NPASS Compound

Natural Product: NPC124677

Natural Product ID	NPC124677
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	NABPSKKFOWENEB-KUYDPMQHSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL501681
PubChem CID	21626520
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 134142 0 0 0 0 0 0 0 0999 V2000 -4.6991 3.9228 1.6867 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5240 3.4269 0.6967 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1101 1.9964 0.2812 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8237 2.1078 -0.1815 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2272 0.9551 -0.6197 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9489 0.8590 -0.0724 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9858 0.7523 -1.1030 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1635 1.9933 -1.1255 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3079 1.7915 -1.3282 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8535 0.7167 -0.3881 C 0 0 1 0 0 0 0 0 0 0 0 0 1.1616 -0.5318 -0.7854 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8152 -1.6728 -0.8891 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2415 -1.9162 -0.6523 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9118 -0.6819 -0.1150 C 0 0 2 0 0 0 0 0 0 0 0 0 3.3245 0.6015 -0.6868 C 0 0 2 0 0 0 0 0 0 0 0 0 4.1145 1.7651 -0.1954 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5247 1.6781 -0.8013 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1541 0.4803 -0.1367 C 0 0 1 0 0 0 0 0 0 0 0 0 5.3347 -0.7310 -0.5676 C 0 0 1 0 0 0 0 0 0 0 0 0 6.1646 -1.8394 -0.0354 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5800 -1.3950 -0.4289 C 0 0 1 0 0 0 0 0 0 0 0 0 7.4852 0.0963 -0.7177 C 0 0 1 0 0 0 0 0 0 0 0 0 7.4968 0.3064 -2.0985 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6631 0.6839 -0.0161 C 0 0 2 0 0 0 0 0 0 0 0 0 9.4327 1.5048 -1.0582 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4486 -0.5123 0.4304 C 0 0 2 0 0 0 0 0 0 0 0 0 8.4703 -1.4926 0.6111 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1193 -0.2884 1.7714 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2223 -1.3139 1.9645 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3206 -1.0450 0.9562 C 0 0 2 0 0 0 0 0 0 0 0 0 11.6630 -0.3900 -0.2455 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3982 -0.8752 -0.4985 O 0 0 0 0 0 0 0 0 0 0 0 0 13.0053 -2.2928 0.4952 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2566 0.6167 1.3435 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2800 -0.5405 -1.0828 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5388 1.0109 1.0392 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9770 -0.2833 -0.1585 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3431 -0.1137 1.2777 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2303 1.0846 1.4656 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.5438 0.6115 1.5679 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1037 0.8867 2.7900 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.4414 -0.3130 3.4547 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2036 -1.1545 2.6493 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6599 -2.2929 3.5695 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4430 -0.5095 2.1114 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2163 0.8657 1.5675 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.4009 1.6290 2.5978 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.1452 1.5090 3.8004 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.4527 1.4935 1.4058 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9429 -1.3016 1.0817 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1452 0.1725 1.9611 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1250 -0.4029 -0.9277 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1196 -1.5844 -1.6728 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.2173 -1.2482 -3.0166 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1677 -0.2721 -3.1764 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3087 0.1071 -4.6519 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5324 -0.6725 -2.7104 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.5587 -1.5224 -1.4859 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.3361 -2.3853 -1.2919 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.4947 -3.5138 -2.0928 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7184 -2.3168 -1.5723 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2138 0.5312 -2.4160 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8513 4.2929 1.3307 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5899 3.5166 0.8790 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2979 4.0409 -0.2249 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8208 1.7538 -0.5371 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2063 0.9373 -1.7342 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5945 0.7756 -2.0604 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3075 2.5491 -0.1519 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4949 2.7310 -1.9011 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4640 1.3953 -2.3537 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8156 2.7499 -1.2279 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2090 -2.5509 -1.1925 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7599 -2.2992 -1.5671 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3327 -2.7183 0.1404 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8127 -0.6994 0.9897 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4388 0.5305 -1.7878 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6680 2.7498 -0.3857 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2911 1.7248 0.9184 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4701 1.4674 -1.8815 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1100 2.5737 -0.5540 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3385 -0.7343 -1.6763 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9398 -2.7893 -0.5394 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0817 -1.8899 1.0681 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9119 -1.9658 -1.3332 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5407 -0.5339 -2.6065 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4180 1.3825 0.7965 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9846 0.8622 -1.7485 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6299 1.9982 -1.6800 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0017 2.3210 -0.6088 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5443 0.7392 1.7544 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3916 -0.3038 2.6025 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8457 -2.3211 1.7936 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6333 -1.1838 2.9942 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0466 -0.3169 1.4127 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6865 0.7033 -0.0642 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2870 -0.5767 -1.1415 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9792 -3.0772 1.2758 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0795 -2.0139 0.2927 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6185 -2.6944 -0.4640 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3033 1.7156 1.5764 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3828 0.2383 1.9034 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1364 0.0775 1.7080 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7719 -1.1700 -0.2768 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4807 -1.1284 -2.0122 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3623 0.7600 1.7375 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6496 0.4367 1.4243 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2912 2.0844 1.2232 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3176 -1.1905 -0.3081 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8088 -1.0422 1.6915 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9867 1.6146 2.4262 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4189 1.4339 3.4730 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6612 -1.6136 1.8231 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7534 -2.7502 4.0274 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3604 -1.8921 4.3035 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1347 -3.0469 2.9090 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2343 -0.4765 2.8896 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6816 0.9127 0.6222 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2794 2.6816 2.3203 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5879 2.3532 4.0285 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9345 0.9859 0.6798 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6484 -2.2348 1.1132 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1552 -0.3549 2.7860 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1778 -2.1646 -1.4739 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8448 0.6484 -2.6581 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3613 0.0766 -5.1900 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1087 -0.5324 -5.0876 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7226 1.1464 -4.6738 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1138 -1.1506 -3.5331 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6836 -0.8700 -0.5986 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3157 -2.6652 -0.2107 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4673 -3.7086 -2.1370 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4624 -1.6947 -1.7681 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0253 0.6433 -2.9543 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 2 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 6 22 24 1 0 24 25 1 0 24 26 1 0 26 27 1 1 26 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 30 33 1 0 18 34 1 1 11 35 1 0 10 36 1 1 5 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 43 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 45 50 1 0 38 51 1 0 37 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 55 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 58 61 1 0 57 62 1 0 39 3 1 0 47 41 1 0 59 53 1 0 35 7 1 0 15 10 1 0 22 18 1 0 32 26 1 0 19 14 1 0 27 21 1 0 1 63 1 0 2 64 1 0 2 65 1 0 3 66 1 6 5 67 1 6 7 68 1 6 8 69 1 0 8 70 1 0 9 71 1 0 9 72 1 0 12 73 1 0 13 74 1 0 13 75 1 0 14 76 1 1 15 77 1 6 16 78 1 0 16 79 1 0 17 80 1 0 17 81 1 0 19 82 1 6 20 83 1 0 20 84 1 0 21 85 1 6 23 86 1 0 24 87 1 1 25 88 1 0 25 89 1 0 25 90 1 0 28 91 1 0 28 92 1 0 29 93 1 0 29 94 1 0 30 95 1 1 31 96 1 0 31 97 1 0 33 98 1 0 33 99 1 0 33100 1 0 34101 1 0 34102 1 0 34103 1 0 35104 1 0 35105 1 0 36106 1 0 36107 1 0 36108 1 0 37109 1 1 38110 1 1 39111 1 1 41112 1 1 43113 1 6 44114 1 0 44115 1 0 44116 1 0 45117 1 1 46118 1 6 47119 1 6 48120 1 0 49121 1 0 50122 1 0 51123 1 0 53124 1 6 55125 1 1 56126 1 0 56127 1 0 56128 1 0 57129 1 6 58130 1 1 59131 1 1 60132 1 0 61133 1 0 62134 1 0 M END

Standard InCHIKey	NABPSKKFOWENEB-KUYDPMQHSA-N
Standard InCHI	InChI=1S/C45H72O17/c1-19-9-14-44(55-18-19)22(4)45(54)29(62-44)16-27-25-8-7-23-15-24(10-12-42(23,5)26(25)11-13-43(27,45)6)58-41-38(61-40-35(52)33(50)31(48)21(3)57-40)36(53)37(28(17-46)59-41)60-39-34(51)32(49)30(47)20(2)56-39/h7,19-22,24-41,46-54H,8-18H2,1-6H3/t19-,20+,21+,22-,24+,25-,26+,27+,28-,29+,30+,31+,32-,33-,34-,35-,36+,37-,38-,39+,40+,41-,42+,43+,44-,45-/m1/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2CC[C@]3(C(=CC[C@@H]4[C@@H]3CC[C@]3([C@H]4C[C@H]4[C@]3(O)[C@H](C)[C@]3(O4)CC[C@H](CO3)C)C)C2)C)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	884.48	Volume:	856.665 ? Van der Waals volume.
Dense:	1.032	LogP:	1.723 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.471 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.221 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	48.0
TPSA:	255.91 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	9.0	Rings:	9.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.157	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.793	Fsp³:	0.956
MCE-18:	236.727 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.807	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.234	Promiscuous compounds:	0.056

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.364	MDCK Permeability:	-5.015
Pgp-inhibitor:	0.0	Pgp-substrate:	0.924
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.057	30% Bioavailability (F30%):	0.46
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.012
Plasma Protein Binding (PPB):	61.942%	Volume Distribution (VD):	-0.39
Fu:	28.935% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.402
BSEP inhibitor:	0.116

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.99	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.079
HLM stability:	0.169 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.26

Half-life (T1/2):

3.604

ADMET: Toxicity

hERG Blockers:	0.057	hERG Blockers (10um):	0.282
Human Hepatotoxicity (H-HT):	0.292	Drug-induced Liver Injury (DILI):	0.906
AMES Toxicity:	0.831	Rat Oral Acute Toxicity:	0.023
Maximum Recommended Daily Dose:	0.024	Skin Sensitization:	1.0
Carcinogencity:	0.016	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.998
Hematotoxicity:	0.093	Drug-induced Nephrotoxicity:	0.655
Genotoxicity:	0.029	RPMI-8226 Immunitoxicity:	0.458
A549 Cytotoxicity:	0.741	Hek293 Cytotoxicity:	0.681
BCF:	1.585 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.409 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.566 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.89 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO24065	Dracaena surculosa	Species	Teiidae	Eukaryota	n.a.	n.a.	n.a.	PMID[11000027]
NPO24065	Dracaena surculosa	Species	Teiidae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO636	Heloniopsis orientalis	Species	Melanthiaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO24065	Dracaena surculosa	Species	Teiidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	4.2	ug.mL-1	PMID[11000027]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC124677 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23942
0.1-0.2	22762
0.2-0.3	2539
0.3-0.4	470
0.4-0.5	74
0.5-0.6	29
0.6-0.7	29
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8421	Intermediate Similarity	NPC40440
0.7879	Intermediate Similarity	NPC469348
0.7677	Intermediate Similarity	NPC42482
0.7426	Intermediate Similarity	NPC470433
0.7426	Intermediate Similarity	NPC46190
0.7426	Intermediate Similarity	NPC171073
0.7282	Intermediate Similarity	NPC274200
0.7212	Intermediate Similarity	NPC480555
0.7212	Intermediate Similarity	NPC150372
0.717	Intermediate Similarity	NPC486386
0.7037	Intermediate Similarity	NPC254255
0.7009	Intermediate Similarity	NPC269297
0.7009	Intermediate Similarity	NPC222202
0.6944	Remote Similarity	NPC475333
0.6944	Remote Similarity	NPC224098
0.6944	Remote Similarity	NPC208383
0.6857	Remote Similarity	NPC248746
0.6818	Remote Similarity	NPC480554
0.6771	Remote Similarity	NPC165439
0.6696	Remote Similarity	NPC480553
0.6577	Remote Similarity	NPC194207
0.6577	Remote Similarity	NPC22779
0.6486	Remote Similarity	NPC13193
0.6481	Remote Similarity	NPC42171
0.6449	Remote Similarity	NPC469347
0.641	Remote Similarity	NPC480556
0.6356	Remote Similarity	NPC224314
0.6293	Remote Similarity	NPC232054
0.6168	Remote Similarity	NPC113044
0.6168	Remote Similarity	NPC283829
0.6168	Remote Similarity	NPC161676
0.6154	Remote Similarity	NPC167183
0.6147	Remote Similarity	NPC602423
0.6132	Remote Similarity	NPC470432
0.6132	Remote Similarity	NPC230507
0.6126	Remote Similarity	NPC475182
0.6117	Remote Similarity	NPC474399
0.6071	Remote Similarity	NPC73243
0.6071	Remote Similarity	NPC244086
0.6071	Remote Similarity	NPC84956
0.6053	Remote Similarity	NPC32361
0.6036	Remote Similarity	NPC300557
0.5981	Remote Similarity	NPC94272
0.5965	Remote Similarity	NPC247037
0.5812	Remote Similarity	NPC249265
0.5806	Remote Similarity	NPC32707
0.5766	Remote Similarity	NPC197231
0.5763	Remote Similarity	NPC23808
0.5763	Remote Similarity	NPC87998
0.5701	Remote Similarity	NPC19400
0.5667	Remote Similarity	NPC308140
0.5664	Remote Similarity	NPC122819
0.5664	Remote Similarity	NPC477809
0.5645	Remote Similarity	NPC477808
0.5586	Remote Similarity	NPC14704
0.5575	Remote Similarity	NPC265275
0.5545	Remote Similarity	NPC485595
0.5545	Remote Similarity	NPC6295
0.5508	Remote Similarity	NPC309278
0.5429	Remote Similarity	NPC181845
0.5398	Remote Similarity	NPC19888
0.5345	Remote Similarity	NPC6806
0.531	Remote Similarity	NPC305423
0.5285	Remote Similarity	NPC287885
0.5268	Remote Similarity	NPC306991
0.5203	Remote Similarity	NPC477811
0.5126	Remote Similarity	NPC102016
0.5126	Remote Similarity	NPC95051
0.5088	Remote Similarity	NPC141433
0.5086	Remote Similarity	NPC98696
0.5041	Remote Similarity	NPC475550

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC124677 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7749
0.1-0.2	1329
0.2-0.3	64
0.3-0.4	4
0.4-0.5	3
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5664	Remote Similarity	NPD8449	Approved

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data