0.5244 | Remote Similarity | NPC305574 |
| 0.5185 | Remote Similarity | NPC243196 |
| 0.5169 | Remote Similarity | NPC486146 |
| 0.5135 | Remote Similarity | NPC475030 |
| 0.5122 | Remote Similarity | NPC146456 |
| 0.5122 | Remote Similarity | NPC171619 |
| 0.5119 | Remote Similarity | NPC480907 |
| 0.5063 | Remote Similarity | NPC158344 |
| 0.5063 | Remote Similarity | NPC474418 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC295110 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).
  Bioactivity similaritySimilarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.
