NPASS Compound

Natural Product: NPC475403

Natural Product ID	NPC475403
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Draconin C
IUPAC Name	n.a.
Synonyms	draconin C
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL504939
PubChem CID	11104718
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 115122 0 0 0 0 0 0 0 0999 V2000 5.0289 -2.1714 1.1072 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6462 -2.0790 -0.3145 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6147 -1.1469 -0.7325 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3537 0.1644 -0.8640 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0061 0.9042 0.4073 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9295 0.1178 1.1039 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4320 -0.9069 0.1233 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3463 -0.3709 -0.7853 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2861 0.4419 -0.0766 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9896 1.6242 0.5467 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8685 1.0358 1.6003 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4287 2.0522 2.5625 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2278 2.6347 3.2098 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1869 2.9554 2.4766 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1931 2.7470 1.0070 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2082 2.8767 0.5348 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6487 4.3367 0.8575 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6074 4.6444 2.3053 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0479 3.5481 3.1424 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8577 4.9669 2.8417 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1610 2.0336 1.0538 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9597 1.5180 0.0437 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1845 0.0322 0.0931 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5584 -0.3325 1.5119 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2865 0.7972 2.1692 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9406 1.7637 1.2456 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2551 2.0806 0.1063 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3217 0.2118 2.9369 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4051 -0.5735 2.2524 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3623 -0.2186 -0.6609 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1327 -1.0959 -1.6833 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9241 -2.3730 -1.6430 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3412 -2.1865 -2.1420 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5997 -0.6844 -2.2432 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5856 -0.1321 -3.2011 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2805 -0.5131 -2.9397 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7435 1.3727 -3.2471 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8602 -0.4762 -2.8332 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2720 -2.8133 -1.3231 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8410 -3.0762 -0.4466 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2399 -4.3382 -0.3426 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7731 -4.7973 -1.4216 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.1542 -5.0865 0.9366 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9039 4.0208 0.4550 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8859 -2.1395 0.7904 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6830 -0.1086 -1.0253 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8749 -1.4901 -1.0413 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0000 -2.0613 -2.4184 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4184 -2.5554 -2.7296 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3949 -1.6199 -2.1406 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5460 -1.4010 -2.7284 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0429 -0.9409 -0.8771 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0285 -1.7397 -0.2975 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5981 -2.6274 -4.0932 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1568 -3.1787 -2.5974 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2770 -2.5995 1.7891 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5080 -1.2341 1.5140 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8886 -2.9116 1.1614 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5401 -3.0983 -0.7394 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2888 -1.4259 -1.7783 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9874 0.7259 -1.7599 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9094 1.0440 1.0583 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6952 1.9316 0.1283 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3173 -0.4223 2.0182 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8133 -1.2556 -1.2377 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7531 0.1984 -1.6463 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2174 -0.1901 0.6527 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3440 0.8411 -0.8958 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6996 1.9611 -0.2892 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1843 0.3932 2.2389 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9792 1.4673 3.3367 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1217 2.7725 2.1433 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1983 2.8003 4.2910 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2603 2.8519 -0.5647 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6595 4.5050 0.4209 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9733 4.9897 0.3024 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9935 5.5757 2.4741 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7815 2.7535 3.3720 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7149 3.9553 4.1158 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5459 4.8645 2.1315 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5638 1.8751 -0.9285 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3488 -0.5598 -0.3187 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1526 -1.2788 1.5059 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6510 1.3386 2.9167 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0616 2.7252 1.8233 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9850 1.4098 1.0133 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8076 0.8914 3.4661 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7268 -0.7714 3.1844 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0435 -1.3910 -1.6380 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4306 -3.0254 -2.4289 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5019 -2.5782 -3.1683 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6112 -0.1987 -1.2710 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8342 -0.5112 -4.2143 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7772 1.9018 -3.3852 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1301 1.7404 -2.2571 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4931 1.6953 -3.9991 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4771 -0.0621 -2.1943 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0900 -2.9947 -1.8711 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8663 -5.9551 0.9114 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4937 -4.4234 1.7388 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1223 -5.4203 1.1637 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5910 4.2249 -0.5860 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8396 4.8603 1.1254 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0125 3.8044 0.3468 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3679 -3.0688 0.4088 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7848 -2.2858 0.5799 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9355 -2.0737 1.9078 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7641 -1.3052 -3.1848 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5904 -3.5464 -2.2193 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7905 -1.9080 -3.6565 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3042 -0.7227 -2.3409 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8947 -0.8120 -0.1854 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5998 0.0522 -1.1684 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9083 -1.7576 -4.4537 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5953 -4.0088 -2.2283 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 2 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 18 20 1 0 16 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 25 28 1 0 24 29 1 0 23 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 35 37 1 0 34 38 1 0 33 39 1 0 32 40 1 0 40 41 1 0 41 42 2 0 41 43 1 0 15 44 1 0 7 45 1 0 4 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 2 0 50 52 1 0 52 53 1 0 49 54 1 0 48 55 1 0 47 2 1 0 7 3 1 0 11 6 1 0 15 10 1 0 19 14 1 0 27 22 1 0 36 31 1 0 53 47 1 0 1 56 1 0 1 57 1 0 1 58 1 0 2 59 1 0 3 60 1 0 4 61 1 0 5 62 1 0 5 63 1 0 6 64 1 0 8 65 1 0 8 66 1 0 9 67 1 0 9 68 1 0 10 69 1 0 11 70 1 0 12 71 1 0 12 72 1 0 13 73 1 0 16 74 1 0 17 75 1 0 17 76 1 0 18 77 1 0 19 78 1 0 19 79 1 0 20 80 1 0 22 81 1 0 23 82 1 0 24 83 1 0 25 84 1 0 26 85 1 0 26 86 1 0 28 87 1 0 29 88 1 0 31 89 1 0 32 90 1 0 33 91 1 0 34 92 1 0 35 93 1 0 37 94 1 0 37 95 1 0 37 96 1 0 38 97 1 0 39 98 1 0 43 99 1 0 43100 1 0 43101 1 0 44102 1 0 44103 1 0 44104 1 0 45105 1 0 45106 1 0 45107 1 0 48108 1 0 49109 1 0 51110 1 0 51111 1 0 52112 1 0 52113 1 0 54114 1 0 55115 1 0 M END

Standard InCHIKey	YYYQAUCUWHBYHS-CPMLXNJUSA-N
Standard InCHI	InChI=1S/C40H60O15/c1-16-14-50-40(35(48)29(16)44)17(2)28-26(55-40)13-24-22-8-7-20-11-21(42)12-27(39(20,6)23(22)9-10-38(24,28)5)53-36-33(31(46)25(43)15-49-36)54-37-34(52-19(4)41)32(47)30(45)18(3)51-37/h7,17-18,21-37,42-48H,1,8-15H2,2-6H3/t17-,18-,21+,22+,23-,24-,25-,26-,27+,28-,29-,30-,31-,32+,33+,34+,35-,36-,37-,38-,39-,40-/m0/s1
SMILES	CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)O)OC6C(C(C(CO6)O)O)OC7C(C(C(C(O7)C)O)O)OC(=O)C)C)C)OC18C(C(C(=C)CO8)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	780.39	Volume:	755.888 ? Van der Waals volume.
Dense:	1.032	LogP:	1.594 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.179 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.761 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	6.0	Rigid Bonds:	44.0
TPSA:	223.29 ? Topological Polar Surface Area.	H-Bond Acceptor:	15.0
H-Bond Donor:	7.0	Rings:	8.0
Heavy Atoms:	15.0

MedChem Properties

QED Drug-Likeness Score:	0.149	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.7	Fsp³:	0.875
MCE-18:	209.0 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.055	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.013 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.251 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.288	Promiscuous compounds:	0.001

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.935	MDCK Permeability:	-5.095
Pgp-inhibitor:	0.0	Pgp-substrate:	0.995
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.727
20% Bioavailability (F20%):	0.456	30% Bioavailability (F30%):	0.973
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.009	MRP1:	1.0
Plasma Protein Binding (PPB):	44.155%	Volume Distribution (VD):	-0.551
Fu:	59.354% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.421	BCRP inhibitor:	0.011
BSEP inhibitor:	0.11

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.008	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.045	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.012	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

1.899

Half-life (T1/2):

3.956

ADMET: Toxicity

hERG Blockers:	0.082	hERG Blockers (10um):	0.356
Human Hepatotoxicity (H-HT):	0.537	Drug-induced Liver Injury (DILI):	0.379
AMES Toxicity:	0.47	Rat Oral Acute Toxicity:	0.535
Maximum Recommended Daily Dose:	0.731	Skin Sensitization:	0.004
Carcinogencity:	0.027	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.035
Drug-induced Neurotoxicity:	0.632	Ototoxicity:	1.0
Hematotoxicity:	0.011	Drug-induced Nephrotoxicity:	0.035
Genotoxicity:	0.033	RPMI-8226 Immunitoxicity:	0.209
A549 Cytotoxicity:	0.068	Hek293 Cytotoxicity:	0.925
BCF:	0.723 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.827 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.834 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.235 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO3545	Dracaena draco	Species	Asparagaceae	Eukaryota	bark	n.a.	n.a.	PMID[12828464]
NPO3545	Dracaena draco	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO3545	Dracaena draco	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO3545	Dracaena draco	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO3545	Dracaena draco	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO3545	Dracaena draco	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1
Activity	1

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	IC50	>	100000.0	nM	PMID[12392731]
NPT116	Cell line	HL-60	Homo sapiens	Activity	=	5.0	%	PMID[21680190]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC475403 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20982
0.1-0.2	25648
0.2-0.3	2943
0.3-0.4	234
0.4-0.5	25
0.5-0.6	13
0.6-0.7	9
0.7-0.8	0
0.8-0.85	2
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8526	High Similarity	NPC473633
0.8316	Intermediate Similarity	NPC476085
0.8105	Intermediate Similarity	NPC51154
0.7879	Intermediate Similarity	NPC160888
0.6635	Remote Similarity	NPC11548
0.6577	Remote Similarity	NPC229962
0.6538	Remote Similarity	NPC112274
0.6518	Remote Similarity	NPC50689
0.6429	Remote Similarity	NPC195560
0.6346	Remote Similarity	NPC70204
0.6346	Remote Similarity	NPC475670
0.6218	Remote Similarity	NPC295133
0.6174	Remote Similarity	NPC479532
0.5962	Remote Similarity	NPC306131
0.5962	Remote Similarity	NPC200802
0.5635	Remote Similarity	NPC257207
0.5528	Remote Similarity	NPC198325
0.5514	Remote Similarity	NPC475431
0.5345	Remote Similarity	NPC475247
0.5345	Remote Similarity	NPC294129
0.5339	Remote Similarity	NPC475487
0.5333	Remote Similarity	NPC13190
0.5276	Remote Similarity	NPC233391
0.52	Remote Similarity	NPC43842
0.5197	Remote Similarity	NPC207243
0.5169	Remote Similarity	NPC148965

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC475403 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7225
0.1-0.2	1868
0.2-0.3	52
0.3-0.4	5
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data