NPASS Compound

Natural Product: NPC485601

Natural Product ID	NPC485601
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	HWJIWDPYZVHRPJ-NMUPNISHSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	118712562
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 140147 0 0 0 0 0 0 0 0999 V2000 8.4660 1.7755 -2.5483 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0897 1.3648 -1.9405 C 0 0 2 0 0 0 0 0 0 0 0 0 6.5328 2.5435 -1.2771 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2866 2.7532 -0.6004 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7696 2.1395 0.6076 C 0 0 2 0 0 0 0 0 0 0 0 0 4.5014 0.7042 0.6714 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4714 -0.0413 1.6045 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1671 0.6237 1.4162 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9421 2.0277 1.9180 C 0 0 2 0 0 0 0 0 0 0 0 0 1.4163 2.2224 1.8953 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8904 0.8983 1.4951 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4475 0.8924 0.8105 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.4596 1.4258 1.7697 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8849 1.1714 1.3353 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1261 -0.2601 0.9931 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5404 -0.4265 0.4631 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8445 -1.8509 0.1375 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.7917 -2.4816 -0.7457 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3950 -2.1917 -0.3049 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1174 -0.7444 -0.0581 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.3196 -0.0051 -1.3599 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7597 -0.5511 0.5167 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3215 -1.2147 -0.3047 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6753 -1.0475 0.2941 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9883 0.4073 0.5382 C 0 0 2 0 0 0 0 0 0 0 0 0 2.0001 1.1735 -0.7412 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0611 -1.9204 -0.5353 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9849 -2.6868 0.1345 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.2209 -1.8761 0.4056 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.0400 -2.6648 1.4123 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.6995 -4.1381 1.3569 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.2249 -4.6160 0.0293 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.4539 -4.9903 -0.8096 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9575 -5.6454 -1.9542 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3664 -3.7869 -0.6463 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8330 -4.4232 2.4000 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3763 -2.5141 1.0465 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8841 -0.6166 0.8037 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3644 0.3793 -0.0521 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2376 1.2901 0.7854 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5509 2.6387 0.8296 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4834 3.1426 -0.6046 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.6444 2.1331 -1.3718 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.2873 1.7396 -2.6799 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3000 1.0448 -0.5944 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8872 4.3984 -0.5695 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1754 3.5294 1.6764 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.5228 1.3942 0.2382 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6990 1.5141 2.4228 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5655 2.8277 1.0142 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6749 2.4216 1.7090 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3181 0.1012 -1.2162 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1278 -0.0157 -0.1772 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4463 0.0489 -0.2405 C 0 0 1 0 0 0 0 0 0 0 0 0 10.1213 0.9811 0.7674 C 0 0 1 0 0 0 0 0 0 0 0 0 11.5635 1.1384 0.3199 C 0 0 2 0 0 0 0 0 0 0 0 0 12.1912 -0.2396 0.4529 C 0 0 1 0 0 0 0 0 0 0 0 0 11.3184 -1.2114 -0.2733 C 0 0 1 0 0 0 0 0 0 0 0 0 11.8645 -2.6332 -0.1030 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1114 -3.5194 -0.8762 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0094 -1.2461 0.1508 O 0 0 0 0 0 0 0 0 0 0 0 0 13.4460 -0.2534 -0.1476 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2288 2.0789 1.0822 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4817 2.1744 0.9472 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2630 2.5488 -3.3419 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0752 2.1887 -1.7541 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8885 0.9089 -3.0407 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4245 1.1444 -2.8422 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3983 2.9386 -0.5654 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6754 3.4260 -2.0734 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2434 3.9244 -0.4193 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4056 2.6489 -1.3944 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4481 0.1516 -0.2629 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7685 -1.0234 1.2009 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0349 -0.2295 2.5970 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3610 0.6103 1.8029 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1561 -0.1102 2.2189 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3294 2.1688 2.9456 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1168 3.0692 1.2750 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0905 2.4304 2.9381 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9087 0.2030 2.3489 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4207 1.5307 -0.0860 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3319 2.5276 1.8503 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3180 1.0152 2.7906 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1224 1.8053 0.4775 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0361 -0.8945 1.8853 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2235 -0.0925 1.2665 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7120 0.2371 -0.4125 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8852 -2.4398 1.0924 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9419 -3.5931 -0.6370 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9387 -2.2583 -1.8008 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7267 -2.5051 -1.1604 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0747 -2.7653 0.5823 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5494 -0.3743 -2.0671 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3417 1.0788 -1.2595 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3028 -0.3215 -1.7686 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7491 -1.0760 1.5139 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2734 -0.9626 -1.3804 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0901 -2.3208 -0.2610 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4215 -1.4037 -0.4657 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7228 -1.6102 1.2289 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0828 0.9065 -1.3090 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9549 2.2677 -0.5866 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8447 0.8305 -1.3422 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5016 -3.0335 1.0820 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7923 -1.7673 -0.5568 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9226 -2.3282 2.4396 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6544 -4.6891 1.6050 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7113 -5.6074 0.2190 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1277 -5.6126 -0.2220 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9066 -4.0603 -1.1634 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3181 -6.3364 -1.5875 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7696 -3.6720 3.0337 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8877 -3.3465 1.1778 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9295 -0.0805 -0.8891 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3186 0.9479 1.8417 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4887 2.4531 1.1285 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5081 3.2086 -1.0048 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6897 2.6547 -1.6305 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3474 0.6655 -2.8401 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7449 2.1747 -3.5656 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2953 2.2296 -2.7080 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4204 5.0164 -1.1228 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5983 4.3328 1.7280 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0416 1.9556 0.8657 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0204 0.6916 2.8989 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1626 3.2365 1.4752 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7749 -0.6439 -2.0604 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3796 -0.5096 -1.0382 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9425 0.2025 -1.2009 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1074 0.4548 1.7686 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5447 1.4025 -0.7455 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2395 -0.5462 1.5174 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2865 -0.9599 -1.3716 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7028 -2.9043 0.9573 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9246 -2.6310 -0.4083 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2914 -3.1017 -1.2459 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0163 0.4405 0.2885 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1392 2.9753 0.6752 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1336 2.9201 1.0448 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 17 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 30 37 1 0 29 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 43 45 1 0 42 46 1 0 41 47 1 0 40 48 1 0 14 49 1 0 9 50 1 0 5 51 1 1 2 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 58 61 1 0 57 62 1 0 56 63 1 0 55 64 1 0 50 5 1 0 61 54 1 0 25 8 1 0 35 28 1 0 45 39 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 65 1 0 1 66 1 0 1 67 1 0 2 68 1 6 3 69 1 0 3 70 1 0 4 71 1 0 4 72 1 0 6 73 1 6 7 74 1 0 7 75 1 0 7 76 1 0 8 77 1 1 9 78 1 1 10 79 1 0 10 80 1 0 11 81 1 1 12 82 1 6 13 83 1 0 13 84 1 0 14 85 1 6 15 86 1 1 16 87 1 0 16 88 1 0 17 89 1 1 18 90 1 0 18 91 1 0 19 92 1 0 19 93 1 0 21 94 1 0 21 95 1 0 21 96 1 0 22 97 1 1 23 98 1 0 23 99 1 0 24100 1 0 24101 1 0 26102 1 0 26103 1 0 26104 1 0 28105 1 1 29106 1 6 30107 1 1 31108 1 1 32109 1 1 33110 1 0 33111 1 0 34112 1 0 36113 1 0 37114 1 0 39115 1 6 40116 1 1 41117 1 1 42118 1 6 43119 1 6 44120 1 0 44121 1 0 44122 1 0 46123 1 0 47124 1 0 48125 1 0 49126 1 0 51127 1 0 52128 1 0 52129 1 0 54130 1 6 55131 1 1 56132 1 6 57133 1 1 58134 1 6 59135 1 0 59136 1 0 60137 1 0 62138 1 0 63139 1 0 64140 1 0 M END

Standard InCHIKey	HWJIWDPYZVHRPJ-NMUPNISHSA-N
Standard InCHI	InChI=1S/C45H76O19/c1-18(17-58-40-37(55)35(53)32(50)28(15-46)61-40)6-11-45(57)19(2)30-27(64-45)14-24-22-13-26(48)25-12-21(7-9-43(25,4)23(22)8-10-44(24,30)5)60-42-39(36(54)33(51)29(16-47)62-42)63-41-38(56)34(52)31(49)20(3)59-41/h18-42,46-57H,6-17H2,1-5H3/t18-,19+,20+,21+,22-,23+,24+,25-,26+,27+,28-,29-,30+,31+,32-,33-,34-,35+,36+,37-,38-,39-,40-,41+,42-,43-,44+,45-/m1/s1
SMILES	C[C@H](CC[C@@]1([C@@H](C)[C@H]2[C@H](C[C@H]3[C@@H]4C[C@@H]([C@H]5C[C@H](CC[C@]5(C)[C@H]4CC[C@]23C)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O)O)O)O1)O)CO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	920.5	Volume:	885.438 ? Van der Waals volume.
Dense:	1.04	LogP:	0.724 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.581 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.423 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	42.0
TPSA:	307.37 ? Topological Polar Surface Area.	H-Bond Acceptor:	19.0
H-Bond Donor:	12.0	Rings:	8.0
Heavy Atoms:	19.0

MedChem Properties

QED Drug-Likeness Score:	0.096	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.424	Fsp³:	1.0
MCE-18:	159.822 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.593	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.011 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.28	Promiscuous compounds:	0.27

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.303	MDCK Permeability:	-5.138
Pgp-inhibitor:	0.0	Pgp-substrate:	0.987
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.563
20% Bioavailability (F20%):	0.309	30% Bioavailability (F30%):	0.994
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.006	MRP1:	0.008
Plasma Protein Binding (PPB):	44.383%	Volume Distribution (VD):	-0.416
Fu:	39.838% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.233
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.998	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.909
HLM stability:	0.086 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.102

Half-life (T1/2):

3.728

ADMET: Toxicity

hERG Blockers:	0.012	hERG Blockers (10um):	0.037
Human Hepatotoxicity (H-HT):	0.59	Drug-induced Liver Injury (DILI):	0.806
AMES Toxicity:	0.869	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.007	Skin Sensitization:	1.0
Carcinogencity:	0.024	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.353	Drug-induced Nephrotoxicity:	0.953
Genotoxicity:	0.009	RPMI-8226 Immunitoxicity:	0.204
A549 Cytotoxicity:	0.947	Hek293 Cytotoxicity:	0.773
BCF:	1.351 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.349 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.59 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.813 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40931	Solanum macaonense	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25036668]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2	Others	Unspecified	n.a.	IC50	>	10000.0	nM	PMID[25036668]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC485601 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	27487
0.1-0.2	18926
0.2-0.3	2674
0.3-0.4	608
0.4-0.5	104
0.5-0.6	31
0.6-0.7	19
0.7-0.8	0
0.8-0.85	3
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8415	Intermediate Similarity	NPC485600
0.8353	Intermediate Similarity	NPC291203
0.8353	Intermediate Similarity	NPC217205
0.7579	Intermediate Similarity	NPC98696
0.7416	Intermediate Similarity	NPC485602
0.6538	Remote Similarity	NPC73243
0.6538	Remote Similarity	NPC244086
0.6538	Remote Similarity	NPC84956
0.6415	Remote Similarity	NPC247037
0.6381	Remote Similarity	NPC102016
0.6381	Remote Similarity	NPC95051
0.6239	Remote Similarity	NPC249265
0.6182	Remote Similarity	NPC23808
0.6182	Remote Similarity	NPC87998
0.6162	Remote Similarity	NPC476538
0.6162	Remote Similarity	NPC476539
0.6111	Remote Similarity	NPC470863
0.6091	Remote Similarity	NPC218571
0.6091	Remote Similarity	NPC487615
0.6075	Remote Similarity	NPC98018
0.6075	Remote Similarity	NPC284104
0.6075	Remote Similarity	NPC103616
0.6061	Remote Similarity	NPC128123
0.602	Remote Similarity	NPC477451
0.5841	Remote Similarity	NPC84111
0.5841	Remote Similarity	NPC287483
0.5841	Remote Similarity	NPC470865
0.5825	Remote Similarity	NPC485595
0.5816	Remote Similarity	NPC297348
0.5816	Remote Similarity	NPC249204
0.5816	Remote Similarity	NPC48339
0.5816	Remote Similarity	NPC141769
0.5816	Remote Similarity	NPC477547
0.5714	Remote Similarity	NPC485599
0.5567	Remote Similarity	NPC172838
0.5534	Remote Similarity	NPC211354
0.5487	Remote Similarity	NPC470861
0.5446	Remote Similarity	NPC51520
0.5446	Remote Similarity	NPC303069
0.5392	Remote Similarity	NPC210157
0.5347	Remote Similarity	NPC137004
0.5288	Remote Similarity	NPC476540
0.5288	Remote Similarity	NPC476541
0.5283	Remote Similarity	NPC107962
0.5278	Remote Similarity	NPC113044
0.5278	Remote Similarity	NPC283829
0.5278	Remote Similarity	NPC161676
0.5234	Remote Similarity	NPC6295
0.5192	Remote Similarity	NPC222731
0.5182	Remote Similarity	NPC486388
0.5169	Remote Similarity	NPC92297
0.5138	Remote Similarity	NPC305423
0.5135	Remote Similarity	NPC475643
0.5133	Remote Similarity	NPC475182
0.5093	Remote Similarity	NPC306991

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC485601 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7826
0.1-0.2	1260
0.2-0.3	55
0.3-0.4	6
0.4-0.5	3
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data