NPASS Compound

Natural Product: NPC477807

Natural Product ID	NPC477807
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	[(1S,2S,4S,5'S,6R,7S,8R,9S,12S,13R,14R,16R)-16-[(2R,3R,4R,5R,6R)-3,4-dihydroxy-5-[(2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(2S,3S,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-(hydroxymethyl)oxan-2-yl]oxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14-yl] acetate
IUPAC Name	[(1S,2S,4S,5'S,6R,7S,8R,9S,12S,13R,14R,16R)-16-[(2R,3R,4R,5R,6R)-3,4-dihydroxy-5-[(2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-4-[(2S,3S,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-(hydroxymethyl)oxan-2-yl]oxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-14-yl] acetate
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	44575241
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 159168 0 0 0 0 0 0 0 0999 V2000 14.5776 1.8961 2.2050 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3673 1.8860 1.3119 C 0 0 1 0 0 0 0 0 0 0 0 0 13.6137 1.2031 -0.0116 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4948 0.2562 -0.3783 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1481 0.6784 0.0759 C 0 0 2 0 0 0 0 0 0 0 0 0 10.2188 -0.5286 0.1362 C 0 0 2 0 0 0 0 0 0 0 0 0 8.8919 0.1369 0.2507 C 0 0 1 0 0 0 0 0 0 0 0 0 9.1568 1.4880 -0.4324 C 0 0 1 0 0 0 0 0 0 0 0 0 10.4440 1.4394 -0.8938 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1038 1.5516 -1.5528 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0289 0.7669 -0.9174 C 0 0 2 0 0 0 0 0 0 0 0 0 7.7764 -0.5054 -0.5463 C 0 0 2 0 0 0 0 0 0 0 0 0 6.8600 -1.3586 0.2419 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5355 -0.7199 0.5741 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8395 -0.0488 -0.5209 C 0 0 1 0 0 0 0 0 0 0 0 0 5.7951 0.4518 -1.6224 C 0 0 1 0 0 0 0 0 0 0 0 0 5.1531 1.5776 -2.3577 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7048 1.3759 -2.4602 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0374 0.3482 -1.9707 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7541 -0.7607 -1.2273 C 0 0 2 0 0 0 0 0 0 0 0 0 2.7314 -1.4472 -0.3715 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7729 -0.4709 0.2709 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9704 0.3036 -0.7636 C 0 0 1 0 0 0 0 0 0 0 0 0 1.5690 0.2840 -2.1246 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3737 -0.0073 -0.6769 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1616 1.0011 -0.1944 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.3792 1.3330 -1.0120 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1437 2.4184 -0.2895 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.5844 1.8460 1.0354 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.2551 1.5457 1.7508 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.5527 0.5543 1.1059 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4193 1.3267 3.2265 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1671 2.4131 3.7380 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2687 0.6852 0.9494 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4460 0.5302 1.6117 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.6828 0.3971 0.7473 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8506 -1.0329 0.2752 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.6526 -1.8573 0.7290 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.6093 -1.7158 2.2303 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.3585 -0.4365 2.5735 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5943 -2.6787 2.8363 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9341 -3.9504 2.4229 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7782 -3.2018 0.4404 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9567 -1.1517 -1.0961 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0947 -1.8101 -1.5035 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8469 -3.0237 -2.3174 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3582 -2.7777 -3.7136 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.9082 -1.4787 -4.2171 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.1790 -1.1937 -3.4742 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.0027 -0.9601 -2.1381 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.7115 -0.0079 -4.0317 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2272 -1.5991 -5.5753 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9674 -2.8652 -3.8304 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0805 -3.7101 -2.4233 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8349 0.7649 1.4203 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5448 1.7952 0.8600 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.9945 1.5021 0.6560 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.5013 0.8295 1.9361 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.9518 1.6078 3.0908 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.4086 2.9508 2.6894 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.4367 2.8876 1.7259 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7529 3.5489 3.9410 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7661 3.6064 4.9123 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9753 1.8142 4.0130 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9315 -0.4410 1.9702 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7038 2.6551 0.3684 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1652 2.9530 -1.0415 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0690 1.8123 -2.2690 O 0 0 0 0 0 0 0 0 0 0 0 0 1.9492 -2.2824 -1.2139 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7686 -3.6228 -1.0193 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3196 -4.1822 -0.0357 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9471 -4.4273 -1.9301 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2049 -1.7362 -2.2897 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2810 -1.2880 -1.7123 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5191 -1.4232 1.3205 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1123 1.2998 1.3156 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2822 1.1296 2.0328 C 0 0 0 0 0 0 0 0 0 0 0 0 15.4916 1.5468 1.7009 H 0 0 0 0 0 0 0 0 0 0 0 0 14.4433 1.2846 3.1292 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7967 2.9334 2.5805 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0212 2.9258 1.1244 H 0 0 0 0 0 0 0 0 0 0 0 0 14.5397 0.5745 0.1206 H 0 0 0 0 0 0 0 0 0 0 0 0 13.8341 1.9245 -0.8229 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4728 0.1940 -1.4994 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7042 -0.7794 -0.0383 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3837 -1.0639 -0.8328 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6323 0.2708 1.3023 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9352 2.3052 0.2724 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7882 2.6324 -1.6380 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4918 1.1958 -2.5058 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7918 1.2533 0.0600 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3744 -1.5998 1.2158 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6462 -2.3636 -0.2110 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7863 0.0348 1.3820 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9438 -1.4909 1.0936 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3852 0.9061 -0.1154 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9346 -0.3625 -2.3841 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3281 2.5567 -1.8698 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5849 1.6606 -3.3968 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1546 2.1717 -2.9991 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1315 -2.0853 0.4111 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1147 -1.0483 0.9494 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3888 0.1781 0.9230 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0425 1.3789 -0.4064 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3298 -0.6102 -2.7246 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1688 1.1451 -2.6864 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6407 1.9553 0.0257 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9679 0.3925 -1.0887 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4207 3.2314 -0.0719 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0428 2.6427 1.6283 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5854 2.4591 1.6717 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9472 0.3991 3.4726 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4200 1.3923 3.7158 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8488 3.2586 3.2852 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6159 1.4951 2.1636 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5649 1.0366 -0.1303 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7356 -1.5109 0.7259 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7049 -1.4916 0.2517 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6153 -2.0327 2.6019 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5717 -2.4265 2.5623 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7589 -2.6385 3.9293 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7787 -4.2763 2.7761 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0384 -3.5935 -0.0666 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6251 -2.1205 -0.5579 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1710 -3.7466 -1.8256 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7519 -3.5894 -4.3955 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2117 -0.6286 -4.0645 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9570 -1.9706 -3.6988 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1042 0.5642 -3.3212 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0163 -1.0485 -5.8176 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7714 -2.9937 -4.7926 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9605 -4.6047 -2.8264 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0066 2.1038 -0.0778 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1996 0.7816 -0.1574 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6043 0.7422 1.9386 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.1546 1.0511 3.6390 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2332 3.6566 2.4316 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.9685 2.8871 4.3357 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4372 4.5747 3.7243 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3955 4.0053 5.7582 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8869 1.2204 4.8180 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2865 -0.9828 2.7257 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6324 2.6239 0.7394 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3159 2.2955 -1.7931 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5384 1.3355 -2.9939 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3782 -4.5024 -2.9603 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0699 -3.9599 -2.0297 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8597 -5.4770 -1.5641 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4133 -2.5213 -2.4742 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1113 -2.2864 -2.0463 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3386 -1.2554 -3.2813 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0116 -0.7600 -2.3472 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7598 -2.2119 -1.2654 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4255 -1.7052 -2.2778 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7174 -2.2015 1.3333 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5185 -1.8389 1.2263 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3628 -0.8258 2.2392 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5704 0.0884 2.2042 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1002 1.6215 3.0334 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 2 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 29 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 39 41 1 0 41 42 1 0 38 43 1 0 37 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 49 51 1 0 48 52 1 0 47 53 1 0 46 54 1 0 36 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 60 62 1 0 62 63 1 0 59 64 1 0 58 65 1 0 57 66 1 0 28 67 1 0 27 68 1 0 21 69 1 0 69 70 1 0 70 71 2 0 70 72 1 0 20 73 1 6 12 74 1 6 6 75 1 0 5 76 1 1 76 77 1 0 77 2 1 0 9 5 1 0 61 56 1 0 12 7 1 0 16 11 1 0 20 15 1 0 24 19 1 0 31 26 1 0 40 35 1 0 50 45 1 0 1 78 1 0 1 79 1 0 1 80 1 0 2 81 1 6 3 82 1 0 3 83 1 0 4 84 1 0 4 85 1 0 6 86 1 6 7 87 1 1 8 88 1 1 10 89 1 0 10 90 1 0 11 91 1 1 13 92 1 0 13 93 1 0 14 94 1 0 14 95 1 0 15 96 1 1 16 97 1 6 17 98 1 0 17 99 1 0 18100 1 0 21101 1 1 22102 1 0 22103 1 0 23104 1 1 24105 1 0 24106 1 0 26107 1 1 27108 1 6 28109 1 1 29110 1 1 30111 1 1 32112 1 0 32113 1 0 33114 1 0 35115 1 1 36116 1 6 37117 1 1 38118 1 6 39119 1 1 41120 1 0 41121 1 0 42122 1 0 43123 1 0 45124 1 1 46125 1 1 47126 1 6 48127 1 6 49128 1 1 51129 1 0 52130 1 0 53131 1 0 54132 1 0 56133 1 6 57134 1 6 58135 1 6 59136 1 1 60137 1 6 62138 1 0 62139 1 0 63140 1 0 64141 1 0 65142 1 0 66143 1 0 67144 1 0 68145 1 0 72146 1 0 72147 1 0 72148 1 0 73149 1 0 73150 1 0 73151 1 0 74152 1 0 74153 1 0 74154 1 0 75155 1 0 75156 1 0 75157 1 0 77158 1 0 77159 1 0 M END

Standard InCHIKey	GYXRRPJFAZJWMW-DNBYBFJXSA-N
Standard InCHI	InChI=1S/C52H82O25/c1-19-8-11-52(67-18-19)20(2)32-27(77-52)14-26-24-7-6-22-12-23(13-31(68-21(3)56)51(22,5)25(24)9-10-50(26,32)4)69-46-41(65)37(61)42(30(17-55)72-46)73-49-44(75-47-39(63)35(59)33(57)28(15-53)70-47)43(34(58)29(16-54)71-49)74-48-40(64)36(60)38(62)45(66)76-48/h6,19-20,23-49,53-55,57-66H,7-18H2,1-5H3/t19-,20-,23+,24+,25-,26-,27-,28+,29+,30+,31+,32-,33+,34+,35-,36+,37+,38+,39+,40-,41+,42-,43-,44+,45+,46+,47-,48-,49-,50-,51-,52+/m0/s1
SMILES	C[C@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5([C@@H](C[C@@H](C6)O[C@H]7[C@@H]([C@H]([C@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O[C@@H]9[C@H]([C@@H]([C@H]([C@@H](O9)O)O)O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O)OC(=O)C)C)C)C)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1106.51	Volume:	1036.866 ? Van der Waals volume.
Dense:	1.067	LogP:	0.143 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.18 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.463 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	13.0	Rigid Bonds:	55.0
TPSA:	381.59 ? Topological Polar Surface Area.	H-Bond Acceptor:	25.0
H-Bond Donor:	13.0	Rings:	10.0
Heavy Atoms:	25.0

MedChem Properties

QED Drug-Likeness Score:	0.067	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.406	Fsp³:	0.942
MCE-18:	266.832 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.747	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.334	Promiscuous compounds:	0.193

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.718	MDCK Permeability:	-5.001
Pgp-inhibitor:	0.0	Pgp-substrate:	0.987
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.924
20% Bioavailability (F20%):	0.529	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.192
Plasma Protein Binding (PPB):	57.236%	Volume Distribution (VD):	-0.505
Fu:	32.755% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.422	CYP3A4-substrate:	0.055
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.011
HLM stability:	0.003 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.213

Half-life (T1/2):

3.109

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.623	Drug-induced Liver Injury (DILI):	0.997
AMES Toxicity:	0.999	Rat Oral Acute Toxicity:	0.001
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.284	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.75	Drug-induced Nephrotoxicity:	1.0
Genotoxicity:	0.586	RPMI-8226 Immunitoxicity:	0.518
A549 Cytotoxicity:	0.999	Hek293 Cytotoxicity:	0.941
BCF:	0.684 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.216 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.522 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.644 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	rhizomes	Kangwon Province of Korea	2002-MAY	PMID[16562835]
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO9935	Polygonatum sibiricum	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT83	Cell line	MCF7	Homo sapiens	IC50	=	71400	nM	PMID[16562835]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC477807 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	23928
0.1-0.2	22449
0.2-0.3	2865
0.3-0.4	416
0.4-0.5	105
0.5-0.6	71
0.6-0.7	18
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8198	Intermediate Similarity	NPC477811
0.7563	Intermediate Similarity	NPC477808
0.6777	Remote Similarity	NPC31896
0.6638	Remote Similarity	NPC300557
0.6535	Remote Similarity	NPC210569
0.6466	Remote Similarity	NPC602423
0.641	Remote Similarity	NPC477809
0.6387	Remote Similarity	NPC97700
0.6387	Remote Similarity	NPC184617
0.6387	Remote Similarity	NPC30856
0.6385	Remote Similarity	NPC305771
0.6385	Remote Similarity	NPC94072
0.6385	Remote Similarity	NPC169816
0.6179	Remote Similarity	NPC63609
0.6174	Remote Similarity	NPC470432
0.6174	Remote Similarity	NPC230507
0.616	Remote Similarity	NPC132080
0.6154	Remote Similarity	NPC15918
0.6098	Remote Similarity	NPC309278
0.6015	Remote Similarity	NPC263359
0.5965	Remote Similarity	NPC206003
0.5965	Remote Similarity	NPC473610
0.595	Remote Similarity	NPC6806
0.5946	Remote Similarity	NPC181845
0.5935	Remote Similarity	NPC115165
0.592	Remote Similarity	NPC232037
0.5873	Remote Similarity	NPC470864
0.584	Remote Similarity	NPC473518
0.584	Remote Similarity	NPC116756
0.5827	Remote Similarity	NPC476112
0.5827	Remote Similarity	NPC83137
0.5827	Remote Similarity	NPC307534
0.5781	Remote Similarity	NPC233433
0.5778	Remote Similarity	NPC244431
0.5772	Remote Similarity	NPC480555
0.5772	Remote Similarity	NPC150372
0.5752	Remote Similarity	NPC325828
0.575	Remote Similarity	NPC475351
0.5659	Remote Similarity	NPC480553
0.5649	Remote Similarity	NPC470866
0.5635	Remote Similarity	NPC269297
0.5635	Remote Similarity	NPC222202
0.5635	Remote Similarity	NPC475550
0.5597	Remote Similarity	NPC220836
0.5565	Remote Similarity	NPC249553
0.5556	Remote Similarity	NPC79900
0.5546	Remote Similarity	NPC107962
0.5537	Remote Similarity	NPC14704
0.5528	Remote Similarity	NPC470433
0.5528	Remote Similarity	NPC46190
0.5528	Remote Similarity	NPC171073
0.5504	Remote Similarity	NPC480554
0.55	Remote Similarity	NPC481190
0.5462	Remote Similarity	NPC470862
0.5447	Remote Similarity	NPC473601
0.5426	Remote Similarity	NPC232611
0.541	Remote Similarity	NPC113044
0.541	Remote Similarity	NPC283829
0.541	Remote Similarity	NPC161676
0.5407	Remote Similarity	NPC224314
0.5373	Remote Similarity	NPC94086
0.5373	Remote Similarity	NPC473817
0.5372	Remote Similarity	NPC125324
0.5349	Remote Similarity	NPC475333
0.5349	Remote Similarity	NPC32361
0.5349	Remote Similarity	NPC224098
0.5349	Remote Similarity	NPC208383
0.5333	Remote Similarity	NPC480556
0.5308	Remote Similarity	NPC194207
0.5308	Remote Similarity	NPC22779
0.5245	Remote Similarity	NPC330026
0.5234	Remote Similarity	NPC294129
0.5231	Remote Similarity	NPC475625
0.5224	Remote Similarity	NPC167183
0.5221	Remote Similarity	NPC248202
0.521	Remote Similarity	NPC250393
0.5197	Remote Similarity	NPC51172
0.5197	Remote Similarity	NPC49032
0.5197	Remote Similarity	NPC182900
0.5194	Remote Similarity	NPC475319
0.5188	Remote Similarity	NPC256983
0.5124	Remote Similarity	NPC306131
0.5124	Remote Similarity	NPC200802
0.5124	Remote Similarity	NPC107188
0.5118	Remote Similarity	NPC248746
0.5111	Remote Similarity	NPC232054
0.5081	Remote Similarity	NPC70204
0.5074	Remote Similarity	NPC470867
0.5072	Remote Similarity	NPC473505
0.5071	Remote Similarity	NPC32707
0.5042	Remote Similarity	NPC234352

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC477807 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7677
0.1-0.2	1411
0.2-0.3	55
0.3-0.4	4
0.4-0.5	1
0.5-0.6	2
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5752	Remote Similarity	NPD8171	Phase 2
0.5246	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data