NPASS Compound

Natural Product: NPC274200

Natural Product ID	NPC274200
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Aspaoligonin B
IUPAC Name	n.a.
Synonyms	aspaoligonin B
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL504136
PubChem CID	11377966
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 133141 0 0 0 0 0 0 0 0999 V2000 -4.1235 2.4711 -2.0423 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9972 1.9425 -2.9868 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3045 0.4828 -2.7116 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2021 -0.3109 -2.7158 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5848 -0.6036 -1.5383 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7134 0.4101 -1.1902 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4054 -0.0607 -1.2026 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5256 0.7189 -2.1350 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8696 0.1621 -2.0169 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4314 0.7012 -0.7001 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4122 0.7305 0.3880 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8019 -0.1016 0.1754 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9734 0.2981 1.7409 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3666 0.7220 1.9818 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3140 0.5217 0.8291 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5787 -0.1541 -0.2649 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4292 -0.5919 -1.4215 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7292 -1.2156 -1.0150 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4341 -0.3646 -0.0098 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5201 -0.2991 1.2239 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4269 0.3425 2.2120 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7864 -0.3117 1.9126 C 0 0 1 0 0 0 0 0 0 0 0 0 6.6358 -1.0251 0.5978 C 0 0 1 0 0 0 0 0 0 0 0 0 6.3353 -2.3621 0.8488 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9289 -0.8237 -0.0934 C 0 0 2 0 0 0 0 0 0 0 0 0 8.7191 -2.1440 -0.0634 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6627 0.1703 0.7699 C 0 0 2 0 0 0 0 0 0 0 0 0 7.7842 0.6089 1.7507 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2458 1.3100 -0.0212 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7134 1.0682 -0.2957 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4340 1.1162 1.0387 C 0 0 1 0 0 0 0 0 0 0 0 0 10.5556 0.4446 2.0594 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7210 -0.4586 1.4526 O 0 0 0 0 0 0 0 0 0 0 0 0 12.7924 0.4545 0.9369 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7030 0.9929 -0.5660 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9340 2.1140 -1.0376 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5218 -0.9515 -0.3887 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.9003 -1.0818 -0.9812 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2485 0.2869 -1.5496 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.5871 0.3606 -1.8858 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3113 1.3270 -1.2408 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.1977 0.7661 -0.3158 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6266 1.7228 0.6047 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.5307 2.2276 1.4963 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2765 2.9175 -0.0686 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.4144 2.5459 -1.5314 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.0243 2.2878 -2.1288 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.3774 3.5036 -2.1265 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0751 3.4830 -2.2855 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.5527 3.1456 0.4220 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8575 -1.5740 -0.1454 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1662 -2.1297 0.2579 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9126 -1.9536 1.5989 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.6050 -2.2650 1.9130 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4552 -3.4686 2.5683 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3539 -4.5575 2.0424 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7966 -4.1635 2.2174 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8876 -2.7006 2.4773 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6661 -2.4668 3.8328 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5818 -4.5725 1.1380 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1811 -5.7447 2.7863 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1971 3.4284 -1.9061 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9254 2.5471 -2.9125 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6412 2.0766 -4.0376 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9128 0.1619 -3.6201 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9977 -1.5661 -1.7122 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4302 -1.1140 -1.5466 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8089 0.5936 -3.2017 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6311 1.7747 -1.8665 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7926 -0.9303 -1.9991 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5049 0.5139 -2.8530 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0902 1.8077 0.4988 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5319 -1.1498 0.5038 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5711 0.2152 0.9197 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8121 -0.8042 1.9064 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3157 0.7908 2.4944 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7599 0.0814 2.8266 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3880 1.7549 2.3932 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7111 1.5307 0.5806 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1377 -1.0980 0.1747 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5344 0.2040 -2.2002 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8434 -1.4055 -1.9450 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4837 -2.2099 -0.5487 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3214 -1.3964 -1.9359 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2839 -1.3384 1.4920 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1955 0.0914 3.2714 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4761 1.4318 2.1328 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0340 -1.0607 2.6865 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3007 -2.9286 0.0505 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8985 -0.5464 -1.1467 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7534 -1.9812 0.2416 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7428 -2.6295 -1.0618 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2552 -2.8626 0.6280 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2005 2.2420 0.5929 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7696 1.4747 -1.0079 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7960 0.0318 -0.6699 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1268 1.8109 -1.0087 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5741 2.1811 1.3322 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9805 1.1900 2.6256 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1927 -0.1264 2.7835 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1404 0.1799 1.9428 H 0 0 0 0 0 0 0 0 0 0 0 0 13.5353 1.1364 0.4911 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7002 -0.4081 0.2534 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8199 1.3502 -1.1088 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4862 0.8761 -1.3459 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9439 1.7481 0.1868 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1023 2.7197 -1.5076 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2285 2.6849 -0.1582 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6867 2.0477 -1.8478 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5039 -0.1490 0.3768 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8384 -1.7622 -1.8820 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9894 1.0378 -0.7889 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5807 1.9116 -0.6050 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4220 1.2427 1.2275 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9370 2.3235 2.5223 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2381 3.2571 1.1752 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6539 1.5442 1.5090 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7042 3.8463 0.0572 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0161 1.5982 -1.5580 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2175 1.8974 -3.1497 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5337 3.9779 -2.9803 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6017 3.0412 -3.0256 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.1141 3.4890 -0.3205 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5394 -2.1386 -0.5948 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0667 -0.8626 1.8297 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3724 -3.7872 2.4370 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5339 -3.3510 3.6848 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0965 -4.7347 0.9767 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2459 -4.6694 3.1235 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9367 -2.3834 2.2916 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5264 -2.4124 4.3467 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4541 -5.5042 0.9025 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8190 -6.4344 2.4932 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 1 23 25 1 0 25 26 1 0 25 27 1 0 27 28 1 1 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 31 34 1 0 19 35 1 6 10 36 1 6 5 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 43 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 45 50 1 0 38 51 1 0 37 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 57 60 1 0 56 61 1 0 39 3 1 0 47 41 1 0 58 53 1 0 12 7 1 0 20 15 1 0 28 22 1 0 16 10 1 0 23 19 1 0 33 27 1 0 1 62 1 0 2 63 1 0 2 64 1 0 3 65 1 6 5 66 1 6 7 67 1 6 8 68 1 0 8 69 1 0 9 70 1 0 9 71 1 0 11 72 1 1 12 73 1 0 12 74 1 0 13 75 1 0 13 76 1 0 14 77 1 0 14 78 1 0 15 79 1 6 16 80 1 1 17 81 1 0 17 82 1 0 18 83 1 0 18 84 1 0 20 85 1 1 21 86 1 0 21 87 1 0 22 88 1 1 24 89 1 0 25 90 1 6 26 91 1 0 26 92 1 0 26 93 1 0 29 94 1 0 29 95 1 0 30 96 1 0 30 97 1 0 31 98 1 1 32 99 1 0 32100 1 0 34101 1 0 34102 1 0 34103 1 0 35104 1 0 35105 1 0 35106 1 0 36107 1 0 36108 1 0 36109 1 0 37110 1 1 38111 1 6 39112 1 1 41113 1 1 43114 1 1 44115 1 0 44116 1 0 44117 1 0 45118 1 6 46119 1 1 47120 1 6 48121 1 0 49122 1 0 50123 1 0 51124 1 0 53125 1 1 55126 1 0 55127 1 0 56128 1 6 57129 1 1 58130 1 6 59131 1 0 60132 1 0 61133 1 0 M END

Standard InCHIKey	PDZAPEHDSGAIHT-GIGASQICSA-N
Standard InCHI	InChI=1S/C44H72O17/c1-19-8-13-43(55-17-19)21(3)44(53)29(61-43)15-26-24-7-6-22-14-23(9-11-41(22,4)25(24)10-12-42(26,44)5)57-40-37(60-38-33(50)31(48)27(46)18-54-38)35(52)36(28(16-45)58-40)59-39-34(51)32(49)30(47)20(2)56-39/h19-40,45-53H,6-18H2,1-5H3/t19-,20-,21+,22+,23-,24+,25-,26-,27+,28+,29-,30-,31-,32+,33+,34+,35-,36+,37+,38-,39-,40+,41-,42-,43+,44+/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@@H](C2)CC[C@@H]2[C@@H]3CC[C@]3([C@H]2C[C@H]2[C@]3(O)[C@H](C)[C@]3(O2)CC[C@@H](CO3)C)C)C)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	872.48	Volume:	842.006 ? Van der Waals volume.
Dense:	1.036	LogP:	1.554 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.4 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.188 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	48.0
TPSA:	255.91 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	9.0	Rings:	9.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.153	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.757	Fsp³:	1.0
MCE-18:	235.682 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.756	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.011 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.26	Promiscuous compounds:	0.146

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.324	MDCK Permeability:	-4.937
Pgp-inhibitor:	0.001	Pgp-substrate:	0.931
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.041	30% Bioavailability (F30%):	0.511
50% Bioavailability (F50%):	0.995

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	0.043
Plasma Protein Binding (PPB):	60.841%	Volume Distribution (VD):	-0.397
Fu:	29.933% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.107
BSEP inhibitor:	0.232

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.002	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.711	CYP3A4-substrate:	0.994
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.001
HLM stability:	0.042 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.198

Half-life (T1/2):

3.247

ADMET: Toxicity

hERG Blockers:	0.025	hERG Blockers (10um):	0.157
Human Hepatotoxicity (H-HT):	0.406	Drug-induced Liver Injury (DILI):	0.77
AMES Toxicity:	0.689	Rat Oral Acute Toxicity:	0.008
Maximum Recommended Daily Dose:	0.023	Skin Sensitization:	1.0
Carcinogencity:	0.026	Eye Corrosion:	0.0
Eye Irritation:	0.004	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.997
Hematotoxicity:	0.133	Drug-induced Nephrotoxicity:	0.777
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.282
A549 Cytotoxicity:	0.423	Hek293 Cytotoxicity:	0.439
BCF:	1.509 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.36 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.455 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.804 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32947	asparagus oligoclonos	Species	Asparagaceae	Eukaryota	rhizomes	n.a.	n.a.	PMID[15921426]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	5

Activity Type	# Activity
Cell line	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT81	Cell line	A549	Homo sapiens	IC50	=	2.55	ug.mL-1	PMID[19856955]
NPT146	Cell line	SK-OV-3	Homo sapiens	IC50	=	2.73	ug.mL-1	PMID[24601655]
NPT147	Cell line	SK-MEL-2	Homo sapiens	IC50	=	2.59	ug.mL-1	PMID[21084196]
NPT574	Cell line	XF498	Homo sapiens	IC50	=	2.51	ug.mL-1	PubChem BioAssay data set
NPT148	Cell line	HCT-15	Homo sapiens	IC50	=	2.57	ug.mL-1	PubChem BioAssay data set

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC274200 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	28023
0.1-0.2	19054
0.2-0.3	2181
0.3-0.4	444
0.4-0.5	96
0.5-0.6	48
0.6-0.7	9
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7292	Intermediate Similarity	NPC474399
0.7282	Intermediate Similarity	NPC124677
0.68	Remote Similarity	NPC19400
0.6792	Remote Similarity	NPC471464
0.6698	Remote Similarity	NPC469348
0.6602	Remote Similarity	NPC6295
0.6126	Remote Similarity	NPC128572
0.6055	Remote Similarity	NPC40440
0.6053	Remote Similarity	NPC475333
0.6053	Remote Similarity	NPC224098
0.6053	Remote Similarity	NPC208383
0.5981	Remote Similarity	NPC485595
0.5818	Remote Similarity	NPC475351
0.581	Remote Similarity	NPC250393
0.5727	Remote Similarity	NPC160426
0.5652	Remote Similarity	NPC97700
0.5652	Remote Similarity	NPC30856
0.562	Remote Similarity	NPC167183
0.561	Remote Similarity	NPC480556
0.5566	Remote Similarity	NPC477451
0.5508	Remote Similarity	NPC475625
0.5495	Remote Similarity	NPC195297
0.5492	Remote Similarity	NPC232054
0.5487	Remote Similarity	NPC42482
0.5439	Remote Similarity	NPC470433
0.5439	Remote Similarity	NPC46190
0.5439	Remote Similarity	NPC469347
0.5439	Remote Similarity	NPC171073
0.5424	Remote Similarity	NPC486386
0.5339	Remote Similarity	NPC475319
0.5333	Remote Similarity	NPC232037
0.5333	Remote Similarity	NPC254255
0.5328	Remote Similarity	NPC132080
0.5312	Remote Similarity	NPC32707
0.5304	Remote Similarity	NPC475643
0.5299	Remote Similarity	NPC480555
0.5299	Remote Similarity	NPC150372
0.5273	Remote Similarity	NPC211354
0.525	Remote Similarity	NPC116756
0.5234	Remote Similarity	NPC297348
0.5234	Remote Similarity	NPC249204
0.5234	Remote Similarity	NPC48339
0.5234	Remote Similarity	NPC141769
0.5234	Remote Similarity	NPC477547
0.5203	Remote Similarity	NPC233433
0.5182	Remote Similarity	NPC206003
0.5182	Remote Similarity	NPC473610
0.5179	Remote Similarity	NPC107962
0.5167	Remote Similarity	NPC269297
0.5167	Remote Similarity	NPC222202
0.5122	Remote Similarity	NPC486384
0.5093	Remote Similarity	NPC325828
0.5093	Remote Similarity	NPC177834
0.5085	Remote Similarity	NPC51172
0.5085	Remote Similarity	NPC49032
0.5082	Remote Similarity	NPC194207
0.5082	Remote Similarity	NPC22779
0.5041	Remote Similarity	NPC249265
0.5041	Remote Similarity	NPC480554

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC274200 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7969
0.1-0.2	1117
0.2-0.3	51
0.3-0.4	10
0.4-0.5	2
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5093	Remote Similarity	NPD8171	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data