NPASS Compound

Natural Product: NPC477809

Natural Product ID	NPC477809
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	(2S,3R,4S,5S,6R)-2-[(2S,3R,4S,5S,6R)-2-[(2R,3R,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(1S,2S,4S,6R,7S,8R,9S,12S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxyoxan-3-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
IUPAC Name	(2S,3R,4S,5S,6R)-2-[(2S,3R,4S,5S,6R)-2-[(2R,3R,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(1S,2S,4S,6R,7S,8R,9S,12S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxyoxan-3-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	11600446
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 135143 0 0 0 0 0 0 0 0999 V2000 9.9127 1.2316 2.3834 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2173 0.2676 1.4085 C 0 0 1 0 0 0 0 0 0 0 0 0 7.8964 0.8492 1.0487 C 0 0 1 0 0 0 0 0 0 0 0 0 8.0209 1.1650 -0.4328 C 0 0 2 0 0 0 0 0 0 0 0 0 6.6745 0.7726 -1.0582 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7719 0.6032 0.1112 C 0 0 2 0 0 0 0 0 0 0 0 0 6.7274 -0.0705 1.1079 C 0 0 2 0 0 0 0 0 0 0 0 0 6.0135 -0.0309 2.4402 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7174 -0.7561 2.3870 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8712 -0.4608 1.1805 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6285 -0.3650 -0.0923 C 0 0 1 0 0 0 0 0 0 0 0 0 3.7015 0.2809 -1.1361 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3857 -0.4058 -1.1407 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9830 -1.1951 -0.1522 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7783 -1.4918 1.0665 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9362 -1.4211 2.3270 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5635 -2.0287 2.1629 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1074 -1.3661 0.9991 C 0 0 1 0 0 0 0 0 0 0 0 0 0.6210 -1.8462 -0.2459 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4651 -1.4992 0.9332 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1603 -0.2644 0.9208 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.8176 -0.0315 -0.4040 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3063 -0.2416 -0.3929 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8478 0.4684 0.8354 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2240 -0.1240 2.0461 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8845 -0.0330 2.0365 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7660 -1.4958 2.3854 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3536 -1.9031 3.6579 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2170 0.5295 0.8530 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6653 1.8105 0.7008 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6454 1.9579 -0.4587 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.5710 3.3960 -0.8708 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.4121 4.2486 0.3252 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.6336 3.6426 1.6560 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3745 2.3110 1.8081 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1040 3.8678 2.0311 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3711 3.4973 3.3291 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1051 4.7954 0.3205 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6861 3.8005 -1.6039 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3551 1.0740 -1.4826 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.4397 0.2319 -1.6779 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.0089 0.3285 -3.0723 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.0292 -0.9972 -3.7866 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.4431 -2.1437 -2.9159 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2215 -1.8681 -1.4491 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.0786 -1.0777 -1.3565 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9512 -3.1499 -0.6882 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6849 -2.7505 0.6384 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7371 -2.5849 -3.1692 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7855 -1.2532 -4.4094 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.2695 0.9042 -3.1083 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7024 -1.5497 -0.5079 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5472 1.2463 -0.9170 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3237 -2.8924 0.8940 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9811 -1.4657 0.6521 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9958 0.3200 -0.8981 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9884 0.3248 0.1076 C 0 0 2 0 0 0 0 0 0 0 0 0 10.9663 -0.7907 -0.0647 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5068 -0.7316 -1.4750 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8574 0.6430 -1.9374 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9656 1.7156 -1.3578 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6735 1.5307 -0.0290 O 0 0 0 0 0 0 0 0 0 0 0 0 11.6721 0.6884 -3.4496 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9693 0.8910 2.5282 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8550 2.2480 1.9718 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3472 1.1654 3.3307 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2191 -0.6975 1.9044 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6436 1.7640 1.6326 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2225 2.2465 -0.5963 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7597 -0.0643 -1.7449 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2842 1.6392 -1.6629 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4040 1.5566 0.5018 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6816 -0.5748 3.1604 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9551 1.0084 2.7705 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8605 -1.8371 2.5878 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1122 -0.3957 3.2738 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3449 0.5245 1.3151 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9797 -1.2938 -0.5364 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5998 1.3606 -0.9221 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1851 0.1568 -2.1295 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7399 -0.2428 -1.9968 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4897 -2.0089 3.1126 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8578 -0.3894 2.6843 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6440 -3.1312 2.0427 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0030 -1.7974 3.0798 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1400 -0.2646 1.0541 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0778 -1.4931 -1.1258 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7508 -2.9287 -0.2804 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3193 0.5031 0.9587 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3895 -0.7506 -1.1323 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7142 0.3181 -1.2693 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4586 1.5202 0.7298 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5806 0.5239 2.9095 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3832 -2.2716 1.6890 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8770 -1.4980 2.4075 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0930 -2.2041 4.2290 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8132 2.5087 0.5786 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6665 1.7701 -0.0649 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6491 3.4942 -1.5197 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0958 5.1340 0.2348 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0738 4.2531 2.4298 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7869 3.3630 1.3196 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3527 4.9591 1.9504 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5629 3.0242 3.6949 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1141 5.7717 0.4434 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4560 3.6935 -2.5797 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2408 0.5030 -0.9662 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3262 0.9874 -3.6536 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7598 -0.9173 -4.6183 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7746 -3.0079 -3.1728 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0964 -1.3958 -0.9556 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0830 -3.7044 -1.0402 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8782 -3.7878 -0.6554 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9380 -2.1012 0.6453 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8654 -3.4369 -2.6892 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2443 -1.8883 -3.8923 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4842 1.2430 -3.9973 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1083 -1.7388 -1.3885 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0887 1.7553 -0.2108 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7183 -3.3296 1.8332 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0867 -2.9886 0.1219 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4701 -3.5603 0.6140 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9877 -1.6059 -0.4427 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1197 -2.0972 1.0092 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8686 -1.9465 1.0827 H 0 0 0 0 0 0 0 0 0 0 0 0 11.7403 -0.6964 0.7019 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4234 -1.7695 0.0177 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7479 -1.2304 -2.1445 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4222 -1.3579 -1.5597 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9039 0.9061 -1.7091 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5224 2.6872 -1.4339 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0937 1.8168 -2.0186 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6314 0.3163 -3.6811 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6849 1.7403 -3.7977 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3528 0.0199 -3.9759 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 2 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 25 27 1 0 27 28 1 0 24 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 34 36 1 0 36 37 1 0 33 38 1 0 32 39 1 0 31 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 45 47 1 0 47 48 1 0 44 49 1 0 43 50 1 0 42 51 1 0 23 52 1 0 22 53 1 0 15 54 1 6 7 55 1 6 4 56 1 0 57 56 1 6 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 60 63 1 0 57 2 1 0 7 3 1 0 11 6 1 0 15 10 1 0 19 14 1 0 26 21 1 0 35 30 1 0 46 41 1 0 62 57 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 1 3 68 1 1 4 69 1 1 5 70 1 0 5 71 1 0 6 72 1 1 8 73 1 0 8 74 1 0 9 75 1 0 9 76 1 0 10 77 1 1 11 78 1 6 12 79 1 0 12 80 1 0 13 81 1 0 16 82 1 0 16 83 1 0 17 84 1 0 17 85 1 0 18 86 1 1 19 87 1 0 19 88 1 0 21 89 1 1 22 90 1 6 23 91 1 6 24 92 1 6 25 93 1 1 27 94 1 0 27 95 1 0 28 96 1 0 30 97 1 6 31 98 1 1 32 99 1 6 33100 1 6 34101 1 1 36102 1 0 36103 1 0 37104 1 0 38105 1 0 39106 1 0 41107 1 1 42108 1 6 43109 1 6 44110 1 6 45111 1 1 47112 1 0 47113 1 0 48114 1 0 49115 1 0 50116 1 0 51117 1 0 52118 1 0 53119 1 0 54120 1 0 54121 1 0 54122 1 0 55123 1 0 55124 1 0 55125 1 0 58126 1 0 58127 1 0 59128 1 0 59129 1 0 60130 1 0 61131 1 0 61132 1 0 63133 1 0 63134 1 0 63135 1 0 M END

Standard InCHIKey	IATOWVQMFQIWJG-XPCIHDEQSA-N
Standard InCHI	InChI=1S/C45H72O18/c1-19-7-12-45(56-18-19)20(2)30-26(63-45)14-25-23-6-5-21-13-22(8-10-43(21,3)24(23)9-11-44(25,30)4)57-40-37(55)35(53)38(29(17-48)60-40)61-42-39(34(52)32(50)28(16-47)59-42)62-41-36(54)33(51)31(49)27(15-46)58-41/h5,19-20,22-42,46-55H,6-18H2,1-4H3/t19?,20-,22-,23+,24-,25-,26-,27+,28+,29+,30-,31+,32+,33-,34-,35+,36+,37+,38-,39+,40+,41-,42-,43-,44-,45+/m0/s1
SMILES	C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)CO)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O)O)C)C)O[C@]19CCC(CO9)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	900.47	Volume:	865.455 ? Van der Waals volume.
Dense:	1.04	LogP:	1.851 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.755 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.79 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	48.0
TPSA:	276.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	10.0	Rings:	9.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.127	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.701	Fsp³:	0.956
MCE-18:	229.091 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.764	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.004 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.241	Promiscuous compounds:	0.005

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.417	MDCK Permeability:	-5.101
Pgp-inhibitor:	0.0	Pgp-substrate:	0.242
PAMPA:	0.961 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.103
20% Bioavailability (F20%):	0.282	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.003	MRP1:	0.014
Plasma Protein Binding (PPB):	59.648%	Volume Distribution (VD):	-0.418
Fu:	31.539% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.122
BSEP inhibitor:	0.004

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.796	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.937
HLM stability:	0.004 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.26

Half-life (T1/2):

2.656

ADMET: Toxicity

hERG Blockers:	0.009	hERG Blockers (10um):	0.015
Human Hepatotoxicity (H-HT):	0.62	Drug-induced Liver Injury (DILI):	0.979
AMES Toxicity:	0.973	Rat Oral Acute Toxicity:	0.004
Maximum Recommended Daily Dose:	0.004	Skin Sensitization:	1.0
Carcinogencity:	0.113	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.001	Ototoxicity:	1.0
Hematotoxicity:	0.638	Drug-induced Nephrotoxicity:	0.805
Genotoxicity:	0.01	RPMI-8226 Immunitoxicity:	0.291
A549 Cytotoxicity:	0.97	Hek293 Cytotoxicity:	0.943
BCF:	1.548 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.37 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.595 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.878 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	rhizomes	Kangwon Province of Korea	2002-MAY	PMID[16562835]
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT83	Cell line	MCF7	Homo sapiens	IC50	=	24300	nM	PMID[16562835]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC477809 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23969
0.1-0.2	22150
0.2-0.3	2710
0.3-0.4	760
0.4-0.5	117
0.5-0.6	76
0.6-0.7	40
0.7-0.8	0
0.8-0.85	7
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8495	Intermediate Similarity	NPC113044
0.8495	Intermediate Similarity	NPC283829
0.8495	Intermediate Similarity	NPC161676
0.8295	Intermediate Similarity	NPC181845
0.828	Intermediate Similarity	NPC470432
0.828	Intermediate Similarity	NPC230507
0.81	Intermediate Similarity	NPC475550
0.798	Intermediate Similarity	NPC480555
0.798	Intermediate Similarity	NPC150372
0.7885	Intermediate Similarity	NPC477811
0.7789	Intermediate Similarity	NPC107962
0.77	Intermediate Similarity	NPC6806
0.7677	Intermediate Similarity	NPC470433
0.7677	Intermediate Similarity	NPC46190
0.7677	Intermediate Similarity	NPC171073
0.7573	Intermediate Similarity	NPC269297
0.7573	Intermediate Similarity	NPC222202
0.7547	Intermediate Similarity	NPC480553
0.7358	Intermediate Similarity	NPC480554
0.7353	Intermediate Similarity	NPC300557
0.72	Intermediate Similarity	NPC14704
0.717	Intermediate Similarity	NPC475333
0.717	Intermediate Similarity	NPC224098
0.717	Intermediate Similarity	NPC208383
0.7157	Intermediate Similarity	NPC602423
0.7103	Intermediate Similarity	NPC194207
0.7103	Intermediate Similarity	NPC22779
0.7087	Intermediate Similarity	NPC248746
0.7009	Intermediate Similarity	NPC13193
0.6931	Remote Similarity	NPC141433
0.693	Remote Similarity	NPC477808
0.6903	Remote Similarity	NPC480556
0.6875	Remote Similarity	NPC297348
0.6875	Remote Similarity	NPC325828
0.6875	Remote Similarity	NPC249204
0.6875	Remote Similarity	NPC48339
0.6875	Remote Similarity	NPC141769
0.6875	Remote Similarity	NPC477547
0.6863	Remote Similarity	NPC305423
0.6847	Remote Similarity	NPC31896
0.6842	Remote Similarity	NPC224314
0.6786	Remote Similarity	NPC232054
0.6762	Remote Similarity	NPC92890
0.6698	Remote Similarity	NPC249553
0.6698	Remote Similarity	NPC42171
0.6697	Remote Similarity	NPC32361
0.6581	Remote Similarity	NPC210569
0.6566	Remote Similarity	NPC477451
0.6545	Remote Similarity	NPC475625
0.6545	Remote Similarity	NPC309278
0.6417	Remote Similarity	NPC305771
0.6417	Remote Similarity	NPC94072
0.6417	Remote Similarity	NPC169816
0.641	Remote Similarity	NPC477807
0.63	Remote Similarity	NPC294686
0.6273	Remote Similarity	NPC184617
0.6262	Remote Similarity	NPC98696
0.6262	Remote Similarity	NPC40440
0.6214	Remote Similarity	NPC306131
0.6214	Remote Similarity	NPC211354
0.6214	Remote Similarity	NPC200802
0.619	Remote Similarity	NPC6295
0.6167	Remote Similarity	NPC15918
0.6126	Remote Similarity	NPC97700
0.6126	Remote Similarity	NPC30856
0.6091	Remote Similarity	NPC182900
0.6019	Remote Similarity	NPC250393
0.6019	Remote Similarity	NPC222731
0.6016	Remote Similarity	NPC263359
0.5913	Remote Similarity	NPC63609
0.5905	Remote Similarity	NPC107188
0.5905	Remote Similarity	NPC19400
0.5897	Remote Similarity	NPC132080
0.5893	Remote Similarity	NPC475182
0.5877	Remote Similarity	NPC247037
0.5851	Remote Similarity	NPC100451
0.5842	Remote Similarity	NPC485594
0.5841	Remote Similarity	NPC73243
0.5841	Remote Similarity	NPC244086
0.5841	Remote Similarity	NPC84956
0.5825	Remote Similarity	NPC234352
0.5812	Remote Similarity	NPC23808
0.5812	Remote Similarity	NPC87998
0.581	Remote Similarity	NPC206003
0.581	Remote Similarity	NPC473610
0.578	Remote Similarity	NPC160426
0.576	Remote Similarity	NPC244431
0.5741	Remote Similarity	NPC94272
0.5741	Remote Similarity	NPC485595
0.5688	Remote Similarity	NPC195297
0.5664	Remote Similarity	NPC124677
0.5641	Remote Similarity	NPC232037
0.5638	Remote Similarity	NPC235126
0.5638	Remote Similarity	NPC242419
0.5607	Remote Similarity	NPC54619
0.5596	Remote Similarity	NPC15249
0.5596	Remote Similarity	NPC25455
0.5593	Remote Similarity	NPC249265
0.5593	Remote Similarity	NPC470864
0.5583	Remote Similarity	NPC308140
0.5556	Remote Similarity	NPC116756
0.5546	Remote Similarity	NPC476112
0.5546	Remote Similarity	NPC83137
0.5546	Remote Similarity	NPC307534
0.5545	Remote Similarity	NPC70204
0.5536	Remote Similarity	NPC486388
0.552	Remote Similarity	NPC79900
0.5517	Remote Similarity	NPC115165
0.5514	Remote Similarity	NPC121453
0.55	Remote Similarity	NPC277715
0.5478	Remote Similarity	NPC128572
0.5455	Remote Similarity	NPC306991
0.5446	Remote Similarity	NPC475351
0.5431	Remote Similarity	NPC102016
0.5431	Remote Similarity	NPC95051
0.5424	Remote Similarity	NPC473518
0.5372	Remote Similarity	NPC233433
0.5366	Remote Similarity	NPC470866
0.5304	Remote Similarity	NPC122819
0.5288	Remote Similarity	NPC486114
0.5263	Remote Similarity	NPC161738
0.5263	Remote Similarity	NPC42482
0.5259	Remote Similarity	NPC471464
0.5221	Remote Similarity	NPC470748
0.5221	Remote Similarity	NPC600116
0.5217	Remote Similarity	NPC475643
0.5207	Remote Similarity	NPC218571
0.5207	Remote Similarity	NPC487615
0.5204	Remote Similarity	NPC486119
0.5197	Remote Similarity	NPC220836
0.5192	Remote Similarity	NPC24960
0.5179	Remote Similarity	NPC125324
0.5161	Remote Similarity	NPC167183
0.5152	Remote Similarity	NPC22140
0.5152	Remote Similarity	NPC243728
0.5152	Remote Similarity	NPC158088
0.514	Remote Similarity	NPC272015
0.514	Remote Similarity	NPC177834
0.513	Remote Similarity	NPC197231
0.5089	Remote Similarity	NPC295980
0.5085	Remote Similarity	NPC150057
0.5085	Remote Similarity	NPC147753
0.505	Remote Similarity	NPC282669
0.5043	Remote Similarity	NPC19888
0.5041	Remote Similarity	NPC470862

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC477809 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7593
0.1-0.2	1467
0.2-0.3	80
0.3-0.4	5
0.4-0.5	1
0.5-0.6	2
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6875	Remote Similarity	NPD8171	Phase 2
0.619	Remote Similarity	NPD8170	Phase 2
0.5304	Remote Similarity	NPD8449	Approved
0.5085	Remote Similarity	NPD8450	Suspended

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data