NPASS Compound

Natural Product: NPC277715

Natural Product ID	NPC277715
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	DQGDIBFTBNPWKO-YPOSEEEYSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	15108421
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 96102 0 0 0 0 0 0 0 0999 V2000 8.5718 3.4531 0.1231 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4998 2.4940 0.5435 C 0 0 2 0 0 0 0 0 0 0 0 0 6.8416 1.9283 -0.6742 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3826 2.3520 -0.6556 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7528 1.8508 0.6232 C 0 0 2 0 0 0 0 0 0 0 0 0 4.6716 0.3228 0.5181 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6986 -0.3072 1.4689 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3241 0.0524 1.0900 C 0 0 1 0 0 0 0 0 0 0 0 0 2.7011 1.4094 1.3999 C 0 0 2 0 0 0 0 0 0 0 0 0 1.2462 1.3120 0.9487 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0413 -0.1527 0.8410 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.1629 -0.6049 0.1062 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.3758 -0.2680 0.9515 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6231 -0.7701 0.2018 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5361 -2.2736 0.2887 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8007 -2.9291 -0.1554 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7343 -4.4175 0.1090 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.3590 -4.7821 0.5661 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2544 -4.2405 -0.3054 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3289 -2.7438 -0.4907 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.4471 -2.4144 -1.9631 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0941 -2.1381 0.0731 C 0 0 1 0 0 0 0 0 0 0 0 0 1.1586 -2.5391 -0.6605 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3773 -2.0564 0.0960 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3456 -0.5723 0.1472 C 0 0 2 0 0 0 0 0 0 0 0 0 2.4459 0.0052 -1.2377 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0308 -5.1227 -1.0329 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7569 -0.2352 0.7725 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5043 0.5579 -0.1297 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8833 0.0125 -0.2311 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9779 1.0102 -0.3880 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6545 2.4015 0.0464 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2171 2.6707 -0.3971 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.8827 4.1371 -0.2520 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5731 4.3512 -0.6156 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4267 1.8513 0.3915 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.4644 3.2954 -0.6463 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1079 0.6059 0.3613 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9215 -0.8054 -1.3858 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4402 2.2878 0.6497 O 0 0 0 0 0 0 0 0 0 0 0 0 5.4753 2.2394 1.7430 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4648 3.1576 1.4549 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3147 3.9590 -0.8511 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4895 2.8491 -0.1230 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8551 4.1855 0.8840 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9604 1.6894 1.1739 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8624 0.8369 -0.7474 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3102 2.3212 -1.6061 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3140 3.4633 -0.7273 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8808 1.8888 -1.5156 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8405 -0.0327 -0.4966 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1966 -1.0731 2.1299 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4840 -0.8484 0.9235 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0850 0.4633 2.1702 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3529 -0.5690 2.0145 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7431 1.6354 2.4824 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5872 1.7917 1.7265 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0624 1.8546 0.0098 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0498 -0.6183 1.8383 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2726 -0.1969 -0.9069 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4521 0.8052 1.1814 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3118 -0.9006 1.8644 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5754 -0.4576 -0.8614 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3593 -2.5677 1.3453 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6319 -2.5117 0.4459 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0221 -2.7741 -1.2272 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4377 -4.7051 0.9175 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2835 -5.9062 0.4801 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1669 -4.5749 1.6391 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3341 -4.7504 -1.2978 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2968 -4.5587 0.1925 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4299 -2.0050 -2.2414 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6936 -1.6634 -2.2848 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2299 -3.3324 -2.5464 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0123 -2.4586 1.1292 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2410 -3.6210 -0.7546 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2021 -2.1187 -1.6870 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4957 -2.5419 1.0706 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2642 -2.3526 -0.5297 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5351 -0.1145 -1.8431 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2890 -0.4734 -1.7430 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6312 1.1181 -1.2035 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8937 -4.9050 -1.4399 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9647 0.5282 -1.0926 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1322 -0.6535 0.6365 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3437 1.0737 -1.4481 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7719 2.5490 1.1266 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1406 2.3327 -1.4443 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5353 4.6809 -0.9699 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0119 4.4459 0.7891 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0936 4.8869 0.0578 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5012 3.0771 -1.6119 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7180 0.0517 -0.1894 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8524 -1.0911 -1.4901 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0991 4.1081 1.0468 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9771 3.3954 2.4143 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 17 27 1 0 14 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 33 36 1 0 32 37 1 0 31 38 1 0 30 39 1 0 9 40 1 0 5 41 1 1 41 42 1 0 42 2 1 0 40 5 1 0 25 8 1 0 36 29 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 43 1 0 1 44 1 0 1 45 1 0 2 46 1 1 3 47 1 0 3 48 1 0 4 49 1 0 4 50 1 0 6 51 1 6 7 52 1 0 7 53 1 0 7 54 1 0 8 55 1 1 9 56 1 1 10 57 1 0 10 58 1 0 11 59 1 1 12 60 1 6 13 61 1 0 13 62 1 0 14 63 1 6 15 64 1 1 16 65 1 0 16 66 1 0 17 67 1 1 18 68 1 0 18 69 1 0 19 70 1 0 19 71 1 0 21 72 1 0 21 73 1 0 21 74 1 0 22 75 1 1 23 76 1 0 23 77 1 0 24 78 1 0 24 79 1 0 26 80 1 0 26 81 1 0 26 82 1 0 27 83 1 0 29 84 1 6 30 85 1 1 31 86 1 6 32 87 1 1 33 88 1 6 34 89 1 0 34 90 1 0 35 91 1 0 37 92 1 0 38 93 1 0 39 94 1 0 42 95 1 0 42 96 1 0 M END

Standard InCHIKey	DQGDIBFTBNPWKO-YPOSEEEYSA-N
Standard InCHI	InChI=1S/C33H54O9/c1-16-5-10-33(39-15-16)17(2)26-24(42-33)13-21-19-12-23(40-30-29(38)28(37)27(36)25(14-34)41-30)22-11-18(35)6-8-31(22,3)20(19)7-9-32(21,26)4/h16-30,34-38H,5-15H2,1-4H3/t16-,17+,18+,19-,20+,21+,22-,23+,24+,25-,26+,27-,28+,29-,30-,31-,32+,33-/m1/s1
SMILES	C[C@@H]1CC[C@@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5C[C@@H]([C@H]6C[C@H](CC[C@]6(C)[C@H]5CC[C@]34C)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O2)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	594.38	Volume:	598.541 ? Van der Waals volume.
Dense:	0.993	LogP:	3.112 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.494 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.689 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	3.0	Rigid Bonds:	36.0
TPSA:	138.07 ? Topological Polar Surface Area.	H-Bond Acceptor:	9.0
H-Bond Donor:	5.0	Rings:	7.0
Heavy Atoms:	9.0

MedChem Properties

QED Drug-Likeness Score:	0.312	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.878	Fsp³:	1.0
MCE-18:	173.182 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.746	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.048 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.208	Promiscuous compounds:	0.021

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.642	MDCK Permeability:	-5.165
Pgp-inhibitor:	0.027	Pgp-substrate:	0.443
PAMPA:	0.821 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.001
20% Bioavailability (F20%):	0.059	30% Bioavailability (F30%):	0.583
50% Bioavailability (F50%):	0.986

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.028	MRP1:	0.039
Plasma Protein Binding (PPB):	62.435%	Volume Distribution (VD):	-0.423
Fu:	33.974% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.739
BSEP inhibitor:	0.676

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.066
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.995
HLM stability:	0.082 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.098

Half-life (T1/2):

2.681

ADMET: Toxicity

hERG Blockers:	0.053	hERG Blockers (10um):	0.086
Human Hepatotoxicity (H-HT):	0.641	Drug-induced Liver Injury (DILI):	0.884
AMES Toxicity:	0.742	Rat Oral Acute Toxicity:	0.03
Maximum Recommended Daily Dose:	0.16	Skin Sensitization:	1.0
Carcinogencity:	0.446	Eye Corrosion:	0.0
Eye Irritation:	0.086	Respiratory Toxicity:	0.02
Drug-induced Neurotoxicity:	0.006	Ototoxicity:	0.971
Hematotoxicity:	0.107	Drug-induced Nephrotoxicity:	0.756
Genotoxicity:	0.007	RPMI-8226 Immunitoxicity:	0.14
A549 Cytotoxicity:	0.646	Hek293 Cytotoxicity:	0.788
BCF:	1.648 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.37 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.483 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.982 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40931	Solanum macaonense	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25036668]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2	Others	Unspecified	n.a.	IC50	>	10000.0	nM	PMID[25036668]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC277715 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25709
0.1-0.2	20767
0.2-0.3	2919
0.3-0.4	283
0.4-0.5	80
0.5-0.6	62
0.6-0.7	22
0.7-0.8	0
0.8-0.85	0
0.85-0.9	2
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8732	High Similarity	NPC144790
0.8732	High Similarity	NPC149400
0.7973	Intermediate Similarity	NPC88962
0.775	Intermediate Similarity	NPC131693
0.775	Intermediate Similarity	NPC475436
0.7595	Intermediate Similarity	NPC485594
0.7108	Intermediate Similarity	NPC485591
0.7079	Intermediate Similarity	NPC485605
0.6941	Remote Similarity	NPC312678
0.6941	Remote Similarity	NPC253268
0.6923	Remote Similarity	NPC485603
0.6914	Remote Similarity	NPC24960
0.6471	Remote Similarity	NPC181845
0.6438	Remote Similarity	NPC296734
0.6301	Remote Similarity	NPC248944
0.6301	Remote Similarity	NPC7479
0.6301	Remote Similarity	NPC257296
0.6207	Remote Similarity	NPC297348
0.6207	Remote Similarity	NPC325828
0.6207	Remote Similarity	NPC249204
0.6207	Remote Similarity	NPC48339
0.6207	Remote Similarity	NPC141769
0.6207	Remote Similarity	NPC477547
0.6136	Remote Similarity	NPC179859
0.6136	Remote Similarity	NPC294686
0.6136	Remote Similarity	NPC473851
0.6136	Remote Similarity	NPC234352
0.6	Remote Similarity	NPC473774
0.6	Remote Similarity	NPC481419
0.6	Remote Similarity	NPC481417
0.5934	Remote Similarity	NPC206003
0.5934	Remote Similarity	NPC473610
0.5889	Remote Similarity	NPC477451
0.587	Remote Similarity	NPC211354
0.587	Remote Similarity	NPC107188
0.5824	Remote Similarity	NPC222731
0.5761	Remote Similarity	NPC121453
0.5745	Remote Similarity	NPC107962
0.5684	Remote Similarity	NPC6295
0.5632	Remote Similarity	NPC481420
0.5632	Remote Similarity	NPC481421
0.5625	Remote Similarity	NPC195297
0.5567	Remote Similarity	NPC113044
0.5567	Remote Similarity	NPC283829
0.5567	Remote Similarity	NPC160426
0.5567	Remote Similarity	NPC161676
0.5545	Remote Similarity	NPC485604
0.5521	Remote Similarity	NPC485595
0.551	Remote Similarity	NPC475351
0.55	Remote Similarity	NPC477809
0.5474	Remote Similarity	NPC485590
0.5455	Remote Similarity	NPC481418
0.5455	Remote Similarity	NPC473601
0.5446	Remote Similarity	NPC300557
0.5426	Remote Similarity	NPC291547
0.5426	Remote Similarity	NPC485593
0.5426	Remote Similarity	NPC174024
0.5408	Remote Similarity	NPC14704
0.5408	Remote Similarity	NPC485599
0.5392	Remote Similarity	NPC480555
0.5392	Remote Similarity	NPC150372
0.5385	Remote Similarity	NPC273290
0.5385	Remote Similarity	NPC232044
0.5368	Remote Similarity	NPC19400
0.5361	Remote Similarity	NPC470432
0.5361	Remote Similarity	NPC230507
0.5333	Remote Similarity	NPC473518
0.5326	Remote Similarity	NPC177834
0.5319	Remote Similarity	NPC250393
0.5306	Remote Similarity	NPC141433
0.5256	Remote Similarity	NPC227260
0.5248	Remote Similarity	NPC602423
0.5243	Remote Similarity	NPC128572
0.5208	Remote Similarity	NPC306131
0.5208	Remote Similarity	NPC54619
0.5208	Remote Similarity	NPC200802
0.5192	Remote Similarity	NPC97700
0.5192	Remote Similarity	NPC184617
0.5192	Remote Similarity	NPC30856
0.5185	Remote Similarity	NPC305808
0.5185	Remote Similarity	NPC481427
0.5181	Remote Similarity	NPC235126
0.5181	Remote Similarity	NPC242419
0.5149	Remote Similarity	NPC485596
0.5143	Remote Similarity	NPC115165
0.5098	Remote Similarity	NPC470433
0.5098	Remote Similarity	NPC46190
0.5098	Remote Similarity	NPC171073
0.5054	Remote Similarity	NPC481424
0.5054	Remote Similarity	NPC481422
0.5051	Remote Similarity	NPC125324
0.505	Remote Similarity	NPC485597

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC277715 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7510
0.1-0.2	1544
0.2-0.3	88
0.3-0.4	4
0.4-0.5	1
0.5-0.6	1
0.6-0.7	2
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6301	Remote Similarity	NPD6928	Phase 2
0.6207	Remote Similarity	NPD8171	Phase 2
0.5361	Remote Similarity	NPD8170	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data