NPASS Compound

Natural Product: NPC485599

Natural Product ID	NPC485599
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	GLNYRTUWOHBTNS-YPXFQTFQSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	118712560
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 136143 0 0 0 0 0 0 0 0999 V2000 8.4987 -1.7415 1.7748 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2514 -0.8428 1.7838 C 0 0 2 0 0 0 0 0 0 0 0 0 6.7982 -0.6492 0.3742 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5881 0.2008 0.1889 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3706 -0.3621 0.7878 C 0 0 2 0 0 0 0 0 0 0 0 0 3.8609 -1.6684 0.2670 C 0 0 1 0 0 0 0 0 0 0 0 0 4.6155 -2.8990 0.5953 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4816 -1.6956 0.9133 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2795 -0.2193 1.2385 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8635 0.1203 0.7828 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2679 -1.2148 0.6613 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0609 -1.3371 0.0261 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.0244 -0.4054 0.7138 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4175 -0.7088 0.0947 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7539 -2.0770 0.6179 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2050 -2.4213 0.5955 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4062 -3.7722 1.2195 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1067 -4.3867 1.6955 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1660 -4.4500 0.5289 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8728 -3.0958 -0.0744 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.0968 -3.1212 -1.5550 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4417 -2.7903 0.2132 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4732 -3.6267 -0.5544 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9386 -3.4328 -0.0603 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3679 -2.0082 -0.0481 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6344 -1.4685 -1.4240 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9727 -4.6912 0.3161 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2814 0.2862 0.5194 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7563 1.0947 -0.5150 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.2185 1.2685 -0.3891 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.8250 2.2599 -1.3769 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9943 3.5113 -1.3612 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.5106 3.2354 -1.3143 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8054 4.5506 -1.0618 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1855 2.3819 -0.2608 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2281 4.3154 -2.4818 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0820 2.5601 -0.8640 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1313 2.3366 -1.7182 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.1379 1.3520 -1.1857 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.9428 2.0748 -0.1127 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.8021 3.0876 -0.8343 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.0877 3.5515 -2.0658 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7223 3.5569 -1.9736 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.0115 2.4538 -1.1605 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.0642 2.7555 0.7509 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.9983 0.9297 -2.1760 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9599 0.0868 -0.3743 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2288 0.4560 0.4763 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4588 -0.4166 2.1815 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7856 0.5115 2.2882 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7447 0.9234 1.3985 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3314 2.1297 1.6898 C 0 0 1 0 0 0 0 0 0 0 0 0 10.8211 2.0096 1.9409 C 0 0 1 0 0 0 0 0 0 0 0 0 11.4254 1.2181 0.8042 C 0 0 2 0 0 0 0 0 0 0 0 0 10.6489 1.5166 -0.4422 C 0 0 1 0 0 0 0 0 0 0 0 0 9.9427 2.8406 -0.4186 C 0 0 1 0 0 0 0 0 0 0 0 0 9.1153 2.9231 -1.7003 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4795 4.1454 -1.7947 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0862 3.0017 0.6548 O 0 0 0 0 0 0 0 0 0 0 0 0 11.5907 1.5867 -1.4947 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4054 -0.1505 1.1207 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3574 3.3104 1.8625 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0361 -1.5318 0.8268 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2463 -2.8002 1.8151 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1702 -1.4561 2.6090 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5450 -1.2710 2.4709 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6729 -1.6797 -0.0549 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6079 -0.2026 -0.2638 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8159 1.1781 0.7095 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4639 0.5027 -0.8845 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7639 -1.6332 -0.8491 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0686 -3.3575 -0.3167 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2587 -2.8874 1.4648 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8142 -3.6771 0.8649 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4052 -2.3550 1.7728 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3943 -0.0118 2.3155 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3263 0.7098 1.5738 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8664 0.7192 -0.1404 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2055 -1.6704 1.6850 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0972 -1.1263 -1.0480 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7789 0.6167 0.4295 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0872 -0.6028 1.7821 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3151 -0.6983 -1.0112 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4143 -2.0887 1.6980 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7120 -1.6797 1.2772 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6469 -2.3251 -0.4003 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0910 -3.7465 2.0855 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6939 -3.9094 2.5841 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3496 -5.4427 1.9683 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2348 -4.9697 0.8870 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6091 -5.1465 -0.2155 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1087 -2.7194 -1.8432 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3194 -2.5393 -2.1004 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1215 -4.1933 -1.8841 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2762 -3.0247 1.3060 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6937 -4.7190 -0.4883 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4977 -3.3692 -1.6354 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0916 -3.9035 0.9165 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6035 -3.9741 -0.7933 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1920 -2.2662 -1.9815 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6965 -1.3226 -1.9952 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1557 -0.5096 -1.4017 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3912 -4.2315 -0.4480 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4062 0.7805 -1.4969 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4052 1.7462 0.6195 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8481 1.8823 -2.4014 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2606 4.1163 -0.4700 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1869 2.8408 -2.2906 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7345 4.3997 -0.7969 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8217 5.1961 -1.9641 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2484 5.1315 -0.2382 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9726 3.9760 -3.0361 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7633 1.9377 -2.6978 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6733 0.4572 -0.7401 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5241 1.3472 0.4752 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.0722 3.9070 -0.1372 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4712 3.0580 -3.0063 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3887 4.6323 -2.2095 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.2696 1.8846 -0.3737 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8959 2.2314 1.5768 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7104 0.1199 -2.6488 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3547 -0.1089 0.5075 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0500 -1.2435 2.5418 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9293 1.1941 2.4051 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2840 0.3409 3.2853 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8770 2.5322 2.6236 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9945 1.5396 2.9106 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4918 1.4947 0.6877 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9778 0.6752 -0.7118 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6872 3.6535 -0.4404 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7561 2.7922 -2.5931 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3590 2.1131 -1.7266 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0600 4.7753 -2.2669 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3731 2.1380 -1.2221 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3727 -0.6722 0.2887 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3368 3.2873 1.9759 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 6 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 6 17 27 1 0 14 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 33 35 1 0 32 36 1 0 31 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 41 44 1 0 40 45 1 0 39 46 1 0 30 47 1 0 9 48 1 0 5 49 1 1 2 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 56 59 1 0 55 60 1 0 54 61 1 0 53 62 1 0 48 5 1 0 59 52 1 0 25 8 1 0 35 29 1 0 43 38 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 63 1 0 1 64 1 0 1 65 1 0 2 66 1 1 3 67 1 0 3 68 1 0 4 69 1 0 4 70 1 0 6 71 1 6 7 72 1 0 7 73 1 0 7 74 1 0 8 75 1 1 9 76 1 1 10 77 1 0 10 78 1 0 11 79 1 1 12 80 1 6 13 81 1 0 13 82 1 0 14 83 1 6 15 84 1 1 16 85 1 0 16 86 1 0 17 87 1 1 18 88 1 0 18 89 1 0 19 90 1 0 19 91 1 0 21 92 1 0 21 93 1 0 21 94 1 0 22 95 1 1 23 96 1 0 23 97 1 0 24 98 1 0 24 99 1 0 26100 1 0 26101 1 0 26102 1 0 27103 1 0 29104 1 6 30105 1 1 31106 1 6 32107 1 1 33108 1 6 34109 1 0 34110 1 0 34111 1 0 36112 1 0 38113 1 6 39114 1 1 40115 1 1 41116 1 1 42117 1 0 42118 1 0 44119 1 0 45120 1 0 46121 1 0 47122 1 0 49123 1 0 50124 1 0 50125 1 0 52126 1 1 53127 1 1 54128 1 6 55129 1 6 56130 1 6 57131 1 0 57132 1 0 58133 1 0 60134 1 0 61135 1 0 62136 1 0 M END

Standard InCHIKey	GLNYRTUWOHBTNS-YPXFQTFQSA-N
Standard InCHI	InChI=1S/C44H74O18/c1-18(16-56-39-36(53)34(51)33(50)29(15-45)60-39)6-11-44(55)19(2)30-28(62-44)14-24-22-13-27(25-12-21(46)7-9-42(25,4)23(22)8-10-43(24,30)5)59-41-37(54)38(31(48)20(3)58-41)61-40-35(52)32(49)26(47)17-57-40/h18-41,45-55H,6-17H2,1-5H3/t18-,19+,20-,21+,22-,23+,24+,25-,26-,27+,28+,29-,30+,31-,32+,33-,34+,35-,36-,37-,38+,39-,40+,41+,42-,43+,44-/m1/s1
SMILES	C[C@H](CC[C@@]1([C@@H](C)[C@H]2[C@H](C[C@H]3[C@@H]4C[C@@H]([C@H]5C[C@H](CC[C@]5(C)[C@H]4CC[C@]23C)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](C)O2)O)O[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O)O)O1)O)CO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	890.49	Volume:	859.352 ? Van der Waals volume.
Dense:	1.036	LogP:	1.972 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.575 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.24 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	42.0
TPSA:	287.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	11.0	Rings:	8.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.109	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.404	Fsp³:	1.0
MCE-18:	158.045 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.622	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.01 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.258	Promiscuous compounds:	0.154

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.067	MDCK Permeability:	-5.232
Pgp-inhibitor:	0.0	Pgp-substrate:	0.996
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.01
20% Bioavailability (F20%):	0.023	30% Bioavailability (F30%):	0.898
50% Bioavailability (F50%):	0.996

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.004
Plasma Protein Binding (PPB):	34.296%	Volume Distribution (VD):	-0.516
Fu:	54.145% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.199
BSEP inhibitor:	0.004

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.009
CYP3A4-inhibitor:	0.952	CYP3A4-substrate:	0.506
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.679
HLM stability:	0.3 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.036

Half-life (T1/2):

4.3

ADMET: Toxicity

hERG Blockers:	0.01	hERG Blockers (10um):	0.011
Human Hepatotoxicity (H-HT):	0.552	Drug-induced Liver Injury (DILI):	0.47
AMES Toxicity:	0.732	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.017	Skin Sensitization:	1.0
Carcinogencity:	0.024	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.206	Drug-induced Nephrotoxicity:	0.962
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.133
A549 Cytotoxicity:	0.679	Hek293 Cytotoxicity:	0.667
BCF:	1.07 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.213 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.325 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.586 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO40931	Solanum macaonense	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25036668]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Others	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2	Others	Unspecified	n.a.	IC50	>	10000.0	nM	PMID[25036668]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC485599 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	28212
0.1-0.2	18646
0.2-0.3	2641
0.3-0.4	289
0.4-0.5	19
0.5-0.6	35
0.6-0.7	8
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.7449	Intermediate Similarity	NPC485603
0.7347	Intermediate Similarity	NPC485596
0.7245	Intermediate Similarity	NPC485597
0.71	Intermediate Similarity	NPC485598
0.6632	Remote Similarity	NPC485602
0.6598	Remote Similarity	NPC312678
0.6598	Remote Similarity	NPC253268
0.6408	Remote Similarity	NPC485605
0.6364	Remote Similarity	NPC291547
0.6364	Remote Similarity	NPC485593
0.6364	Remote Similarity	NPC174024
0.6111	Remote Similarity	NPC485604
0.59	Remote Similarity	NPC131693
0.59	Remote Similarity	NPC475436
0.5876	Remote Similarity	NPC485600
0.5826	Remote Similarity	NPC84111
0.5826	Remote Similarity	NPC287483
0.5826	Remote Similarity	NPC470865
0.5743	Remote Similarity	NPC179859
0.5743	Remote Similarity	NPC473851
0.5714	Remote Similarity	NPC485601
0.5588	Remote Similarity	NPC485591
0.5577	Remote Similarity	NPC476540
0.5577	Remote Similarity	NPC476541
0.5524	Remote Similarity	NPC476538
0.5524	Remote Similarity	NPC476539
0.5517	Remote Similarity	NPC218571
0.5517	Remote Similarity	NPC487615
0.5517	Remote Similarity	NPC249265
0.5464	Remote Similarity	NPC88962
0.5437	Remote Similarity	NPC291203
0.5437	Remote Similarity	NPC217205
0.5408	Remote Similarity	NPC277715
0.5391	Remote Similarity	NPC470863
0.5351	Remote Similarity	NPC98018
0.5351	Remote Similarity	NPC284104
0.5351	Remote Similarity	NPC103616
0.5345	Remote Similarity	NPC470861
0.5327	Remote Similarity	NPC485590
0.5315	Remote Similarity	NPC98696
0.5304	Remote Similarity	NPC51520
0.5304	Remote Similarity	NPC303069
0.5086	Remote Similarity	NPC73243
0.5086	Remote Similarity	NPC244086
0.5086	Remote Similarity	NPC84956
0.5086	Remote Similarity	NPC102016
0.5086	Remote Similarity	NPC95051

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC485599 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7876
0.1-0.2	1223
0.2-0.3	46
0.3-0.4	5
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data