NPASS Compound

Natural Product: NPC294129

Natural Product ID	NPC294129
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	KQUKDOSYQGPURW-VQCUNOQJSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL445238
PubChem CID	11158720
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 127135 0 0 0 0 0 0 0 0999 V2000 11.4796 1.1766 -1.7970 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1256 0.6471 -2.2946 C 0 0 2 0 0 0 0 0 0 0 0 0 9.0858 1.7018 -2.2576 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7338 1.1206 -2.4436 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4620 -0.0937 -1.5859 C 0 0 2 0 0 0 0 0 0 0 0 0 6.1703 -0.7810 -2.0136 C 0 0 1 0 0 0 0 0 0 0 0 0 6.4625 -2.2092 -2.5036 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4094 -0.9434 -0.7490 C 0 0 1 0 0 0 0 0 0 0 0 0 6.3663 -0.4767 0.3297 C 0 0 2 0 0 0 0 0 0 0 0 0 5.5000 0.1793 1.3947 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1615 -0.1909 0.9887 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9965 0.6100 1.4309 C 0 0 2 0 0 0 0 0 0 0 0 0 2.9983 0.9476 2.8912 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1604 0.0008 3.6807 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0046 -0.4747 3.2292 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2169 -1.3976 4.0283 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2172 -1.5064 3.7277 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6144 -0.3955 2.7978 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7148 -0.4645 1.4931 C 0 0 2 0 0 0 0 0 0 0 0 0 0.6189 0.0423 1.8439 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4719 1.5763 1.9761 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7864 -0.2442 1.0074 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6953 -0.0947 -0.4493 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9429 -0.6374 -1.1139 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2250 -0.0773 -0.5504 C 0 0 2 0 0 0 0 0 0 0 0 0 4.3788 1.3323 -1.0125 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4177 0.1282 0.4937 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1388 -0.6477 -0.3496 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.5873 -0.2712 -0.5504 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.2253 -1.5479 -1.0197 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4663 -2.0100 -2.2591 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.4506 -0.9872 -2.6336 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6045 -0.5633 -1.6487 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3449 -2.1585 -3.3351 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5660 -1.5656 -1.1854 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1402 -2.5395 -0.3737 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.1406 -1.9342 0.5473 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4864 -2.6550 0.5113 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.9428 -2.8033 -0.9279 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7755 -3.0863 -1.8475 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6794 -3.5816 -1.1425 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.8970 -3.7954 -1.0006 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.4386 -1.8948 1.1884 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6558 -1.9504 1.8577 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2454 0.2311 0.5278 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5857 1.5700 0.4060 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0354 1.8805 0.3428 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.3403 3.3488 0.2709 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4597 4.1542 1.1694 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0644 3.6548 1.2422 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.3458 3.9992 -0.0536 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9620 2.2820 1.3879 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0495 4.3767 2.4157 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3483 3.8298 -1.0418 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4745 1.3693 -0.9174 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9541 -1.2941 4.9162 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1877 0.4384 -0.3001 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4961 -0.9482 -1.4384 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7480 -0.4676 -1.3595 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2834 0.5830 -2.3166 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5994 2.2325 -2.0583 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6176 0.9593 -0.7098 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2875 0.3240 -3.3273 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1618 2.3845 -1.3777 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2728 2.3883 -3.1361 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5355 0.8420 -3.4974 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0071 1.9525 -2.2111 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6682 -0.2984 -2.8459 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8147 -2.2295 -3.5400 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0682 -2.7763 -1.8002 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4427 -2.7025 -2.5162 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1258 -1.9886 -0.5047 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9631 -1.3127 0.7363 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7445 -0.3306 2.3762 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7111 1.2509 1.5460 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9672 -1.2608 1.1949 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0247 1.5645 0.8760 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8294 2.0096 3.1288 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0547 0.7456 3.2385 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4728 -0.3407 4.6775 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3349 -1.0481 5.1054 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6386 -2.4362 4.0718 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5546 -2.5011 3.3746 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4232 0.5282 3.3293 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6457 -0.6042 2.4919 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7334 -1.5563 1.3578 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4550 1.8617 3.0504 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1876 2.1233 1.3583 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5394 1.9080 1.5925 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0491 -1.3283 1.2131 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5679 0.9676 -0.7156 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8664 -0.6407 -0.9338 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9369 -1.7505 -1.1024 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9295 -0.3212 -2.1968 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1190 1.9271 -0.4701 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3733 1.8138 -1.0824 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7240 1.3117 -2.0785 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1024 -1.6844 0.0192 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5480 0.5310 -1.3454 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9295 -2.3164 -0.2361 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9622 -2.9848 -2.1222 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7906 -1.4817 -3.4151 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9239 -0.1405 -3.2151 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1344 -1.5693 -3.2370 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3426 -3.0381 0.2365 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3614 -0.8931 0.2709 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3228 -3.6529 0.9632 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3746 -1.8214 -1.2322 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4567 -2.1596 -2.3228 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0870 -3.8874 -2.5466 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8624 -4.3337 -0.1719 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6639 -1.1182 0.6241 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5085 -1.0392 2.1786 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1546 1.8957 -0.5887 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6804 1.4126 1.0862 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4003 3.5345 0.6317 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4114 5.1855 0.7034 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5014 4.1566 2.0466 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0201 4.0131 -0.9319 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8588 5.0069 -0.0112 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5681 3.2399 -0.2976 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0577 3.5574 2.9743 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1495 3.4246 -1.5024 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7521 1.4637 -1.6004 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9768 -2.1729 5.3962 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5516 -1.2346 -1.4660 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8966 -0.0529 -0.3168 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 1 19 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 31 34 1 0 30 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 39 42 1 0 38 43 1 0 37 44 1 0 29 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 50 52 1 0 49 53 1 0 48 54 1 0 47 55 1 0 17 56 1 0 9 57 1 0 5 58 1 1 58 59 1 0 59 2 1 0 57 5 1 0 25 8 1 0 33 28 1 0 41 36 1 0 52 46 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 60 1 0 1 61 1 0 1 62 1 0 2 63 1 6 3 64 1 0 3 65 1 0 4 66 1 0 4 67 1 0 6 68 1 6 7 69 1 0 7 70 1 0 7 71 1 0 8 72 1 1 9 73 1 1 10 74 1 0 10 75 1 0 11 76 1 6 12 77 1 6 13 78 1 0 13 79 1 0 14 80 1 0 16 81 1 0 16 82 1 0 17 83 1 6 18 84 1 0 18 85 1 0 19 86 1 6 21 87 1 0 21 88 1 0 21 89 1 0 22 90 1 6 23 91 1 0 23 92 1 0 24 93 1 0 24 94 1 0 26 95 1 0 26 96 1 0 26 97 1 0 28 98 1 1 29 99 1 6 30100 1 1 31101 1 1 32102 1 0 32103 1 0 34104 1 0 36105 1 1 37106 1 6 38107 1 1 39108 1 6 40109 1 0 40110 1 0 42111 1 0 43112 1 0 44113 1 0 46114 1 6 47115 1 1 48116 1 1 49117 1 6 50118 1 1 51119 1 0 51120 1 0 51121 1 0 53122 1 0 54123 1 0 55124 1 0 56125 1 0 59126 1 0 59127 1 0 M END

Standard InCHIKey	KQUKDOSYQGPURW-VQCUNOQJSA-N
Standard InCHI	InChI=1S/C43H68O16/c1-18-8-11-43(54-15-18)19(2)30-28(59-43)14-25-23-7-6-21-12-22(44)13-29(42(21,5)24(23)9-10-41(25,30)4)56-40-37(58-39-35(51)33(49)31(47)20(3)55-39)36(27(46)17-53-40)57-38-34(50)32(48)26(45)16-52-38/h6,18-20,22-40,44-51H,7-17H2,1-5H3/t18-,19+,20+,22-,23-,24+,25+,26-,27+,28+,29-,30+,31+,32+,33-,34-,35-,36+,37-,38+,39+,40+,41+,42+,43-/m1/s1
SMILES	C[C@@H]1CC[C@@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC=C6C[C@H](C[C@H]([C@]6(C)[C@H]5CC[C@]34C)O[C@H]3[C@@H]([C@H]([C@H](CO3)O)O[C@H]3[C@@H]([C@H]([C@@H](CO3)O)O)O)O[C@H]3[C@@H]([C@@H]([C@H]([C@H](C)O3)O)O)O)O)O2)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	840.45	Volume:	813.283 ? Van der Waals volume.
Dense:	1.033	LogP:	2.24 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.915 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.414 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	6.0	Rigid Bonds:	48.0
TPSA:	235.68 ? Topological Polar Surface Area.	H-Bond Acceptor:	16.0
H-Bond Donor:	8.0	Rings:	9.0
Heavy Atoms:	16.0

MedChem Properties

QED Drug-Likeness Score:	0.17	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.755	Fsp³:	0.953
MCE-18:	227.571 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.731	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.006 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.202	Promiscuous compounds:	0.024

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.942	MDCK Permeability:	-5.149
Pgp-inhibitor:	0.0	Pgp-substrate:	0.997
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.059	30% Bioavailability (F30%):	0.537
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.03
Plasma Protein Binding (PPB):	54.69%	Volume Distribution (VD):	-0.423
Fu:	36.524% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.621
BSEP inhibitor:	0.017

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.032
CYP3A4-inhibitor:	0.998	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.717
HLM stability:	0.106 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.365

Half-life (T1/2):

2.938

ADMET: Toxicity

hERG Blockers:	0.029	hERG Blockers (10um):	0.087
Human Hepatotoxicity (H-HT):	0.465	Drug-induced Liver Injury (DILI):	0.831
AMES Toxicity:	0.556	Rat Oral Acute Toxicity:	0.009
Maximum Recommended Daily Dose:	0.218	Skin Sensitization:	1.0
Carcinogencity:	0.057	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.002
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.998
Hematotoxicity:	0.049	Drug-induced Nephrotoxicity:	0.926
Genotoxicity:	0.002	RPMI-8226 Immunitoxicity:	0.384
A549 Cytotoxicity:	0.48	Hek293 Cytotoxicity:	0.753
BCF:	1.436 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.348 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.588 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.866 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO29813	Ornithogalum thyrsoides	Species	Hyacinthaceae	Eukaryota	bulbs	n.a.	n.a.	PMID[12398536]
NPO29813	Ornithogalum thyrsoides	Species	Hyacinthaceae	Eukaryota	n.a.	bulb	n.a.	PMID[12398536]
NPO29813	Ornithogalum thyrsoides	Species	Hyacinthaceae	Eukaryota	bulbs	n.a.	n.a.	PMID[15497941]
NPO29813	Ornithogalum thyrsoides	Species	Hyacinthaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	1.9	ug.mL-1	PMID[9677277]
NPT924	Cell line	HSC-2	Homo sapiens	IC50	=	21.2	ug.mL-1	PMID[20702006]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC294129 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25445
0.1-0.2	21607
0.2-0.3	2350
0.3-0.4	235
0.4-0.5	110
0.5-0.6	85
0.6-0.7	16
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8958	High Similarity	NPC475247
0.8125	Intermediate Similarity	NPC70204
0.7526	Intermediate Similarity	NPC306131
0.7526	Intermediate Similarity	NPC200802
0.7228	Intermediate Similarity	NPC475670
0.7087	Intermediate Similarity	NPC112274
0.6957	Remote Similarity	NPC198325
0.6667	Remote Similarity	NPC13190
0.6435	Remote Similarity	NPC50689
0.6303	Remote Similarity	NPC43842
0.6296	Remote Similarity	NPC51154
0.625	Remote Similarity	NPC202261
0.6239	Remote Similarity	NPC11548
0.6228	Remote Similarity	NPC475333
0.6228	Remote Similarity	NPC224098
0.6228	Remote Similarity	NPC208383
0.6148	Remote Similarity	NPC295133
0.6148	Remote Similarity	NPC207243
0.6098	Remote Similarity	NPC233391
0.6095	Remote Similarity	NPC476540
0.6095	Remote Similarity	NPC476541
0.6036	Remote Similarity	NPC602423
0.5929	Remote Similarity	NPC300557
0.5856	Remote Similarity	NPC475351
0.5833	Remote Similarity	NPC106589
0.5833	Remote Similarity	NPC31896
0.5827	Remote Similarity	NPC257207
0.5798	Remote Similarity	NPC195560
0.5772	Remote Similarity	NPC480556
0.5727	Remote Similarity	NPC470432
0.5727	Remote Similarity	NPC230507
0.5686	Remote Similarity	NPC473774
0.5686	Remote Similarity	NPC481418
0.5686	Remote Similarity	NPC481419
0.5686	Remote Similarity	NPC481417
0.5667	Remote Similarity	NPC229962
0.5664	Remote Similarity	NPC473601
0.5656	Remote Similarity	NPC475357
0.5614	Remote Similarity	NPC470433
0.5614	Remote Similarity	NPC46190
0.5614	Remote Similarity	NPC171073
0.5596	Remote Similarity	NPC475431
0.5556	Remote Similarity	NPC97700
0.5556	Remote Similarity	NPC250393
0.5556	Remote Similarity	NPC30856
0.5546	Remote Similarity	NPC309278
0.5528	Remote Similarity	NPC232054
0.5512	Remote Similarity	NPC210569
0.5487	Remote Similarity	NPC113044
0.5487	Remote Similarity	NPC283829
0.5487	Remote Similarity	NPC161676
0.547	Remote Similarity	NPC480555
0.547	Remote Similarity	NPC150372
0.5455	Remote Similarity	NPC473923
0.5455	Remote Similarity	NPC476538
0.5455	Remote Similarity	NPC476539
0.5421	Remote Similarity	NPC177834
0.5385	Remote Similarity	NPC481420
0.5385	Remote Similarity	NPC481421
0.5378	Remote Similarity	NPC115165
0.5354	Remote Similarity	NPC224314
0.5351	Remote Similarity	NPC14704
0.5347	Remote Similarity	NPC473476
0.5345	Remote Similarity	NPC475403
0.5339	Remote Similarity	NPC160888
0.5333	Remote Similarity	NPC269297
0.5333	Remote Similarity	NPC222202
0.5327	Remote Similarity	NPC181845
0.5306	Remote Similarity	NPC235126
0.5306	Remote Similarity	NPC242419
0.5289	Remote Similarity	NPC475487
0.5289	Remote Similarity	NPC32361
0.5254	Remote Similarity	NPC471464
0.5254	Remote Similarity	NPC51172
0.5254	Remote Similarity	NPC6806
0.5254	Remote Similarity	NPC49032
0.525	Remote Similarity	NPC148965
0.5246	Remote Similarity	NPC232037
0.5243	Remote Similarity	NPC144790
0.5243	Remote Similarity	NPC149400
0.5243	Remote Similarity	NPC88962
0.5242	Remote Similarity	NPC132080
0.5234	Remote Similarity	NPC477807
0.5225	Remote Similarity	NPC206003
0.5225	Remote Similarity	NPC473610
0.521	Remote Similarity	NPC128572
0.5203	Remote Similarity	NPC480554
0.5179	Remote Similarity	NPC19400
0.5169	Remote Similarity	NPC248746
0.5133	Remote Similarity	NPC264101
0.5126	Remote Similarity	NPC473633
0.5122	Remote Similarity	NPC194207
0.5122	Remote Similarity	NPC22779
0.512	Remote Similarity	NPC480553
0.51	Remote Similarity	NPC177818
0.5091	Remote Similarity	NPC485591
0.5083	Remote Similarity	NPC151134
0.5072	Remote Similarity	NPC329807
0.5047	Remote Similarity	NPC24960
0.5046	Remote Similarity	NPC481424
0.5046	Remote Similarity	NPC481422
0.5046	Remote Similarity	NPC481423
0.5045	Remote Similarity	NPC477451
0.5043	Remote Similarity	NPC6295
0.5041	Remote Similarity	NPC473518
0.5041	Remote Similarity	NPC116756
0.5038	Remote Similarity	NPC263359

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC294129 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7797
0.1-0.2	1306
0.2-0.3	40
0.3-0.4	4
0.4-0.5	3
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data