NPASS Compound

Natural Product: NPC248746

Natural Product ID	NPC248746
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	IGGJLWGOQNBJHC-OKJXOJKZSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL450855
PubChem CID	44575741
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 134142 0 0 0 0 0 0 0 0999 V2000 13.2281 -1.1945 0.3839 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2718 -0.6691 -0.4797 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9346 0.7632 -0.1200 C 0 0 2 0 0 0 0 0 0 0 0 0 11.3925 0.8085 1.2868 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9578 0.3398 1.2694 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0858 1.1406 0.3331 C 0 0 1 0 0 0 0 0 0 0 0 0 9.9231 2.0307 -0.3527 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8734 1.2722 -1.0619 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4755 0.2871 -0.5924 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3295 0.9069 -1.0223 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9006 1.9079 0.0071 C 0 0 2 0 0 0 0 0 0 0 0 0 7.9707 1.8255 1.0688 C 0 0 2 0 0 0 0 0 0 0 0 0 8.4009 3.2222 1.5262 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5458 1.4769 0.4298 C 0 0 2 0 0 0 0 0 0 0 0 0 5.0150 0.8317 -0.8532 C 0 0 1 0 0 0 0 0 0 0 0 0 6.1599 -0.0341 -1.2431 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7067 0.1555 -0.6420 C 0 0 2 0 0 0 0 0 0 0 0 0 3.2788 -0.4424 -1.9481 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8509 -0.8696 -1.8337 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0296 -0.3846 -0.9375 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3972 0.6500 0.0880 C 0 0 2 0 0 0 0 0 0 0 0 0 2.7154 1.2684 -0.2883 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2171 2.0885 0.8692 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6056 2.6299 0.7006 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4304 0.0122 1.4406 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2846 1.6689 0.0363 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4894 1.5900 -1.2604 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3038 0.3341 -1.2758 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3885 -0.8280 -0.9155 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3695 0.4821 -0.3921 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5752 0.2249 -0.9600 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.4179 1.3412 -0.9328 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5245 1.1167 -1.7857 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2362 2.4293 -1.9259 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6655 2.8741 -0.6951 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3799 0.0189 -1.2012 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.4541 -1.2149 -1.2129 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3587 -0.8706 -0.2568 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.5935 -1.8861 0.2097 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6571 -2.0062 1.5915 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4433 -1.6647 2.1799 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5863 -1.3665 3.5311 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3392 -0.0330 3.5806 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4042 -2.3704 4.2697 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.5901 -3.6056 3.4144 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2061 -3.3002 2.0901 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5796 -3.1996 2.2407 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3222 -4.5321 4.1548 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7622 -2.6746 5.4672 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1058 -2.3735 -0.9851 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5203 -0.2336 -1.9260 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7163 -0.0969 -1.3022 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.3472 -1.3633 -1.1042 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4462 -1.9504 -2.3804 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.7783 -3.4131 -2.3214 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4838 -1.2342 -3.2030 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.0528 0.1950 -3.3792 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.7269 0.7457 -1.9818 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.9367 0.7758 -1.2916 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.0262 0.9947 -3.9445 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.5884 -1.7773 -4.4872 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5625 0.5341 1.5811 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5206 -2.0885 0.0907 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3641 -1.2940 -0.4460 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7331 -0.6951 -1.5096 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8722 1.3651 -0.1962 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4226 1.8307 1.7186 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9519 0.0744 1.9140 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5494 0.4653 2.3021 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9556 -0.7518 1.0101 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2902 1.8900 -1.8547 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2985 0.4154 -1.4822 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5412 1.3669 -2.0111 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8914 2.9007 -0.4942 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6957 1.2242 1.9345 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8958 3.7836 0.7105 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5260 3.7657 1.9127 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0832 3.0559 2.4041 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8464 1.6820 -1.5485 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0569 -0.3290 -2.3061 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1994 -0.9101 -0.5796 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7266 -0.6563 0.0935 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3185 0.3479 -2.7400 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9348 -1.3082 -2.2182 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5218 -1.6306 -2.5604 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6232 1.9041 -1.1715 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4742 2.9086 1.0057 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2172 1.4323 1.7695 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8981 3.0976 1.6542 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6793 3.3974 -0.0944 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5327 -0.6292 1.5530 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3597 0.7648 2.2590 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3069 -0.6348 1.5284 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6756 2.7226 0.1135 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3845 1.5185 0.9194 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2447 1.6513 -2.0909 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1749 2.4810 -1.2968 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7479 0.1053 -2.2799 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6255 -1.2766 0.0574 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5468 -1.6557 -1.6613 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4241 -0.0961 -2.0369 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1761 0.8175 -2.8116 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4600 3.1699 -2.2750 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0144 2.4438 -2.7047 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0585 3.7883 -0.8554 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6026 0.3134 -0.1545 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9990 -1.2590 -2.2421 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8475 -0.3756 0.6122 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3712 -1.2045 1.9472 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6431 -1.2014 4.0459 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4165 -0.2503 3.7426 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0190 0.5555 4.4893 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2172 0.5548 2.6621 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4041 -1.9417 4.5725 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5825 -4.0375 3.2508 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0109 -4.1669 1.4293 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7663 -2.9677 3.1837 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6814 -4.9246 4.8118 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2274 -1.9291 5.8123 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6387 -2.3584 -0.1472 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5578 0.2584 -0.2698 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4654 -1.7710 -2.8825 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3874 -3.6596 -1.4302 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3631 -3.6658 -3.2178 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8616 -4.0512 -2.3601 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4718 -1.2427 -2.7413 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1210 0.2945 -3.9929 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4480 1.7936 -2.1600 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0997 -0.0390 -0.7537 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9692 1.8868 -3.5236 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3505 -1.2735 -4.9133 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7591 1.1204 2.5071 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3758 -0.2170 1.4729 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6249 -0.0098 1.7746 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 6 7 8 1 0 6 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 11 14 1 0 14 15 1 0 15 16 1 0 15 17 1 0 17 18 1 0 18 19 1 0 19 20 2 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 21 25 1 1 21 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 28 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 33 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 45 48 1 0 44 49 1 0 37 50 1 0 36 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 54 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 57 60 1 0 56 61 1 0 14 62 1 1 8 3 1 0 16 10 1 0 22 17 1 0 38 31 1 0 46 40 1 0 58 52 1 0 12 6 1 0 24 14 1 0 29 20 1 0 1 63 1 0 2 64 1 0 2 65 1 0 3 66 1 1 4 67 1 0 4 68 1 0 5 69 1 0 5 70 1 0 8 71 1 0 8 72 1 0 10 73 1 6 11 74 1 6 12 75 1 1 13 76 1 0 13 77 1 0 13 78 1 0 15 79 1 6 16 80 1 0 16 81 1 0 17 82 1 1 18 83 1 0 18 84 1 0 19 85 1 0 22 86 1 6 23 87 1 0 23 88 1 0 24 89 1 0 24 90 1 0 25 91 1 0 25 92 1 0 25 93 1 0 26 94 1 0 26 95 1 0 27 96 1 0 27 97 1 0 28 98 1 6 29 99 1 0 29100 1 0 31101 1 6 33102 1 6 34103 1 0 34104 1 0 35105 1 0 36106 1 1 37107 1 6 38108 1 1 40109 1 1 42110 1 1 43111 1 0 43112 1 0 43113 1 0 44114 1 1 45115 1 6 46116 1 6 47117 1 0 48118 1 0 49119 1 0 50120 1 0 52121 1 1 54122 1 6 55123 1 0 55124 1 0 55125 1 0 56126 1 1 57127 1 6 58128 1 6 59129 1 0 60130 1 0 61131 1 0 62132 1 0 62133 1 0 62134 1 0 M END

Standard InCHIKey	IGGJLWGOQNBJHC-OKJXOJKZSA-N
Standard InCHI	InChI=1S/C45H72O17/c1-19-30-28(62-45(19)13-8-22(16-46)18-55-45)15-27-25-7-6-23-14-24(9-11-43(23,4)26(25)10-12-44(27,30)5)58-42-39(61-41-36(53)34(51)32(49)21(3)57-41)37(54)38(29(17-47)59-42)60-40-35(52)33(50)31(48)20(2)56-40/h6,19-22,24-42,46-54H,7-18H2,1-5H3/t19-,20-,21-,22-,24-,25+,26-,27-,28-,29+,30-,31-,32-,33+,34+,35+,36+,37-,38+,39+,40-,41-,42+,43-,44-,45+/m0/s1
SMILES	OC[C@@H]1CC[C@@]2(OC1)O[C@@H]1[C@H]([C@@H]2C)[C@@]2([C@@H](C1)[C@@H]1CC=C3[C@]([C@H]1CC2)(C)CC[C@@H](C3)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	884.48	Volume:	856.665 ? Van der Waals volume.
Dense:	1.032	LogP:	1.285 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.025 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.43 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	48.0
TPSA:	255.91 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	9.0	Rings:	9.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.148	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.739	Fsp³:	0.956
MCE-18:	229.091 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.703	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.234	Promiscuous compounds:	0.015

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.684	MDCK Permeability:	-4.876
Pgp-inhibitor:	0.0	Pgp-substrate:	0.977
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.004
20% Bioavailability (F20%):	0.116	30% Bioavailability (F30%):	0.67
50% Bioavailability (F50%):	0.978

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.028
Plasma Protein Binding (PPB):	65.214%	Volume Distribution (VD):	-0.377
Fu:	27.432% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.072
BSEP inhibitor:	0.009

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.35	CYP3A4-substrate:	0.494
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.033 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.299

Half-life (T1/2):

3.158

ADMET: Toxicity

hERG Blockers:	0.005	hERG Blockers (10um):	0.026
Human Hepatotoxicity (H-HT):	0.519	Drug-induced Liver Injury (DILI):	0.955
AMES Toxicity:	0.964	Rat Oral Acute Toxicity:	0.011
Maximum Recommended Daily Dose:	0.006	Skin Sensitization:	1.0
Carcinogencity:	0.233	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.998
Hematotoxicity:	0.305	Drug-induced Nephrotoxicity:	0.993
Genotoxicity:	0.04	RPMI-8226 Immunitoxicity:	0.43
A549 Cytotoxicity:	0.948	Hek293 Cytotoxicity:	0.782
BCF:	1.546 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.414 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.564 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.907 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO19123	Polygonatum zanlanscianense	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[15620239]
NPO19123	Polygonatum zanlanscianense	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO19123	Polygonatum zanlanscianense	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO19123	Polygonatum zanlanscianense	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO19123	Polygonatum zanlanscianense	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT165	Cell line	HeLa	Homo sapiens	IC50	=	3.62	ug.mL-1	PMID[16562826]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC248746 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23893
0.1-0.2	22671
0.2-0.3	2576
0.3-0.4	505
0.4-0.5	99
0.5-0.6	53
0.6-0.7	24
0.7-0.8	0
0.8-0.85	2
0.85-0.9	8
0.9-0.95	3
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9231	High Similarity	NPC470433
0.9231	High Similarity	NPC46190
0.9231	High Similarity	NPC171073
0.8936	High Similarity	NPC480555
0.8936	High Similarity	NPC150372
0.866	High Similarity	NPC269297
0.866	High Similarity	NPC222202
0.8632	High Similarity	NPC42171
0.8571	High Similarity	NPC475333
0.8571	High Similarity	NPC224098
0.8571	High Similarity	NPC208383
0.84	Intermediate Similarity	NPC480554
0.8235	Intermediate Similarity	NPC480553
0.7941	Intermediate Similarity	NPC194207
0.7941	Intermediate Similarity	NPC22779
0.785	Intermediate Similarity	NPC480556
0.7778	Intermediate Similarity	NPC224314
0.7732	Intermediate Similarity	NPC113044
0.7732	Intermediate Similarity	NPC283829
0.7732	Intermediate Similarity	NPC161676
0.7708	Intermediate Similarity	NPC470432
0.7708	Intermediate Similarity	NPC230507
0.757	Intermediate Similarity	NPC232054
0.75	Intermediate Similarity	NPC32361
0.75	Intermediate Similarity	NPC602423
0.7404	Intermediate Similarity	NPC475550
0.7353	Intermediate Similarity	NPC300557
0.7216	Intermediate Similarity	NPC19400
0.7184	Intermediate Similarity	NPC6806
0.7087	Intermediate Similarity	NPC477809
0.703	Intermediate Similarity	NPC14704
0.7009	Intermediate Similarity	NPC13193
0.7	Intermediate Similarity	NPC94272
0.7	Intermediate Similarity	NPC485595
0.7	Intermediate Similarity	NPC6295
0.6947	Remote Similarity	NPC181845
0.6857	Remote Similarity	NPC124677
0.6783	Remote Similarity	NPC477808
0.6762	Remote Similarity	NPC122819
0.6729	Remote Similarity	NPC73243
0.6729	Remote Similarity	NPC244086
0.6729	Remote Similarity	NPC84956
0.6699	Remote Similarity	NPC305423
0.6636	Remote Similarity	NPC475182
0.6606	Remote Similarity	NPC247037
0.6545	Remote Similarity	NPC309278
0.6495	Remote Similarity	NPC165439
0.6429	Remote Similarity	NPC249265
0.6372	Remote Similarity	NPC23808
0.6372	Remote Similarity	NPC87998
0.6316	Remote Similarity	NPC477811
0.6286	Remote Similarity	NPC141433
0.6286	Remote Similarity	NPC195297
0.6261	Remote Similarity	NPC287885
0.6121	Remote Similarity	NPC308140
0.6091	Remote Similarity	NPC471464
0.6058	Remote Similarity	NPC306131
0.6058	Remote Similarity	NPC200802
0.6055	Remote Similarity	NPC265275
0.5922	Remote Similarity	NPC477451
0.5851	Remote Similarity	NPC486119
0.578	Remote Similarity	NPC160426
0.5739	Remote Similarity	NPC486386
0.5676	Remote Similarity	NPC98696
0.5676	Remote Similarity	NPC40440
0.5664	Remote Similarity	NPC249553
0.5641	Remote Similarity	NPC254255
0.5596	Remote Similarity	NPC15249
0.5596	Remote Similarity	NPC25455
0.5583	Remote Similarity	NPC31896
0.5577	Remote Similarity	NPC297348
0.5577	Remote Similarity	NPC249204
0.5577	Remote Similarity	NPC48339
0.5577	Remote Similarity	NPC141769
0.5577	Remote Similarity	NPC477547
0.5565	Remote Similarity	NPC102016
0.5565	Remote Similarity	NPC95051
0.5545	Remote Similarity	NPC70204
0.5505	Remote Similarity	NPC107962
0.5478	Remote Similarity	NPC128572
0.5439	Remote Similarity	NPC469348
0.5429	Remote Similarity	NPC325828
0.5391	Remote Similarity	NPC182900
0.5385	Remote Similarity	NPC485594
0.537	Remote Similarity	NPC206003
0.537	Remote Similarity	NPC473610
0.5361	Remote Similarity	NPC100451
0.5345	Remote Similarity	NPC150057
0.5345	Remote Similarity	NPC147753
0.5333	Remote Similarity	NPC218571
0.5333	Remote Similarity	NPC487615
0.5321	Remote Similarity	NPC211354
0.5288	Remote Similarity	NPC486114
0.5278	Remote Similarity	NPC222731
0.5276	Remote Similarity	NPC210569
0.5268	Remote Similarity	NPC475670
0.5229	Remote Similarity	NPC121453
0.5217	Remote Similarity	NPC475643
0.5175	Remote Similarity	NPC112274
0.5169	Remote Similarity	NPC294129
0.5155	Remote Similarity	NPC235126
0.5155	Remote Similarity	NPC242419
0.5138	Remote Similarity	NPC250393
0.513	Remote Similarity	NPC161738
0.513	Remote Similarity	NPC42482
0.5118	Remote Similarity	NPC477807
0.5044	Remote Similarity	NPC125324
0.5043	Remote Similarity	NPC475351
0.5039	Remote Similarity	NPC15918
0.5038	Remote Similarity	NPC305771
0.5038	Remote Similarity	NPC94072
0.5038	Remote Similarity	NPC169816

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC248746 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7620
0.1-0.2	1465
0.2-0.3	54
0.3-0.4	7
0.4-0.5	1
0.5-0.6	2
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6762	Remote Similarity	NPD8449	Approved
0.5429	Remote Similarity	NPD8171	Phase 2
0.5345	Remote Similarity	NPD8450	Suspended

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data