NPASS Compound

Natural Product: NPC264101

Natural Product ID	NPC264101
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Aspafilioside B
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL400900
PubChem CID	44445744
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 128136 0 0 0 0 0 0 0 0999 V2000 13.3693 -0.3173 -0.9229 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9198 -0.0263 -1.2708 C 0 0 1 0 0 0 0 0 0 0 0 0 11.0951 -1.2863 -1.2752 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0289 -1.2763 -0.1809 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2156 -0.0174 -0.3370 C 0 0 1 0 0 0 0 0 0 0 0 0 10.0019 1.1056 -0.5488 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3332 0.9242 -0.2542 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3595 -0.1410 -1.4264 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3019 0.7254 -1.2260 C 0 0 2 0 0 0 0 0 0 0 0 0 7.1193 0.8508 0.2726 C 0 0 2 0 0 0 0 0 0 0 0 0 8.3430 0.2575 0.8671 C 0 0 2 0 0 0 0 0 0 0 0 0 9.0002 1.3390 1.7370 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8436 0.0541 0.5325 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0526 0.5011 -0.6774 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9974 0.1827 -1.7746 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7546 -0.1931 -0.6783 C 0 0 2 0 0 0 0 0 0 0 0 0 2.9197 0.0780 -1.9279 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7818 -0.9004 -1.8686 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9654 -0.7858 -0.6033 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7285 -0.5317 0.6256 C 0 0 2 0 0 0 0 0 0 0 0 0 2.9431 0.3633 0.4704 C 0 0 1 0 0 0 0 0 0 0 0 0 3.6682 0.5971 1.7258 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1323 0.4857 1.7668 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1936 -1.8490 1.2693 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8486 0.1320 1.6623 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5814 -0.3464 1.4134 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0432 0.4845 0.2317 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1687 0.1565 -0.9135 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4002 0.4673 0.0151 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0303 1.6830 0.2292 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6946 2.2495 -1.0014 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9498 1.5191 -1.3492 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6148 0.2354 -1.7735 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8483 1.5497 -0.1585 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1422 1.1084 1.0864 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8861 1.5471 1.2873 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1335 -0.4269 1.0618 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4343 -0.9007 0.8605 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4728 -2.2932 0.8352 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9756 -2.7402 -0.3641 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3768 -4.0635 -0.2159 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7376 -4.0435 0.4806 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6994 -3.0745 1.6224 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3060 -2.7045 2.0373 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6892 -3.7767 2.6536 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3253 -1.8872 1.2111 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6920 -3.6379 -0.4386 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0519 0.8700 -0.3441 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1656 1.7155 -0.2451 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.9511 1.3654 0.8546 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.1756 1.9738 0.8984 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2850 3.1950 0.0262 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.9135 2.9616 -1.4142 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.9873 1.7740 -1.4914 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.1322 1.8528 -2.5896 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0554 2.6897 -2.1721 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4352 4.1764 0.5683 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2051 -1.3844 0.5260 C 0 0 0 0 0 0 0 0 0 0 0 0 13.7355 0.3661 -0.1304 H 0 0 0 0 0 0 0 0 0 0 0 0 13.4293 -1.3837 -0.6202 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0205 -0.1876 -1.8100 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9172 0.4933 -2.2439 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5902 -1.3592 -2.2673 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7385 -2.1893 -1.1887 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4024 -2.1604 -0.3378 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5289 -1.3186 0.8076 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4719 0.4811 0.7556 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8162 1.9315 -0.3113 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5831 1.6962 -1.6831 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9568 1.9077 0.5746 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2148 -0.6067 1.5158 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5693 2.0072 1.0931 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1989 1.8671 2.3115 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6373 0.8422 2.5225 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8845 1.5872 -0.5845 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0334 -0.9209 -1.8977 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7617 0.6858 -2.7343 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7681 -1.2786 -0.5592 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5084 -0.1067 -2.8210 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5579 1.1321 -1.8263 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1999 -1.9184 -2.0031 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1453 -0.7189 -2.7590 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4905 -1.8094 -0.4897 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5346 1.3499 0.1038 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3754 1.5976 2.1770 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2406 -0.1233 2.4914 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4655 -0.1942 2.5970 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5992 1.4762 2.0567 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7820 -1.9834 2.2892 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2960 -1.8499 1.3909 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9139 -2.6634 0.5889 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0851 -0.2045 2.6888 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8804 1.2451 1.5546 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1448 -0.0646 2.3216 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5402 -1.4152 1.2217 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8013 1.5504 0.5368 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2706 1.0659 -1.4192 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7816 -0.3411 -1.7140 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2973 2.4732 0.5425 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8492 3.3390 -0.8444 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0049 2.1718 -1.8670 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3985 2.0700 -2.2189 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1254 0.0321 -2.6138 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1035 2.6383 0.0148 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8293 1.3375 1.9614 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7794 -0.8487 2.0168 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5032 -0.8425 0.2759 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4595 -2.6674 0.9747 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4548 -4.5782 -1.1988 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6657 -4.5662 0.4624 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9583 -5.0520 0.8885 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2755 -3.4875 2.4674 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3993 -1.8648 2.7785 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3291 -4.4119 3.0670 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1456 -1.7909 0.2427 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3686 -3.8250 -1.3390 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7581 2.7230 -0.0389 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0444 1.2901 0.7786 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2879 2.3620 1.9588 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3573 3.5489 0.1028 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3450 3.8264 -1.8517 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6190 0.8720 -1.6409 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9351 2.8246 -2.7538 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4929 1.8882 -1.8239 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3242 4.8653 -0.1437 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4346 -2.0972 0.2363 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0881 -1.6150 -0.1281 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4853 -1.6675 1.5788 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 6 6 7 1 0 5 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 10 13 1 0 13 14 1 0 14 15 1 0 14 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 20 24 1 1 20 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 32 34 1 0 34 35 1 0 35 36 1 0 35 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 43 46 1 0 42 47 1 0 34 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 53 56 1 0 52 57 1 0 13 58 1 1 7 2 1 0 15 9 1 0 21 16 1 0 36 30 1 0 44 39 1 0 54 49 1 0 11 5 1 0 23 13 1 0 28 19 1 0 1 59 1 0 1 60 1 0 1 61 1 0 2 62 1 6 3 63 1 0 3 64 1 0 4 65 1 0 4 66 1 0 7 67 1 0 7 68 1 0 9 69 1 6 10 70 1 6 11 71 1 1 12 72 1 0 12 73 1 0 12 74 1 0 14 75 1 1 15 76 1 0 15 77 1 0 16 78 1 1 17 79 1 0 17 80 1 0 18 81 1 0 18 82 1 0 19 83 1 1 21 84 1 6 22 85 1 0 22 86 1 0 23 87 1 0 23 88 1 0 24 89 1 0 24 90 1 0 24 91 1 0 25 92 1 0 25 93 1 0 26 94 1 0 26 95 1 0 27 96 1 1 28 97 1 0 28 98 1 0 30 99 1 1 31100 1 0 31101 1 0 32102 1 6 33103 1 0 34104 1 1 35105 1 1 37106 1 0 37107 1 0 39108 1 1 41109 1 0 41110 1 0 42111 1 1 43112 1 1 44113 1 1 45114 1 0 46115 1 0 47116 1 0 49117 1 1 51118 1 0 51119 1 0 52120 1 6 53121 1 6 54122 1 6 55123 1 0 56124 1 0 57125 1 0 58126 1 0 58127 1 0 58128 1 0 M END

Standard InCHIKey	LGUTXUSCHKEEJA-BFTDEGHSSA-N
Standard InCHI	InChI=1S/C43H70O15/c1-20-7-12-43(54-16-20)21(2)33-30(58-43)14-26-24-6-5-22-13-23(8-10-41(22,3)25(24)9-11-42(26,33)4)55-32-15-27(44)38(57-40-37(50)35(48)29(46)18-52-40)31(56-32)19-53-39-36(49)34(47)28(45)17-51-39/h20-40,44-50H,5-19H2,1-4H3/t20-,21-,22+,23-,24+,25-,26-,27+,28-,29+,30-,31+,32+,33-,34-,35-,36+,37+,38+,39-,40-,41-,42-,43+/m0/s1
SMILES	C[C@H]1CC[C@@]2(OC1)O[C@@H]1[C@H]([C@@H]2C)[C@@]2([C@@H](C1)[C@@H]1CC[C@H]3[C@]([C@H]1CC2)(C)CC[C@@H](C3)O[C@H]1C[C@@H](O)[C@H]([C@H](O1)CO[C@@H]1OC[C@@H]([C@@H]([C@H]1O)O)O)O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	826.47	Volume:	807.129 ? Van der Waals volume.
Dense:	1.024	LogP:	2.829 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.633 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.944 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	7.0	Rigid Bonds:	48.0
TPSA:	215.45 ? Topological Polar Surface Area.	H-Bond Acceptor:	15.0
H-Bond Donor:	7.0	Rings:	9.0
Heavy Atoms:	15.0

MedChem Properties

QED Drug-Likeness Score:	0.182	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.636	Fsp³:	1.0
MCE-18:	221.372 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.759	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.036 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.256	Promiscuous compounds:	0.04

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.865	MDCK Permeability:	-5.04
Pgp-inhibitor:	0.001	Pgp-substrate:	0.99
PAMPA:	0.999 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.018	30% Bioavailability (F30%):	0.31
50% Bioavailability (F50%):	0.991

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.052
Plasma Protein Binding (PPB):	56.481%	Volume Distribution (VD):	-0.423
Fu:	33.976% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.113
BSEP inhibitor:	0.945

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.003	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.173
HLM stability:	0.058 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.794

Half-life (T1/2):

2.552

ADMET: Toxicity

hERG Blockers:	0.056	hERG Blockers (10um):	0.258
Human Hepatotoxicity (H-HT):	0.727	Drug-induced Liver Injury (DILI):	0.975
AMES Toxicity:	0.663	Rat Oral Acute Toxicity:	0.022
Maximum Recommended Daily Dose:	0.223	Skin Sensitization:	1.0
Carcinogencity:	0.073	Eye Corrosion:	0.0
Eye Irritation:	0.018	Respiratory Toxicity:	0.006
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	0.989
Hematotoxicity:	0.089	Drug-induced Nephrotoxicity:	0.887
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.218
A549 Cytotoxicity:	0.651	Hek293 Cytotoxicity:	0.787
BCF:	1.918 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.6 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.764 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.187 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO7925	Asparagus officinalis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[11032480]
NPO4755	Asparagus filicinus	Species	Asparagaceae	Eukaryota	Roots	n.a.	n.a.	PMID[17629328]
NPO7925	Asparagus officinalis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[6821187]
NPO7925	Asparagus officinalis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO4755	Asparagus filicinus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO7925	Asparagus officinalis	Species	Asparagaceae	Eukaryota		n.a.	n.a.	Database[FooDB]
NPO7925	Asparagus officinalis	Species	Asparagaceae	Eukaryota	Seed	n.a.	n.a.	Database[FooDB]
NPO7925	Asparagus officinalis	Species	Asparagaceae	Eukaryota	Shoot	n.a.	n.a.	Database[FooDB]
NPO7925	Asparagus officinalis	Species	Asparagaceae	Eukaryota	n.a.	n.a.		Database[FooDB]
NPO7925	Asparagus officinalis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO4755	Asparagus filicinus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO7925	Asparagus officinalis	Species	Asparagaceae	Eukaryota	n.a.	n.a.		Database[Phenol-Explorer]
NPO4755	Asparagus filicinus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO7925	Asparagus officinalis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO7925	Asparagus officinalis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO4755	Asparagus filicinus	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO7925	Asparagus officinalis	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
EC50	2

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT81	Cell line	A549	Homo sapiens	EC50	=	7.6	ug.mL-1	PMID[17629328]
NPT83	Cell line	MCF7	Homo sapiens	EC50	=	10.4	ug.mL-1	PMID[17629328]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC264101 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	27064
0.1-0.2	20844
0.2-0.3	1570
0.3-0.4	203
0.4-0.5	105
0.5-0.6	47
0.6-0.7	18
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.75	Intermediate Similarity	NPC177834
0.7347	Intermediate Similarity	NPC128572
0.7253	Intermediate Similarity	NPC250393
0.7097	Intermediate Similarity	NPC107188
0.6939	Remote Similarity	NPC202898
0.6837	Remote Similarity	NPC475351
0.6735	Remote Similarity	NPC160426
0.6733	Remote Similarity	NPC471464
0.6442	Remote Similarity	NPC97700
0.6442	Remote Similarity	NPC30856
0.6263	Remote Similarity	NPC215408
0.6224	Remote Similarity	NPC211354
0.6211	Remote Similarity	NPC325828
0.6204	Remote Similarity	NPC232037
0.6122	Remote Similarity	NPC206003
0.6122	Remote Similarity	NPC473610
0.6111	Remote Similarity	NPC475625
0.6095	Remote Similarity	NPC51172
0.6095	Remote Similarity	NPC49032
0.6058	Remote Similarity	NPC475643
0.6036	Remote Similarity	NPC132080
0.6022	Remote Similarity	NPC481418
0.5979	Remote Similarity	NPC234352
0.59	Remote Similarity	NPC19400
0.5876	Remote Similarity	NPC297348
0.5876	Remote Similarity	NPC249204
0.5876	Remote Similarity	NPC48339
0.5876	Remote Similarity	NPC141769
0.5876	Remote Similarity	NPC477547
0.5818	Remote Similarity	NPC116756
0.581	Remote Similarity	NPC473601
0.578	Remote Similarity	NPC475319
0.5758	Remote Similarity	NPC477451
0.5728	Remote Similarity	NPC6295
0.5699	Remote Similarity	NPC88962
0.5631	Remote Similarity	NPC107962
0.5495	Remote Similarity	NPC115165
0.5478	Remote Similarity	NPC233433
0.547	Remote Similarity	NPC470866
0.5429	Remote Similarity	NPC125324
0.5405	Remote Similarity	NPC184617
0.5391	Remote Similarity	NPC476112
0.5391	Remote Similarity	NPC307534
0.53	Remote Similarity	NPC481423
0.5294	Remote Similarity	NPC94086
0.5294	Remote Similarity	NPC473817
0.5271	Remote Similarity	NPC329807
0.5263	Remote Similarity	NPC475333
0.5263	Remote Similarity	NPC224098
0.5263	Remote Similarity	NPC208383
0.52	Remote Similarity	NPC485594
0.5196	Remote Similarity	NPC485591
0.5179	Remote Similarity	NPC151134
0.5172	Remote Similarity	NPC48463
0.5172	Remote Similarity	NPC108072
0.5172	Remote Similarity	NPC248944
0.5172	Remote Similarity	NPC7479
0.5172	Remote Similarity	NPC257296
0.5164	Remote Similarity	NPC220836
0.5152	Remote Similarity	NPC481189
0.514	Remote Similarity	NPC485595
0.5133	Remote Similarity	NPC294129
0.5113	Remote Similarity	NPC329727
0.5096	Remote Similarity	NPC312678
0.5096	Remote Similarity	NPC253268
0.5051	Remote Similarity	NPC473774
0.5051	Remote Similarity	NPC481419
0.5051	Remote Similarity	NPC481417
0.5043	Remote Similarity	NPC470864

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC264101 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7796
0.1-0.2	1304
0.2-0.3	37
0.3-0.4	9
0.4-0.5	1
0.5-0.6	2
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6211	Remote Similarity	NPD8171	Phase 2
0.5283	Remote Similarity	NPD8170	Phase 2
0.5172	Remote Similarity	NPD6928	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data