NPASS Compound

Natural Product: NPC125324

Natural Product ID	NPC125324
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	IJWTZRAQSKPMNN-NKYRUOMISA-N
IUPAC Name	n.a.
Synonyms	schidigera-saponin A3
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL454720
PubChem CID	10509967
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 135143 0 0 0 0 0 0 0 0999 V2000 -5.1508 4.6792 -1.1292 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1768 3.7879 -1.5818 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8357 2.5081 -2.1150 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.9179 1.6351 -2.5668 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2978 0.7790 -1.7157 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.4869 1.5304 -0.8666 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1403 1.2232 -1.0238 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3825 2.3510 -1.7061 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0280 1.7715 -1.8981 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7643 1.7546 -0.5756 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8360 1.4737 0.5545 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4295 0.7342 0.1684 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 0.7953 1.7308 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8586 0.4838 1.7647 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7119 0.8613 0.5799 C 0 0 2 0 0 0 0 0 0 0 0 0 2.8856 0.7712 -0.6597 C 0 0 2 0 0 0 0 0 0 0 0 0 3.6774 0.9414 -1.9265 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8976 0.0568 -1.9675 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7056 0.2378 -0.7234 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8283 -0.1232 0.4472 C 0 0 1 0 0 0 0 0 0 0 0 0 5.8054 -0.1911 1.5593 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9315 -1.0022 0.9377 C 0 0 1 0 0 0 0 0 0 0 0 0 6.7599 -0.8524 -0.5665 C 0 0 2 0 0 0 0 0 0 0 0 0 8.1277 -0.4409 -1.0178 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5392 -1.1437 -2.2996 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9871 -0.8890 0.1486 C 0 0 2 0 0 0 0 0 0 0 0 0 8.1764 -0.4634 1.2292 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3143 -0.1653 0.1597 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3702 -1.1578 0.6113 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8252 -2.0736 1.6500 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3324 -2.2257 2.8399 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6003 -2.8564 1.2434 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0937 -2.2525 0.1078 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3063 1.5975 -0.6758 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3036 3.1765 -0.4004 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2824 0.0237 -0.8884 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4070 0.8196 -0.3437 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.8288 2.0047 -1.1434 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.0817 1.8039 -1.7658 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1455 1.2351 0.9881 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1180 0.7736 1.8499 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7171 1.8935 2.4555 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9107 1.5227 3.0823 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.5452 2.7820 3.6284 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7822 3.6523 2.5619 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5668 0.6339 4.2478 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6046 -0.4688 3.9211 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4981 -0.0275 2.9697 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.9113 -1.1874 2.4410 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0060 -0.9140 5.0937 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7788 0.0251 4.6355 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6891 -1.1721 -1.4831 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2848 -2.3037 -0.8288 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4537 -3.1416 -1.5560 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0659 -3.6320 -2.7047 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4504 -2.9067 -3.8761 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0716 -3.1086 -3.9633 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5456 -3.3938 -2.7189 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2036 -3.7129 -1.4184 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5153 -2.9985 -0.3053 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2254 -3.8343 0.7749 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5310 -3.2622 -1.4921 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0718 -4.3107 -3.6620 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2001 4.7082 -0.1400 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5732 3.5296 -0.7117 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5667 4.2387 -2.3822 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4283 2.8915 -3.0101 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6742 0.0450 -2.2979 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1162 0.3957 -1.8053 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3000 3.2563 -1.1098 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7672 2.5384 -2.7176 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5668 2.2891 -2.7037 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8836 0.7233 -2.2130 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4568 2.4860 0.9071 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0674 0.7606 1.0994 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1316 -0.3559 0.0983 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8806 -0.2027 1.8526 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1261 1.3530 2.6663 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0551 -0.5925 2.0495 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3167 1.0529 2.6398 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1333 1.8640 0.7613 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4355 -0.2530 -0.6826 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9980 1.9797 -2.1121 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0297 0.6398 -2.7727 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4545 0.2542 -2.8786 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5653 -1.0184 -1.9825 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4341 -1.1486 0.2700 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1386 0.7702 1.9635 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4010 -0.7597 2.4504 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8482 -2.0532 1.2382 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4730 -1.7928 -1.0586 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2743 0.6593 -1.0979 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5934 -1.5161 -2.7697 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1638 -2.0400 -2.1214 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9918 -0.4175 -3.0038 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6282 0.1518 -0.8703 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3277 0.6676 0.8826 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6511 -1.8234 -0.2612 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2896 -0.7026 0.9795 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8881 -2.9060 3.5440 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2064 -1.6701 3.1334 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9142 -3.8934 0.9197 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8965 -2.9020 2.0734 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0754 1.7187 0.1167 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5694 2.3777 -0.5230 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7200 1.7918 -1.7112 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0234 3.5726 0.6227 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3816 3.2581 -0.4879 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7652 3.8824 -1.1035 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6863 -0.3270 0.0211 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3506 0.1832 -0.2461 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0445 2.8445 -0.4171 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9650 1.9043 -2.7606 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9014 0.1721 1.3337 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5353 1.0001 2.3445 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8455 3.2186 4.3589 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5297 2.5100 4.0819 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0980 3.5931 1.8508 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1443 1.2577 5.0695 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1477 -1.3184 3.4371 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7520 0.5982 3.4875 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5157 -1.7272 3.1655 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5724 -0.1745 5.5736 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9619 0.3450 5.5543 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6924 -1.9922 0.0800 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8097 -4.7134 -2.8217 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5930 -1.7982 -3.7268 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9612 -3.1512 -4.8272 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7678 -2.9949 -4.8878 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8203 -2.3991 -3.1097 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2117 -4.8149 -1.2374 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1901 -2.2081 0.0964 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7800 -4.6289 0.3960 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8553 -3.2134 -0.5473 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9854 -4.0814 -3.8995 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 26 27 1 1 26 28 1 0 28 29 1 0 29 30 1 0 30 31 2 0 30 32 1 0 32 33 1 0 19 34 1 1 10 35 1 1 5 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 37 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 43 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 47 50 1 0 46 51 1 0 36 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 55 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 59 62 1 0 58 63 1 0 38 3 1 0 48 41 1 0 60 53 1 0 12 7 1 0 20 15 1 0 27 22 1 0 16 10 1 0 23 19 1 0 33 26 1 0 1 64 1 0 2 65 1 0 2 66 1 0 3 67 1 6 5 68 1 6 7 69 1 6 8 70 1 0 8 71 1 0 9 72 1 0 9 73 1 0 11 74 1 1 12 75 1 0 12 76 1 0 13 77 1 0 13 78 1 0 14 79 1 0 14 80 1 0 15 81 1 1 16 82 1 6 17 83 1 0 17 84 1 0 18 85 1 0 18 86 1 0 20 87 1 6 21 88 1 0 21 89 1 0 22 90 1 6 23 91 1 6 24 92 1 6 25 93 1 0 25 94 1 0 25 95 1 0 28 96 1 0 28 97 1 0 29 98 1 0 29 99 1 0 31100 1 0 31101 1 0 32102 1 0 32103 1 0 34104 1 0 34105 1 0 34106 1 0 35107 1 0 35108 1 0 35109 1 0 36110 1 1 37111 1 1 38112 1 1 39113 1 0 41114 1 6 43115 1 6 44116 1 0 44117 1 0 45118 1 0 46119 1 1 47120 1 6 48121 1 1 49122 1 0 50123 1 0 51124 1 0 53125 1 1 55126 1 6 56127 1 0 56128 1 0 57129 1 0 58130 1 6 59131 1 1 60132 1 1 61133 1 0 62134 1 0 63135 1 0 M END

Standard InCHIKey	IJWTZRAQSKPMNN-NKYRUOMISA-N
Standard InCHI	InChI=1S/C45H72O18/c1-19-7-12-45(56-18-19)20(2)30-26(63-45)14-25-23-6-5-21-13-22(8-10-43(21,3)24(23)9-11-44(25,30)4)57-42-39(62-41-37(55)35(53)32(50)28(16-47)59-41)38(33(51)29(17-48)60-42)61-40-36(54)34(52)31(49)27(15-46)58-40/h20-42,46-55H,1,5-18H2,2-4H3/t20-,21+,22-,23+,24-,25-,26-,27+,28+,29+,30-,31+,32+,33+,34-,35-,36+,37+,38-,39+,40-,41-,42+,43-,44-,45+/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@@H](C2)CC[C@@H]2[C@@H]3CC[C@]3([C@H]2C[C@H]2[C@@H]3[C@H](C)[C@]3(O2)CCC(=C)CO3)C)C)[C@@H]([C@H]([C@@H]1O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	900.47	Volume:	865.455 ? Van der Waals volume.
Dense:	1.04	LogP:	1.386 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.192 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.058 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	49.0
TPSA:	276.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	10.0	Rings:	9.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.1	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.753	Fsp³:	0.956
MCE-18:	230.455 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.64	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.01 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.259	Promiscuous compounds:	0.043

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.392	MDCK Permeability:	-5.129
Pgp-inhibitor:	0.0	Pgp-substrate:	0.066
PAMPA:	0.882 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.001	30% Bioavailability (F30%):	0.973
50% Bioavailability (F50%):	0.994

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.452	MRP1:	0.004
Plasma Protein Binding (PPB):	61.976%	Volume Distribution (VD):	-0.47
Fu:	31.112% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.104
BSEP inhibitor:	0.018

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.001	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.999	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.178
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.297

Half-life (T1/2):

3.498

ADMET: Toxicity

hERG Blockers:	0.007	hERG Blockers (10um):	0.016
Human Hepatotoxicity (H-HT):	0.644	Drug-induced Liver Injury (DILI):	0.983
AMES Toxicity:	0.947	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.1	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.291	Drug-induced Nephrotoxicity:	0.671
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.181
A549 Cytotoxicity:	0.721	Hek293 Cytotoxicity:	0.797
BCF:	1.503 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.332 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.473 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.889 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10757713]
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	bark	n.a.	n.a.	PMID[15165156]
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	6

Activity Type	# Activity
Organism	6

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	MIC	=	12.5	ug.mL-1	PubChem BioAssay data set
NPT20	Organism	Candida albicans	Candida albicans	MIC	=	12.5	ug.mL-1	PubChem BioAssay data set
NPT772	Organism	Pichia anomala	Wickerhamomyces anomalus	MIC	=	6.13	ug.mL-1	DOI[10.6019/CHEMBL1201861]
NPT5427	Organism	Hanseniaspora uvarum	Hanseniaspora uvarum	MIC	>	100.0	ug.mL-1	PMID[22413887]
NPT5425	Organism	Pichia nakazawae	Pichia nakazawae	MIC	=	3.13	ug.mL-1	PMID[12880329]
NPT5426	Organism	Debaryomyces hansenii	Debaryomyces hansenii	MIC	>	100.0	ug.mL-1	PMID[11141096]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC125324 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25709
0.1-0.2	20927
0.2-0.3	2593
0.3-0.4	382
0.4-0.5	133
0.5-0.6	68
0.6-0.7	31
0.7-0.8	0
0.8-0.85	0
0.85-0.9	2
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9213	High Similarity	NPC51172
0.9213	High Similarity	NPC49032
0.8605	High Similarity	NPC206003
0.8605	High Similarity	NPC473610
0.7957	Intermediate Similarity	NPC475351
0.78	Intermediate Similarity	NPC108072
0.7732	Intermediate Similarity	NPC151134
0.73	Intermediate Similarity	NPC97700
0.73	Intermediate Similarity	NPC184617
0.73	Intermediate Similarity	NPC30856
0.6957	Remote Similarity	NPC297348
0.6957	Remote Similarity	NPC249204
0.6957	Remote Similarity	NPC48339
0.6957	Remote Similarity	NPC141769
0.6957	Remote Similarity	NPC477547
0.6822	Remote Similarity	NPC132080
0.6774	Remote Similarity	NPC325828
0.6771	Remote Similarity	NPC54619
0.6768	Remote Similarity	NPC160426
0.6765	Remote Similarity	NPC300557
0.6762	Remote Similarity	NPC116756
0.6735	Remote Similarity	NPC6295
0.6731	Remote Similarity	NPC475319
0.6702	Remote Similarity	NPC234352
0.6636	Remote Similarity	NPC470864
0.6634	Remote Similarity	NPC473601
0.6632	Remote Similarity	NPC477451
0.6598	Remote Similarity	NPC211354
0.6598	Remote Similarity	NPC107188
0.6569	Remote Similarity	NPC602423
0.6542	Remote Similarity	NPC232037
0.6486	Remote Similarity	NPC470867
0.6465	Remote Similarity	NPC107962
0.6429	Remote Similarity	NPC19400
0.6381	Remote Similarity	NPC128572
0.6339	Remote Similarity	NPC470866
0.6273	Remote Similarity	NPC83137
0.6262	Remote Similarity	NPC115165
0.625	Remote Similarity	NPC475643
0.6216	Remote Similarity	NPC233433
0.6147	Remote Similarity	NPC309278
0.5981	Remote Similarity	NPC42171
0.5929	Remote Similarity	NPC477811
0.59	Remote Similarity	NPC250393
0.5847	Remote Similarity	NPC220836
0.5816	Remote Similarity	NPC481424
0.5816	Remote Similarity	NPC481422
0.5804	Remote Similarity	NPC232611
0.5758	Remote Similarity	NPC177834
0.5714	Remote Similarity	NPC475625
0.5714	Remote Similarity	NPC473518
0.5714	Remote Similarity	NPC485594
0.5714	Remote Similarity	NPC477808
0.5702	Remote Similarity	NPC476112
0.5702	Remote Similarity	NPC470862
0.5702	Remote Similarity	NPC307534
0.57	Remote Similarity	NPC294686
0.5659	Remote Similarity	NPC481189
0.5619	Remote Similarity	NPC485595
0.5603	Remote Similarity	NPC31896
0.5593	Remote Similarity	NPC94086
0.5593	Remote Similarity	NPC473817
0.5586	Remote Similarity	NPC98018
0.5586	Remote Similarity	NPC284104
0.5586	Remote Similarity	NPC103616
0.5566	Remote Similarity	NPC195297
0.5547	Remote Similarity	NPC329807
0.5545	Remote Similarity	NPC471464
0.5506	Remote Similarity	NPC481427
0.55	Remote Similarity	NPC181845
0.55	Remote Similarity	NPC481425
0.55	Remote Similarity	NPC481426
0.5495	Remote Similarity	NPC480555
0.5495	Remote Similarity	NPC150372
0.5487	Remote Similarity	NPC470863
0.5476	Remote Similarity	NPC481190
0.5455	Remote Similarity	NPC92890
0.5437	Remote Similarity	NPC222731
0.5429	Remote Similarity	NPC264101
0.5379	Remote Similarity	NPC329727
0.5372	Remote Similarity	NPC477807
0.537	Remote Similarity	NPC113044
0.537	Remote Similarity	NPC283829
0.537	Remote Similarity	NPC161676
0.5354	Remote Similarity	NPC24960
0.5312	Remote Similarity	NPC330026
0.5285	Remote Similarity	NPC210569
0.5254	Remote Similarity	NPC84111
0.5254	Remote Similarity	NPC287483
0.5254	Remote Similarity	NPC470865
0.5254	Remote Similarity	NPC480553
0.525	Remote Similarity	NPC262050
0.5225	Remote Similarity	NPC470433
0.5225	Remote Similarity	NPC46190
0.5225	Remote Similarity	NPC171073
0.5196	Remote Similarity	NPC481423
0.5182	Remote Similarity	NPC112274
0.5179	Remote Similarity	NPC477809
0.5143	Remote Similarity	NPC474399
0.5096	Remote Similarity	NPC291203
0.5096	Remote Similarity	NPC217205
0.5091	Remote Similarity	NPC14704
0.5085	Remote Similarity	NPC480554
0.5051	Remote Similarity	NPC277715
0.5046	Remote Similarity	NPC470432
0.5046	Remote Similarity	NPC230507
0.5044	Remote Similarity	NPC248746
0.5043	Remote Similarity	NPC102016
0.5043	Remote Similarity	NPC95051

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC125324 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7741
0.1-0.2	1318
0.2-0.3	74
0.3-0.4	11
0.4-0.5	4
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6774	Remote Similarity	NPD8171	Phase 2
0.5769	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data