NPASS Compound

Natural Product: NPC94272

Natural Product ID	NPC94272
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Spongiosides A
IUPAC Name	(2S,3R,4R,5R,6S)-2-[(2R,3S,4S,5R,6R)-4-hydroxy-2-(hydroxymethyl)-6-[[(3S,8S,9S,10R,13S,14S,16S,17R)-17-[(2S,3S)-3-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-16-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL486480
PubChem CID	11040408
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 158165 0 0 0 0 0 0 0 0999 V2000 5.6481 -2.9340 3.9939 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8643 -1.6849 3.4012 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6948 -1.7971 2.1478 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0275 -2.6525 1.2711 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3280 -1.9906 0.2724 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5302 -1.0616 0.8779 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1674 -1.1826 0.6699 C 0 0 1 0 0 0 0 0 0 0 0 0 2.4355 -1.5681 1.9456 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9966 -1.8421 1.4812 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3354 -0.5750 1.1045 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2160 0.2667 0.2637 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6396 1.2377 -0.4912 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7835 1.5208 -0.5403 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5957 0.4596 0.1224 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8498 -0.8335 0.1674 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6138 -2.0383 0.5285 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0664 -2.0765 0.2184 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7481 -0.7539 0.2050 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8898 0.2064 -0.5811 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7303 1.4163 -0.7879 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1566 0.8791 -0.6386 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.9872 -0.6308 -0.6189 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2101 -1.3115 -0.3382 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2421 -0.8722 -1.4154 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.5460 -1.5606 -1.2073 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.6138 -1.1566 -2.1719 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3299 -1.4000 -3.6246 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5600 -0.9222 -4.4005 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.0805 -2.8567 -3.8575 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7586 -1.1419 -2.6703 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2938 -2.7981 -0.3027 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5707 1.3349 0.6036 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6558 2.1603 0.5953 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2640 3.4436 1.0631 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3554 4.2820 0.8355 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9456 5.7426 0.8732 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3972 6.0769 2.1169 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4196 4.0391 1.8833 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.1831 2.7055 2.5137 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7750 1.6590 1.5012 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8888 1.2378 0.7916 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1205 2.7884 3.4264 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6891 4.1923 1.3723 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9324 -0.2536 1.6101 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6517 0.1295 0.1961 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0946 0.1212 2.3774 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3740 -1.4279 -0.6705 C 0 0 1 0 0 0 0 0 0 0 0 0 7.3618 -0.6027 0.0617 C 0 0 2 0 0 0 0 0 0 0 0 0 7.0737 -0.5089 1.5592 C 0 0 2 0 0 0 0 0 0 0 0 0 8.1243 0.0598 2.2447 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9021 1.3808 2.6067 C 0 0 2 0 0 0 0 0 0 0 0 0 8.9868 2.0956 2.1048 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8185 3.4804 2.1693 C 0 0 1 0 0 0 0 0 0 0 0 0 7.9541 4.0220 1.0594 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3009 3.8957 3.5285 C 0 0 1 0 0 0 0 0 0 0 0 0 8.5683 2.7944 4.5488 C 0 0 2 0 0 0 0 0 0 0 0 0 7.9040 1.4967 4.1030 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5556 1.5131 4.5678 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9939 3.2074 5.7477 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0027 5.0190 3.9502 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3064 0.6918 -0.4588 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9719 -2.5466 -1.2886 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7612 -2.5561 -2.6674 C 0 0 2 0 0 0 0 0 0 0 0 0 6.0763 -3.7256 -2.9528 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5474 -3.7415 -4.2452 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3126 -2.8705 -4.2437 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5515 -3.1357 -5.2212 C 0 0 1 0 0 0 0 0 0 0 0 0 7.9415 -3.3565 -4.6511 C 0 0 2 0 0 0 0 0 0 0 0 0 8.0676 -2.4811 -3.4272 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2613 -1.1736 -3.8865 O 0 0 0 0 0 0 0 0 0 0 0 0 8.8369 -2.8692 -5.6085 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4178 -3.7586 -6.4413 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6824 -3.0608 4.2183 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4532 -1.1209 4.1916 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9256 -1.1369 3.2912 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6121 -2.3901 2.4541 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7245 -2.7766 -0.2672 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9103 -1.9809 -0.0490 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7901 -2.5388 2.3488 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5011 -0.8205 2.7349 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0318 -2.5419 0.6502 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4584 -2.2858 2.3620 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3012 1.8560 -1.1110 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0898 1.5129 -1.6423 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0393 2.5408 -0.1410 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7812 0.8573 1.1714 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3882 -1.0322 -0.8322 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1045 -2.9533 0.1018 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4758 -2.1861 1.6423 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1828 -2.5704 -0.7724 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5083 -2.7078 1.0578 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6471 -0.2201 -1.5804 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4855 2.2101 -0.0870 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6499 1.8343 -1.8056 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8054 1.2660 -1.4197 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6454 -0.8666 -1.6825 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6758 -0.9560 0.6153 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4495 0.2148 -1.3518 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3969 -2.6853 -1.2770 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9217 -1.3246 -0.1851 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6920 -0.0241 -2.0789 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5931 -1.5995 -1.8660 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5223 -0.7294 -3.9712 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4648 -1.4130 -4.0509 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3224 -1.0443 -5.4746 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5890 0.1879 -4.2344 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3467 -3.3178 -3.2011 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7983 -2.9925 -4.9287 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0605 -3.3945 -3.7348 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0987 -1.8462 -2.6906 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4659 -3.2678 -1.3100 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4806 -3.3531 0.1324 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2051 -3.1261 0.2936 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1089 2.3688 -0.3907 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7570 4.0898 -0.1836 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8923 6.3333 0.8100 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3257 6.0177 0.0202 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0176 5.2721 2.5933 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2808 4.8204 2.6809 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1234 2.3539 2.9737 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3755 0.7827 2.0555 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1486 1.8903 0.0939 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3803 2.5497 4.3309 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1721 4.9656 1.7494 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2977 -0.9112 2.2820 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6870 0.8063 1.7718 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9626 -0.4075 2.0011 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0049 0.2129 -0.8901 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1829 0.9924 0.7149 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0766 1.2108 2.2021 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0786 -0.1609 2.7436 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6966 -0.0539 3.1515 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8881 -0.8568 -1.5066 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3777 -0.9883 -0.1498 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2523 0.2356 1.6142 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9202 1.7590 2.2643 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8384 3.9177 2.0452 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3722 5.0060 0.7463 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0213 3.3799 0.1511 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8963 4.1957 1.3685 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2474 4.1620 3.4337 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6519 2.6931 4.6825 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4090 0.6500 4.5689 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4196 2.2389 5.2269 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5484 4.1083 5.6667 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0306 5.7503 3.2829 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4028 1.0874 -0.3769 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1533 -1.6675 -3.0087 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2403 -4.7494 -4.5669 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5684 -1.7911 -4.3198 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7314 -2.9634 -3.2837 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6429 -3.1631 -5.0901 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3199 -2.0579 -5.3130 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1244 -4.4297 -4.4465 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9315 -2.7780 -2.7901 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1763 -0.8296 -3.7075 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7734 -2.8844 -5.2662 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1979 -4.2807 -6.7296 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 2 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 24 30 1 0 23 31 1 0 21 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 35 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 39 42 1 0 38 43 1 0 18 44 1 1 11 45 1 0 10 46 1 1 5 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 53 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 56 59 1 0 55 60 1 0 48 61 1 0 47 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 65 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 68 71 1 0 67 72 1 0 49 3 1 0 57 51 1 0 69 63 1 0 45 7 1 0 15 10 1 0 22 18 1 0 40 33 1 0 19 14 1 0 1 73 1 0 2 74 1 0 2 75 1 0 3 76 1 1 5 77 1 6 7 78 1 6 8 79 1 0 8 80 1 0 9 81 1 0 9 82 1 0 12 83 1 0 13 84 1 0 13 85 1 0 14 86 1 1 15 87 1 6 16 88 1 0 16 89 1 0 17 90 1 0 17 91 1 0 19 92 1 6 20 93 1 0 20 94 1 0 21 95 1 6 22 96 1 6 23 97 1 1 24 98 1 6 25 99 1 0 25100 1 0 26101 1 0 26102 1 0 27103 1 0 28104 1 0 28105 1 0 28106 1 0 29107 1 0 29108 1 0 29109 1 0 30110 1 0 31111 1 0 31112 1 0 31113 1 0 33114 1 6 35115 1 6 36116 1 0 36117 1 0 37118 1 0 38119 1 1 39120 1 1 40121 1 1 41122 1 0 42123 1 0 43124 1 0 44125 1 0 44126 1 0 44127 1 0 45128 1 0 45129 1 0 46130 1 0 46131 1 0 46132 1 0 47133 1 6 48134 1 1 49135 1 6 51136 1 6 53137 1 6 54138 1 0 54139 1 0 54140 1 0 55141 1 6 56142 1 1 57143 1 1 58144 1 0 59145 1 0 60146 1 0 61147 1 0 63148 1 1 65149 1 6 66150 1 0 66151 1 0 66152 1 0 67153 1 6 68154 1 1 69155 1 1 70156 1 0 71157 1 0 72158 1 0 M END

Standard InCHIKey	CMVKGKGHOKTWFO-JIOSVILMSA-N
Standard InCHI	InChI=1S/C51H86O21/c1-20(2)8-11-29(54)21(3)33-30(68-48-42(63)39(60)36(57)31(18-52)69-48)17-28-26-10-9-24-16-25(12-14-50(24,6)27(26)13-15-51(28,33)7)67-49-45(72-47-41(62)38(59)35(56)23(5)66-47)43(64)44(32(19-53)70-49)71-46-40(61)37(58)34(55)22(4)65-46/h9,20-23,25-49,52-64H,8,10-19H2,1-7H3/t21-,22+,23+,25+,26-,27+,28+,29+,30+,31-,32-,33+,34+,35+,36-,37-,38-,39+,40-,41-,42-,43+,44-,45-,46+,47+,48-,49-,50+,51+/m1/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2CC[C@]3(C(=CC[C@@H]4[C@@H]3CC[C@]3([C@H]4C[C@@H]([C@@H]3[C@@H]([C@H](CCC(C)C)O)C)O[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)C)C2)C)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1034.57	Volume:	1004.158 ? Van der Waals volume.
Dense:	1.03	LogP:	1.582 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.408 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.443 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	44.0
TPSA:	336.83 ? Topological Polar Surface Area.	H-Bond Acceptor:	21.0
H-Bond Donor:	13.0	Rings:	8.0
Heavy Atoms:	21.0

MedChem Properties

QED Drug-Likeness Score:	0.085	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.675	Fsp³:	0.961
MCE-18:	162.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.704	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.349	Promiscuous compounds:	0.003

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.382	MDCK Permeability:	-5.079
Pgp-inhibitor:	0.0	Pgp-substrate:	0.995
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.01
20% Bioavailability (F20%):	0.003	30% Bioavailability (F30%):	0.843
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.003
Plasma Protein Binding (PPB):	61.042%	Volume Distribution (VD):	-0.263
Fu:	26.91% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.002
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.003	CYP3A4-substrate:	0.953
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.847
HLM stability:	0.105 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.44

Half-life (T1/2):

3.936

ADMET: Toxicity

hERG Blockers:	0.014	hERG Blockers (10um):	0.057
Human Hepatotoxicity (H-HT):	0.447	Drug-induced Liver Injury (DILI):	0.919
AMES Toxicity:	0.906	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.001	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.538	Drug-induced Nephrotoxicity:	0.889
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.436
A549 Cytotoxicity:	0.744	Hek293 Cytotoxicity:	0.314
BCF:	1.709 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.493 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.833 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.101 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO10541	Dioscorea spongiosa	Species	Dioscoreaceae	Eukaryota	rhizomes	n.a.	n.a.	PMID[12762799]
NPO10541	Dioscorea spongiosa	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO10541	Dioscorea spongiosa	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO10541	Dioscorea spongiosa	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO10541	Dioscorea spongiosa	Species	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	2
Inhibition	1

Activity Type	# Activity
Non-molecular	3

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	17.1	%	PMID[12762799]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	30.9	%	PMID[12762799]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Inhibition	=	63.6	%	PMID[12762799]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC94272 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22925
0.1-0.2	23101
0.2-0.3	2686
0.3-0.4	974
0.4-0.5	88
0.5-0.6	40
0.6-0.7	29
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7374	Intermediate Similarity	NPC480555
0.7374	Intermediate Similarity	NPC150372
0.73	Intermediate Similarity	NPC73243
0.73	Intermediate Similarity	NPC244086
0.73	Intermediate Similarity	NPC84956
0.72	Intermediate Similarity	NPC475182
0.7157	Intermediate Similarity	NPC247037
0.7071	Intermediate Similarity	NPC470433
0.7071	Intermediate Similarity	NPC46190
0.7071	Intermediate Similarity	NPC171073
0.7019	Intermediate Similarity	NPC194207
0.7019	Intermediate Similarity	NPC22779
0.7	Intermediate Similarity	NPC248746
0.7	Intermediate Similarity	NPC122819
0.6952	Remote Similarity	NPC249265
0.6931	Remote Similarity	NPC42171
0.6923	Remote Similarity	NPC165439
0.6887	Remote Similarity	NPC23808
0.6887	Remote Similarity	NPC87998
0.6822	Remote Similarity	NPC480553
0.6759	Remote Similarity	NPC308140
0.6697	Remote Similarity	NPC232054
0.6667	Remote Similarity	NPC269297
0.6667	Remote Similarity	NPC222202
0.6636	Remote Similarity	NPC480554
0.6604	Remote Similarity	NPC475333
0.6604	Remote Similarity	NPC224098
0.6604	Remote Similarity	NPC208383
0.6408	Remote Similarity	NPC265275
0.6306	Remote Similarity	NPC287885
0.63	Remote Similarity	NPC295980
0.6228	Remote Similarity	NPC480556
0.6204	Remote Similarity	NPC486386
0.6154	Remote Similarity	NPC98696
0.6147	Remote Similarity	NPC13193
0.6117	Remote Similarity	NPC305423
0.6117	Remote Similarity	NPC113044
0.6117	Remote Similarity	NPC283829
0.6117	Remote Similarity	NPC161676
0.6091	Remote Similarity	NPC254255
0.6034	Remote Similarity	NPC224314
0.6019	Remote Similarity	NPC102016
0.6019	Remote Similarity	NPC95051
0.5981	Remote Similarity	NPC300557
0.5981	Remote Similarity	NPC124677
0.5926	Remote Similarity	NPC150057
0.5926	Remote Similarity	NPC147753
0.5833	Remote Similarity	NPC6806
0.5824	Remote Similarity	NPC473923
0.5794	Remote Similarity	NPC602423
0.5769	Remote Similarity	NPC470432
0.5769	Remote Similarity	NPC230507
0.5769	Remote Similarity	NPC15249
0.5769	Remote Similarity	NPC25455
0.5752	Remote Similarity	NPC218571
0.5752	Remote Similarity	NPC487615
0.5741	Remote Similarity	NPC477809
0.5714	Remote Similarity	NPC32361
0.5714	Remote Similarity	NPC309278
0.5619	Remote Similarity	NPC6295
0.5612	Remote Similarity	NPC486114
0.5583	Remote Similarity	NPC477808
0.5514	Remote Similarity	NPC470748
0.5514	Remote Similarity	NPC600116
0.55	Remote Similarity	NPC181845
0.5487	Remote Similarity	NPC475550
0.5484	Remote Similarity	NPC158088
0.5446	Remote Similarity	NPC272015
0.5413	Remote Similarity	NPC486388
0.5405	Remote Similarity	NPC48886
0.5405	Remote Similarity	NPC94881
0.537	Remote Similarity	NPC14704
0.5347	Remote Similarity	NPC226642
0.5333	Remote Similarity	NPC19400
0.5327	Remote Similarity	NPC306991
0.5327	Remote Similarity	NPC485595
0.5319	Remote Similarity	NPC22140
0.5319	Remote Similarity	NPC243728
0.5208	Remote Similarity	NPC473476
0.5208	Remote Similarity	NPC282669
0.5135	Remote Similarity	NPC40440
0.5126	Remote Similarity	NPC477811
0.5102	Remote Similarity	NPC204881

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC94272 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7559
0.1-0.2	1499
0.2-0.3	78
0.3-0.4	11
0.4-0.5	1
0.5-0.6	1
0.6-0.7	0
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7	Intermediate Similarity	NPD8449	Approved
0.5926	Remote Similarity	NPD8450	Suspended

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data