NPASS Compound

Natural Product: NPC473601

Natural Product ID	NPC473601
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	CZBXLGUXHJJJMB-TWHNOHTISA-N
IUPAC Name	n.a.
Synonyms	25(R And S) Schidigera-Saponins F1
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL446926
PubChem CID	10819502
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 134142 0 0 0 0 0 0 0 0999 V2000 11.4225 -0.2947 0.2228 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7960 -1.3076 1.1177 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1276 -0.6275 2.2937 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8175 -1.3238 2.6264 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8460 -1.2746 1.4680 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7611 -2.3143 1.5660 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5075 -1.5421 1.6426 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9650 -0.0958 1.8601 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2403 -0.0225 1.3748 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9581 0.7626 1.1113 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8875 -0.2108 0.7804 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7049 -1.4164 0.3691 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7317 -2.5192 0.1595 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8908 -2.1491 -1.0374 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1308 -0.8714 -0.8887 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8380 0.2223 -0.1738 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3431 1.3691 -1.0204 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3251 1.8114 -2.0486 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1017 0.9720 -2.0158 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5147 -0.4819 -2.2137 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3159 -1.2839 -2.5661 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0316 -0.8072 -2.1652 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2564 0.6283 -2.4331 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0024 1.3476 -2.9385 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8164 1.3056 -1.3566 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9516 1.9998 -1.5679 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0745 1.4470 -0.7388 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7725 1.6125 0.7070 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5748 2.4124 0.9766 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4534 3.5709 0.0359 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8667 3.3560 -1.2515 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2758 4.7481 0.5632 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0531 5.8838 -0.2418 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5854 2.9879 2.2713 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8745 1.9124 1.4850 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3402 0.8949 2.3044 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2237 1.1660 3.7698 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4564 1.8757 4.3201 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7074 1.0879 3.9649 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3684 -0.0331 2.9970 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5968 0.4679 1.9922 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3482 0.6117 5.0953 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5041 3.1553 3.8073 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0953 -0.0270 4.5207 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3734 0.1237 -1.0804 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6171 -0.0261 -1.6610 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5383 -0.4844 -3.1014 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9258 -0.4329 -3.7475 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8171 -1.3050 -2.8987 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7691 -0.8371 -1.4825 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5039 -0.8011 -0.9227 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6256 -1.7872 -0.6462 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.9199 -1.8884 -1.1258 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5949 -2.6515 -3.0429 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8683 -0.9248 -5.0470 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0506 -1.7636 -3.2546 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9585 -1.5705 -2.9380 O 0 0 0 0 0 0 0 0 0 0 0 0 2.4873 -0.6111 -3.3676 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6015 -1.2197 -0.7879 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8598 -3.1265 2.8431 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5831 -1.4311 0.2946 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7443 -2.1437 0.4282 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5081 0.7151 0.6523 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9175 -0.3104 -0.7662 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4783 -0.6363 0.0097 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5505 -2.0170 1.5234 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7821 -0.7158 3.1875 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9740 0.4355 2.0914 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3530 -0.6998 3.4473 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9745 -2.3168 3.0469 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8846 -3.0194 0.7477 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8511 -1.8120 2.5107 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9610 0.1576 2.9448 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4863 1.2072 0.2602 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6034 1.5604 1.8295 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4311 -0.5157 1.7735 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2211 -3.4938 -0.0587 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0447 -2.6315 1.0293 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1627 -3.0226 -1.1184 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5045 -2.2498 -1.9360 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2071 -1.1780 -0.2922 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0627 0.7273 0.4920 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4515 2.2560 -0.3186 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3498 1.2436 -1.4133 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0243 2.8747 -1.9059 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7940 1.7999 -3.0646 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7063 1.0446 -0.9538 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2722 -1.3794 -3.7030 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4433 -2.3726 -2.2679 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2673 -1.1098 -1.1126 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9713 0.7461 -3.2730 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2623 0.9957 -3.9580 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1305 2.4234 -2.9921 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3237 1.9703 -2.6237 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9767 2.0638 -1.0534 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5185 0.5458 1.0482 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6243 1.8042 0.8707 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3912 3.9120 0.1021 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3424 4.5255 0.5475 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9713 4.9777 1.6046 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0776 5.8905 -0.5061 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5053 3.2780 2.4896 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6522 0.0185 2.1167 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3573 1.7727 4.0783 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3816 1.8923 5.4247 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3867 1.7783 3.4328 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3169 -0.4086 2.5041 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9306 -0.9121 3.4660 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3090 0.6005 4.9136 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2099 3.2721 3.1431 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2150 0.2403 5.4679 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0756 0.9963 -1.7099 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9043 0.2217 -3.6758 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3339 0.5819 -3.7133 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8756 -1.1184 -3.2492 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2206 0.1766 -1.3525 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1875 -2.8081 -0.7309 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5870 -1.5169 0.4160 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2822 -0.9485 -1.1813 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0111 -3.0632 -2.3653 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9023 -0.8896 -5.3150 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6292 -2.1466 -2.4693 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9193 -2.5264 -2.6468 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4272 -0.1223 -3.0736 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1091 0.0218 -4.2237 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5712 -1.6212 -3.7630 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2884 -0.3646 -0.6942 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1726 -2.1891 -0.9151 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1130 -1.0984 -1.7773 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8275 -3.5628 3.0051 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0331 -2.4557 3.7042 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5430 -3.9655 2.7716 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6118 -3.1421 0.9100 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1193 -2.3569 -0.5965 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 29 34 1 0 28 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 39 42 1 0 38 43 1 0 37 44 1 0 27 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 50 52 1 0 52 53 1 0 49 54 1 0 48 55 1 0 47 56 1 0 22 57 1 0 20 58 1 0 12 59 1 0 6 60 1 0 5 61 1 0 61 62 1 0 62 2 1 0 9 5 1 0 12 7 1 0 16 11 1 0 20 15 1 0 24 19 1 0 31 26 1 0 41 36 1 0 51 46 1 0 1 63 1 0 1 64 1 0 1 65 1 0 2 66 1 0 3 67 1 0 3 68 1 0 4 69 1 0 4 70 1 0 6 71 1 0 7 72 1 0 8 73 1 0 10 74 1 0 10 75 1 0 11 76 1 0 13 77 1 0 13 78 1 0 14 79 1 0 14 80 1 0 15 81 1 0 16 82 1 0 17 83 1 0 17 84 1 0 18 85 1 0 18 86 1 0 19 87 1 0 21 88 1 0 21 89 1 0 22 90 1 0 23 91 1 0 24 92 1 0 24 93 1 0 26 94 1 0 27 95 1 0 28 96 1 0 29 97 1 0 30 98 1 0 32 99 1 0 32100 1 0 33101 1 0 34102 1 0 36103 1 0 37104 1 0 38105 1 0 39106 1 0 40107 1 0 40108 1 0 42109 1 0 43110 1 0 44111 1 0 46112 1 0 47113 1 0 48114 1 0 49115 1 0 50116 1 0 52117 1 0 52118 1 0 53119 1 0 54120 1 0 55121 1 0 56122 1 0 57123 1 0 58124 1 0 58125 1 0 58126 1 0 59127 1 0 59128 1 0 59129 1 0 60130 1 0 60131 1 0 60132 1 0 62133 1 0 62134 1 0 M END

Standard InCHIKey	CZBXLGUXHJJJMB-TWHNOHTISA-N
Standard InCHI	InChI=1S/C44H72O18/c1-18-7-10-44(56-16-18)19(2)30-27(62-44)12-23-21-6-5-20-11-26(24(47)13-43(20,4)22(21)8-9-42(23,30)3)57-41-38(61-40-36(54)34(52)32(50)28(14-45)58-40)37(33(51)29(15-46)59-41)60-39-35(53)31(49)25(48)17-55-39/h18-41,45-54H,5-17H2,1-4H3/t18?,19-,20+,21+,22-,23-,24-,25+,26+,27-,28+,29+,30-,31-,32+,33-,34-,35+,36+,37-,38+,39-,40-,41+,42-,43-,44+/m0/s1
SMILES	CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CC(C(C6)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)O)C)C)C)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	888.47	Volume:	850.796 ? Van der Waals volume.
Dense:	1.044	LogP:	0.549 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.494 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.758 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	48.0
TPSA:	276.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	10.0	Rings:	9.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.129	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.768	Fsp³:	1.0
MCE-18:	231.818 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.002	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.051 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.213 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.412	Promiscuous compounds:	0.003

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.824	MDCK Permeability:	-4.8
Pgp-inhibitor:	0.0	Pgp-substrate:	0.961
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.993
20% Bioavailability (F20%):	0.48	30% Bioavailability (F30%):	0.996
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.09	MRP1:	1.0
Plasma Protein Binding (PPB):	45.498%	Volume Distribution (VD):	-0.449
Fu:	37.336% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.06	BCRP inhibitor:	0.001
BSEP inhibitor:	0.052

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	1.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.003	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.002	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.128

Half-life (T1/2):

3.66

ADMET: Toxicity

hERG Blockers:	0.062	hERG Blockers (10um):	0.525
Human Hepatotoxicity (H-HT):	0.547	Drug-induced Liver Injury (DILI):	0.163
AMES Toxicity:	0.36	Rat Oral Acute Toxicity:	0.087
Maximum Recommended Daily Dose:	0.277	Skin Sensitization:	0.009
Carcinogencity:	0.05	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.003
Drug-induced Neurotoxicity:	0.348	Ototoxicity:	1.0
Hematotoxicity:	0.005	Drug-induced Nephrotoxicity:	0.013
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.09
A549 Cytotoxicity:	0.035	Hek293 Cytotoxicity:	0.838
BCF:	1.336 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.93 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.89 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.413 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10757713]
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	bark	n.a.	n.a.	PMID[15165156]
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	6

Activity Type	# Activity
Organism	6

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	MIC	=	100.0	ug.mL-1	PMID[14695798]
NPT20	Organism	Candida albicans	Candida albicans	MIC	>	100.0	ug.mL-1	PMID[19487447]
NPT5427	Organism	Hanseniaspora uvarum	Hanseniaspora uvarum	MIC	>	100.0	ug.mL-1	PMID[25970729]
NPT772	Organism	Pichia anomala	Wickerhamomyces anomalus	MIC	>	100.0	ug.mL-1	PMID[19738026]
NPT5426	Organism	Debaryomyces hansenii	Debaryomyces hansenii	MIC	=	100.0	ug.mL-1	PMID[11325222]
NPT5425	Organism	Pichia nakazawae	Pichia nakazawae	MIC	>	100.0	ug.mL-1	PMID[17531354]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC473601 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	27245
0.1-0.2	19404
0.2-0.3	2695
0.3-0.4	312
0.4-0.5	78
0.5-0.6	60
0.6-0.7	37
0.7-0.8	0
0.8-0.85	3
0.85-0.9	1
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.914	High Similarity	NPC115165
0.8723	High Similarity	NPC151134
0.8387	Intermediate Similarity	NPC475351
0.8283	Intermediate Similarity	NPC232611
0.8	Intermediate Similarity	NPC473518
0.7879	Intermediate Similarity	NPC97700
0.7879	Intermediate Similarity	NPC30856
0.7767	Intermediate Similarity	NPC83137
0.7634	Intermediate Similarity	NPC206003
0.7634	Intermediate Similarity	NPC473610
0.75	Intermediate Similarity	NPC294686
0.7358	Intermediate Similarity	NPC132080
0.7327	Intermediate Similarity	NPC51172
0.7327	Intermediate Similarity	NPC49032
0.7264	Intermediate Similarity	NPC470862
0.7245	Intermediate Similarity	NPC195297
0.7241	Intermediate Similarity	NPC330026
0.7158	Intermediate Similarity	NPC222731
0.7143	Intermediate Similarity	NPC116756
0.713	Intermediate Similarity	NPC31896
0.7115	Intermediate Similarity	NPC475319
0.7075	Intermediate Similarity	NPC232037
0.6792	Remote Similarity	NPC51520
0.6792	Remote Similarity	NPC303069
0.6727	Remote Similarity	NPC233433
0.6698	Remote Similarity	NPC184617
0.6696	Remote Similarity	NPC470866
0.6696	Remote Similarity	NPC210569
0.6667	Remote Similarity	NPC329820
0.6634	Remote Similarity	NPC125324
0.6604	Remote Similarity	NPC128572
0.6583	Remote Similarity	NPC481190
0.6549	Remote Similarity	NPC470867
0.65	Remote Similarity	NPC54619
0.6486	Remote Similarity	NPC476112
0.6486	Remote Similarity	NPC307534
0.6465	Remote Similarity	NPC250393
0.6355	Remote Similarity	NPC300557
0.6325	Remote Similarity	NPC220836
0.625	Remote Similarity	NPC108072
0.625	Remote Similarity	NPC470864
0.6216	Remote Similarity	NPC475625
0.619	Remote Similarity	NPC160426
0.6176	Remote Similarity	NPC107188
0.6168	Remote Similarity	NPC602423
0.6162	Remote Similarity	NPC297348
0.6162	Remote Similarity	NPC325828
0.6162	Remote Similarity	NPC249204
0.6162	Remote Similarity	NPC48339
0.6162	Remote Similarity	NPC141769
0.6162	Remote Similarity	NPC477547
0.6116	Remote Similarity	NPC263359
0.61	Remote Similarity	NPC234352
0.6094	Remote Similarity	NPC481189
0.6068	Remote Similarity	NPC94086
0.6068	Remote Similarity	NPC473817
0.6019	Remote Similarity	NPC211354
0.6	Remote Similarity	NPC177834
0.6	Remote Similarity	NPC6295
0.5984	Remote Similarity	NPC329807
0.5929	Remote Similarity	NPC470861
0.5929	Remote Similarity	NPC309278
0.5909	Remote Similarity	NPC471464
0.5905	Remote Similarity	NPC107962
0.5882	Remote Similarity	NPC477451
0.5854	Remote Similarity	NPC244431
0.581	Remote Similarity	NPC264101
0.5804	Remote Similarity	NPC98018
0.5804	Remote Similarity	NPC284104
0.5804	Remote Similarity	NPC103616
0.5802	Remote Similarity	NPC329727
0.5769	Remote Similarity	NPC121453
0.5758	Remote Similarity	NPC24960
0.5738	Remote Similarity	NPC79900
0.5726	Remote Similarity	NPC477811
0.5714	Remote Similarity	NPC19400
0.569	Remote Similarity	NPC92710
0.5664	Remote Similarity	NPC294129
0.5657	Remote Similarity	NPC481418
0.5586	Remote Similarity	NPC475643
0.5528	Remote Similarity	NPC477808
0.5517	Remote Similarity	NPC475333
0.5517	Remote Similarity	NPC224098
0.5517	Remote Similarity	NPC208383
0.549	Remote Similarity	NPC485594
0.5476	Remote Similarity	NPC305771
0.5476	Remote Similarity	NPC94072
0.5476	Remote Similarity	NPC169816
0.5462	Remote Similarity	NPC84111
0.5462	Remote Similarity	NPC287483
0.5462	Remote Similarity	NPC470865
0.5455	Remote Similarity	NPC277715
0.5447	Remote Similarity	NPC473505
0.5447	Remote Similarity	NPC477807
0.5372	Remote Similarity	NPC167183
0.5366	Remote Similarity	NPC480556
0.5354	Remote Similarity	NPC88962
0.5328	Remote Similarity	NPC262050
0.5288	Remote Similarity	NPC181845
0.5273	Remote Similarity	NPC485595
0.5246	Remote Similarity	NPC232054
0.5238	Remote Similarity	NPC15918
0.5196	Remote Similarity	NPC473774
0.5196	Remote Similarity	NPC481419
0.5196	Remote Similarity	NPC481417
0.5172	Remote Similarity	NPC480555
0.5172	Remote Similarity	NPC150372
0.5167	Remote Similarity	NPC218571
0.5167	Remote Similarity	NPC487615
0.5126	Remote Similarity	NPC32361
0.5088	Remote Similarity	NPC202898
0.5082	Remote Similarity	NPC92297
0.5078	Remote Similarity	NPC32707
0.5045	Remote Similarity	NPC215408
0.5044	Remote Similarity	NPC113044
0.5044	Remote Similarity	NPC283829
0.5044	Remote Similarity	NPC161676
0.5043	Remote Similarity	NPC485603
0.5042	Remote Similarity	NPC470863

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC473601 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7718
0.1-0.2	1354
0.2-0.3	71
0.3-0.4	2
0.4-0.5	3
0.5-0.6	1
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6162	Remote Similarity	NPD8171	Phase 2
0.5413	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data