NPASS Compound

Natural Product: NPC88962

Natural Product ID	NPC88962
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	LIGQJHJGPOMQOW-XRNZZWTLSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL466034
PubChem CID	10951900
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 92 98 0 0 0 0 0 0 0 0999 V2000 -5.4904 -3.9463 -1.0735 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6098 -3.1740 -0.2970 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.4734 -4.0504 0.0950 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2537 -3.3218 0.6105 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9651 -2.0935 -0.1805 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.2030 -1.2147 -0.1577 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2226 -1.9114 -1.0267 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9521 0.1957 -0.4887 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3097 0.9611 0.6481 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3605 1.8096 0.4459 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0209 3.1542 0.6229 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.0986 3.9064 0.1388 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3019 3.7784 1.0569 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.6553 2.3569 1.3455 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4709 1.4288 1.3970 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8891 0.1401 1.0987 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2877 2.3195 2.6048 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3858 4.3801 0.4130 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6071 0.6173 -0.9166 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4547 -0.3059 -0.6409 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8931 -1.2480 0.4447 C 0 0 2 0 0 0 0 0 0 0 0 0 0.2155 -2.0284 1.0725 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2530 -1.0087 1.5656 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8431 -0.4060 0.3470 C 0 0 1 0 0 0 0 0 0 0 0 0 0.7691 0.4642 -0.3048 C 0 0 1 0 0 0 0 0 0 0 0 0 1.5640 0.9842 -1.4661 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8750 1.3776 -0.7699 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8749 0.6566 0.5711 C 0 0 2 0 0 0 0 0 0 0 0 0 4.2683 0.1429 0.7333 C 0 0 2 0 0 0 0 0 0 0 0 0 4.8349 0.7539 2.0084 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9841 0.7002 -0.4971 C 0 0 2 0 0 0 0 0 0 0 0 0 3.9865 0.9378 -1.4366 O 0 0 0 0 0 0 0 0 0 0 0 0 5.9566 -0.3728 -0.9382 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1931 -0.3061 -0.0925 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8903 0.9986 -0.3703 C 0 0 2 0 0 0 0 0 0 0 0 0 6.8684 1.9579 -0.9447 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7059 1.8386 -0.1896 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1080 0.8678 -1.2209 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2982 -1.5010 -0.5651 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6448 -2.5166 -1.5955 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9042 -4.3782 -1.7728 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1587 -2.8658 0.6245 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8324 -4.6786 0.9638 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2216 -4.8071 -0.6894 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3943 -4.0249 0.4927 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3616 -3.1364 1.6986 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5931 -1.3391 0.8979 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8731 -2.1159 -2.0514 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1376 -1.2939 -1.1095 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6982 0.5328 -1.2692 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7645 1.7355 -0.5849 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4253 3.5749 -0.8675 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8094 4.9732 0.1199 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1349 4.3172 2.0112 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4087 1.9297 0.6260 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1108 1.4112 2.4536 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8312 -0.0173 1.3956 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1237 3.1568 3.1142 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1190 5.0637 -0.2403 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3403 1.5857 -0.3855 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5897 0.8296 -2.0314 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2323 -0.8552 -1.5978 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3556 -0.6490 1.2596 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6561 -2.8040 0.4521 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1855 -2.5047 1.9912 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6769 -0.2724 2.1799 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9744 -1.5551 2.2009 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5702 1.3253 0.3709 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7766 0.1321 -2.1676 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1138 1.8232 -1.9945 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8752 2.4781 -0.6458 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5303 1.3188 1.3644 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2686 -0.9501 0.7522 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0242 1.2566 2.6120 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5837 1.5257 1.8171 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2151 -0.0501 2.7025 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1527 -0.3638 -2.0144 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4812 -1.3743 -0.7233 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8609 -0.3238 0.9786 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8530 -1.1800 -0.2124 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2208 1.4638 0.6037 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7157 1.8401 -2.0175 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2629 2.9834 -0.7689 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3558 -0.1973 -1.4123 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0091 1.3520 -2.2191 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0306 1.2974 -0.7309 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6758 -2.3316 0.0934 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4806 -1.8730 -1.2129 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1270 -1.2236 -1.2381 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3088 -3.3973 -1.8406 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6214 -2.9134 -1.6722 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8938 -1.7536 -2.3532 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 14 17 1 0 13 18 1 0 8 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 29 31 1 0 31 32 1 6 31 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 35 38 1 0 24 39 1 6 5 40 1 6 7 2 1 0 15 10 1 0 25 20 1 0 32 27 1 0 21 5 1 0 28 24 1 0 37 31 1 0 1 41 1 0 2 42 1 1 3 43 1 0 3 44 1 0 4 45 1 0 4 46 1 0 6 47 1 1 7 48 1 0 7 49 1 0 8 50 1 6 10 51 1 6 12 52 1 0 12 53 1 0 13 54 1 1 14 55 1 6 15 56 1 1 16 57 1 0 17 58 1 0 18 59 1 0 19 60 1 0 19 61 1 0 20 62 1 6 21 63 1 1 22 64 1 0 22 65 1 0 23 66 1 0 23 67 1 0 25 68 1 1 26 69 1 0 26 70 1 0 27 71 1 1 28 72 1 1 29 73 1 1 30 74 1 0 30 75 1 0 30 76 1 0 33 77 1 0 33 78 1 0 34 79 1 0 34 80 1 0 35 81 1 1 36 82 1 0 36 83 1 0 38 84 1 0 38 85 1 0 38 86 1 0 39 87 1 0 39 88 1 0 39 89 1 0 40 90 1 0 40 91 1 0 40 92 1 0 M END

Standard InCHIKey	LIGQJHJGPOMQOW-XRNZZWTLSA-N
Standard InCHI	InChI=1S/C32H52O8/c1-16-5-10-32(38-14-16)17(2)26-25(40-32)13-21-19-12-24(39-29-28(36)27(35)23(34)15-37-29)22-11-18(33)6-8-30(22,3)20(19)7-9-31(21,26)4/h16-29,33-36H,5-15H2,1-4H3/t16-,17+,18+,19-,20+,21+,22-,23-,24+,25+,26+,27+,28-,29+,30-,31+,32-/m1/s1
SMILES	O[C@H]1CC[C@]2([C@H](C1)[C@@H](O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O)C[C@@H]1[C@@H]2CC[C@]2([C@H]1C[C@H]1[C@@H]2[C@H](C)[C@]2(O1)CC[C@H](CO2)C)C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	564.37	Volume:	572.455 ? Van der Waals volume.
Dense:	0.986	LogP:	3.66 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.807 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.856 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	2.0	Rigid Bonds:	36.0
TPSA:	117.84 ? Topological Polar Surface Area.	H-Bond Acceptor:	8.0
H-Bond Donor:	4.0	Rings:	7.0
Heavy Atoms:	8.0

MedChem Properties

QED Drug-Likeness Score:	0.378	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.868	Fsp³:	1.0
MCE-18:	170.5 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Rejected
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.789	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.07 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.182	Promiscuous compounds:	0.024

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.458	MDCK Permeability:	-5.095
Pgp-inhibitor:	0.042	Pgp-substrate:	0.67
PAMPA:	0.873 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.08	30% Bioavailability (F30%):	0.157
50% Bioavailability (F50%):	0.98

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.015	MRP1:	0.072
Plasma Protein Binding (PPB):	60.764%	Volume Distribution (VD):	-0.412
Fu:	36.101% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.831
BSEP inhibitor:	0.966

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.021
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.993
HLM stability:	0.155 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

4.991

Half-life (T1/2):

2.262

ADMET: Toxicity

hERG Blockers:	0.091	hERG Blockers (10um):	0.172
Human Hepatotoxicity (H-HT):	0.57	Drug-induced Liver Injury (DILI):	0.736
AMES Toxicity:	0.498	Rat Oral Acute Toxicity:	0.048
Maximum Recommended Daily Dose:	0.443	Skin Sensitization:	1.0
Carcinogencity:	0.352	Eye Corrosion:	0.007
Eye Irritation:	0.304	Respiratory Toxicity:	0.059
Drug-induced Neurotoxicity:	0.007	Ototoxicity:	0.914
Hematotoxicity:	0.063	Drug-induced Nephrotoxicity:	0.742
Genotoxicity:	0.002	RPMI-8226 Immunitoxicity:	0.147
A549 Cytotoxicity:	0.436	Hek293 Cytotoxicity:	0.741
BCF:	1.8 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.458 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.6 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.103 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO21208	Solanum chrysotrichum	Species	Solanaceae	Eukaryota	Leaves	n.a.	n.a.	PMID[12502320]
NPO4703	Solanum hispidum	Species	Solanaceae	Eukaryota	leaves	n.a.	n.a.	PMID[15217270]
NPO40931	Solanum macaonense	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25036668]
NPO21208	Solanum chrysotrichum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO4703	Solanum hispidum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO21208	Solanum chrysotrichum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO4703	Solanum hispidum	Species	Solanaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	8
IC50	2

Activity Type	# Activity
Organism	8
Others	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT21	Organism	Aspergillus niger	Aspergillus niger	MIC	>	400.0	ug.mL-1	Open TG-GATES in vivo data: Biochemistry
NPT330	Organism	Trichophyton mentagrophytes	Trichophyton mentagrophytes	MIC	=	100.0	ug.mL-1	PMID[9461658]
NPT329	Organism	Trichophyton rubrum	Trichophyton rubrum	MIC	=	100.0	ug.mL-1	PubChem BioAssay data set
NPT20	Organism	Candida albicans	Candida albicans	MIC	=	200.0	ug.mL-1	DOI[10.6019/CHEMBL1201861]
NPT2	Others	Unspecified	n.a.	IC50	=	7600.0	nM	PMID[25746815]
NPT2	Others	Unspecified	n.a.	IC50	=	4400.0	nM	Open TG-GATES in vivo data: Biochemistry

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC88962 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24960
0.1-0.2	22687
0.2-0.3	1909
0.3-0.4	137
0.4-0.5	102
0.5-0.6	42
0.6-0.7	10
0.7-0.8	0
0.8-0.85	2
0.85-0.9	3
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.88	High Similarity	NPC485591
0.8571	High Similarity	NPC312678
0.8571	High Similarity	NPC253268
0.8082	Intermediate Similarity	NPC144790
0.8082	Intermediate Similarity	NPC149400
0.7973	Intermediate Similarity	NPC277715
0.7195	Intermediate Similarity	NPC131693
0.7195	Intermediate Similarity	NPC475436
0.7159	Intermediate Similarity	NPC485605
0.7	Intermediate Similarity	NPC485603
0.6875	Remote Similarity	NPC481418
0.6782	Remote Similarity	NPC485590
0.6744	Remote Similarity	NPC291547
0.6744	Remote Similarity	NPC485593
0.6744	Remote Similarity	NPC174024
0.6528	Remote Similarity	NPC296734
0.6389	Remote Similarity	NPC248944
0.6389	Remote Similarity	NPC7479
0.6389	Remote Similarity	NPC257296
0.6047	Remote Similarity	NPC485594
0.5909	Remote Similarity	NPC177834
0.5889	Remote Similarity	NPC250393
0.5795	Remote Similarity	NPC481423
0.5699	Remote Similarity	NPC264101
0.5667	Remote Similarity	NPC179859
0.5667	Remote Similarity	NPC473851
0.56	Remote Similarity	NPC485604
0.5517	Remote Similarity	NPC473774
0.5517	Remote Similarity	NPC481419
0.5517	Remote Similarity	NPC481417
0.5464	Remote Similarity	NPC485599
0.5455	Remote Similarity	NPC273290
0.5455	Remote Similarity	NPC232044
0.5455	Remote Similarity	NPC24960
0.5443	Remote Similarity	NPC305808
0.5408	Remote Similarity	NPC475351
0.5385	Remote Similarity	NPC13190
0.5354	Remote Similarity	NPC473601
0.5325	Remote Similarity	NPC227260
0.525	Remote Similarity	NPC481427
0.5244	Remote Similarity	NPC235126
0.5244	Remote Similarity	NPC242419
0.5243	Remote Similarity	NPC294129
0.5238	Remote Similarity	NPC473518
0.52	Remote Similarity	NPC485596
0.5196	Remote Similarity	NPC471464
0.5169	Remote Similarity	NPC481420
0.5169	Remote Similarity	NPC481421
0.5146	Remote Similarity	NPC128572
0.5109	Remote Similarity	NPC181845
0.51	Remote Similarity	NPC485597
0.5096	Remote Similarity	NPC97700
0.5096	Remote Similarity	NPC30856
0.5094	Remote Similarity	NPC475333
0.5094	Remote Similarity	NPC224098
0.5094	Remote Similarity	NPC208383
0.5093	Remote Similarity	NPC476112
0.5093	Remote Similarity	NPC307534
0.506	Remote Similarity	NPC161035
0.506	Remote Similarity	NPC170438
0.5051	Remote Similarity	NPC70204
0.5048	Remote Similarity	NPC115165

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC88962 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7506
0.1-0.2	1583
0.2-0.3	57
0.3-0.4	0
0.4-0.5	3
0.5-0.6	0
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6389	Remote Similarity	NPD6928	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data