NPASS Compound

Natural Product: NPC116756

Natural Product ID	NPC116756
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	22-O-Methylparvispinoside B
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL452064
PubChem CID	11521005
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 181190 0 0 0 0 0 0 0 0999 V2000 -3.8765 0.9145 3.1595 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1736 0.7578 2.6000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9804 0.9078 1.1183 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.1754 -0.0196 0.5600 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9116 0.1633 -0.7895 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.9070 -0.6480 -1.2467 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7849 0.0546 -1.6416 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8508 -0.0153 -0.4012 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1625 -1.3225 -0.2588 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6817 -1.7282 -1.4506 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4327 -0.6504 -2.4961 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.0063 -0.4204 -2.7918 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2782 -0.8652 -3.7057 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7285 -0.6486 -3.2687 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1205 -1.6276 -2.2144 C 0 0 2 0 0 0 0 0 0 0 0 0 2.0943 -1.6646 -1.0733 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5486 -2.6902 -0.0480 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8139 -2.1707 0.6008 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8876 -2.0236 -0.4455 C 0 0 1 0 0 0 0 0 0 0 0 0 4.3408 -1.1329 -1.5464 C 0 0 1 0 0 0 0 0 0 0 0 0 5.5820 -0.9125 -2.3365 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4462 -0.3166 -1.1910 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0190 -1.1410 0.0333 C 0 0 2 0 0 0 0 0 0 0 0 0 7.2763 -1.8646 0.3324 C 0 0 2 0 0 0 0 0 0 0 0 0 7.4470 -2.1811 1.7786 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3190 -0.6593 -0.0088 C 0 0 1 0 0 0 0 0 0 0 0 0 7.7789 -0.5066 -1.3307 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9435 0.2841 0.8352 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1413 1.6033 0.6586 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5805 -1.3924 0.0397 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9121 -0.8193 -0.1152 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4482 0.0515 0.9626 C 0 0 2 0 0 0 0 0 0 0 0 0 12.8367 0.5802 0.6573 C 0 0 0 0 0 0 0 0 0 0 0 0 13.7539 -0.4324 0.4849 O 0 0 0 0 0 0 0 0 0 0 0 0 15.0173 0.0729 0.2236 C 0 0 2 0 0 0 0 0 0 0 0 0 15.3967 -0.1748 -1.1088 O 0 0 0 0 0 0 0 0 0 0 0 0 16.4424 0.7498 -1.3355 C 0 0 2 0 0 0 0 0 0 0 0 0 16.8247 0.8002 -2.7756 C 0 0 0 0 0 0 0 0 0 0 0 0 17.8480 1.7369 -2.9460 O 0 0 0 0 0 0 0 0 0 0 0 0 17.6320 0.4544 -0.4932 C 0 0 2 0 0 0 0 0 0 0 0 0 17.3792 0.0809 0.9207 C 0 0 1 0 0 0 0 0 0 0 0 0 16.0294 -0.4964 1.1501 C 0 0 1 0 0 0 0 0 0 0 0 0 15.5841 -0.2144 2.4580 O 0 0 0 0 0 0 0 0 0 0 0 0 18.3923 -0.8502 1.2749 O 0 0 0 0 0 0 0 0 0 0 0 0 18.4586 1.5956 -0.4992 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6586 -0.7873 2.2599 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3167 -3.3675 -0.9147 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3036 -3.0938 -1.9182 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1569 0.1243 -1.6206 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0364 1.2525 -1.0617 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2987 1.1704 0.3638 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3263 0.4305 0.8780 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1751 1.0126 1.7253 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.2284 0.3758 3.0029 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8764 1.2919 3.8513 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.6245 0.8698 5.2580 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1072 -0.4042 5.5304 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2986 1.4432 3.4882 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.4724 1.7324 1.9671 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.6157 0.8316 1.1994 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.6016 0.8967 -0.1685 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8596 -0.3438 -0.7073 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.6141 -0.9518 -1.1031 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8577 -2.3231 -1.1035 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.6029 -3.1300 -1.3955 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9475 -4.4868 -1.3716 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9260 -2.7694 -2.0471 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.1439 -1.8688 -2.0790 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.7078 -0.4079 -1.9092 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.8522 0.3590 -1.8406 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8404 -2.0451 -3.2545 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4097 -2.9621 -3.3351 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.8532 1.5956 1.7704 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.4791 2.8439 1.7030 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.1136 3.0340 3.0054 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.3097 4.3821 3.1324 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.2118 4.9883 2.1106 C 0 0 2 0 0 0 0 0 0 0 0 0 -14.1089 4.4055 0.7390 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.5846 2.9648 0.7435 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.3429 2.6131 -0.5615 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.3860 4.4358 0.1528 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.8502 6.3538 1.9972 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7901 2.6053 4.1200 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1007 1.5616 -1.8765 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9089 0.5123 -2.9493 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3009 1.4562 2.5786 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4724 -0.2560 2.9319 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7783 1.5676 3.0241 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3732 1.8785 1.0566 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5174 1.2179 -0.8908 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0178 1.1583 -1.6524 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5290 0.1449 0.4677 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1846 0.8559 -0.4245 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4812 -1.2350 0.6596 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8859 -2.1226 -0.0403 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8332 0.2912 -1.9995 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0241 0.4031 -3.5712 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4326 -1.2851 -3.3348 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1879 -1.9077 -4.0341 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0040 -0.1740 -4.4993 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8899 0.4023 -2.9447 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3636 -0.8164 -4.1559 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2221 -2.6150 -2.7014 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2487 -0.6673 -0.5427 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7743 -2.7338 0.7403 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6351 -3.7026 -0.4581 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0937 -2.8653 1.4101 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6053 -1.1671 1.0128 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0808 -0.1566 -1.0658 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0422 -1.7780 -2.7926 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4880 -0.1134 -3.1232 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0717 0.7050 -1.1126 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7327 -0.5016 0.8816 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6006 -2.6341 -0.3464 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4169 -2.1512 2.2423 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1118 -1.4564 2.2664 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8180 -3.2082 1.9632 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1729 1.9458 0.5060 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4420 2.1363 -0.0309 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8852 2.0875 1.6797 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6271 -2.0428 1.0021 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4625 -2.2568 -0.7256 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6364 -1.7004 -0.1747 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0691 -0.3493 -1.1424 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8365 0.8611 1.2622 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8616 1.2848 -0.1735 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1563 1.1453 1.5778 H 0 0 0 0 0 0 0 0 0 0 0 0 14.9488 1.1991 0.2639 H 0 0 0 0 0 0 0 0 0 0 0 0 16.0142 1.7460 -1.0413 H 0 0 0 0 0 0 0 0 0 0 0 0 15.9746 0.9725 -3.4557 H 0 0 0 0 0 0 0 0 0 0 0 0 17.2700 -0.1778 -3.1000 H 0 0 0 0 0 0 0 0 0 0 0 0 17.5096 2.6550 -3.0377 H 0 0 0 0 0 0 0 0 0 0 0 0 18.2480 -0.3235 -1.0194 H 0 0 0 0 0 0 0 0 0 0 0 0 17.5293 0.9767 1.5685 H 0 0 0 0 0 0 0 0 0 0 0 0 16.0141 -1.6015 1.0325 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7807 -0.7328 2.7009 H 0 0 0 0 0 0 0 0 0 0 0 0 19.2499 -0.3959 1.0336 H 0 0 0 0 0 0 0 0 0 0 0 0 17.9422 2.4181 -0.6966 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3528 -0.1881 2.8759 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6972 -0.9942 2.7562 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1403 -1.7378 1.9568 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4709 -3.8491 -1.4531 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4908 -4.0031 -0.0198 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1781 -3.3907 -1.5763 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2857 -3.6194 -1.1246 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3603 -2.9465 -2.8182 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1330 -3.7495 -2.1807 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6618 -0.8284 -1.6720 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3372 2.1442 -1.2178 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5378 2.2202 0.7461 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0711 2.0650 1.9496 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3357 2.2621 3.6392 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5022 0.7856 5.3641 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0367 1.5640 6.0123 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2216 -0.5580 6.4988 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9059 0.5694 3.7186 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1986 2.7819 1.8807 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8600 -0.2448 1.4984 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1947 -1.0464 0.0803 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1723 -2.5725 -0.0456 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1446 -2.8417 -2.3449 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8926 -2.9668 -0.5604 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4409 -4.7444 -2.1752 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2810 -3.7716 -1.7283 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7922 -2.1018 -1.2265 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1338 -0.1638 -2.8551 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7637 1.2203 -2.3314 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5547 -1.3533 -3.2827 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1008 -2.8428 -4.0286 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7847 3.6869 1.6845 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.3255 4.8960 3.0605 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7834 4.5934 4.1320 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.2910 4.9714 2.4307 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4381 4.9932 0.0817 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.5034 2.3726 1.1000 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.9507 1.8742 -0.8662 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.0575 4.0419 0.7615 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9284 6.4939 2.3517 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2367 3.3822 3.9163 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9169 1.1252 -2.7638 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5235 -0.2735 -3.4020 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 26 27 1 0 26 28 1 1 28 29 1 0 26 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 37 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 41 44 1 0 40 45 1 0 32 46 1 0 19 47 1 6 10 48 1 6 5 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 55 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 64 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 68 71 1 0 67 72 1 0 59 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 78 79 1 0 79 80 1 0 78 81 1 0 77 82 1 0 58 83 1 0 50 84 1 0 49 85 1 0 51 3 1 0 60 53 1 0 69 62 1 0 79 74 1 0 12 7 1 0 20 15 1 0 27 22 1 0 42 35 1 0 16 10 1 0 23 19 1 0 1 86 1 0 2 87 1 0 2 88 1 0 3 89 1 1 5 90 1 1 7 91 1 6 8 92 1 0 8 93 1 0 9 94 1 0 9 95 1 0 11 96 1 1 12 97 1 0 12 98 1 0 13 99 1 0 13100 1 0 14101 1 0 14102 1 0 15103 1 6 16104 1 1 17105 1 0 17106 1 0 18107 1 0 18108 1 0 20109 1 1 21110 1 0 21111 1 0 22112 1 1 23113 1 1 24114 1 6 25115 1 0 25116 1 0 25117 1 0 29118 1 0 29119 1 0 29120 1 0 30121 1 0 30122 1 0 31123 1 0 31124 1 0 32125 1 1 33126 1 0 33127 1 0 35128 1 6 37129 1 1 38130 1 0 38131 1 0 39132 1 0 40133 1 6 41134 1 1 42135 1 1 43136 1 0 44137 1 0 45138 1 0 46139 1 0 46140 1 0 46141 1 0 47142 1 0 47143 1 0 47144 1 0 48145 1 0 48146 1 0 48147 1 0 49148 1 6 50149 1 1 51150 1 1 53151 1 1 55152 1 1 56153 1 0 56154 1 0 57155 1 0 58156 1 1 59157 1 1 60158 1 6 62159 1 1 64160 1 1 65161 1 0 65162 1 0 66163 1 0 67164 1 1 68165 1 1 69166 1 6 70167 1 0 71168 1 0 72169 1 0 74170 1 6 76171 1 0 76172 1 0 77173 1 1 78174 1 6 79175 1 1 80176 1 0 81177 1 0 82178 1 0 83179 1 0 84180 1 0 85181 1 0 M END

Standard InCHIKey	QOKZNLCOQRNCTQ-RRUBVMBASA-N
Standard InCHI	InChI=1S/C57H96O28/c1-22(20-75-50-44(71)40(67)37(64)31(16-58)78-50)8-13-57(74-5)23(2)35-30(85-57)15-28-26-7-6-24-14-25(9-11-55(24,3)27(26)10-12-56(28,35)4)77-52-46(73)42(69)47(34(19-61)81-52)82-54-49(84-53-45(72)41(68)38(65)32(17-59)79-53)48(39(66)33(18-60)80-54)83-51-43(70)36(63)29(62)21-76-51/h22-54,58-73H,6-21H2,1-5H3/t22-,23+,24+,25+,26-,27+,28+,29-,30+,31-,32-,33-,34-,35+,36+,37-,38+,39-,40+,41+,42-,43-,44-,45-,46-,47+,48+,49-,50-,51+,52-,53+,54+,55+,56+,57-/m1/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2)CC[C@@H]2[C@@H]3CC[C@]3([C@H]2C[C@H]2[C@@H]3[C@H](C)[C@@](O2)(OC)CC[C@H](CO[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)C)C)C)[C@@H]([C@H]([C@H]1O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O[C@@H]1O[C@H](CO)[C@@H]([C@@H]([C@H]1O)O)O)O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1228.61	Volume:	1154.989 ? Van der Waals volume.
Dense:	1.064	LogP:	0.535 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.282 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.728 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	19.0	Rigid Bonds:	54.0
TPSA:	434.44 ? Topological Polar Surface Area.	H-Bond Acceptor:	28.0
H-Bond Donor:	16.0	Rings:	10.0
Heavy Atoms:	28.0

MedChem Properties

QED Drug-Likeness Score:	0.054	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.303	Fsp³:	1.0
MCE-18:	199.579 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.631	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.006 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.468	Promiscuous compounds:	0.026

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.0	MDCK Permeability:	-5.082
Pgp-inhibitor:	0.0	Pgp-substrate:	0.914
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.999
20% Bioavailability (F20%):	0.96	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.013
Plasma Protein Binding (PPB):	34.182%	Volume Distribution (VD):	-0.383
Fu:	45.926% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.04
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.508

Half-life (T1/2):

3.101

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.773	Drug-induced Liver Injury (DILI):	0.971
AMES Toxicity:	0.998	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.102	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.959	Drug-induced Nephrotoxicity:	0.996
Genotoxicity:	0.006	RPMI-8226 Immunitoxicity:	0.318
A549 Cytotoxicity:	0.999	Hek293 Cytotoxicity:	0.959
BCF:	1.456 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.431 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.647 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.824 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33193	tribulus parvispinus	Species	n.a.	Eukaryota	n.a.	n.a.	n.a.	PMID[16252924]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	3
Activity	2

Activity Type	# Activity
Cell line	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT65	Cell line	HepG2	Homo sapiens	IC50	=	30000.0	nM	DOI[10.6019/CHEMBL1201861]
NPT83	Cell line	MCF7	Homo sapiens	IC50	=	40000.0	nM	PMID[22264170]
NPT466	Cell line	U-937	Homo sapiens	IC50	=	2000.0	nM	PMID[22264170]
NPT466	Cell line	U-937	Homo sapiens	Activity	=	50.0	%	PMID[24963714]
NPT466	Cell line	U-937	Homo sapiens	Activity	=	3.0	%	PMID[24963714]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC116756 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	28837
0.1-0.2	18029
0.2-0.3	2362
0.3-0.4	414
0.4-0.5	90
0.5-0.6	53
0.6-0.7	37
0.7-0.8	1
0.8-0.85	3
0.85-0.9	2
0.9-0.95	3
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9307	High Similarity	NPC470866
0.9072	High Similarity	NPC97700
0.9072	High Similarity	NPC30856
0.8812	High Similarity	NPC470864
0.8529	High Similarity	NPC232611
0.8462	Intermediate Similarity	NPC132080
0.8265	Intermediate Similarity	NPC475351
0.8173	Intermediate Similarity	NPC232037
0.7788	Intermediate Similarity	NPC184617
0.7778	Intermediate Similarity	NPC233433
0.7714	Intermediate Similarity	NPC115165
0.7629	Intermediate Similarity	NPC250393
0.7619	Intermediate Similarity	NPC98018
0.7619	Intermediate Similarity	NPC284104
0.7619	Intermediate Similarity	NPC103616
0.7551	Intermediate Similarity	NPC206003
0.7551	Intermediate Similarity	NPC473610
0.7523	Intermediate Similarity	NPC470862
0.7429	Intermediate Similarity	NPC51172
0.7429	Intermediate Similarity	NPC49032
0.732	Intermediate Similarity	NPC325828
0.7304	Intermediate Similarity	NPC220836
0.7248	Intermediate Similarity	NPC475625
0.7207	Intermediate Similarity	NPC476112
0.7207	Intermediate Similarity	NPC307534
0.7143	Intermediate Similarity	NPC84111
0.7143	Intermediate Similarity	NPC287483
0.7143	Intermediate Similarity	NPC473601
0.7143	Intermediate Similarity	NPC470865
0.7091	Intermediate Similarity	NPC473518
0.7064	Intermediate Similarity	NPC475319
0.7059	Intermediate Similarity	NPC263359
0.7043	Intermediate Similarity	NPC94086
0.7043	Intermediate Similarity	NPC473817
0.699	Remote Similarity	NPC107962
0.6916	Remote Similarity	NPC475643
0.681	Remote Similarity	NPC262050
0.6786	Remote Similarity	NPC309278
0.6783	Remote Similarity	NPC31896
0.6762	Remote Similarity	NPC125324
0.6754	Remote Similarity	NPC83137
0.6696	Remote Similarity	NPC470863
0.6696	Remote Similarity	NPC92297
0.6635	Remote Similarity	NPC107188
0.6577	Remote Similarity	NPC128572
0.646	Remote Similarity	NPC51520
0.646	Remote Similarity	NPC303069
0.6429	Remote Similarity	NPC151134
0.6393	Remote Similarity	NPC210569
0.6387	Remote Similarity	NPC470867
0.6379	Remote Similarity	NPC108072
0.6357	Remote Similarity	NPC329807
0.6336	Remote Similarity	NPC481189
0.6311	Remote Similarity	NPC177834
0.6311	Remote Similarity	NPC273002
0.6303	Remote Similarity	NPC232054
0.6296	Remote Similarity	NPC6295
0.6288	Remote Similarity	NPC329727
0.6271	Remote Similarity	NPC477811
0.625	Remote Similarity	NPC234352
0.6195	Remote Similarity	NPC471464
0.6182	Remote Similarity	NPC160426
0.6154	Remote Similarity	NPC297348
0.6154	Remote Similarity	NPC249204
0.6154	Remote Similarity	NPC48339
0.6154	Remote Similarity	NPC141769
0.6154	Remote Similarity	NPC477547
0.6124	Remote Similarity	NPC330026
0.6098	Remote Similarity	NPC473505
0.6019	Remote Similarity	NPC211354
0.6019	Remote Similarity	NPC19400
0.5984	Remote Similarity	NPC305771
0.5984	Remote Similarity	NPC94072
0.5984	Remote Similarity	NPC169816
0.5965	Remote Similarity	NPC92890
0.5923	Remote Similarity	NPC481190
0.5913	Remote Similarity	NPC300557
0.5888	Remote Similarity	NPC477451
0.5882	Remote Similarity	NPC194207
0.5882	Remote Similarity	NPC22779
0.584	Remote Similarity	NPC477807
0.5818	Remote Similarity	NPC264101
0.5778	Remote Similarity	NPC329820
0.5748	Remote Similarity	NPC15918
0.5739	Remote Similarity	NPC602423
0.5736	Remote Similarity	NPC244431
0.5667	Remote Similarity	NPC470861
0.5556	Remote Similarity	NPC477809
0.5517	Remote Similarity	NPC202898
0.5508	Remote Similarity	NPC6806
0.5504	Remote Similarity	NPC79900
0.547	Remote Similarity	NPC485603
0.5447	Remote Similarity	NPC218571
0.5447	Remote Similarity	NPC487615
0.5447	Remote Similarity	NPC92710
0.5439	Remote Similarity	NPC470432
0.5439	Remote Similarity	NPC230507
0.5431	Remote Similarity	NPC485605
0.5426	Remote Similarity	NPC477808
0.541	Remote Similarity	NPC475333
0.541	Remote Similarity	NPC224098
0.541	Remote Similarity	NPC208383
0.5391	Remote Similarity	NPC248202
0.5391	Remote Similarity	NPC195297
0.537	Remote Similarity	NPC485594
0.5351	Remote Similarity	NPC215408
0.5333	Remote Similarity	NPC485604
0.5304	Remote Similarity	NPC485595
0.5276	Remote Similarity	NPC167183
0.5271	Remote Similarity	NPC480556
0.525	Remote Similarity	NPC274200
0.5227	Remote Similarity	NPC208832
0.5225	Remote Similarity	NPC294686
0.5225	Remote Similarity	NPC291203
0.5225	Remote Similarity	NPC217205
0.512	Remote Similarity	NPC197003
0.5118	Remote Similarity	NPC256983
0.5088	Remote Similarity	NPC121453
0.5082	Remote Similarity	NPC480555
0.5082	Remote Similarity	NPC150372
0.5045	Remote Similarity	NPC181845
0.5041	Remote Similarity	NPC294129
0.5041	Remote Similarity	NPC102016
0.5041	Remote Similarity	NPC95051

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC116756 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7882
0.1-0.2	1198
0.2-0.3	60
0.3-0.4	5
0.4-0.5	3
0.5-0.6	0
0.6-0.7	1
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.732	Intermediate Similarity	NPD8171	Phase 2
0.6296	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data