NPASS Compound

Natural Product: NPC306131

Natural Product ID	NPC306131
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	OWGURJWJHWYCIQ-KJXSMTROSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL291743
PubChem CID	21630158
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 113120 0 0 0 0 0 0 0 0999 V2000 9.5936 3.0690 0.2902 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3960 1.6395 0.7475 C 0 0 1 0 0 0 0 0 0 0 0 0 8.5613 1.5969 2.0260 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1945 2.1603 1.7045 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5671 1.2477 0.6562 C 0 0 2 0 0 0 0 0 0 0 0 0 5.2447 1.8270 0.2051 C 0 0 1 0 0 0 0 0 0 0 0 0 5.5188 2.6620 -1.0516 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4847 0.6368 -0.2348 C 0 0 1 0 0 0 0 0 0 0 0 0 5.3219 -0.4996 0.3183 C 0 0 2 0 0 0 0 0 0 0 0 0 4.3321 -1.4863 0.9661 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0917 -1.0636 0.3308 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7923 -1.5407 0.8514 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7147 -3.0163 1.0466 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0623 -3.7011 -0.1164 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0252 -3.1672 -0.7515 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5469 -3.8962 -1.8700 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7421 -3.2814 -2.4764 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5056 -2.5820 -1.3724 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6361 -1.3450 -0.9181 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.4428 -1.8272 -0.2098 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8914 -2.1448 1.2331 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7755 -1.0013 -0.1750 C 0 0 1 0 0 0 0 0 0 0 0 0 0.6743 0.4484 0.1369 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0132 1.0919 -0.2629 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1632 0.4449 0.4636 C 0 0 2 0 0 0 0 0 0 0 0 0 3.2781 0.9417 1.8596 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4792 -0.4765 -0.2876 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9773 0.5615 -1.0008 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.4676 0.6825 -1.0674 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.7506 1.4004 -2.3823 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.6512 2.4175 -2.5580 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.9643 2.8464 -1.3047 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.7687 3.7815 -0.4377 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5516 1.7921 -0.4977 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2094 3.5401 -3.1626 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0020 1.9188 -2.4981 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1910 -0.4522 -0.8617 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0066 -0.4298 0.2788 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4602 -0.5591 -0.0675 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.3095 -0.9284 1.1252 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7013 -1.9284 2.0392 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.2620 -1.6112 2.2685 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.0911 -0.4742 3.2357 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5562 -1.4590 1.0972 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9006 -3.2066 1.5470 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7257 0.2354 1.7700 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9774 0.6546 -0.5233 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5874 -4.3041 -2.9523 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1798 0.0398 1.2314 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3532 1.1252 -0.4609 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6632 0.7981 -0.2681 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6124 3.2348 -0.1450 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7869 3.4599 -0.3313 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6039 3.7182 1.2150 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3857 1.2031 0.9132 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4374 0.5379 2.2920 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1150 2.1951 2.7697 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1926 3.1962 1.3708 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5869 2.0762 2.6198 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7657 2.4408 0.9870 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5625 3.0224 -1.4963 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2467 3.4534 -0.8874 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9377 1.9290 -1.7821 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3181 0.5607 -1.3285 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8250 -1.0192 -0.5291 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3479 -1.4243 2.0602 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6008 -2.5375 0.6875 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1317 -1.2726 -0.7682 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6259 -1.0605 1.8332 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3247 -3.3552 2.0235 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7849 -3.3838 1.0455 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4398 -4.6616 -0.4607 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8710 -4.9038 -1.4572 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1778 -4.1505 -2.6758 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5571 -2.6324 -3.3479 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6082 -3.3007 -0.5682 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4164 -2.2004 -1.8402 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3972 -0.9436 -1.9176 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9982 -3.2307 1.4008 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2876 -1.6180 1.9877 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9377 -1.7461 1.4080 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2373 -1.0680 -1.2088 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5776 0.6069 1.2383 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0777 1.0059 -0.3975 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9687 2.1498 0.0469 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1233 1.0773 -1.3650 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2997 0.9253 2.2862 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6196 0.4984 2.6030 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9851 2.0343 1.8279 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6082 0.4297 -2.0605 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7621 1.3771 -0.2065 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6195 0.6187 -3.1791 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8714 2.0413 -3.2787 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0388 3.3855 -1.6037 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5521 3.6278 0.6497 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5060 4.8558 -0.6392 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.8717 3.7291 -0.6433 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0455 3.8359 -2.7093 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6422 1.3054 -2.9278 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8564 0.5670 0.7522 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5697 -1.3685 -0.8122 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2560 -1.3937 0.7158 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2441 -1.8365 3.0266 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7969 -2.5098 2.7772 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8570 -0.8338 4.2784 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0182 0.1212 3.3499 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2859 0.2307 2.9611 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5081 -3.8261 2.2393 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0567 0.8398 1.0547 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7975 0.5555 -1.0704 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3880 -4.4733 -3.9020 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8524 -0.2749 -0.0530 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1840 1.0021 -1.2518 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 2 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 1 20 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 1 19 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 32 34 1 0 31 35 1 0 30 36 1 0 29 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 42 44 1 0 41 45 1 0 40 46 1 0 39 47 1 0 17 48 1 0 9 49 1 0 5 50 1 6 50 51 1 0 51 2 1 0 49 5 1 0 25 8 1 0 34 28 1 0 44 38 1 0 25 11 1 0 22 12 1 0 20 15 1 0 1 52 1 0 1 53 1 0 1 54 1 0 2 55 1 1 3 56 1 0 3 57 1 0 4 58 1 0 4 59 1 0 6 60 1 1 7 61 1 0 7 62 1 0 7 63 1 0 8 64 1 6 9 65 1 6 10 66 1 0 10 67 1 0 11 68 1 6 12 69 1 1 13 70 1 0 13 71 1 0 14 72 1 0 16 73 1 0 16 74 1 0 17 75 1 6 18 76 1 0 18 77 1 0 19 78 1 6 21 79 1 0 21 80 1 0 21 81 1 0 22 82 1 6 23 83 1 0 23 84 1 0 24 85 1 0 24 86 1 0 26 87 1 0 26 88 1 0 26 89 1 0 28 90 1 6 29 91 1 1 30 92 1 6 31 93 1 6 32 94 1 6 33 95 1 0 33 96 1 0 33 97 1 0 35 98 1 0 36 99 1 0 38100 1 1 39101 1 6 40102 1 6 41103 1 1 42104 1 1 43105 1 0 43106 1 0 43107 1 0 45108 1 0 46109 1 0 47110 1 0 48111 1 0 51112 1 0 51113 1 0 M END

Standard InCHIKey	OWGURJWJHWYCIQ-KJXSMTROSA-N
Standard InCHI	InChI=1S/C39H62O12/c1-17-9-12-39(46-16-17)18(2)28-26(51-39)15-25-23-8-7-21-13-22(40)14-27(38(21,6)24(23)10-11-37(25,28)5)49-36-34(32(44)30(42)20(4)48-36)50-35-33(45)31(43)29(41)19(3)47-35/h7,17-20,22-36,40-45H,8-16H2,1-6H3/t17-,18-,19-,20+,22+,23+,24-,25-,26-,27+,28-,29-,30-,31+,32-,33+,34+,35-,36-,37-,38-,39+/m0/s1
SMILES	C[C@H]1CC[C@@]2([C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC=C6C[C@H](C[C@H]([C@]6(C)[C@H]5CC[C@]34C)O[C@H]3[C@@H]([C@H]([C@H]([C@@H](C)O3)O)O)O[C@H]3[C@@H]([C@@H]([C@H]([C@H](C)O3)O)O)O)O)O2)OC1

Calculated Properties

Physi-Chem Properties

Molecular Weight:	722.42	Volume:	717.494 ? Van der Waals volume.
Dense:	1.007	LogP:	3.67 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.829 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-5.474 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	4.0	Rigid Bonds:	42.0
TPSA:	176.76 ? Topological Polar Surface Area.	H-Bond Acceptor:	12.0
H-Bond Donor:	6.0	Rings:	8.0
Heavy Atoms:	12.0

MedChem Properties

QED Drug-Likeness Score:	0.234	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.353	Fsp³:	0.949
MCE-18:	202.237 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	0
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.763	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.01 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.201	Promiscuous compounds:	0.022

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-5.752	MDCK Permeability:	-5.107
Pgp-inhibitor:	0.0	Pgp-substrate:	0.991
PAMPA:	0.999 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.0
20% Bioavailability (F20%):	0.401	30% Bioavailability (F30%):	0.843
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.157
Plasma Protein Binding (PPB):	62.46%	Volume Distribution (VD):	-0.356
Fu:	31.454% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.766
BSEP inhibitor:	0.093

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.906	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.993
HLM stability:	0.033 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

2.462

Half-life (T1/2):

2.959

ADMET: Toxicity

hERG Blockers:	0.059	hERG Blockers (10um):	0.242
Human Hepatotoxicity (H-HT):	0.474	Drug-induced Liver Injury (DILI):	0.826
AMES Toxicity:	0.524	Rat Oral Acute Toxicity:	0.053
Maximum Recommended Daily Dose:	0.472	Skin Sensitization:	0.999
Carcinogencity:	0.201	Eye Corrosion:	0.0
Eye Irritation:	0.01	Respiratory Toxicity:	0.01
Drug-induced Neurotoxicity:	0.002	Ototoxicity:	0.986
Hematotoxicity:	0.102	Drug-induced Nephrotoxicity:	0.748
Genotoxicity:	0.006	RPMI-8226 Immunitoxicity:	0.336
A549 Cytotoxicity:	0.621	Hek293 Cytotoxicity:	0.769
BCF:	1.88 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.558 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.717 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.197 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO24065	Dracaena surculosa	Species	Teiidae	Eukaryota	n.a.	n.a.	n.a.	PMID[11000027]
NPO24065	Dracaena surculosa	Species	Teiidae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO24065	Dracaena surculosa	Species	Teiidae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell line	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	8.7	ug.mL-1	PMID[20937542]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC306131 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24495
0.1-0.2	22146
0.2-0.3	2705
0.3-0.4	290
0.4-0.5	110
0.5-0.6	61
0.6-0.7	41
0.7-0.8	0
0.8-0.85	0
0.85-0.9	1
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC200802
0.8837	High Similarity	NPC70204
0.7802	Intermediate Similarity	NPC475670
0.7634	Intermediate Similarity	NPC112274
0.7526	Intermediate Similarity	NPC294129
0.7158	Intermediate Similarity	NPC113044
0.7158	Intermediate Similarity	NPC283829
0.7158	Intermediate Similarity	NPC161676
0.6735	Remote Similarity	NPC51154
0.6667	Remote Similarity	NPC475247
0.6667	Remote Similarity	NPC11548
0.66	Remote Similarity	NPC470433
0.66	Remote Similarity	NPC46190
0.66	Remote Similarity	NPC171073
0.6489	Remote Similarity	NPC477451
0.6444	Remote Similarity	NPC473774
0.6444	Remote Similarity	NPC481419
0.6444	Remote Similarity	NPC481417
0.6408	Remote Similarity	NPC480555
0.6408	Remote Similarity	NPC150372
0.63	Remote Similarity	NPC14704
0.6277	Remote Similarity	NPC13190
0.6263	Remote Similarity	NPC470432
0.6263	Remote Similarity	NPC230507
0.625	Remote Similarity	NPC222731
0.6226	Remote Similarity	NPC269297
0.6226	Remote Similarity	NPC222202
0.6214	Remote Similarity	NPC477809
0.6207	Remote Similarity	NPC473923
0.6204	Remote Similarity	NPC480554
0.62	Remote Similarity	NPC141433
0.617	Remote Similarity	NPC181845
0.6168	Remote Similarity	NPC475333
0.6168	Remote Similarity	NPC224098
0.6168	Remote Similarity	NPC208383
0.6117	Remote Similarity	NPC602423
0.6105	Remote Similarity	NPC297348
0.6105	Remote Similarity	NPC249204
0.6105	Remote Similarity	NPC48339
0.6105	Remote Similarity	NPC141769
0.6105	Remote Similarity	NPC477547
0.6091	Remote Similarity	NPC480553
0.6067	Remote Similarity	NPC473476
0.6058	Remote Similarity	NPC248746
0.6047	Remote Similarity	NPC235126
0.6047	Remote Similarity	NPC242419
0.6019	Remote Similarity	NPC32361
0.6	Remote Similarity	NPC300557
0.6	Remote Similarity	NPC195560
0.5962	Remote Similarity	NPC475403
0.596	Remote Similarity	NPC475431
0.596	Remote Similarity	NPC19400
0.596	Remote Similarity	NPC476538
0.596	Remote Similarity	NPC476539
0.5934	Remote Similarity	NPC144790
0.5934	Remote Similarity	NPC149400
0.5914	Remote Similarity	NPC481420
0.5914	Remote Similarity	NPC481421
0.5876	Remote Similarity	NPC294686
0.5859	Remote Similarity	NPC476540
0.5859	Remote Similarity	NPC476541
0.5856	Remote Similarity	NPC229962
0.5826	Remote Similarity	NPC480556
0.58	Remote Similarity	NPC211354
0.5795	Remote Similarity	NPC177818
0.5784	Remote Similarity	NPC6295
0.5701	Remote Similarity	NPC42171
0.5686	Remote Similarity	NPC107962
0.5684	Remote Similarity	NPC24960
0.5676	Remote Similarity	NPC194207
0.5676	Remote Similarity	NPC22779
0.5673	Remote Similarity	NPC305423
0.567	Remote Similarity	NPC481424
0.567	Remote Similarity	NPC481422
0.5641	Remote Similarity	NPC224314
0.5631	Remote Similarity	NPC485595
0.5577	Remote Similarity	NPC195297
0.5567	Remote Similarity	NPC485594
0.5556	Remote Similarity	NPC131693
0.5556	Remote Similarity	NPC475436
0.5505	Remote Similarity	NPC160888
0.5446	Remote Similarity	NPC475487
0.5431	Remote Similarity	NPC232054
0.5413	Remote Similarity	NPC6806
0.5405	Remote Similarity	NPC148965
0.5385	Remote Similarity	NPC486119
0.531	Remote Similarity	NPC13193
0.531	Remote Similarity	NPC309278
0.53	Remote Similarity	NPC177834
0.5273	Remote Similarity	NPC473633
0.5258	Remote Similarity	NPC481418
0.525	Remote Similarity	NPC198325
0.5248	Remote Similarity	NPC234352
0.5246	Remote Similarity	NPC233391
0.5234	Remote Similarity	NPC160426
0.5221	Remote Similarity	NPC475550
0.5208	Remote Similarity	NPC277715
0.52	Remote Similarity	NPC481425
0.52	Remote Similarity	NPC481426
0.5192	Remote Similarity	NPC54619
0.5164	Remote Similarity	NPC207243
0.5149	Remote Similarity	NPC325828
0.5138	Remote Similarity	NPC40440
0.5135	Remote Similarity	NPC471464
0.513	Remote Similarity	NPC63609
0.5124	Remote Similarity	NPC477807
0.5096	Remote Similarity	NPC206003
0.5096	Remote Similarity	NPC473610
0.5091	Remote Similarity	NPC476085
0.505	Remote Similarity	NPC226642

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC306131 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7677
0.1-0.2	1412
0.2-0.3	53
0.3-0.4	3
0.4-0.5	4
0.5-0.6	1
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5149	Remote Similarity	NPD8171	Phase 2

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data