NPASS Compound

Natural Product: NPC475351

Natural Product ID	NPC475351
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	ZAZNQYAHJWQLHA-GPFJITKXSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL503965
PubChem CID	10819453
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 133141 0 0 0 0 0 0 0 0999 V2000 12.2914 -2.8226 0.2562 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6334 -1.4586 0.3443 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7034 -1.4411 1.5163 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3811 -0.7687 1.2263 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7062 -1.3080 -0.0196 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9939 -0.1102 -0.7041 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8430 -0.1088 0.1393 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4617 -1.6025 0.0804 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6741 -2.1487 0.3914 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4228 -1.5702 1.1467 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7797 -0.1963 1.0678 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6027 0.6113 0.0751 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9818 0.8874 -1.2267 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5084 0.6001 -1.3727 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8706 0.9331 -0.0730 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3260 -0.1916 0.8733 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7256 -1.5075 0.4040 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3260 -1.3350 -0.1429 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6840 -0.1421 0.4337 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4014 1.1049 -0.0629 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9715 2.1791 0.9340 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4932 2.4119 0.8364 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3675 1.2196 0.7427 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7592 0.0399 0.0129 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5183 1.5805 0.0681 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6766 1.3239 0.7759 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7094 0.5572 0.0077 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0156 1.2978 -0.1395 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4150 2.0574 1.0758 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2872 2.3560 2.0367 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1684 2.5607 1.2219 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6044 3.5938 2.8022 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7117 3.4354 3.6305 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9222 3.3349 0.7235 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9716 0.5277 -0.7377 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4185 0.9207 -1.9526 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9107 1.1571 -1.8677 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3224 1.8342 -3.1412 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6856 1.3076 -4.3788 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4635 0.4831 -4.1995 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2982 -0.0849 -2.9477 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2937 2.4443 -5.1339 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1346 3.2099 -2.9722 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2395 2.0213 -0.8187 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9406 -0.6491 0.6590 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5854 -1.7546 -0.0666 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6722 -2.7898 -0.2222 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3157 -2.9858 1.1344 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2576 -3.3102 2.1378 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0190 -2.4630 1.9857 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5596 -2.3987 0.6747 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9577 -3.0474 2.8969 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8269 -2.2218 2.8315 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7776 -3.0657 3.4114 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1935 -4.0649 1.0126 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5966 -2.5135 -1.1945 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9135 1.5208 -1.4078 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8689 1.9868 0.7231 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9236 -0.4567 -2.1298 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6365 -1.8969 -0.8255 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8402 -1.2461 -0.9102 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5112 -3.5972 0.3504 H 0 0 0 0 0 0 0 0 0 0 0 0 12.8247 -2.8735 -0.7225 H 0 0 0 0 0 0 0 0 0 0 0 0 12.9735 -2.9371 1.1217 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3975 -0.6507 0.3872 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5515 -2.4378 1.9792 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1842 -0.8210 2.3206 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4962 0.3359 1.1919 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7453 -0.9802 2.1305 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6206 0.7793 -0.5691 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2149 -0.0171 1.2127 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0705 -1.8908 -0.9114 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6827 -2.3866 1.0804 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9493 -1.7552 2.1194 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9690 0.2470 2.0968 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4489 0.3598 -2.1041 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0930 1.9737 -1.5383 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1398 1.1767 -2.2453 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4221 -0.4622 -1.6700 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3285 1.8736 0.3008 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7529 0.0395 1.8258 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3127 -2.0127 -0.3747 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6117 -2.1582 1.3221 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2715 -1.3796 -1.2511 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6949 -2.2247 0.1774 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7024 -0.1667 1.5356 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4865 3.1410 0.7591 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1907 1.7557 1.9370 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7895 2.9689 1.7788 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7398 3.1809 0.0403 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5794 0.8272 1.7732 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3037 -0.8678 0.3459 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8904 0.0856 -1.0873 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3840 0.8094 1.7104 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2710 0.2972 -0.9750 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8089 2.1116 -0.9124 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2281 1.5879 1.6582 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0344 1.4907 2.6779 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7291 4.4800 2.1470 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7454 3.8402 3.4898 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2438 4.2668 3.5787 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6127 3.5768 -0.1750 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9764 1.8642 -2.3345 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4611 0.1961 -1.7086 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4360 1.6942 -3.2573 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4097 0.7793 -5.0361 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5149 1.0642 -4.4075 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4554 -0.3289 -4.9514 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6937 3.0275 -4.5803 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9766 3.4773 -2.0447 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7022 1.5317 -0.0837 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1935 -1.5158 -1.0771 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1844 -3.7743 -0.4809 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9261 -2.1015 1.4122 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0181 -4.4024 2.1045 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2601 -1.4582 2.4061 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7286 -4.0839 2.6178 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2948 -3.0408 3.9542 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0235 -1.4198 3.3982 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7407 -2.8289 3.3846 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8344 -3.9958 1.7607 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1447 -2.4878 -2.0724 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8791 0.6548 -2.1320 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1161 1.9327 -1.4186 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5566 2.3511 -1.7765 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3321 2.0610 1.7140 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9250 2.1533 0.9484 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5423 2.8166 0.0685 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2028 -1.2265 -2.4378 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8889 0.4433 -2.8169 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9183 -0.9158 -2.4261 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3961 -1.7226 -1.7685 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7813 -0.1687 -1.1657 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 8 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 30 32 1 0 32 33 1 0 29 34 1 0 28 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 39 42 1 0 38 43 1 0 37 44 1 0 27 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 50 52 1 0 52 53 1 0 49 54 1 0 48 55 1 0 47 56 1 0 20 57 1 0 12 58 1 0 6 59 1 0 5 60 1 0 60 61 1 0 61 2 1 0 9 5 1 0 12 7 1 0 16 11 1 0 20 15 1 0 24 19 1 0 31 26 1 0 41 36 1 0 51 46 1 0 1 62 1 0 1 63 1 0 1 64 1 0 2 65 1 0 3 66 1 0 3 67 1 0 4 68 1 0 4 69 1 0 6 70 1 0 7 71 1 0 8 72 1 0 10 73 1 0 10 74 1 0 11 75 1 0 13 76 1 0 13 77 1 0 14 78 1 0 14 79 1 0 15 80 1 0 16 81 1 0 17 82 1 0 17 83 1 0 18 84 1 0 18 85 1 0 19 86 1 0 21 87 1 0 21 88 1 0 22 89 1 0 22 90 1 0 23 91 1 0 24 92 1 0 24 93 1 0 26 94 1 0 27 95 1 0 28 96 1 0 29 97 1 0 30 98 1 0 32 99 1 0 32100 1 0 33101 1 0 34102 1 0 36103 1 0 37104 1 0 38105 1 0 39106 1 0 40107 1 0 40108 1 0 42109 1 0 43110 1 0 44111 1 0 46112 1 0 47113 1 0 48114 1 0 49115 1 0 50116 1 0 52117 1 0 52118 1 0 53119 1 0 54120 1 0 55121 1 0 56122 1 0 57123 1 0 57124 1 0 57125 1 0 58126 1 0 58127 1 0 58128 1 0 59129 1 0 59130 1 0 59131 1 0 61132 1 0 61133 1 0 M END

Standard InCHIKey	ZAZNQYAHJWQLHA-GPFJITKXSA-N
Standard InCHI	InChI=1S/C44H72O17/c1-19-7-12-44(55-17-19)20(2)30-27(61-44)14-25-23-6-5-21-13-22(8-10-42(21,3)24(23)9-11-43(25,30)4)56-41-38(60-40-36(53)34(51)32(49)28(15-45)57-40)37(33(50)29(16-46)58-41)59-39-35(52)31(48)26(47)18-54-39/h19-41,45-53H,5-18H2,1-4H3/t19?,20-,21+,22-,23+,24-,25-,26+,27-,28+,29+,30-,31-,32+,33-,34-,35+,36+,37-,38+,39-,40-,41+,42-,43-,44+/m0/s1
SMILES	CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)C)C)C)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	872.48	Volume:	842.006 ? Van der Waals volume.
Dense:	1.036	LogP:	0.87 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.852 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.939 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	8.0	Rigid Bonds:	48.0
TPSA:	255.91 ? Topological Polar Surface Area.	H-Bond Acceptor:	17.0
H-Bond Donor:	9.0	Rings:	9.0
Heavy Atoms:	17.0

MedChem Properties

QED Drug-Likeness Score:	0.145	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.649	Fsp³:	1.0
MCE-18:	227.955 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.003	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.066 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.208 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.392	Promiscuous compounds:	0.004

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.603	MDCK Permeability:	-4.809
Pgp-inhibitor:	0.0	Pgp-substrate:	0.696
PAMPA:	0.999 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.899
20% Bioavailability (F20%):	0.038	30% Bioavailability (F30%):	0.946
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.128	MRP1:	1.0
Plasma Protein Binding (PPB):	49.343%	Volume Distribution (VD):	-0.461
Fu:	38.244% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.044	BCRP inhibitor:	0.001
BSEP inhibitor:	0.292

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	1.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	1.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.058	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.001	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.153

Half-life (T1/2):

3.371

ADMET: Toxicity

hERG Blockers:	0.083	hERG Blockers (10um):	0.612
Human Hepatotoxicity (H-HT):	0.566	Drug-induced Liver Injury (DILI):	0.179
AMES Toxicity:	0.308	Rat Oral Acute Toxicity:	0.084
Maximum Recommended Daily Dose:	0.353	Skin Sensitization:	0.011
Carcinogencity:	0.071	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.004
Drug-induced Neurotoxicity:	0.313	Ototoxicity:	1.0
Hematotoxicity:	0.005	Drug-induced Nephrotoxicity:	0.008
Genotoxicity:	0.0	RPMI-8226 Immunitoxicity:	0.091
A549 Cytotoxicity:	0.046	Hek293 Cytotoxicity:	0.836
BCF:	1.592 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.229 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.937 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.771 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10757713]
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	bark	n.a.	n.a.	PMID[15165156]
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	6

Activity Type	# Activity
Organism	6

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	MIC	=	25.0	ug.mL-1	PubChem BioAssay data set
NPT20	Organism	Candida albicans	Candida albicans	MIC	>	100.0	ug.mL-1	PMID[20585134]
NPT772	Organism	Pichia anomala	Wickerhamomyces anomalus	MIC	=	3.13	ug.mL-1	DOI[10.6019/CHEMBL1201861]
NPT5427	Organism	Hanseniaspora uvarum	Hanseniaspora uvarum	MIC	>	100.0	ug.mL-1	PMID[25946116]
NPT5425	Organism	Pichia nakazawae	Pichia nakazawae	MIC	=	12.5	ug.mL-1	PMID[26560048]
NPT5426	Organism	Debaryomyces hansenii	Debaryomyces hansenii	MIC	=	50.0	ug.mL-1	PMID[11325222]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC475351 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	27819
0.1-0.2	18843
0.2-0.3	2545
0.3-0.4	399
0.4-0.5	105
0.5-0.6	68
0.6-0.7	32
0.7-0.8	1
0.8-0.85	5
0.85-0.9	2
0.9-0.95	4
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9176	High Similarity	NPC206003
0.9176	High Similarity	NPC473610
0.913	High Similarity	NPC97700
0.913	High Similarity	NPC30856
0.871	High Similarity	NPC51172
0.871	High Similarity	NPC49032
0.8485	Intermediate Similarity	NPC132080
0.8438	Intermediate Similarity	NPC475319
0.8387	Intermediate Similarity	NPC473601
0.8265	Intermediate Similarity	NPC116756
0.8182	Intermediate Similarity	NPC232037
0.7957	Intermediate Similarity	NPC125324
0.7879	Intermediate Similarity	NPC115165
0.7857	Intermediate Similarity	NPC128572
0.7778	Intermediate Similarity	NPC184617
0.7767	Intermediate Similarity	NPC233433
0.7714	Intermediate Similarity	NPC470866
0.7609	Intermediate Similarity	NPC250393
0.7473	Intermediate Similarity	NPC297348
0.7473	Intermediate Similarity	NPC249204
0.7473	Intermediate Similarity	NPC48339
0.7473	Intermediate Similarity	NPC141769
0.7473	Intermediate Similarity	NPC477547
0.7423	Intermediate Similarity	NPC160426
0.7404	Intermediate Similarity	NPC108072
0.7327	Intermediate Similarity	NPC151134
0.7283	Intermediate Similarity	NPC325828
0.7273	Intermediate Similarity	NPC220836
0.7263	Intermediate Similarity	NPC211354
0.7263	Intermediate Similarity	NPC107188
0.7238	Intermediate Similarity	NPC470864
0.7216	Intermediate Similarity	NPC6295
0.7212	Intermediate Similarity	NPC475625
0.7212	Intermediate Similarity	NPC473518
0.7204	Intermediate Similarity	NPC234352
0.717	Intermediate Similarity	NPC476112
0.717	Intermediate Similarity	NPC307534
0.7143	Intermediate Similarity	NPC232611
0.7128	Intermediate Similarity	NPC477451
0.7097	Intermediate Similarity	NPC177834
0.7059	Intermediate Similarity	NPC471464
0.7059	Intermediate Similarity	NPC300557
0.7	Intermediate Similarity	NPC94086
0.7	Intermediate Similarity	NPC473817
0.6939	Remote Similarity	NPC107962
0.6907	Remote Similarity	NPC19400
0.6881	Remote Similarity	NPC31896
0.6863	Remote Similarity	NPC602423
0.6852	Remote Similarity	NPC83137
0.6837	Remote Similarity	NPC264101
0.6803	Remote Similarity	NPC481189
0.6762	Remote Similarity	NPC98018
0.6762	Remote Similarity	NPC284104
0.6762	Remote Similarity	NPC103616
0.6699	Remote Similarity	NPC475643
0.6694	Remote Similarity	NPC329807
0.6574	Remote Similarity	NPC309278
0.648	Remote Similarity	NPC329727
0.6466	Remote Similarity	NPC210569
0.6446	Remote Similarity	NPC330026
0.6339	Remote Similarity	NPC84111
0.6339	Remote Similarity	NPC287483
0.6339	Remote Similarity	NPC470865
0.625	Remote Similarity	NPC470862
0.6195	Remote Similarity	NPC477811
0.6186	Remote Similarity	NPC485594
0.6174	Remote Similarity	NPC262050
0.6162	Remote Similarity	NPC294686
0.6126	Remote Similarity	NPC475333
0.6126	Remote Similarity	NPC224098
0.6126	Remote Similarity	NPC208383
0.6102	Remote Similarity	NPC477808
0.6063	Remote Similarity	NPC329820
0.6058	Remote Similarity	NPC485595
0.6017	Remote Similarity	NPC473505
0.6	Remote Similarity	NPC195297
0.5981	Remote Similarity	NPC202898
0.5968	Remote Similarity	NPC481190
0.5962	Remote Similarity	NPC215408
0.5932	Remote Similarity	NPC480556
0.5913	Remote Similarity	NPC92297
0.5902	Remote Similarity	NPC305771
0.5902	Remote Similarity	NPC263359
0.5902	Remote Similarity	NPC94072
0.5902	Remote Similarity	NPC169816
0.5893	Remote Similarity	NPC470863
0.5882	Remote Similarity	NPC222731
0.5872	Remote Similarity	NPC92890
0.5856	Remote Similarity	NPC294129
0.5818	Remote Similarity	NPC274200
0.5816	Remote Similarity	NPC24960
0.5812	Remote Similarity	NPC232054
0.5804	Remote Similarity	NPC51520
0.5804	Remote Similarity	NPC303069
0.58	Remote Similarity	NPC181845
0.5766	Remote Similarity	NPC480555
0.5766	Remote Similarity	NPC150372
0.575	Remote Similarity	NPC477807
0.5739	Remote Similarity	NPC218571
0.5739	Remote Similarity	NPC487615
0.5714	Remote Similarity	NPC481418
0.5656	Remote Similarity	NPC15918
0.5648	Remote Similarity	NPC113044
0.5648	Remote Similarity	NPC283829
0.5648	Remote Similarity	NPC161676
0.5645	Remote Similarity	NPC244431
0.563	Remote Similarity	NPC470867
0.5577	Remote Similarity	NPC474399
0.5574	Remote Similarity	NPC273002
0.5534	Remote Similarity	NPC291203
0.5534	Remote Similarity	NPC217205
0.5528	Remote Similarity	NPC79900
0.551	Remote Similarity	NPC277715
0.5508	Remote Similarity	NPC480553
0.5495	Remote Similarity	NPC470433
0.5495	Remote Similarity	NPC46190
0.5495	Remote Similarity	NPC171073
0.5446	Remote Similarity	NPC477809
0.5408	Remote Similarity	NPC88962
0.5385	Remote Similarity	NPC194207
0.5385	Remote Similarity	NPC22779
0.5364	Remote Similarity	NPC14704
0.5339	Remote Similarity	NPC480554
0.5327	Remote Similarity	NPC54619
0.5321	Remote Similarity	NPC470432
0.5321	Remote Similarity	NPC230507
0.5304	Remote Similarity	NPC102016
0.5304	Remote Similarity	NPC95051
0.5273	Remote Similarity	NPC141433
0.5263	Remote Similarity	NPC6806
0.5248	Remote Similarity	NPC473774
0.5248	Remote Similarity	NPC481419
0.5248	Remote Similarity	NPC481417
0.5234	Remote Similarity	NPC128123
0.5214	Remote Similarity	NPC269297
0.5214	Remote Similarity	NPC222202
0.5172	Remote Similarity	NPC475247
0.5164	Remote Similarity	NPC167183
0.5135	Remote Similarity	NPC70204
0.5093	Remote Similarity	NPC121453
0.5088	Remote Similarity	NPC485603
0.5044	Remote Similarity	NPC485605
0.5043	Remote Similarity	NPC248746
0.5042	Remote Similarity	NPC470861

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC475351 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7803
0.1-0.2	1266
0.2-0.3	69
0.3-0.4	6
0.4-0.5	4
0.5-0.6	0
0.6-0.7	1
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7283	Intermediate Similarity	NPD8171	Phase 2
0.6214	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data