NPASS Compound

Natural Product: NPC31896

Natural Product ID	NPC31896
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	XVPVVWNZAJAPLF-MMPILWSFSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL445227
PubChem CID	44576161
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 153162 0 0 0 0 0 0 0 0999 V2000 13.5412 0.7109 1.9156 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2790 -0.4545 0.9851 C 0 0 2 0 0 0 0 0 0 0 0 0 13.4205 -0.0619 -0.4669 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1050 0.3534 -1.0839 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9323 -0.4488 -0.6361 C 0 0 2 0 0 0 0 0 0 0 0 0 9.9733 -0.7964 -1.7482 C 0 0 1 0 0 0 0 0 0 0 0 0 10.3011 -2.2204 -2.1966 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6535 -0.8357 -1.0789 C 0 0 1 0 0 0 0 0 0 0 0 0 9.0215 -0.6450 0.3995 C 0 0 2 0 0 0 0 0 0 0 0 0 7.8794 0.1012 1.0293 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8771 0.2395 -0.0534 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0240 1.4660 -0.0194 C 0 0 2 0 0 0 0 0 0 0 0 0 5.3612 1.5331 1.3185 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9719 2.0036 1.3073 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3826 2.4267 0.2210 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9517 2.9126 0.2019 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2025 1.8690 -0.5960 C 0 0 2 0 0 0 0 0 0 0 0 0 1.8348 1.6884 -1.9352 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0673 2.5255 -2.1649 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0925 2.4607 -1.0901 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8588 3.7717 -1.0968 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9975 1.2730 -1.1467 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6842 1.1178 -2.4555 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8898 0.2577 -2.4829 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7768 0.3732 -1.2928 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5094 1.6722 -1.1919 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1523 0.3486 -2.2161 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1461 2.0914 -0.7106 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8942 1.1079 -0.1016 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.8690 1.6072 0.9262 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2578 1.0622 0.6449 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.2475 -0.4064 0.3483 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.1187 -0.7306 -0.5763 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.4675 -1.7516 -1.6413 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4032 -1.2653 -2.5381 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5916 0.4104 -1.1046 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5086 -0.7313 -0.1794 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1984 -1.6063 0.6157 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6086 -1.2827 0.9298 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.5135 -2.5040 0.8237 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.8091 -3.7637 1.2423 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.3592 -3.8157 0.9130 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.9894 -5.1629 0.3294 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8135 -5.3593 -0.7775 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1211 -2.8587 -0.0821 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9606 -3.9403 2.6332 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9486 -2.7043 -0.4774 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3436 -2.7005 -0.6094 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.8080 -1.5652 -1.4891 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.2746 -2.0652 -2.8382 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.2378 -3.2211 -2.6996 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.0035 -4.0759 -1.4857 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7025 -3.9295 -1.0790 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.5658 -2.7858 -2.7566 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1988 -2.3645 -3.6731 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8035 -0.8146 -0.8784 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7409 -0.6698 2.1664 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3707 0.5401 2.1677 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4663 0.5892 3.2502 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.9396 1.9910 3.4640 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.3817 2.9516 2.4348 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9277 2.7438 2.1437 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0601 3.8527 2.6802 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5447 5.0966 2.2175 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4405 1.5198 2.6000 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1882 2.9036 1.3132 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6525 2.4560 4.7703 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4591 -0.3289 3.0551 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8642 1.7066 -0.4313 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5128 1.2446 2.2087 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1057 0.2181 0.2716 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4113 -1.5772 0.0347 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9523 -1.1054 1.2514 C 0 0 0 0 0 0 0 0 0 0 0 0 14.1645 1.5012 1.4488 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0368 0.3678 2.8473 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5728 1.1908 2.2348 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0540 -1.2347 1.2372 H 0 0 0 0 0 0 0 0 0 0 0 0 14.1291 0.7930 -0.5027 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8765 -0.9174 -1.0092 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2177 0.2446 -2.1890 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9207 1.4255 -0.8862 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0519 -0.1609 -2.6235 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3564 -2.7782 -2.3340 H 0 0 0 0 0 0 0 0 0 0 0 0 10.8472 -2.7623 -1.3740 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9653 -2.2379 -3.0733 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0438 -1.7234 -1.2302 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2617 -1.6097 0.8776 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1659 1.0290 1.5445 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4220 -0.5499 1.8287 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2565 -0.6754 -0.1425 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5685 2.3841 -0.2646 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9608 2.2339 1.9582 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4335 0.5480 1.8655 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4237 1.9978 2.2290 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5415 2.9714 1.2290 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9937 3.8981 -0.3071 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3434 0.9069 -0.0183 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0969 2.0053 -2.7145 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4481 2.2633 -3.1706 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6899 3.5831 -2.2661 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2753 4.0043 -0.1004 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6576 3.8114 -1.8451 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0996 4.5658 -1.3317 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4003 0.3646 -0.9513 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9134 2.0801 -2.9589 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9315 0.6306 -3.1508 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5144 0.5694 -3.3715 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6692 -0.8142 -2.6811 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9727 2.4674 -1.7620 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5445 1.6522 -1.5730 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5810 2.0726 -0.1533 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3453 -0.2264 -2.1580 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2144 0.3821 0.3636 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9216 2.6961 0.8624 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9204 1.2170 1.5269 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1247 -0.9948 1.3249 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2910 -1.1969 0.0487 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6575 -2.7379 -1.2320 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5080 -1.8652 -2.2352 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9250 -0.6437 -3.1557 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6515 -1.8376 1.5560 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0107 -0.5825 0.1727 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3700 -2.3518 1.4685 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3058 -4.6435 0.7848 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7292 -3.5614 1.8072 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9594 -5.0585 -0.0713 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9931 -5.9761 1.0520 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3898 -5.1324 -1.6370 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9014 -4.2790 2.7840 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7635 -2.5463 0.3984 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9435 -0.9010 -1.6636 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8280 -1.2353 -3.3179 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0992 -3.8569 -3.6004 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7568 -3.8869 -0.6904 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0802 -5.1582 -1.8285 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.1925 -3.5153 -2.5204 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3881 -2.4472 -3.0853 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6678 0.1453 -1.1068 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7187 0.8957 1.1984 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9124 0.2945 4.1913 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0436 2.0134 3.3704 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4773 3.9668 2.8945 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8323 2.8102 1.0186 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0417 3.6893 2.3055 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0653 3.9409 3.7838 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0497 5.5620 2.9059 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7473 3.7042 1.2872 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6002 3.4460 4.7911 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1544 -1.1969 3.4172 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1629 2.5948 -0.1066 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5662 1.5702 2.3471 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2964 -0.3435 1.7267 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0240 -1.9462 1.9730 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 1 18 27 1 0 17 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 33 36 1 0 32 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 42 45 1 0 41 46 1 0 40 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 51 54 1 0 50 55 1 0 49 56 1 0 39 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 62 65 1 0 61 66 1 0 60 67 1 0 59 68 1 0 31 69 1 0 30 70 1 0 9 71 1 0 5 72 1 1 72 73 1 0 73 2 1 0 71 5 1 0 25 8 1 0 36 29 1 0 45 38 1 0 53 48 1 0 65 58 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 74 1 0 1 75 1 0 1 76 1 0 2 77 1 1 3 78 1 0 3 79 1 0 4 80 1 0 4 81 1 0 6 82 1 6 7 83 1 0 7 84 1 0 7 85 1 0 8 86 1 1 9 87 1 1 10 88 1 0 10 89 1 0 11 90 1 6 12 91 1 6 13 92 1 0 13 93 1 0 14 94 1 0 16 95 1 0 16 96 1 0 17 97 1 1 18 98 1 6 19 99 1 0 19100 1 0 21101 1 0 21102 1 0 21103 1 0 22104 1 1 23105 1 0 23106 1 0 24107 1 0 24108 1 0 26109 1 0 26110 1 0 26111 1 0 27112 1 0 29113 1 1 30114 1 1 31115 1 1 32116 1 1 33117 1 1 34118 1 0 34119 1 0 35120 1 0 38121 1 1 39122 1 6 40123 1 1 41124 1 6 42125 1 1 43126 1 0 43127 1 0 44128 1 0 46129 1 0 48130 1 1 49131 1 6 50132 1 6 51133 1 6 52134 1 0 52135 1 0 54136 1 0 55137 1 0 56138 1 0 58139 1 6 59140 1 1 60141 1 1 61142 1 1 62143 1 6 63144 1 0 63145 1 0 64146 1 0 66147 1 0 67148 1 0 68149 1 0 69150 1 0 70151 1 0 73152 1 0 73153 1 0 M END

Standard InCHIKey	XVPVVWNZAJAPLF-MMPILWSFSA-N
Standard InCHI	InChI=1S/C50H80O23/c1-19-7-10-50(65-17-19)20(2)32-28(73-50)12-24-22-6-5-21-11-27(25(54)13-49(21,4)23(22)8-9-48(24,32)3)66-45-40(63)37(60)41(31(16-53)69-45)70-47-43(72-46-39(62)36(59)34(57)29(14-51)67-46)42(35(58)30(15-52)68-47)71-44-38(61)33(56)26(55)18-64-44/h5,19-20,22-47,51-63H,6-18H2,1-4H3/t19-,20+,22-,23+,24+,25-,26-,27-,28+,29-,30-,31-,32+,33+,34-,35-,36+,37-,38-,39-,40-,41+,42+,43-,44+,45-,46+,47+,48+,49+,50-/m1/s1
SMILES	C[C@@H]1CC[C@@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC=C6C[C@H]([C@@H](C[C@]6(C)[C@H]5CC[C@]34C)O)O[C@H]3[C@@H]([C@H]([C@H]([C@@H](CO)O3)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O[C@H]3[C@@H]([C@H]([C@@H](CO3)O)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O)O2)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1048.51	Volume:	987.33 ? Van der Waals volume.
Dense:	1.062	LogP:	0.86 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.549 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.308 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	54.0
TPSA:	355.29 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	13.0	Rings:	10.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.09	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.271	Fsp³:	0.96
MCE-18:	260.898 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.609	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.337	Promiscuous compounds:	0.01

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.733	MDCK Permeability:	-5.063
Pgp-inhibitor:	0.0	Pgp-substrate:	0.933
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.84
20% Bioavailability (F20%):	0.537	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.006	MRP1:	0.008
Plasma Protein Binding (PPB):	48.656%	Volume Distribution (VD):	-0.396
Fu:	35.56% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.044
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.992	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.36
HLM stability:	0.019 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.192

Half-life (T1/2):

3.106

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.003
Human Hepatotoxicity (H-HT):	0.591	Drug-induced Liver Injury (DILI):	0.981
AMES Toxicity:	0.988	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.049	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.503	Drug-induced Nephrotoxicity:	0.968
Genotoxicity:	0.006	RPMI-8226 Immunitoxicity:	0.455
A549 Cytotoxicity:	0.987	Hek293 Cytotoxicity:	0.942
BCF:	1.121 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.239 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.377 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.537 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO27323	Cestrum nocturnum	Species	Solanaceae	Eukaryota	leaves	n.a.	n.a.	PMID[11170659]
NPO27323	Cestrum nocturnum	Species	Solanaceae	Eukaryota	leaves	n.a.	n.a.	PMID[12502329]
NPO19011	Schisandra grandiflora	Species	Schisandraceae	Eukaryota	n.a.	n.a.	n.a.	PMID[19685905]
NPO14215	Centaurium littorale	Species	Gentianaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO15483	Acer platanoides	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO14307	Rhizopus oryzae	Species	Rhizopodaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO19011	Schisandra grandiflora	Species	Schisandraceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO27323	Cestrum nocturnum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO15483	Acer platanoides	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO27323	Cestrum nocturnum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO27323	Cestrum nocturnum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO15483	Acer platanoides	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO14307	Rhizopus oryzae	Species	Rhizopodaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO27323	Cestrum nocturnum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO15483	Acer platanoides	Species	Sapindaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO4509	Nidorella auriculata	Species	Asteraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO14215	Centaurium littorale	Species	Gentianaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO19011	Schisandra grandiflora	Species	Schisandraceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO14307	Rhizopus oryzae	Species	Rhizopodaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO27323	Cestrum nocturnum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC31896 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24378
0.1-0.2	22014
0.2-0.3	2757
0.3-0.4	478
0.4-0.5	98
0.5-0.6	64
0.6-0.7	47
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.934	High Similarity	NPC210569
0.8571	High Similarity	NPC263359
0.8246	Intermediate Similarity	NPC244431
0.7982	Intermediate Similarity	NPC79900
0.785	Intermediate Similarity	NPC115165
0.7768	Intermediate Similarity	NPC167183
0.7706	Intermediate Similarity	NPC473518
0.7589	Intermediate Similarity	NPC477811
0.7431	Intermediate Similarity	NPC97700
0.7431	Intermediate Similarity	NPC30856
0.7311	Intermediate Similarity	NPC32707
0.7281	Intermediate Similarity	NPC256983
0.7265	Intermediate Similarity	NPC248202
0.7248	Intermediate Similarity	NPC300557
0.7168	Intermediate Similarity	NPC232611
0.713	Intermediate Similarity	NPC473601
0.7064	Intermediate Similarity	NPC602423
0.7049	Intermediate Similarity	NPC305771
0.7049	Intermediate Similarity	NPC94072
0.7049	Intermediate Similarity	NPC169816
0.7025	Intermediate Similarity	NPC208832
0.6983	Remote Similarity	NPC132080
0.6881	Remote Similarity	NPC475351
0.687	Remote Similarity	NPC197003
0.6847	Remote Similarity	NPC477809
0.6803	Remote Similarity	NPC15918
0.6783	Remote Similarity	NPC32361
0.6783	Remote Similarity	NPC116756
0.6783	Remote Similarity	NPC309278
0.6777	Remote Similarity	NPC477807
0.6752	Remote Similarity	NPC83137
0.6724	Remote Similarity	NPC232037
0.6721	Remote Similarity	NPC477808
0.6667	Remote Similarity	NPC308459
0.6638	Remote Similarity	NPC475333
0.6638	Remote Similarity	NPC224098
0.6638	Remote Similarity	NPC208383
0.661	Remote Similarity	NPC476112
0.661	Remote Similarity	NPC307534
0.6606	Remote Similarity	NPC470432
0.6606	Remote Similarity	NPC230507
0.6555	Remote Similarity	NPC233433
0.6491	Remote Similarity	NPC6806
0.6475	Remote Similarity	NPC190939
0.6435	Remote Similarity	NPC151134
0.6423	Remote Similarity	NPC480556
0.6393	Remote Similarity	NPC470866
0.6381	Remote Similarity	NPC181845
0.6379	Remote Similarity	NPC184617
0.6333	Remote Similarity	NPC470862
0.6311	Remote Similarity	NPC232054
0.6293	Remote Similarity	NPC480555
0.6293	Remote Similarity	NPC150372
0.6239	Remote Similarity	NPC206003
0.6239	Remote Similarity	NPC473610
0.6207	Remote Similarity	NPC51172
0.6207	Remote Similarity	NPC49032
0.619	Remote Similarity	NPC220836
0.6147	Remote Similarity	NPC250393
0.6136	Remote Similarity	NPC330026
0.605	Remote Similarity	NPC475319
0.6034	Remote Similarity	NPC470433
0.6034	Remote Similarity	NPC46190
0.6034	Remote Similarity	NPC171073
0.6016	Remote Similarity	NPC480553
0.6	Remote Similarity	NPC269297
0.6	Remote Similarity	NPC222202
0.6	Remote Similarity	NPC475550
0.5984	Remote Similarity	NPC218571
0.5984	Remote Similarity	NPC487615
0.5984	Remote Similarity	NPC470864
0.5952	Remote Similarity	NPC94086
0.5952	Remote Similarity	NPC473817
0.595	Remote Similarity	NPC475625
0.5917	Remote Similarity	NPC51520
0.5917	Remote Similarity	NPC303069
0.5913	Remote Similarity	NPC113044
0.5913	Remote Similarity	NPC283829
0.5913	Remote Similarity	NPC161676
0.5902	Remote Similarity	NPC194207
0.5902	Remote Similarity	NPC22779
0.5873	Remote Similarity	NPC470867
0.5872	Remote Similarity	NPC325828
0.5859	Remote Similarity	NPC473505
0.5854	Remote Similarity	NPC480554
0.5833	Remote Similarity	NPC294129
0.5776	Remote Similarity	NPC14704
0.5736	Remote Similarity	NPC224314
0.5704	Remote Similarity	NPC481190
0.5667	Remote Similarity	NPC249553
0.5664	Remote Similarity	NPC121453
0.5652	Remote Similarity	NPC107962
0.5603	Remote Similarity	NPC125324
0.5583	Remote Similarity	NPC248746
0.5574	Remote Similarity	NPC98018
0.5574	Remote Similarity	NPC284104
0.5574	Remote Similarity	NPC103616
0.5574	Remote Similarity	NPC102016
0.5574	Remote Similarity	NPC95051
0.5571	Remote Similarity	NPC329820
0.5532	Remote Similarity	NPC481189
0.5492	Remote Similarity	NPC128572
0.5476	Remote Similarity	NPC108072
0.5429	Remote Similarity	NPC329807
0.5424	Remote Similarity	NPC195297
0.5385	Remote Similarity	NPC329727
0.5345	Remote Similarity	NPC107188
0.5285	Remote Similarity	NPC42171
0.5271	Remote Similarity	NPC84111
0.5271	Remote Similarity	NPC287483
0.5271	Remote Similarity	NPC470865
0.5267	Remote Similarity	NPC262050
0.5263	Remote Similarity	NPC294686
0.5234	Remote Similarity	NPC249265
0.521	Remote Similarity	NPC6295
0.52	Remote Similarity	NPC475247
0.5197	Remote Similarity	NPC470861
0.5197	Remote Similarity	NPC13193
0.5167	Remote Similarity	NPC70204
0.5161	Remote Similarity	NPC471464
0.5161	Remote Similarity	NPC182900
0.5124	Remote Similarity	NPC160426
0.512	Remote Similarity	NPC150057
0.512	Remote Similarity	NPC147753
0.5116	Remote Similarity	NPC92710
0.5043	Remote Similarity	NPC297348
0.5043	Remote Similarity	NPC249204
0.5043	Remote Similarity	NPC48339
0.5043	Remote Similarity	NPC141769
0.5043	Remote Similarity	NPC222731
0.5043	Remote Similarity	NPC477547
0.5038	Remote Similarity	NPC92297

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC31896 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7692
0.1-0.2	1381
0.2-0.3	69
0.3-0.4	4
0.4-0.5	1
0.5-0.6	3
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5872	Remote Similarity	NPD8171	Phase 2
0.5339	Remote Similarity	NPD8170	Phase 2
0.512	Remote Similarity	NPD8450	Suspended

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data