NPASS Compound

Natural Product: NPC486388

Natural Product ID	NPC486388
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	HECYSHBRLVPASC-WRLHXSSBSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 135141 0 0 0 0 0 0 0 0999 V2000 8.0138 -1.7192 1.6048 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1354 -0.2461 1.8045 C 0 0 2 0 0 0 0 0 0 0 0 0 7.3458 0.5651 0.8667 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8732 0.4476 0.8318 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2233 -0.7780 0.3977 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7811 -1.5752 -0.3229 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8127 -1.1147 0.8293 C 0 0 1 0 0 0 0 0 0 0 0 0 3.8293 -1.1873 2.3160 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8958 -0.1028 0.2256 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0454 -0.2111 -1.2497 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0082 0.0045 -1.9124 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7234 -0.6535 -1.7533 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8466 0.0984 -0.8415 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5961 -0.2472 -0.7795 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.1422 -0.1709 -2.1976 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6165 0.0074 -2.1771 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3115 0.3633 -1.1447 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8034 0.4926 -1.3117 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3270 1.7280 -0.6707 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1253 2.6173 -0.3055 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3856 1.8520 0.8006 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6821 0.6450 0.1710 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0004 -0.5636 1.0456 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2316 0.8319 0.0480 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5585 1.0026 1.3890 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9183 0.8949 1.3970 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4539 -0.2206 0.5352 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9645 -1.5339 1.0156 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9896 1.4139 0.5012 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2966 1.8673 0.4648 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.2543 0.7628 0.7466 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.4943 1.3832 1.3794 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.6864 2.7754 0.8500 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5333 3.6322 1.2677 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.8053 4.3625 2.5634 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7430 5.2068 2.8994 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3695 2.8741 1.4544 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7958 2.6734 -0.5531 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3037 1.4160 2.7585 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5978 -0.0169 -0.3414 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3509 -1.3740 -0.1676 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.6517 -2.1752 -0.0546 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.0805 -2.7915 -1.3421 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.9430 -3.3111 -2.1865 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.9385 -2.1759 -2.3059 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8066 -2.6505 -3.1927 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4510 -1.9195 -1.0426 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4348 -3.6561 -3.4317 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9450 -3.8614 -1.0396 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.5176 -3.1626 0.9414 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5957 0.1834 1.8670 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1985 -0.1458 0.6810 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5561 0.2287 0.7142 C 0 0 1 0 0 0 0 0 0 0 0 0 12.4010 -0.9824 0.5615 C 0 0 1 0 0 0 0 0 0 0 0 0 12.6560 -1.4077 -0.8642 C 0 0 2 0 0 0 0 0 0 0 0 0 11.9719 -0.4594 -1.8295 C 0 0 1 0 0 0 0 0 0 0 0 0 12.3507 0.9397 -1.3624 C 0 0 1 0 0 0 0 0 0 0 0 0 11.8258 1.9170 -2.4041 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4416 1.8333 -2.5451 O 0 0 0 0 0 0 0 0 0 0 0 0 11.7601 1.2490 -0.1729 O 0 0 0 0 0 0 0 0 0 0 0 0 12.4108 -0.6307 -3.1324 O 0 0 0 0 0 0 0 0 0 0 0 0 12.3026 -2.7083 -1.1313 O 0 0 0 0 0 0 0 0 0 0 0 0 13.5757 -0.9441 1.3193 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7962 -2.2647 2.2381 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2018 -1.9541 0.5406 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0132 -2.0942 1.8882 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7307 -0.0627 2.8644 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7547 0.4744 -0.2027 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6190 1.6614 1.0860 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4507 0.7812 1.8273 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5473 1.2400 0.0572 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5653 -2.0987 0.3931 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7428 -2.2671 2.6528 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1247 -0.5273 2.8413 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8383 -0.9007 2.7448 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2350 0.8906 0.6039 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6805 -1.7558 -1.6429 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5848 -0.4410 -2.8323 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9878 1.1788 -1.0172 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7776 -1.2616 -0.4366 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9134 -1.1338 -2.6963 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6330 0.6248 -2.7802 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1214 -0.1891 -3.1381 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2293 -0.3960 -0.8092 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1014 0.4621 -2.3670 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9726 2.2807 -1.3869 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4300 3.5844 0.0894 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4227 2.6866 -1.1539 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6889 2.4922 1.3200 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1613 1.4582 1.4794 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9464 -0.2582 2.1115 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0910 -0.8401 0.9085 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3585 -1.4294 0.8235 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0494 1.8021 -0.4999 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7973 2.0345 1.7376 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0094 0.3311 2.1766 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2685 0.9073 2.4249 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3129 1.8451 0.9305 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8317 -2.3056 0.2305 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5464 -1.9941 1.8088 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0587 -1.3744 1.4599 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4942 2.3154 -0.5208 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8474 0.0523 1.5239 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4087 0.7731 1.1581 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6570 3.1779 1.2649 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3597 4.4134 0.4810 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7064 5.0119 2.4935 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8883 3.6364 3.3955 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4221 5.6513 2.0627 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6107 2.1786 -0.7570 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3548 1.3046 3.0203 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8882 -1.4576 0.8621 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4386 -1.4479 0.2645 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6007 -2.0268 -1.9546 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4182 -4.1828 -1.7077 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4123 -1.2724 -2.6944 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9770 -1.9429 -3.2700 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2389 -2.8244 -4.2185 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4358 -3.6230 -2.8311 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6379 -4.6262 -3.4736 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1576 -3.8960 -0.0737 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5722 -3.4940 0.9990 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6796 1.2151 2.1950 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0765 -0.4616 2.6617 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7717 0.6720 1.7362 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8145 -1.8385 1.0141 H 0 0 0 0 0 0 0 0 0 0 0 0 13.7597 -1.3129 -1.0390 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8696 -0.5294 -1.7575 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4458 1.0674 -1.3364 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0695 2.9706 -2.1188 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2654 1.7358 -3.4021 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9476 2.0801 -1.7451 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2903 -1.5624 -3.4106 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8641 -3.1505 -0.3661 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4549 -1.3652 2.2232 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 0 5 7 1 0 7 8 1 0 7 9 1 0 9 10 1 0 10 11 2 0 10 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 1 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 1 19 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 34 37 1 0 33 38 1 0 32 39 1 0 31 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 45 47 1 0 44 48 1 0 43 49 1 0 42 50 1 0 2 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 57 60 1 0 56 61 1 0 55 62 1 0 54 63 1 0 27 9 1 0 37 30 1 0 47 41 1 0 60 53 1 0 27 13 1 0 24 14 1 0 22 17 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 1 3 68 1 0 3 69 1 0 4 70 1 0 4 71 1 0 7 72 1 6 8 73 1 0 8 74 1 0 8 75 1 0 9 76 1 0 12 77 1 0 12 78 1 0 13 79 1 6 14 80 1 1 15 81 1 0 15 82 1 0 16 83 1 0 18 84 1 0 18 85 1 0 19 86 1 6 20 87 1 0 20 88 1 0 21 89 1 0 21 90 1 0 23 91 1 0 23 92 1 0 23 93 1 0 24 94 1 6 25 95 1 0 25 96 1 0 26 97 1 0 26 98 1 0 28 99 1 0 28100 1 0 28101 1 0 30102 1 6 31103 1 1 32104 1 1 33105 1 1 34106 1 6 35107 1 0 35108 1 0 36109 1 0 38110 1 0 39111 1 0 41112 1 1 42113 1 1 43114 1 6 44115 1 1 45116 1 6 46117 1 0 46118 1 0 46119 1 0 48120 1 0 49121 1 0 50122 1 0 51123 1 0 51124 1 0 53125 1 1 54126 1 1 55127 1 6 56128 1 6 57129 1 1 58130 1 0 58131 1 0 59132 1 0 61133 1 0 62134 1 0 63135 1 0 M END

Standard InCHIKey	HECYSHBRLVPASC-WRLHXSSBSA-N
Standard InCHI	InChI=1S/C45H72O18/c1-19(18-58-41-38(56)36(54)33(51)29(16-46)61-41)6-9-27(48)20(2)31-28(49)15-26-24-8-7-22-14-23(10-12-44(22,4)25(24)11-13-45(26,31)5)60-43-40(37(55)34(52)30(17-47)62-43)63-42-39(57)35(53)32(50)21(3)59-42/h7,19-21,23-26,29-43,46-47,50-57H,6,8-18H2,1-5H3/t19-,20-,21+,23+,24-,25+,26+,29-,30-,31?,32+,33-,34-,35-,36+,37+,38-,39-,40-,41-,42+,43-,44+,45+/m1/s1
SMILES	C[C@H](CCC(=O)[C@@H](C)C1C(=O)C[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O[C@H]1[C@@H]([C@@H]([C@H]([C@H](C)O1)O)O)O)CO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	900.47	Volume:	877.295 ? Van der Waals volume.
Dense:	1.026	LogP:	1.014 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.011 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.235 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	14.0	Rigid Bonds:	40.0
TPSA:	291.82 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	10.0	Rings:	7.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.096	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.239	Fsp³:	0.911
MCE-18:	139.07 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.632	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.165	Promiscuous compounds:	0.029

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.313	MDCK Permeability:	-5.129
Pgp-inhibitor:	0.0	Pgp-substrate:	0.119
PAMPA:	0.989 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.009	30% Bioavailability (F30%):	0.942
50% Bioavailability (F50%):	0.994

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.011
Plasma Protein Binding (PPB):	57.317%	Volume Distribution (VD):	-0.408
Fu:	35.541% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.037
BSEP inhibitor:	0.354

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.012	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.179	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.999
HLM stability:	0.941 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.331

Half-life (T1/2):

2.696

ADMET: Toxicity

hERG Blockers:	0.006	hERG Blockers (10um):	0.019
Human Hepatotoxicity (H-HT):	0.609	Drug-induced Liver Injury (DILI):	0.868
AMES Toxicity:	0.896	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.004	Skin Sensitization:	1.0
Carcinogencity:	0.037	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.469	Drug-induced Nephrotoxicity:	0.806
Genotoxicity:	0.17	RPMI-8226 Immunitoxicity:	0.264
A549 Cytotoxicity:	0.585	Hek293 Cytotoxicity:	0.527
BCF:	0.652 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.215 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.585 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.716 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO16818	Trillium tschonoskii	Species	Melanthiaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32870000]
NPO16818	Trillium tschonoskii	Species	Melanthiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO16818	Trillium tschonoskii	Species	Melanthiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO16818	Trillium tschonoskii	Species	Melanthiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO16818	Trillium tschonoskii	Species	Melanthiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO16818	Trillium tschonoskii	Species	Melanthiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
FC	2

Activity Type	# Activity
Others	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2	Others	Unspecified	n.a.	FC	=	1.8	n.a.	PMID[32870000]
NPT2	Others	Unspecified	n.a.	FC	=	8.4	n.a.	PMID[32870000]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC486388 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	21363
0.1-0.2	24000
0.2-0.3	3275
0.3-0.4	1051
0.4-0.5	102
0.5-0.6	54
0.6-0.7	9
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7684	Intermediate Similarity	NPC306991
0.703	Intermediate Similarity	NPC98696
0.6449	Remote Similarity	NPC475182
0.6346	Remote Similarity	NPC113044
0.6346	Remote Similarity	NPC283829
0.6346	Remote Similarity	NPC470748
0.6346	Remote Similarity	NPC161676
0.6091	Remote Similarity	NPC73243
0.6091	Remote Similarity	NPC244086
0.6091	Remote Similarity	NPC84956
0.6038	Remote Similarity	NPC305423
0.5982	Remote Similarity	NPC247037
0.5946	Remote Similarity	NPC102016
0.5946	Remote Similarity	NPC95051
0.5926	Remote Similarity	NPC40440
0.5877	Remote Similarity	NPC194207
0.5877	Remote Similarity	NPC22779
0.5826	Remote Similarity	NPC249265
0.5789	Remote Similarity	NPC13193
0.5776	Remote Similarity	NPC23808
0.5776	Remote Similarity	NPC87998
0.5741	Remote Similarity	NPC600116
0.5702	Remote Similarity	NPC486386
0.569	Remote Similarity	NPC218571
0.569	Remote Similarity	NPC487615
0.5678	Remote Similarity	NPC308140
0.5652	Remote Similarity	NPC309278
0.5641	Remote Similarity	NPC486383
0.563	Remote Similarity	NPC232054
0.5603	Remote Similarity	NPC254255
0.5575	Remote Similarity	NPC480555
0.5575	Remote Similarity	NPC150372
0.5536	Remote Similarity	NPC477809
0.5534	Remote Similarity	NPC272015
0.5413	Remote Similarity	NPC94272
0.5405	Remote Similarity	NPC19888
0.5357	Remote Similarity	NPC197231
0.5351	Remote Similarity	NPC300557
0.534	Remote Similarity	NPC165439
0.5333	Remote Similarity	NPC480553
0.531	Remote Similarity	NPC470433
0.531	Remote Similarity	NPC46190
0.531	Remote Similarity	NPC171073
0.5294	Remote Similarity	NPC242748
0.5254	Remote Similarity	NPC475333
0.5254	Remote Similarity	NPC224098
0.5254	Remote Similarity	NPC208383
0.5229	Remote Similarity	NPC600456
0.5225	Remote Similarity	NPC141433
0.5182	Remote Similarity	NPC485601
0.5175	Remote Similarity	NPC602423
0.5167	Remote Similarity	NPC480554
0.5143	Remote Similarity	NPC181845
0.512	Remote Similarity	NPC480556
0.5102	Remote Similarity	NPC22140
0.5102	Remote Similarity	NPC243728
0.5102	Remote Similarity	NPC158088
0.5093	Remote Similarity	NPC86020
0.5086	Remote Similarity	NPC6806
0.5047	Remote Similarity	NPC291203
0.5047	Remote Similarity	NPC217205
0.5046	Remote Similarity	NPC128123
0.5044	Remote Similarity	NPC14704
0.5042	Remote Similarity	NPC269297
0.5042	Remote Similarity	NPC222202

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC486388 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7157
0.1-0.2	1872
0.2-0.3	109
0.3-0.4	10
0.4-0.5	2
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data