NPASS Compound

Natural Product: NPC206003

Natural Product ID	NPC206003
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	DKEFDSJGKPNAQN-XDDGKFFLSA-N
IUPAC Name	n.a.
Synonyms	25(S)-Schidigera-Saponin D3
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL452382
PubChem CID	21603425
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000258] Steroids and steroid derivatives [CHEMONTID:0001013] Steroidal glycosides [CHEMONTID:0002364] Steroidal saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 137145 0 0 0 0 0 0 0 0999 V2000 -8.0562 0.2662 2.8717 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.8734 -0.3875 2.5282 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8553 0.5976 1.9962 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.7175 -0.1216 1.6733 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.8486 0.5536 0.8354 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7905 -0.3108 0.5755 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5632 0.1823 1.0015 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.0708 -0.7076 2.0729 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2102 -1.4026 1.9290 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9594 -1.1850 0.6510 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8022 0.2499 0.2363 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6465 0.5094 -0.1151 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2837 1.2477 1.2432 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6075 0.8119 1.8329 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2592 -0.2226 0.9953 C 0 0 2 0 0 0 0 0 0 0 0 0 2.3985 -1.5035 0.9165 C 0 0 2 0 0 0 0 0 0 0 0 0 2.9835 -2.3921 -0.1426 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4540 -2.5806 -0.0759 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2535 -1.3681 0.2611 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5714 -0.7002 1.4717 C 0 0 1 0 0 0 0 0 0 0 0 0 5.5789 0.2930 1.8876 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9062 -0.4356 1.6657 C 0 0 1 0 0 0 0 0 0 0 0 0 6.5864 -1.6771 0.8630 C 0 0 2 0 0 0 0 0 0 0 0 0 7.7187 -1.8258 -0.0910 C 0 0 2 0 0 0 0 0 0 0 0 0 8.5242 -3.0739 0.3015 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5795 -0.6311 0.2253 C 0 0 2 0 0 0 0 0 0 0 0 0 7.7625 0.2925 0.8723 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2167 -0.0084 -0.9960 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5983 0.5180 -0.6874 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7229 1.0613 0.7050 C 0 0 1 0 0 0 0 0 0 0 0 0 10.0516 0.1959 1.7460 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6123 -0.9607 1.1054 O 0 0 0 0 0 0 0 0 0 0 0 0 12.2037 1.2386 1.0222 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3139 -0.3703 -0.8659 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3699 -2.0526 -0.4424 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4243 0.9899 -0.4796 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8917 0.6030 -0.4943 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.4859 1.2269 0.7664 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.8664 1.1882 0.7822 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9936 -0.7784 -0.3680 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.6027 -1.4026 -1.4406 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7644 -2.0824 -1.1170 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9535 -3.2561 -1.8187 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.3683 -3.7380 -1.4780 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4916 -3.9605 -0.1102 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.9299 -4.2761 -1.3254 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.5641 -3.6778 -1.4839 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.5814 -2.2986 -2.1066 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.7397 -2.3460 -3.4890 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8671 -3.6571 -0.2599 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.0625 -5.4881 -1.9986 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3768 2.3798 -0.6280 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6788 2.7477 -1.7742 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5566 3.4838 -1.5260 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6913 4.8236 -1.3522 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7280 5.2624 -0.2493 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0233 4.5962 0.9455 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0605 5.3235 -1.0039 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1351 4.7006 -1.8695 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6154 3.5311 -2.6577 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.9929 3.9959 -3.8143 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2085 4.2869 -1.0970 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.0822 6.7049 -1.2803 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.8827 0.8623 3.6403 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4758 -0.9956 3.3660 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1140 -1.0787 1.6945 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6523 1.3220 2.8068 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4718 1.5013 1.3321 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8303 1.1810 1.4730 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8469 -1.4656 2.3955 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9903 -0.0788 3.0262 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9018 -1.1765 2.7921 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0395 -2.5105 2.0136 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3832 0.3964 -0.6975 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7247 1.5851 -0.3670 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8457 -0.0228 -1.0677 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5545 1.4475 2.0506 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3768 2.2259 0.6947 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5438 0.5591 2.9013 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2738 1.7245 1.7981 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3269 0.1331 -0.0541 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5591 -2.0113 1.8943 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5272 -3.4118 0.0379 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6849 -2.1262 -1.1750 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7942 -2.9723 -1.0663 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7350 -3.3781 0.6553 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4113 -1.4664 2.2597 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5436 1.2764 1.4275 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4547 0.4568 2.9936 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3480 -0.7082 2.6495 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4533 -2.5625 1.5201 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4731 -1.9571 -1.1391 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0888 -2.9000 1.2402 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2096 -3.3766 -0.5100 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8472 -3.9266 0.4970 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2645 -0.6850 -1.8485 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5887 0.8904 -1.2587 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3931 -0.2303 -0.9019 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7863 1.3668 -1.4050 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2781 2.0910 0.7787 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2046 0.7541 2.2399 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7829 -0.0673 2.5433 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7634 0.2972 1.0009 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6753 1.9239 0.2913 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3492 1.6894 2.0226 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2083 0.6846 -0.5370 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2277 -0.4061 -1.4704 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4799 -0.5683 -1.5705 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6840 -1.7001 -1.4370 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5451 -3.1333 -0.2621 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7415 -1.9373 -0.4006 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8803 0.4852 -1.3152 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3083 1.0054 -1.4129 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1716 2.2884 0.7639 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1854 1.9092 0.1631 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8735 -0.6132 -2.1702 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8530 -3.1299 -2.8952 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4835 -4.7022 -1.9979 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0874 -2.9978 -1.8381 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0904 -3.3511 0.3563 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1260 -4.3812 -0.2329 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9732 -4.3188 -2.1670 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5820 -1.8565 -1.9190 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9960 -2.8380 -3.8801 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4249 -4.0930 0.4225 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8890 -6.2010 -1.3218 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3426 1.8274 -2.3124 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3619 5.3891 -2.2718 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6928 5.0628 -0.5776 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8039 6.3611 -0.0996 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6480 5.0613 1.7256 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2631 5.2300 0.0838 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5509 5.4252 -2.6158 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4458 2.8190 -2.9259 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1448 3.4819 -3.9249 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0749 4.6279 -1.3990 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3025 7.0107 -1.7737 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 24 26 1 0 26 27 1 1 26 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 30 33 1 0 19 34 1 6 10 35 1 6 5 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 37 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 43 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 47 50 1 0 46 51 1 0 36 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 55 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 59 62 1 0 58 63 1 0 38 3 1 0 48 41 1 0 60 53 1 0 12 7 1 0 20 15 1 0 27 22 1 0 16 10 1 0 23 19 1 0 32 26 1 0 1 64 1 0 2 65 1 0 2 66 1 0 3 67 1 1 5 68 1 1 7 69 1 1 8 70 1 0 8 71 1 0 9 72 1 0 9 73 1 0 11 74 1 6 12 75 1 0 12 76 1 0 13 77 1 0 13 78 1 0 14 79 1 0 14 80 1 0 15 81 1 6 16 82 1 1 17 83 1 0 17 84 1 0 18 85 1 0 18 86 1 0 20 87 1 1 21 88 1 0 21 89 1 0 22 90 1 1 23 91 1 1 24 92 1 6 25 93 1 0 25 94 1 0 25 95 1 0 28 96 1 0 28 97 1 0 29 98 1 0 29 99 1 0 30100 1 6 31101 1 0 31102 1 0 33103 1 0 33104 1 0 33105 1 0 34106 1 0 34107 1 0 34108 1 0 35109 1 0 35110 1 0 35111 1 0 36112 1 6 37113 1 6 38114 1 6 39115 1 0 41116 1 6 43117 1 6 44118 1 0 44119 1 0 45120 1 0 46121 1 1 47122 1 6 48123 1 6 49124 1 0 50125 1 0 51126 1 0 53127 1 6 55128 1 6 56129 1 0 56130 1 0 57131 1 0 58132 1 1 59133 1 6 60134 1 6 61135 1 0 62136 1 0 63137 1 0 M END

Standard InCHIKey	DKEFDSJGKPNAQN-XDDGKFFLSA-N
Standard InCHI	InChI=1S/C45H74O18/c1-19-7-12-45(56-18-19)20(2)30-26(63-45)14-25-23-6-5-21-13-22(8-10-43(21,3)24(23)9-11-44(25,30)4)57-42-39(62-41-37(55)35(53)32(50)28(16-47)59-41)38(33(51)29(17-48)60-42)61-40-36(54)34(52)31(49)27(15-46)58-40/h19-42,46-55H,5-18H2,1-4H3/t19-,20-,21+,22-,23+,24-,25-,26-,27+,28+,29+,30-,31+,32+,33-,34-,35-,36+,37+,38-,39+,40-,41-,42+,43-,44-,45+/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@@H](C2)CC[C@@H]2[C@@H]3CC[C@]3([C@H]2C[C@H]2[C@@H]3[C@H](C)[C@]3(O2)CC[C@@H](CO3)C)C)C)[C@@H]([C@H]([C@H]1O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	902.49	Volume:	868.092 ? Van der Waals volume.
Dense:	1.04	LogP:	1.831 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	2.672 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.762 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	9.0	Rigid Bonds:	48.0
TPSA:	276.14 ? Topological Polar Surface Area.	H-Bond Acceptor:	18.0
H-Bond Donor:	10.0	Rings:	9.0
Heavy Atoms:	18.0

MedChem Properties

QED Drug-Likeness Score:	0.128	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.689	Fsp³:	1.0
MCE-18:	230.667 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.7	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.022 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.309	Promiscuous compounds:	0.018

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.327	MDCK Permeability:	-5.103
Pgp-inhibitor:	0.0	Pgp-substrate:	0.236
PAMPA:	0.98 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.002
20% Bioavailability (F20%):	0.096	30% Bioavailability (F30%):	0.997
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.003	MRP1:	0.028
Plasma Protein Binding (PPB):	57.971%	Volume Distribution (VD):	-0.384
Fu:	32.307% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.039
BSEP inhibitor:	0.006

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.998	CYP3A4-substrate:	0.995
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.007
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.184

Half-life (T1/2):

2.929

ADMET: Toxicity

hERG Blockers:	0.006	hERG Blockers (10um):	0.01
Human Hepatotoxicity (H-HT):	0.713	Drug-induced Liver Injury (DILI):	0.986
AMES Toxicity:	0.975	Rat Oral Acute Toxicity:	0.002
Maximum Recommended Daily Dose:	0.002	Skin Sensitization:	1.0
Carcinogencity:	0.186	Eye Corrosion:	0.0
Eye Irritation:	0.001	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.49	Drug-induced Nephrotoxicity:	0.909
Genotoxicity:	0.001	RPMI-8226 Immunitoxicity:	0.218
A549 Cytotoxicity:	0.958	Hek293 Cytotoxicity:	0.857
BCF:	1.649 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.374 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.496 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.906 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[10757713]
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	bark	n.a.	n.a.	PMID[15165156]
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO1943	Yucca schidigera	Species	Asparagaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
MIC	6

Activity Type	# Activity
Organism	6

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT20	Organism	Candida albicans	Candida albicans	MIC	=	25.0	ug.mL-1	PMID[11806727]
NPT312	Organism	Saccharomyces cerevisiae	Saccharomyces cerevisiae	MIC	=	12.5	ug.mL-1	PMID[11858749]
NPT772	Organism	Pichia anomala	Wickerhamomyces anomalus	MIC	=	3.13	ug.mL-1	DOI[10.6019/CHEMBL1201861]
NPT5427	Organism	Hanseniaspora uvarum	Hanseniaspora uvarum	MIC	=	50.0	ug.mL-1	PMID[7334384]
NPT5425	Organism	Pichia nakazawae	Pichia nakazawae	MIC	=	6.25	ug.mL-1	PMID[23734721]
NPT5426	Organism	Debaryomyces hansenii	Debaryomyces hansenii	MIC	=	6.25	ug.mL-1	PMID[20041704]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC206003 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	28082
0.1-0.2	18691
0.2-0.3	2498
0.3-0.4	333
0.4-0.5	98
0.5-0.6	75
0.6-0.7	40
0.7-0.8	1
0.8-0.85	8
0.85-0.9	1
0.9-0.95	1
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC473610
0.9176	High Similarity	NPC475351
0.8605	High Similarity	NPC125324
0.837	Intermediate Similarity	NPC97700
0.837	Intermediate Similarity	NPC184617
0.837	Intermediate Similarity	NPC30856
0.8095	Intermediate Similarity	NPC297348
0.8095	Intermediate Similarity	NPC249204
0.8095	Intermediate Similarity	NPC48339
0.8095	Intermediate Similarity	NPC141769
0.8095	Intermediate Similarity	NPC477547
0.7957	Intermediate Similarity	NPC51172
0.7957	Intermediate Similarity	NPC49032
0.7882	Intermediate Similarity	NPC325828
0.7791	Intermediate Similarity	NPC234352
0.7778	Intermediate Similarity	NPC132080
0.7778	Intermediate Similarity	NPC6295
0.7708	Intermediate Similarity	NPC475319
0.7701	Intermediate Similarity	NPC477451
0.7634	Intermediate Similarity	NPC473601
0.7609	Intermediate Similarity	NPC160426
0.7579	Intermediate Similarity	NPC300557
0.7551	Intermediate Similarity	NPC116756
0.7475	Intermediate Similarity	NPC232037
0.7473	Intermediate Similarity	NPC107962
0.7444	Intermediate Similarity	NPC211354
0.7444	Intermediate Similarity	NPC107188
0.7444	Intermediate Similarity	NPC19400
0.74	Intermediate Similarity	NPC470864
0.7368	Intermediate Similarity	NPC602423
0.7172	Intermediate Similarity	NPC115165
0.7143	Intermediate Similarity	NPC128572
0.7087	Intermediate Similarity	NPC233433
0.7048	Intermediate Similarity	NPC470866
0.699	Remote Similarity	NPC83137
0.6848	Remote Similarity	NPC250393
0.6837	Remote Similarity	NPC475643
0.6731	Remote Similarity	NPC108072
0.6699	Remote Similarity	NPC309278
0.6667	Remote Similarity	NPC485594
0.6636	Remote Similarity	NPC220836
0.6634	Remote Similarity	NPC151134
0.663	Remote Similarity	NPC294686
0.6604	Remote Similarity	NPC477811
0.6538	Remote Similarity	NPC475625
0.6538	Remote Similarity	NPC473518
0.6522	Remote Similarity	NPC177834
0.6509	Remote Similarity	NPC476112
0.6509	Remote Similarity	NPC307534
0.6495	Remote Similarity	NPC485595
0.6476	Remote Similarity	NPC232611
0.6429	Remote Similarity	NPC195297
0.6373	Remote Similarity	NPC471464
0.6364	Remote Similarity	NPC94086
0.6364	Remote Similarity	NPC473817
0.6355	Remote Similarity	NPC470862
0.6339	Remote Similarity	NPC477808
0.6316	Remote Similarity	NPC222731
0.6275	Remote Similarity	NPC92890
0.6264	Remote Similarity	NPC24960
0.6239	Remote Similarity	NPC31896
0.6237	Remote Similarity	NPC181845
0.623	Remote Similarity	NPC481189
0.6154	Remote Similarity	NPC480555
0.6154	Remote Similarity	NPC150372
0.6122	Remote Similarity	NPC264101
0.6116	Remote Similarity	NPC329807
0.6095	Remote Similarity	NPC98018
0.6095	Remote Similarity	NPC284104
0.6095	Remote Similarity	NPC103616
0.605	Remote Similarity	NPC481190
0.604	Remote Similarity	NPC113044
0.604	Remote Similarity	NPC283829
0.604	Remote Similarity	NPC161676
0.5981	Remote Similarity	NPC470863
0.5979	Remote Similarity	NPC474399
0.5965	Remote Similarity	NPC477807
0.5934	Remote Similarity	NPC277715
0.592	Remote Similarity	NPC329727
0.5868	Remote Similarity	NPC330026
0.5865	Remote Similarity	NPC470433
0.5865	Remote Similarity	NPC46190
0.5865	Remote Similarity	NPC171073
0.5862	Remote Similarity	NPC210569
0.5856	Remote Similarity	NPC480553
0.581	Remote Similarity	NPC477809
0.5728	Remote Similarity	NPC14704
0.5714	Remote Similarity	NPC84111
0.5714	Remote Similarity	NPC287483
0.5714	Remote Similarity	NPC470865
0.5702	Remote Similarity	NPC470867
0.57	Remote Similarity	NPC54619
0.5686	Remote Similarity	NPC470432
0.5686	Remote Similarity	NPC230507
0.5676	Remote Similarity	NPC480554
0.5638	Remote Similarity	NPC473774
0.5638	Remote Similarity	NPC481419
0.5638	Remote Similarity	NPC481417
0.5631	Remote Similarity	NPC141433
0.5612	Remote Similarity	NPC291203
0.5612	Remote Similarity	NPC217205
0.5565	Remote Similarity	NPC262050
0.5545	Remote Similarity	NPC269297
0.5545	Remote Similarity	NPC222202
0.5512	Remote Similarity	NPC329820
0.5495	Remote Similarity	NPC475333
0.5495	Remote Similarity	NPC224098
0.5495	Remote Similarity	NPC208383
0.5446	Remote Similarity	NPC194207
0.5446	Remote Similarity	NPC22779
0.5446	Remote Similarity	NPC121453
0.5437	Remote Similarity	NPC215408
0.5424	Remote Similarity	NPC473505
0.537	Remote Similarity	NPC248746
0.5364	Remote Similarity	NPC102016
0.5364	Remote Similarity	NPC95051
0.5339	Remote Similarity	NPC480556
0.5328	Remote Similarity	NPC305771
0.5328	Remote Similarity	NPC263359
0.5328	Remote Similarity	NPC94072
0.5328	Remote Similarity	NPC169816
0.5327	Remote Similarity	NPC202898
0.5321	Remote Similarity	NPC6806
0.5319	Remote Similarity	NPC144790
0.5319	Remote Similarity	NPC149400
0.5312	Remote Similarity	NPC481420
0.5312	Remote Similarity	NPC481421
0.5304	Remote Similarity	NPC92297
0.5294	Remote Similarity	NPC128123
0.5294	Remote Similarity	NPC248944
0.5294	Remote Similarity	NPC7479
0.5294	Remote Similarity	NPC257296
0.5225	Remote Similarity	NPC294129
0.5214	Remote Similarity	NPC232054
0.5182	Remote Similarity	NPC274200
0.5179	Remote Similarity	NPC51520
0.5179	Remote Similarity	NPC303069
0.513	Remote Similarity	NPC218571
0.513	Remote Similarity	NPC487615
0.5096	Remote Similarity	NPC306131
0.5096	Remote Similarity	NPC200802
0.5088	Remote Similarity	NPC470861
0.5088	Remote Similarity	NPC32361
0.5088	Remote Similarity	NPC13193
0.5082	Remote Similarity	NPC15918
0.5081	Remote Similarity	NPC244431
0.5047	Remote Similarity	NPC70204
0.5045	Remote Similarity	NPC42171
0.5041	Remote Similarity	NPC224314

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC206003 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7770
0.1-0.2	1288
0.2-0.3	79
0.3-0.4	7
0.4-0.5	1
0.5-0.6	2
0.6-0.7	1
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.7882	Intermediate Similarity	NPD8171	Phase 2
0.6667	Remote Similarity	NPD8170	Phase 2
0.5294	Remote Similarity	NPD6928	Phase 2
0.5208	Remote Similarity	NPD7991	Discontinued

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data