NPASS Compound

Natural Product: NPC486114

Natural Product ID	NPC486114
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	NAQRQPJCRPQLGO-QFEUKSQXSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	n.a.
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0002031] Stigmastanes and derivatives

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 121126 0 0 0 0 0 0 0 0999 V2000 -10.6115 -0.4373 -0.0336 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.0346 0.4493 1.0154 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5884 0.6949 0.9951 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.5959 -0.3445 1.1547 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3491 -1.5048 0.3228 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9296 -1.4749 -1.0764 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.8742 -0.7981 -2.0355 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5065 -1.4172 -1.4171 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4139 -1.3970 -2.9616 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8957 -1.3787 -3.2157 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3667 -1.0309 -1.8798 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2023 -0.0856 -1.8467 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.3209 -0.3435 -3.0006 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1025 -0.1568 -2.6347 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5662 0.2108 -1.4626 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0124 0.3488 -1.2652 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3995 -0.7858 -0.3129 C 0 0 2 0 0 0 0 0 0 0 0 0 1.5201 -0.8089 0.8660 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4194 0.1883 0.9562 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3350 0.4841 -0.2979 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5861 1.9854 -0.3117 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6147 -0.3040 -0.4722 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.6285 -0.0314 0.5525 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0568 -0.1625 0.2568 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5462 -0.3752 -1.1151 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.7399 0.9403 -1.8363 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7383 -0.7483 -0.1235 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5104 -1.7466 -0.5745 C 0 0 1 0 0 0 0 0 0 0 0 0 5.4861 -1.2347 -1.6285 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8897 -1.1500 -1.0511 C 0 0 2 0 0 0 0 0 0 0 0 0 6.7726 -0.5245 0.3500 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0674 -1.5525 1.1739 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2940 -0.9126 2.3047 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1652 -0.1298 3.0411 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1726 -2.3470 0.4812 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0410 -0.3057 0.8678 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3912 1.0062 1.0633 C 0 0 1 0 0 0 0 0 0 0 0 0 8.9805 1.2732 2.4212 C 0 0 1 0 0 0 0 0 0 0 0 0 10.3245 1.9757 2.3459 C 0 0 1 0 0 0 0 0 0 0 0 0 11.3074 1.2618 1.4565 C 0 0 2 0 0 0 0 0 0 0 0 0 10.5323 0.4597 0.4385 C 0 0 2 0 0 0 0 0 0 0 0 0 11.3165 0.1083 -0.7821 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4197 1.2233 0.0704 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1802 0.4552 2.1899 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1129 3.2747 1.8976 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1313 2.2090 3.0647 O 0 0 0 0 0 0 0 0 0 0 0 0 7.6331 -0.2842 -1.8238 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4868 -2.0225 -2.7771 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3327 1.7297 2.1390 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8919 2.0964 2.2304 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9217 1.2698 3.4314 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.7627 -0.4217 0.0397 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4754 0.0003 -1.0697 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3800 -1.4983 0.0346 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4390 0.2038 2.0373 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5260 1.4673 0.8316 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3976 1.3733 0.0885 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6282 0.2018 1.4345 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8203 -0.8005 2.2151 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5714 -2.2142 0.8397 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2567 -2.1872 0.4635 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1606 -2.5924 -1.4065 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0543 0.2493 -1.8978 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8523 -1.3765 -2.0102 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5489 -1.0359 -3.1088 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9962 -2.4040 -1.1572 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9246 -2.2220 -3.4313 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7267 -0.3707 -3.3044 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6220 -0.6965 -4.0375 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5848 -2.3912 -3.5228 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1303 -1.9558 -1.3011 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5182 0.9813 -1.8845 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5103 -1.3827 -3.3731 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5724 0.3826 -3.8101 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8518 -0.3455 -3.4290 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5466 0.2557 -2.2410 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3220 1.3290 -0.8611 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1861 -1.7215 -0.9069 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0354 -1.8252 0.9704 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0829 -0.7265 1.8450 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3563 -0.2471 1.6647 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7251 1.1206 1.4994 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2197 2.3290 -1.1247 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4182 2.4938 -0.4362 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9231 2.3602 0.7021 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3436 -1.4003 -0.4401 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3882 -0.7240 1.4293 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3662 0.9805 1.0102 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5199 0.8274 0.5873 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5018 -0.9860 0.8945 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8111 1.2139 -1.9283 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3043 0.9870 -2.8343 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2825 1.7311 -1.2076 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9690 -2.5774 -1.0863 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1784 -0.2296 -1.9118 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2736 -2.1872 -1.0078 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2385 0.4210 0.2644 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8409 -2.1970 1.6956 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4772 -0.2512 1.9724 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9134 -1.7191 2.9808 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8762 -0.6836 3.4679 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6477 1.7603 0.8310 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9962 0.3843 3.0771 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7705 1.9757 3.3654 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9043 2.0095 0.8540 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1985 -0.5172 0.9023 H 0 0 0 0 0 0 0 0 0 0 0 0 11.9468 -0.7909 -0.5135 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7139 -0.0382 -1.6811 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0732 0.9275 -0.9547 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9380 1.0700 2.4488 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9659 3.3151 0.9345 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2287 3.0460 2.5145 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1498 -0.7476 -2.5242 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0827 -2.8101 -2.6971 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8983 2.6435 1.7951 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7862 3.1509 2.6553 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3722 2.1728 1.2537 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3010 1.4677 2.9364 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0231 0.1895 3.4982 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3616 1.7121 4.2880 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9648 1.6918 3.5384 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 17 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 31 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 41 43 1 0 40 44 1 0 39 45 1 0 38 46 1 0 30 47 1 0 29 48 1 0 3 49 1 0 49 50 1 0 49 51 1 0 25 8 1 0 35 28 1 0 43 37 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 52 1 0 1 53 1 0 1 54 1 0 2 55 1 0 2 56 1 0 3 57 1 6 4 58 1 0 4 59 1 0 5 60 1 0 5 61 1 0 6 62 1 6 7 63 1 0 7 64 1 0 7 65 1 0 8 66 1 1 9 67 1 0 9 68 1 0 10 69 1 0 10 70 1 0 11 71 1 1 12 72 1 1 13 73 1 0 13 74 1 0 14 75 1 0 16 76 1 0 16 77 1 0 17 78 1 6 18 79 1 0 18 80 1 0 19 81 1 0 19 82 1 0 21 83 1 0 21 84 1 0 21 85 1 0 22 86 1 6 23 87 1 0 23 88 1 0 24 89 1 0 24 90 1 0 26 91 1 0 26 92 1 0 26 93 1 0 28 94 1 6 29 95 1 6 30 96 1 1 31 97 1 6 32 98 1 1 33 99 1 0 33100 1 0 34101 1 0 37102 1 6 38103 1 1 39104 1 1 40105 1 6 41106 1 1 42107 1 0 42108 1 0 42109 1 0 44110 1 0 45111 1 0 46112 1 0 47113 1 0 48114 1 0 49115 1 0 50116 1 0 50117 1 0 50118 1 0 51119 1 0 51120 1 0 51121 1 0 M END

Standard InCHIKey	NAQRQPJCRPQLGO-QFEUKSQXSA-N
Standard InCHI	InChI=1S/C41H70O10/c1-8-24(21(2)3)10-9-22(4)28-13-14-29-27-12-11-25-19-26(15-17-40(25,6)30(27)16-18-41(28,29)7)49-39-36(47)34(45)37(31(20-42)50-39)51-38-35(46)33(44)32(43)23(5)48-38/h11,21-24,26-39,42-47H,8-10,12-20H2,1-7H3/t22-,23+,24-,26+,27+,28-,29+,30+,31-,32+,33-,34-,35-,36-,37-,38+,39-,40+,41-/m1/s1
SMILES	CC[C@H](CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O[C@H]1[C@@H]([C@@H]([C@H]([C@H](C)O1)O)O)O)O)O)C(C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	722.5	Volume:	751.619 ? Van der Waals volume.
Dense:	0.961	LogP:	5.832 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	5.548 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.468 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	32.0
TPSA:	158.3 ? Topological Polar Surface Area.	H-Bond Acceptor:	10.0
H-Bond Donor:	6.0	Rings:	6.0
Heavy Atoms:	10.0

MedChem Properties

QED Drug-Likeness Score:	0.165	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.539	Fsp³:	0.951
MCE-18:	112.875 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.985	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.346	Promiscuous compounds:	0.003

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.66	MDCK Permeability:	-5.121
Pgp-inhibitor:	0.0	Pgp-substrate:	0.232
PAMPA:	0.876 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.003	30% Bioavailability (F30%):	0.414
50% Bioavailability (F50%):	0.996

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.002	MRP1:	0.001
Plasma Protein Binding (PPB):	75.334%	Volume Distribution (VD):	-0.444
Fu:	19.755% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.027
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.171	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.999	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	1.0
HLM stability:	0.895 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

1.017

Half-life (T1/2):

2.021

ADMET: Toxicity

hERG Blockers:	0.107	hERG Blockers (10um):	0.28
Human Hepatotoxicity (H-HT):	0.45	Drug-induced Liver Injury (DILI):	0.767
AMES Toxicity:	0.698	Rat Oral Acute Toxicity:	0.02
Maximum Recommended Daily Dose:	0.024	Skin Sensitization:	1.0
Carcinogencity:	0.075	Eye Corrosion:	0.0
Eye Irritation:	0.026	Respiratory Toxicity:	0.106
Drug-induced Neurotoxicity:	0.002	Ototoxicity:	0.981
Hematotoxicity:	0.448	Drug-induced Nephrotoxicity:	0.576
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.15
A549 Cytotoxicity:	0.933	Hek293 Cytotoxicity:	0.652
BCF:	2.763 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.489 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.232 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	5.092 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40499	Dioscorea nipponica Makino subsp. rosthornii (Prain et Burkill) C. T. Ting	Strain	Dioscoreaceae	Eukaryota	Rhizomes	n.a.	n.a.	PMID[28606759]
NPO40499	Dioscorea nipponica Makino subsp. rosthornii (Prain et Burkill) C. T. Ting	Strain	Dioscoreaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT397	Cell line	NCI-H460	Homo sapiens	IC50	>	50000.0	nM	PMID[28606759]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC486114 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20201
0.1-0.2	24613
0.2-0.3	4131
0.3-0.4	739
0.4-0.5	117
0.5-0.6	41
0.6-0.7	10
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7973	Intermediate Similarity	NPC22140
0.7973	Intermediate Similarity	NPC243728
0.6477	Remote Similarity	NPC295389
0.6452	Remote Similarity	NPC470432
0.6452	Remote Similarity	NPC230507
0.6452	Remote Similarity	NPC15249
0.6452	Remote Similarity	NPC25455
0.642	Remote Similarity	NPC158088
0.6173	Remote Similarity	NPC473890
0.6145	Remote Similarity	NPC470434
0.6071	Remote Similarity	NPC282669
0.6	Remote Similarity	NPC6806
0.5889	Remote Similarity	NPC165439
0.5882	Remote Similarity	NPC608180
0.5714	Remote Similarity	NPC44083
0.5612	Remote Similarity	NPC94272
0.561	Remote Similarity	NPC207617
0.561	Remote Similarity	NPC607440
0.549	Remote Similarity	NPC265275
0.5472	Remote Similarity	NPC269297
0.5472	Remote Similarity	NPC222202
0.5437	Remote Similarity	NPC122819
0.5426	Remote Similarity	NPC272015
0.5385	Remote Similarity	NPC42171
0.5347	Remote Similarity	NPC470748
0.534	Remote Similarity	NPC470433
0.534	Remote Similarity	NPC46190
0.534	Remote Similarity	NPC171073
0.5288	Remote Similarity	NPC248746
0.5288	Remote Similarity	NPC477809
0.5287	Remote Similarity	NPC21064
0.5273	Remote Similarity	NPC23808
0.5273	Remote Similarity	NPC87998
0.5195	Remote Similarity	NPC230301
0.5189	Remote Similarity	NPC480555
0.5189	Remote Similarity	NPC475182
0.5189	Remote Similarity	NPC150372
0.5185	Remote Similarity	NPC247037
0.5179	Remote Similarity	NPC308140
0.5172	Remote Similarity	NPC154452
0.5165	Remote Similarity	NPC210178
0.514	Remote Similarity	NPC73243
0.514	Remote Similarity	NPC244086
0.514	Remote Similarity	NPC84956
0.5106	Remote Similarity	NPC296686
0.5094	Remote Similarity	NPC48886
0.5094	Remote Similarity	NPC94881
0.5049	Remote Similarity	NPC14704
0.5049	Remote Similarity	NPC600116
0.5048	Remote Similarity	NPC602423
0.5047	Remote Similarity	NPC150057
0.5047	Remote Similarity	NPC147753
0.5046	Remote Similarity	NPC475550

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC486114 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7131
0.1-0.2	1845
0.2-0.3	153
0.3-0.4	16
0.4-0.5	2
0.5-0.6	3
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5437	Remote Similarity	NPD8449	Approved
0.5195	Remote Similarity	NPD7339	Approved
0.5047	Remote Similarity	NPD8450	Suspended

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data