NPASS Compound

Natural Product: NPC608063

Natural Product ID	NPC608063
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	GPMRZMZJGUPWPZ-BRBRUXTHSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL393052
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 97103 0 0 0 0 0 0 0 0999 V2000 5.4765 2.2995 -1.8409 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8594 1.9714 -0.4729 C 0 0 1 0 0 0 0 0 0 0 0 0 3.5026 1.8818 -0.6896 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7244 1.4045 0.3100 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0371 0.2344 -0.0166 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6560 0.4226 0.0566 C 0 0 1 0 0 0 0 0 0 0 0 0 0.1274 0.2476 -1.3433 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3578 0.4879 -1.2420 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9791 -0.7556 -0.6119 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.0779 -1.7352 -1.7138 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0679 -2.2229 -2.1950 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3643 -0.3812 -0.1694 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.1883 0.2155 -1.2849 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5607 -0.3690 -1.4232 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3052 -0.5161 -0.1273 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.5330 -1.3685 -0.3816 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7025 0.8549 0.3992 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.0486 1.2762 0.0028 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0817 1.5485 0.8082 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2505 1.9344 0.0387 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.4003 2.2588 0.4737 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8908 1.8885 -1.2913 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5541 1.4998 -1.3703 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5462 0.7532 1.9051 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3820 -0.2018 2.1114 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4720 -1.1235 0.9449 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0563 -2.3074 1.3981 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1081 -1.5369 0.3868 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3131 -2.2099 1.4574 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0725 -1.4592 1.7973 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1921 -1.2564 0.5508 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7862 -2.5770 0.2220 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0085 -0.5149 0.9988 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5695 1.1409 1.5447 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5848 0.0951 1.1120 C 0 0 2 0 0 0 0 0 0 0 0 0 5.2939 -0.2808 2.2260 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4031 0.6507 -0.0039 C 0 0 2 0 0 0 0 0 0 0 0 0 6.7122 0.6101 0.3025 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5521 -0.1677 -0.4268 C 0 0 2 0 0 0 0 0 0 0 0 0 7.9777 -1.2036 0.4432 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0013 -1.9400 -0.1511 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2445 -1.1036 0.0822 C 0 0 1 0 0 0 0 0 0 0 0 0 11.3745 -1.7182 -0.4702 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0461 0.2767 -0.4200 C 0 0 2 0 0 0 0 0 0 0 0 0 10.3433 1.1645 0.6220 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7112 0.5804 -1.0024 C 0 0 1 0 0 0 0 0 0 0 0 0 8.7892 0.4299 -2.3908 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7259 2.7732 -2.5072 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2815 3.0733 -1.7207 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8246 1.3914 -2.3605 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0258 2.8084 0.2359 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9765 2.2129 0.5596 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4883 1.4785 0.3484 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2980 -0.7663 -1.7321 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6134 1.0101 -1.9941 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7189 0.5714 -2.3055 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6141 1.3883 -0.6558 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1353 -2.0848 -2.1764 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2795 0.4197 0.6075 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2960 1.3085 -1.1390 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6978 0.1042 -2.2748 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1489 0.3918 -2.0224 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6177 -1.2992 -2.0159 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3627 -2.3564 0.0738 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4247 -0.8668 0.0532 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6261 -1.5284 -1.4640 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9548 1.5896 0.0417 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0740 1.4965 1.8942 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9528 2.2691 -1.9074 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5176 0.5993 -2.0183 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3343 1.7185 2.3894 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4752 0.3394 2.3306 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6065 -0.7279 3.0730 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4363 0.3119 2.2630 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7822 -2.0864 2.0579 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3607 -2.3218 -0.3607 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9292 -2.2572 2.3800 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0650 -3.2700 1.2120 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2018 -0.5323 2.3581 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4529 -2.1328 2.4626 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4803 -2.9755 1.0987 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7957 -1.2340 1.3495 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2180 0.0750 1.9429 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0266 2.0958 1.8483 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9552 0.7138 2.3659 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9658 -0.8004 0.8105 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1544 0.1954 2.2337 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2477 -0.0451 -0.8810 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0687 -0.7296 -1.2660 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1187 -2.8705 0.4416 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8284 -2.1692 -1.2042 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4085 -1.1140 1.1787 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4361 -1.5272 -1.4413 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8479 0.4634 -1.1878 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0459 0.7758 1.4968 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5129 1.6774 -0.8366 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4297 1.0465 -2.7910 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 6 10 11 2 0 9 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 6 15 17 1 0 17 18 1 0 18 19 2 0 19 20 1 0 20 21 2 0 20 22 1 0 22 23 1 0 17 24 1 0 24 25 1 0 25 26 1 0 26 27 1 1 26 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 6 31 33 1 0 4 34 1 0 34 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 44 46 1 0 46 47 1 0 37 2 1 0 46 39 1 0 33 6 1 0 31 9 1 0 28 12 1 0 26 15 1 0 23 18 1 0 1 48 1 0 1 49 1 0 1 50 1 0 2 51 1 1 4 52 1 1 6 53 1 1 7 54 1 0 7 55 1 0 8 56 1 0 8 57 1 0 10 58 1 0 12 59 1 1 13 60 1 0 13 61 1 0 14 62 1 0 14 63 1 0 16 64 1 0 16 65 1 0 16 66 1 0 17 67 1 6 19 68 1 0 23 69 1 0 23 70 1 0 24 71 1 0 24 72 1 0 25 73 1 0 25 74 1 0 27 75 1 0 28 76 1 6 29 77 1 0 29 78 1 0 30 79 1 0 30 80 1 0 32 81 1 0 33 82 1 0 33 83 1 0 34 84 1 0 34 85 1 0 35 86 1 6 36 87 1 0 37 88 1 6 39 89 1 6 41 90 1 0 41 91 1 0 42 92 1 1 43 93 1 0 44 94 1 6 45 95 1 0 46 96 1 6 47 97 1 0 M END

Standard InCHIKey	GPMRZMZJGUPWPZ-BRBRUXTHSA-N
Standard InCHI	InChI=1S/C34H50O13/c1-17-29(47-30-28(40)27(39)24(37)15-44-30)23(36)12-26(45-17)46-19-3-8-32(16-35)21-4-7-31(2)20(18-11-25(38)43-14-18)6-10-34(31,42)22(21)5-9-33(32,41)13-19/h11,16-17,19-24,26-30,36-37,39-42H,3-10,12-15H2,1-2H3/t17-,19+,20-,21+,22-,23+,24-,26+,27+,28-,29-,30+,31-,32+,33+,34+/m1/s1
SMILES	C[C@H]1O[C@@H](O[C@H]2CC[C@]3(C=O)[C@H]4CC[C@]5(C)[C@@H](C6=CC(=O)OC6)CC[C@]5(O)[C@@H]4CC[C@]3(O)C2)C[C@H](O)[C@@H]1O[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO54515	Erysimum cheiranthoides L.	Genus	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO46824	Erysimum hieraciifolium auct.	Genus	Brassicaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1
Activity	1

Activity Type	# Activity
Unchecked	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT28438	Unchecked	Unchecked	n.a.	IC50	=	160.0	nM	PMID[17618121]
NPT28438	Unchecked	Unchecked	n.a.	Activity	=	0.341	n.a.	PMID[17618121]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC608063 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	17338
0.1-0.2	28853
0.2-0.3	3326
0.3-0.4	171
0.4-0.5	83
0.5-0.6	49
0.6-0.7	22
0.7-0.8	1
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8481	Intermediate Similarity	NPC219085
0.7396	Intermediate Similarity	NPC329675
0.7349	Intermediate Similarity	NPC158344
0.7333	Intermediate Similarity	NPC475556
0.7333	Intermediate Similarity	NPC311706
0.7143	Intermediate Similarity	NPC32793
0.7143	Intermediate Similarity	NPC116075
0.7093	Intermediate Similarity	NPC17896
0.7093	Intermediate Similarity	NPC469755
0.7093	Intermediate Similarity	NPC284406
0.7093	Intermediate Similarity	NPC197707
0.7093	Intermediate Similarity	NPC251866
0.7083	Intermediate Similarity	NPC329636
0.6842	Remote Similarity	NPC146857
0.6632	Remote Similarity	NPC125077
0.6556	Remote Similarity	NPC180079
0.6535	Remote Similarity	NPC194716
0.6517	Remote Similarity	NPC6108
0.6517	Remote Similarity	NPC89514
0.6264	Remote Similarity	NPC10823
0.6224	Remote Similarity	NPC469749
0.618	Remote Similarity	NPC474418
0.6162	Remote Similarity	NPC247190
0.6154	Remote Similarity	NPC157376
0.6154	Remote Similarity	NPC142066
0.6154	Remote Similarity	NPC603972
0.6122	Remote Similarity	NPC59288
0.6111	Remote Similarity	NPC99728
0.6111	Remote Similarity	NPC87250
0.6111	Remote Similarity	NPC244402
0.6111	Remote Similarity	NPC50305
0.6087	Remote Similarity	NPC604978
0.6078	Remote Similarity	NPC475590
0.6044	Remote Similarity	NPC84987
0.6	Remote Similarity	NPC72260
0.5957	Remote Similarity	NPC9499
0.5957	Remote Similarity	NPC471360
0.5957	Remote Similarity	NPC469751
0.5957	Remote Similarity	NPC471361
0.5957	Remote Similarity	NPC86159
0.5957	Remote Similarity	NPC469752
0.5957	Remote Similarity	NPC469754
0.5957	Remote Similarity	NPC70542
0.581	Remote Similarity	NPC120390
0.58	Remote Similarity	NPC55532
0.57	Remote Similarity	NPC475629
0.566	Remote Similarity	NPC74259
0.5647	Remote Similarity	NPC72772
0.5638	Remote Similarity	NPC34390
0.5625	Remote Similarity	NPC471359
0.56	Remote Similarity	NPC188234
0.5532	Remote Similarity	NPC484211
0.549	Remote Similarity	NPC208193
0.5474	Remote Similarity	NPC469750
0.5417	Remote Similarity	NPC480914
0.5392	Remote Similarity	NPC264336
0.5385	Remote Similarity	NPC329986
0.5385	Remote Similarity	NPC140092
0.5368	Remote Similarity	NPC309034
0.5361	Remote Similarity	NPC77319
0.5361	Remote Similarity	NPC471351
0.5361	Remote Similarity	NPC471355
0.5347	Remote Similarity	NPC236973
0.5347	Remote Similarity	NPC32177
0.5347	Remote Similarity	NPC469756
0.5347	Remote Similarity	NPC275901
0.5263	Remote Similarity	NPC99620
0.5263	Remote Similarity	NPC471633
0.5258	Remote Similarity	NPC243196
0.5253	Remote Similarity	NPC469753
0.5253	Remote Similarity	NPC471354
0.5253	Remote Similarity	NPC27507
0.5155	Remote Similarity	NPC5311
0.5155	Remote Similarity	NPC77299
0.5155	Remote Similarity	NPC480906
0.5149	Remote Similarity	NPC173555
0.5143	Remote Similarity	NPC232785
0.5143	Remote Similarity	NPC486139
0.514	Remote Similarity	NPC475219
0.5102	Remote Similarity	NPC76572
0.5102	Remote Similarity	NPC193382
0.5051	Remote Similarity	NPC484212
0.5047	Remote Similarity	NPC486138
0.5047	Remote Similarity	NPC276838

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC608063 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6514
0.1-0.2	2543
0.2-0.3	79
0.3-0.4	1
0.4-0.5	7
0.5-0.6	4
0.6-0.7	1
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7093	Intermediate Similarity	NPD7319	Approved
0.6	Remote Similarity	NPD8294	Phase 4
0.5644	Remote Similarity	NPD8377	Phase 4
0.5361	Remote Similarity	NPD8335	Phase 4
0.5306	Remote Similarity	NPD8380	Approved
0.5149	Remote Similarity	NPD8296	Phase 4

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data