NPASS Compound

Natural Product: NPC107962

Natural Product ID	NPC107962
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	JNTJNUDLVQQYGM-VFWCLKQGSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL1078619
PubChem CID	44255060
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 137145 0 0 0 0 0 0 0 0999 V2000 13.2096 -1.6541 -0.7464 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6798 -0.7181 0.3075 C 0 0 2 0 0 0 0 0 0 0 0 0 11.7787 -1.4255 1.3088 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7134 -0.4317 1.7287 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8092 -0.2023 0.5629 C 0 0 2 0 0 0 0 0 0 0 0 0 8.8406 0.9406 0.7696 C 0 0 1 0 0 0 0 0 0 0 0 0 9.4305 2.1696 0.0638 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6335 0.4721 0.0313 C 0 0 1 0 0 0 0 0 0 0 0 0 7.9092 -0.9889 -0.2934 C 0 0 2 0 0 0 0 0 0 0 0 0 6.6471 -1.7588 0.1334 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6508 -0.6841 0.0969 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3261 -0.8668 0.6942 C 0 0 2 0 0 0 0 0 0 0 0 0 3.6381 -2.1647 0.3435 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3141 -2.1282 1.0791 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4539 -0.9976 0.5612 C 0 0 2 0 0 0 0 0 0 0 0 0 1.0123 -1.3551 -0.8172 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1609 -0.2988 -1.4799 C 0 0 2 0 0 0 0 0 0 0 0 0 1.0141 0.9647 -1.4992 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2972 1.3473 -0.0878 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1100 0.3416 0.6822 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0482 0.7538 2.1416 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5024 0.3123 0.1465 C 0 0 1 0 0 0 0 0 0 0 0 0 4.2364 1.5965 0.2271 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5540 1.6193 0.8823 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3735 0.4086 0.8738 C 0 0 2 0 0 0 0 0 0 0 0 0 6.7965 -0.0387 2.2491 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0571 -0.0864 -0.8683 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1333 -0.3251 -1.7134 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0811 -1.3558 -1.1575 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3105 -1.4498 -2.0280 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.9201 -0.0261 -2.1699 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8082 0.6981 -2.8624 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2372 1.9546 -3.5143 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6958 2.9167 -2.6667 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7864 0.9123 -1.9039 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1518 0.5238 -0.9749 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3761 0.9159 -0.5601 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9980 0.0661 0.5187 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.7863 0.5788 1.9228 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.6561 1.5812 1.8652 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.1574 2.6731 0.9476 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1494 3.8007 0.9090 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9108 4.2392 2.2065 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3912 2.2471 -0.3235 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4013 2.1720 3.1077 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3565 -0.4365 2.7846 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4051 0.0178 0.3536 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8915 -1.2661 0.2436 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.8313 -1.5844 1.3725 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.1899 -2.0357 0.8576 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.6377 -1.0005 -0.1572 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.6139 -0.8540 -1.2646 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.4573 0.6075 -1.5757 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.7632 1.0962 -1.8154 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4480 -1.5247 -1.0039 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.8810 -1.3976 -0.6351 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.0779 -2.0283 1.9277 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3398 -2.6029 2.1850 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2269 -2.3747 -1.6345 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4182 -2.6005 -1.2649 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0105 -1.3617 0.4269 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5533 -0.0025 -0.5758 O 0 0 0 0 0 0 0 0 0 0 0 0 11.8638 0.3653 -0.3493 C 0 0 0 0 0 0 0 0 0 0 0 0 13.7264 -2.5283 -0.2972 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3875 -1.9518 -1.4318 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9691 -1.0976 -1.3256 H 0 0 0 0 0 0 0 0 0 0 0 0 13.5207 -0.3011 0.8783 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3081 -2.2796 0.7432 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3505 -1.8211 2.1738 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1610 -0.8914 2.5827 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2403 0.5026 2.0541 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6857 1.2179 1.8096 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9573 1.8871 -0.8657 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5933 2.8872 -0.1375 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0962 2.6640 0.7947 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4615 1.0813 -0.8852 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0678 -1.0880 -1.3844 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4459 -2.4917 -0.6862 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7612 -2.2342 1.1066 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5643 -0.3070 -0.9456 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2642 -0.7671 1.7969 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5580 -2.3559 -0.7242 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2393 -2.9719 0.8564 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7421 -3.0660 0.9257 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5550 -1.9661 2.1483 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5473 -0.9822 1.2096 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5046 -2.3401 -0.7615 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8889 -1.4989 -1.5117 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0396 -0.6265 -2.5444 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3950 1.7773 -1.9372 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8959 0.7543 -2.1128 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7138 2.3604 -0.0712 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3008 1.4266 0.4382 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8993 1.3793 2.4527 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1307 1.3833 2.3425 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9253 -0.1422 2.7975 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4021 0.0454 -0.9494 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3332 2.0819 -0.7909 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5657 2.3239 0.7746 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4365 1.9491 1.9587 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1745 2.4561 0.4398 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0744 -0.6520 2.7783 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9284 0.9059 2.8551 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7650 -0.5895 2.2516 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7774 -0.6527 -2.7120 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3325 -1.1643 -0.0942 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9687 -1.6997 -3.0499 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7361 -0.1385 -2.8853 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3658 -0.0061 -3.6465 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1075 1.6852 -4.1913 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4774 2.3492 -4.2294 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1833 3.6056 -3.2193 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0566 0.7461 -1.4229 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6797 -0.9830 0.5146 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6853 1.0949 2.3229 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7529 1.0965 1.4463 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0891 3.0751 1.3861 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5797 4.6058 0.2798 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2173 3.4771 0.3998 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7833 4.4591 2.6045 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3834 1.4235 3.7789 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3653 -1.3320 2.3546 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0279 -1.9671 0.3244 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0236 -0.6844 1.9925 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0883 -3.0393 0.3965 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7894 -0.0484 0.4000 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0739 -1.3233 -2.1685 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8843 0.8233 -2.4872 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1007 1.2078 -0.7073 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7530 2.0527 -2.0672 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8335 -2.3782 -0.7630 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9488 -1.5770 1.6980 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9369 -3.3700 2.2077 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9474 -2.7906 -0.7566 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9476 -2.8172 -0.4201 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9811 1.2756 0.2646 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3177 0.5950 -1.3382 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 1 17 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 41 44 1 0 40 45 1 0 39 46 1 0 38 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 52 55 1 0 51 56 1 0 50 57 1 0 49 58 1 0 30 59 1 0 29 60 1 0 9 61 1 0 5 62 1 6 62 63 1 0 63 2 1 0 61 5 1 0 25 8 1 0 35 28 1 0 44 37 1 0 55 48 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 1 3 68 1 0 3 69 1 0 4 70 1 0 4 71 1 0 6 72 1 1 7 73 1 0 7 74 1 0 7 75 1 0 8 76 1 6 9 77 1 6 10 78 1 0 10 79 1 0 11 80 1 6 12 81 1 1 13 82 1 0 13 83 1 0 14 84 1 0 14 85 1 0 15 86 1 1 16 87 1 0 16 88 1 0 17 89 1 6 18 90 1 0 18 91 1 0 19 92 1 0 19 93 1 0 21 94 1 0 21 95 1 0 21 96 1 0 22 97 1 6 23 98 1 0 23 99 1 0 24100 1 0 24101 1 0 26102 1 0 26103 1 0 26104 1 0 28105 1 6 29106 1 1 30107 1 6 31108 1 6 32109 1 6 33110 1 0 33111 1 0 34112 1 0 37113 1 6 38114 1 1 39115 1 1 40116 1 6 41117 1 1 42118 1 0 42119 1 0 43120 1 0 45121 1 0 46122 1 0 48123 1 1 49124 1 1 50125 1 6 51126 1 1 52127 1 6 53128 1 0 53129 1 0 54130 1 0 56131 1 0 57132 1 0 58133 1 0 59134 1 0 60135 1 0 63136 1 0 63137 1 0 M END

Standard InCHIKey	JNTJNUDLVQQYGM-VFWCLKQGSA-N
Standard InCHI	InChI=1S/C45H74O18/c1-19-7-12-45(56-18-19)20(2)30-26(63-45)14-25-23-6-5-21-13-22(8-10-43(21,3)24(23)9-11-44(25,30)4)57-40-37(55)35(53)38(29(17-48)60-40)61-42-39(34(52)32(50)28(16-47)59-42)62-41-36(54)33(51)31(49)27(15-46)58-41/h19-42,46-55H,5-18H2,1-4H3/t19-,20+,21-,22+,23-,24+,25+,26+,27-,28-,29-,30+,31-,32-,33+,34+,35-,36-,37-,38+,39-,40-,41+,42+,43+,44+,45-/m1/s1
SMILES	C[C@@H]1CC[C@@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC[C@@H]6C[C@H](CC[C@]6(C)[C@H]5CC[C@]34C)O[C@H]3[C@@H]([C@H]([C@H]([C@@H](CO)O3)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O)O2)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	902.49	Volume:	868.092 ? Van der Waals volume.
Dense:	1.04	LogP:	1.503 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.545 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.622 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	48.0
TPSA:	276.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	10.0	Rings:	9.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.128	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.689	Fsp³:	1.0
MCE-18:	230.667 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.737	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.021 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.317	Promiscuous compounds:	0.034

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.372	MDCK Permeability:	-5.097
Pgp-inhibitor:	0.0	Pgp-substrate:	0.434
PAMPA:	0.989 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.47
20% Bioavailability (F20%):	0.7	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.011	MRP1:	0.078
Plasma Protein Binding (PPB):	55.406%	Volume Distribution (VD):	-0.419
Fu:	34.682% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.027
BSEP inhibitor:	0.011

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.035	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.996	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.778
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.212

Half-life (T1/2):

2.769

ADMET: Toxicity

hERG Blockers:	0.007	hERG Blockers (10um):	0.015
Human Hepatotoxicity (H-HT):	0.704	Drug-induced Liver Injury (DILI):	0.995
AMES Toxicity:	0.988	Rat Oral Acute Toxicity:	0.006
Maximum Recommended Daily Dose:	0.003	Skin Sensitization:	1.0
Carcinogencity:	0.216	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	1.0
Hematotoxicity:	0.558	Drug-induced Nephrotoxicity:	0.929
Genotoxicity:	0.01	RPMI-8226 Immunitoxicity:	0.282
A549 Cytotoxicity:	0.991	Hek293 Cytotoxicity:	0.956
BCF:	1.532 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.344 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.403 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.781 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO16699	Agave utahensis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[19645463]
NPO16699	Agave utahensis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO16699	Agave utahensis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	4.9	ug.mL-1	PMID[25443644]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC107962 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	28515
0.1-0.2	18196
0.2-0.3	2386
0.3-0.4	513
0.4-0.5	104
0.5-0.6	75
0.6-0.7	42
0.7-0.8	1
0.8-0.85	3
0.85-0.9	6
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8902	High Similarity	NPC297348
0.8902	High Similarity	NPC325828
0.8902	High Similarity	NPC249204
0.8902	High Similarity	NPC48339
0.8902	High Similarity	NPC141769
0.8902	High Similarity	NPC477547
0.8471	Intermediate Similarity	NPC477451
0.837	Intermediate Similarity	NPC92890
0.8229	Intermediate Similarity	NPC475625
0.7978	Intermediate Similarity	NPC211354
0.7917	Intermediate Similarity	NPC184617
0.7912	Intermediate Similarity	NPC6295
0.7789	Intermediate Similarity	NPC477809
0.7753	Intermediate Similarity	NPC250393
0.7732	Intermediate Similarity	NPC97700
0.7732	Intermediate Similarity	NPC30856
0.7582	Intermediate Similarity	NPC107188
0.7582	Intermediate Similarity	NPC19400
0.7528	Intermediate Similarity	NPC294686
0.7528	Intermediate Similarity	NPC234352
0.7473	Intermediate Similarity	NPC206003
0.7473	Intermediate Similarity	NPC473610
0.7379	Intermediate Similarity	NPC132080
0.7368	Intermediate Similarity	NPC160426
0.7174	Intermediate Similarity	NPC222731
0.7087	Intermediate Similarity	NPC232037
0.7019	Intermediate Similarity	NPC470864
0.699	Remote Similarity	NPC116756
0.6939	Remote Similarity	NPC475351
0.6931	Remote Similarity	NPC128572
0.6735	Remote Similarity	NPC195297
0.6697	Remote Similarity	NPC470866
0.6667	Remote Similarity	NPC113044
0.6667	Remote Similarity	NPC283829
0.6667	Remote Similarity	NPC471464
0.6667	Remote Similarity	NPC177834
0.6667	Remote Similarity	NPC161676
0.6634	Remote Similarity	NPC475643
0.6633	Remote Similarity	NPC485595
0.663	Remote Similarity	NPC485594
0.6574	Remote Similarity	NPC233433
0.6495	Remote Similarity	NPC54619
0.6481	Remote Similarity	NPC83137
0.6476	Remote Similarity	NPC115165
0.6465	Remote Similarity	NPC125324
0.6465	Remote Similarity	NPC470432
0.6465	Remote Similarity	NPC230507
0.6458	Remote Similarity	NPC474399
0.6316	Remote Similarity	NPC220836
0.6286	Remote Similarity	NPC480555
0.6286	Remote Similarity	NPC150372
0.6262	Remote Similarity	NPC475550
0.625	Remote Similarity	NPC291203
0.625	Remote Similarity	NPC217205
0.6238	Remote Similarity	NPC141433
0.6211	Remote Similarity	NPC181845
0.6182	Remote Similarity	NPC476112
0.6182	Remote Similarity	NPC307534
0.6126	Remote Similarity	NPC477811
0.6064	Remote Similarity	NPC24960
0.6061	Remote Similarity	NPC121453
0.6053	Remote Similarity	NPC94086
0.6053	Remote Similarity	NPC473817
0.6038	Remote Similarity	NPC51172
0.6038	Remote Similarity	NPC6806
0.6038	Remote Similarity	NPC49032
0.6	Remote Similarity	NPC470433
0.6	Remote Similarity	NPC46190
0.6	Remote Similarity	NPC171073
0.5982	Remote Similarity	NPC480553
0.5963	Remote Similarity	NPC269297
0.5963	Remote Similarity	NPC222202
0.5909	Remote Similarity	NPC473518
0.5905	Remote Similarity	NPC473601
0.59	Remote Similarity	NPC128123
0.5893	Remote Similarity	NPC470862
0.5872	Remote Similarity	NPC475319
0.5856	Remote Similarity	NPC232611
0.5818	Remote Similarity	NPC470863
0.5804	Remote Similarity	NPC480554
0.578	Remote Similarity	NPC98018
0.578	Remote Similarity	NPC284104
0.578	Remote Similarity	NPC103616
0.5745	Remote Similarity	NPC277715
0.5741	Remote Similarity	NPC300557
0.5686	Remote Similarity	NPC306131
0.5686	Remote Similarity	NPC200802
0.5652	Remote Similarity	NPC31896
0.5631	Remote Similarity	NPC264101
0.5625	Remote Similarity	NPC475333
0.5625	Remote Similarity	NPC32361
0.5625	Remote Similarity	NPC13193
0.5625	Remote Similarity	NPC224098
0.5625	Remote Similarity	NPC208383
0.5577	Remote Similarity	NPC215408
0.5575	Remote Similarity	NPC194207
0.5575	Remote Similarity	NPC22779
0.5566	Remote Similarity	NPC14704
0.5565	Remote Similarity	NPC84111
0.5565	Remote Similarity	NPC287483
0.5565	Remote Similarity	NPC470865
0.5556	Remote Similarity	NPC602423
0.5546	Remote Similarity	NPC477807
0.552	Remote Similarity	NPC481190
0.5505	Remote Similarity	NPC248746
0.5464	Remote Similarity	NPC473774
0.5464	Remote Similarity	NPC481419
0.5464	Remote Similarity	NPC481417
0.5463	Remote Similarity	NPC202898
0.5462	Remote Similarity	NPC481189
0.5462	Remote Similarity	NPC480556
0.5455	Remote Similarity	NPC210569
0.5417	Remote Similarity	NPC224314
0.5372	Remote Similarity	NPC477808
0.5349	Remote Similarity	NPC329807
0.5339	Remote Similarity	NPC232054
0.5303	Remote Similarity	NPC329727
0.5294	Remote Similarity	NPC470867
0.5283	Remote Similarity	NPC485601
0.5278	Remote Similarity	NPC305423
0.5234	Remote Similarity	NPC330026
0.5185	Remote Similarity	NPC70204
0.5179	Remote Similarity	NPC249553
0.5179	Remote Similarity	NPC42171
0.5179	Remote Similarity	NPC274200
0.5172	Remote Similarity	NPC63609
0.5167	Remote Similarity	NPC262050
0.5164	Remote Similarity	NPC473505
0.5155	Remote Similarity	NPC144790
0.5155	Remote Similarity	NPC149400
0.5152	Remote Similarity	NPC481420
0.5152	Remote Similarity	NPC481421
0.5133	Remote Similarity	NPC151134
0.5128	Remote Similarity	NPC108072
0.5114	Remote Similarity	NPC248944
0.5114	Remote Similarity	NPC7479
0.5114	Remote Similarity	NPC257296
0.5096	Remote Similarity	NPC210157
0.5086	Remote Similarity	NPC309278
0.5079	Remote Similarity	NPC305771
0.5079	Remote Similarity	NPC94072
0.5079	Remote Similarity	NPC169816
0.5048	Remote Similarity	NPC292467
0.5042	Remote Similarity	NPC92297

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC107962 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7855
0.1-0.2	1206
0.2-0.3	76
0.3-0.4	8
0.4-0.5	1
0.5-0.6	2
0.6-0.7	0
0.7-0.8	1
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.8902	High Similarity	NPD8171	Phase 2
0.7527	Intermediate Similarity	NPD8170	Phase 2
0.5114	Remote Similarity	NPD6928	Phase 2
0.5051	Remote Similarity	NPD7991	Discontinued

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data