NPASS Compound

Natural Product: NPC471375

Natural Product ID	NPC471375
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	ZFPSHUSKOFTYNL-FYRRPLJSSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2420030
PubChem CID	73353730
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 165174 0 0 0 0 0 0 0 0999 V2000 9.2257 -5.1933 -1.0992 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9730 -3.7983 -1.5299 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1230 -3.5568 -2.7615 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5905 -2.7638 -0.7148 O 0 0 0 0 0 0 0 0 0 0 0 0 8.3747 -1.4673 -1.2597 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3872 -0.5701 -0.5765 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1221 0.8921 -0.7723 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7073 1.2643 -0.3183 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0319 0.0596 0.0987 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9749 -1.0719 -0.9294 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3232 -2.0768 0.0278 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6215 -1.3685 0.9411 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6326 0.0139 0.6031 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5495 0.7061 1.9071 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3196 1.4738 2.2172 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1446 0.9418 1.3881 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7929 1.2991 1.8078 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8779 0.0781 1.6767 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3069 0.3226 0.7600 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0654 1.4370 1.5077 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2981 2.6536 1.4090 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1908 2.4909 1.1086 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5292 2.5912 -0.3274 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4531 1.5610 -0.9177 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5751 1.2895 -0.0233 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5167 0.1611 -0.3805 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0167 0.2883 -1.8154 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0902 -0.7480 -2.0741 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7609 -0.3689 -3.2384 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6526 -1.1048 -0.4298 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3052 2.6522 -0.0272 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9261 3.5069 0.2763 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5166 3.5083 2.6717 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3770 1.5513 1.1624 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2796 0.7341 1.6409 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2816 0.2922 0.6325 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3830 -1.1824 0.7251 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4042 -1.4293 2.2642 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7529 -0.2406 3.0708 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0347 0.9499 2.7954 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3986 -2.4082 2.4953 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8112 -3.5905 2.9586 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0380 -4.7140 1.9770 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3229 -5.9444 2.4714 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4386 -6.1876 3.9370 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4260 -4.9152 4.7189 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3116 -3.9620 4.1867 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.6136 -5.1301 6.1878 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7106 -6.0903 6.6185 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.5740 -6.9526 4.2296 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9547 -5.7958 2.1650 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3908 -5.0324 1.8621 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2384 -1.7646 0.2377 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2953 0.9431 -0.5751 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4943 1.4845 -0.8851 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9330 1.3395 -2.2747 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4841 1.2194 -2.1611 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.8829 2.5148 -1.5040 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9687 3.1518 -0.5498 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5981 2.9108 -0.6597 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3870 2.9429 0.8910 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5874 3.8425 1.6442 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0702 2.2177 -0.7747 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.0748 1.0918 -3.3892 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3808 0.4204 -3.1054 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1365 0.9948 -4.3422 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7346 1.0396 -4.8254 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6902 2.1469 -5.8843 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0727 2.3841 -6.4638 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9206 1.1372 -6.4958 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8942 0.3767 -5.3480 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8841 2.7956 -7.8048 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2703 3.3376 -5.2999 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8441 1.3945 -3.8153 O 0 0 0 0 0 0 0 0 0 0 0 0 1.8486 1.5963 3.3086 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1781 1.6633 0.0146 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3557 1.2237 -2.2388 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3593 -5.2993 -0.0133 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0822 -5.6686 -1.6251 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3220 -5.7875 -1.4397 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5800 -1.5273 -2.3294 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3744 -0.7722 -1.0909 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5482 -0.8753 0.4791 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8545 1.9193 0.5835 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3111 1.9031 -1.0931 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6457 -0.3867 0.9373 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8917 -2.9416 -0.4470 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2227 -2.4906 0.5960 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8222 0.0286 2.7834 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4276 1.4259 1.9762 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1210 1.3382 3.3308 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4238 2.5785 2.1564 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2669 -0.1618 1.6118 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4097 -0.1685 2.6699 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4027 -0.8312 1.3837 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0983 0.5003 -0.2558 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9483 -0.5870 0.9389 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0984 0.9441 2.5191 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6335 3.3777 1.6321 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0065 3.6045 -0.5703 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6402 2.6146 -1.0139 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9113 2.0714 -1.8436 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8813 0.7642 -1.3478 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1597 0.0026 -2.4877 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2501 1.3026 -2.1123 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6022 -1.7300 -2.3598 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1437 -1.1515 -3.7053 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9724 -1.8050 -1.2401 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6059 -0.9142 -0.6128 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6917 -1.6945 0.5161 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7313 3.4109 0.5031 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3504 3.0058 -1.1037 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2995 2.6524 0.3307 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3616 2.9080 -0.5126 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7358 4.1061 0.7289 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1757 4.2487 -0.0868 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4146 4.0159 2.9879 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2331 4.3628 2.4652 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0282 2.9412 3.4728 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6507 -0.1609 2.0450 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3508 0.5972 1.0525 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3172 -1.6004 0.2992 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4644 -1.8699 2.5797 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8392 -0.0412 3.1862 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4103 -0.4848 4.1292 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7363 -3.4338 3.0421 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6302 -4.4765 0.9743 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6394 -6.8557 1.9050 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5633 -6.7897 4.2517 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4106 -4.4546 4.5575 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3751 -4.1544 6.7089 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6680 -5.3349 6.4350 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8835 -6.0380 6.0659 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0334 -7.2298 3.3996 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7772 -5.5177 1.2546 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9305 -4.7261 2.6241 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2599 -2.7315 0.0911 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2988 1.0641 -0.1766 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8872 2.3559 -2.8270 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6876 0.3980 -1.4630 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2114 3.2008 -2.3308 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0745 4.2773 -0.6986 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4498 3.2872 1.0749 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3412 1.9224 1.2496 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1115 4.2041 2.4056 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5160 3.1009 -0.6439 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5420 0.2160 -3.4152 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5067 2.0714 -4.3509 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4597 0.0716 -5.2883 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9916 1.8748 -6.6931 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5403 3.2210 -5.9442 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9931 1.4744 -6.6328 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6888 0.5031 -7.3874 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1184 3.7218 -7.9670 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9284 3.7791 -4.7257 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2531 1.5787 -2.9562 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3199 0.6874 3.7994 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8495 1.6088 3.7888 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3442 2.5410 3.5178 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0319 0.9639 0.2242 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7894 2.0841 0.9528 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6251 2.4706 -0.6294 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3880 0.2811 -2.8148 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4590 1.8177 -2.6040 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2658 1.8305 -2.3810 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 26 30 1 0 25 31 1 0 21 32 1 0 21 33 1 0 20 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 38 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 45 50 1 0 44 51 1 0 43 52 1 0 37 53 1 0 36 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 59 61 1 0 61 62 1 0 58 63 1 0 57 64 1 0 56 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 69 72 1 0 68 73 1 0 67 74 1 0 17 75 1 0 7 76 1 0 7 77 1 0 10 5 1 0 71 66 1 0 13 9 1 0 28 10 1 0 26 13 1 0 25 16 1 0 22 17 1 0 40 35 1 0 47 42 1 0 60 55 1 0 1 78 1 0 1 79 1 0 1 80 1 0 5 81 1 0 6 82 1 0 6 83 1 0 8 84 1 0 8 85 1 0 9 86 1 0 11 87 1 0 11 88 1 0 14 89 1 0 14 90 1 0 15 91 1 0 15 92 1 0 16 93 1 0 18 94 1 0 18 95 1 0 19 96 1 0 19 97 1 0 20 98 1 0 22 99 1 0 23100 1 0 23101 1 0 24102 1 0 24103 1 0 27104 1 0 27105 1 0 28106 1 0 29107 1 0 30108 1 0 30109 1 0 30110 1 0 31111 1 0 31112 1 0 31113 1 0 32114 1 0 32115 1 0 32116 1 0 33117 1 0 33118 1 0 33119 1 0 35120 1 0 36121 1 0 37122 1 0 38123 1 0 39124 1 0 39125 1 0 42126 1 0 43127 1 0 44128 1 0 45129 1 0 46130 1 0 48131 1 0 48132 1 0 49133 1 0 50134 1 0 51135 1 0 52136 1 0 53137 1 0 55138 1 0 56139 1 0 57140 1 0 58141 1 0 59142 1 0 61143 1 0 61144 1 0 62145 1 0 63146 1 0 64147 1 0 66148 1 0 67149 1 0 68150 1 0 69151 1 0 70152 1 0 70153 1 0 72154 1 0 73155 1 0 74156 1 0 75157 1 0 75158 1 0 75159 1 0 76160 1 0 76161 1 0 76162 1 0 77163 1 0 77164 1 0 77165 1 0 M END

Standard InCHIKey	ZFPSHUSKOFTYNL-FYRRPLJSSA-N
Standard InCHI	InChI=1S/C54H88O23/c1-23(57)71-33-17-48(2,3)15-30-53(33)22-70-54(30)14-10-29-50(6)12-11-32(49(4,5)28(50)9-13-51(29,7)52(54,8)16-31(53)59)75-46-42(37(63)27(21-69-46)74-45-41(67)38(64)35(61)25(18-55)72-45)77-47-43(39(65)36(62)26(19-56)73-47)76-44-40(66)34(60)24(58)20-68-44/h24-47,55-56,58-67H,9-22H2,1-8H3/t24-,25-,26-,27+,28+,29-,30-,31-,32+,33+,34+,35-,36-,37+,38+,39+,40-,41-,42-,43-,44+,45+,46+,47+,50+,51-,52+,53+,54+/m1/s1
SMILES	CC(=O)OC1CC(CC2C13COC24CCC5C6(CCC(C(C6CCC5(C4(CC3O)C)C)(C)C)OC7C(C(C(CO7)OC8C(C(C(C(O8)CO)O)O)O)O)OC9C(C(C(C(O9)CO)O)O)OC1C(C(C(CO1)O)O)O)C)(C)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1104.57	Volume:	1056.514 ? Van der Waals volume.
Dense:	1.045	LogP:	-0.057 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.057 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.212 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	12.0	Rigid Bonds:	54.0
TPSA:	352.13 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	12.0	Rings:	10.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.082	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.908	Fsp³:	0.981
MCE-18:	289.084 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.023	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.136 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.372	Promiscuous compounds:	0.005

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.565	MDCK Permeability:	-4.974
Pgp-inhibitor:	0.0	Pgp-substrate:	0.97
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.994
20% Bioavailability (F20%):	0.109	30% Bioavailability (F30%):	0.99
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.006	MRP1:	1.0
Plasma Protein Binding (PPB):	31.235%	Volume Distribution (VD):	-0.549
Fu:	36.884% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	0.0
OATP1B3 inhibitor:	0.083	BCRP inhibitor:	0.0
BSEP inhibitor:	0.045

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.998	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.843	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.339	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.0
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.384

Half-life (T1/2):

3.651

ADMET: Toxicity

hERG Blockers:	0.025	hERG Blockers (10um):	0.316
Human Hepatotoxicity (H-HT):	0.407	Drug-induced Liver Injury (DILI):	0.287
AMES Toxicity:	0.694	Rat Oral Acute Toxicity:	0.126
Maximum Recommended Daily Dose:	0.228	Skin Sensitization:	0.02
Carcinogencity:	0.021	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.332	Ototoxicity:	1.0
Hematotoxicity:	0.002	Drug-induced Nephrotoxicity:	0.033
Genotoxicity:	0.003	RPMI-8226 Immunitoxicity:	0.183
A549 Cytotoxicity:	0.015	Hek293 Cytotoxicity:	0.83
BCF:	1.06 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	4.514 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	6.726 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.899 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO33016	lysimachia parvifolia	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[23911853]
NPO33016	lysimachia parvifolia	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	6

Activity Type	# Activity
Cell line	5
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2015	Cell line	U-266	Homo sapiens	IC50	=	8830.0	nM	PMID[9170288]
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	6800.0	nM	PMID[15104493]
NPT515	Cell line	SGC-7901	Homo sapiens	IC50	=	7690.0	nM	PMID[17008103]
NPT81	Cell line	A549	Homo sapiens	IC50	=	5280.0	nM	DrugMatrix in vitro pharmacology data
NPT65	Cell line	HepG2	Homo sapiens	IC50	=	4920.0	nM	PMID[19188377]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	5880.0	nM	PMID[23911853]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC471375 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	25548
0.1-0.2	20721
0.2-0.3	2596
0.3-0.4	701
0.4-0.5	229
0.5-0.6	12
0.6-0.7	25
0.7-0.8	0
0.8-0.85	3
0.85-0.9	1
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.92	High Similarity	NPC471374
0.8558	High Similarity	NPC51579
0.8252	Intermediate Similarity	NPC77717
0.8019	Intermediate Similarity	NPC138219
0.8019	Intermediate Similarity	NPC475234
0.783	Intermediate Similarity	NPC471373
0.7615	Intermediate Similarity	NPC473688
0.7549	Intermediate Similarity	NPC18724
0.7477	Intermediate Similarity	NPC253611
0.7477	Intermediate Similarity	NPC488782
0.7387	Intermediate Similarity	NPC209798
0.7364	Intermediate Similarity	NPC475630
0.7364	Intermediate Similarity	NPC273189
0.7238	Intermediate Similarity	NPC158051
0.7182	Intermediate Similarity	NPC40716
0.7143	Intermediate Similarity	NPC224003
0.713	Intermediate Similarity	NPC262567
0.7091	Intermediate Similarity	NPC267238
0.7069	Intermediate Similarity	NPC471425
0.7043	Intermediate Similarity	NPC205129
0.7009	Intermediate Similarity	NPC189575
0.6944	Remote Similarity	NPC323231
0.6917	Remote Similarity	NPC471427
0.6917	Remote Similarity	NPC471426
0.6891	Remote Similarity	NPC231566
0.6875	Remote Similarity	NPC148593
0.6833	Remote Similarity	NPC106701
0.6807	Remote Similarity	NPC471429
0.6757	Remote Similarity	NPC119628
0.6667	Remote Similarity	NPC184805
0.6667	Remote Similarity	NPC126753
0.6667	Remote Similarity	NPC471431
0.6637	Remote Similarity	NPC207693
0.6579	Remote Similarity	NPC157571
0.6429	Remote Similarity	NPC171741
0.629	Remote Similarity	NPC22709
0.6261	Remote Similarity	NPC158367
0.624	Remote Similarity	NPC471424
0.6186	Remote Similarity	NPC609281
0.6167	Remote Similarity	NPC610204
0.6111	Remote Similarity	NPC471430
0.6068	Remote Similarity	NPC470623
0.6047	Remote Similarity	NPC471428
0.6033	Remote Similarity	NPC610461
0.6016	Remote Similarity	NPC470622
0.6016	Remote Similarity	NPC471626
0.5902	Remote Similarity	NPC607904
0.5887	Remote Similarity	NPC603137
0.576	Remote Similarity	NPC609305
0.575	Remote Similarity	NPC606145
0.563	Remote Similarity	NPC267637
0.561	Remote Similarity	NPC606553
0.5492	Remote Similarity	NPC87393
0.544	Remote Similarity	NPC185466
0.5159	Remote Similarity	NPC207738
0.5124	Remote Similarity	NPC159005
0.5115	Remote Similarity	NPC66513
0.5077	Remote Similarity	NPC477465

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC471375 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7606
0.1-0.2	1502
0.2-0.3	39
0.3-0.4	3
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data