NPASS Compound

Natural Product: NPC157571

Natural Product ID	NPC157571
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Ardisianoside J
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL374984
PubChem CID	16109783
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 160169 0 0 0 0 0 0 0 0999 V2000 -8.2803 -1.8018 5.2544 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.7590 -1.5296 3.8455 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.2720 -1.4886 3.8864 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.8330 -1.0629 2.5507 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.1308 0.2296 2.1823 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.6412 -0.0597 2.1037 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.2315 -0.3045 3.4275 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3788 -1.2115 1.3877 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5067 -1.0148 0.3127 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.2951 -1.3464 -0.9306 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3602 -1.6543 -2.0872 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5414 -2.8800 -1.7236 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.2731 -2.9020 -2.5125 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4685 -1.8527 -2.1669 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3013 -2.9874 -0.3917 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3089 -1.9043 0.4012 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1495 -1.1451 0.1861 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3694 -1.0766 1.3231 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1011 -1.8906 1.0923 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1188 -1.2951 1.8792 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6961 -0.0740 1.2702 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8448 0.7973 0.9619 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.0299 0.3019 1.7870 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.0952 1.1636 1.5644 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5792 2.1272 1.1326 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8266 2.8958 -0.0021 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.8886 3.9155 0.2930 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3123 5.2912 0.2860 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.6425 5.5994 -1.0409 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9653 4.3451 -1.5753 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7509 4.6483 -2.4182 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2744 5.2267 -1.6774 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7004 3.4656 -0.5286 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6298 5.9963 -1.9318 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5263 5.5886 1.3823 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9134 3.8886 -0.6631 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9156 -0.4812 0.1916 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4510 -0.3495 0.4445 C 0 0 1 0 0 0 0 0 0 0 0 0 1.0516 -1.7158 0.5872 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4986 -1.8582 0.3486 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0181 -1.1155 -0.8873 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5110 -1.8255 -2.0805 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5837 0.2970 -0.7348 C 0 0 1 0 0 0 0 0 0 0 0 0 3.1247 1.0876 -1.8809 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6369 1.1228 -1.8865 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2757 -0.1954 -1.6283 C 0 0 2 0 0 0 0 0 0 0 0 0 5.4318 -0.8624 -2.9715 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5230 -1.1130 -0.7288 C 0 0 2 0 0 0 0 0 0 0 0 0 5.1311 -2.4745 -0.6759 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5940 -2.4343 -0.4352 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3452 -1.2649 -0.9269 C 0 0 2 0 0 0 0 0 0 0 0 0 8.6918 -1.2733 -0.3183 C 0 0 2 0 0 0 0 0 0 0 0 0 8.9375 -0.9668 1.0697 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4054 -1.3465 1.3472 C 0 0 2 0 0 0 0 0 0 0 0 0 11.0665 -0.3171 2.2607 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1833 -1.5284 0.0833 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8785 -0.5034 -0.9905 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4445 -0.3884 -1.3076 C 0 0 2 0 0 0 0 0 0 0 0 0 8.9048 1.0183 -1.3430 C 0 0 1 0 0 0 0 0 0 0 0 0 7.4690 1.0530 -1.7088 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6317 0.0428 -0.9429 C 0 0 1 0 0 0 0 0 0 0 0 0 6.4114 0.6375 0.4199 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2540 1.7462 -0.2161 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9945 -1.0483 -2.5525 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6727 -1.1153 -3.6054 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7242 -1.5436 -2.2929 O 0 0 0 0 0 0 0 0 0 0 0 0 10.4430 -2.6382 2.0919 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9966 -3.6370 1.6765 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1471 0.5738 -0.4679 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0696 1.9959 0.0775 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3557 0.6193 -1.7608 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1400 -1.9706 -3.1799 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1691 -0.3499 -1.3102 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.3207 1.1290 3.2251 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1963 -0.8178 2.6713 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7244 -2.7553 4.2368 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0036 -1.3619 5.9720 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2546 -1.4292 5.4195 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3243 -2.9110 5.4371 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4270 -2.3288 3.1803 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6317 -0.7828 4.6546 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6156 -1.8264 1.7799 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5129 0.6940 1.2625 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1415 0.8412 1.7455 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1932 0.0528 0.2409 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8271 -2.3160 -0.7059 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.6743 -0.8194 -2.2288 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1748 -3.7983 -1.9996 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5548 -2.8224 -3.5866 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7355 -3.8851 -2.3634 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3933 -1.2019 -2.9178 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3031 -2.2667 1.4841 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9068 -1.6069 2.1339 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2769 -2.9033 1.4930 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7546 -1.8678 0.0617 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0512 0.3613 2.0602 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1627 0.6638 -0.1025 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8173 0.3451 2.8693 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8008 1.0821 2.2658 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2353 2.2398 -0.8343 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2996 3.7432 1.3146 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1911 5.9992 0.3545 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9073 6.3948 -0.9447 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7058 3.8468 -2.2325 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4460 3.7045 -2.9002 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9937 5.3596 -3.2345 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1529 5.1032 -2.1061 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0932 5.2565 -2.3729 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5766 5.3324 1.2818 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8055 3.9125 -0.2165 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4992 0.0810 1.4861 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4870 -2.3884 -0.1254 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8337 -2.1506 1.5908 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6777 -2.9684 0.2213 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1342 -1.5505 1.1964 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6296 -2.4842 -1.8146 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1269 -1.1772 -2.8954 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2278 -2.5190 -2.5740 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1449 0.6731 0.1800 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7733 0.7523 -2.8751 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7849 2.1414 -1.7645 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9796 1.9551 -1.2374 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9022 1.4881 -2.9280 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4480 -0.6683 -3.5028 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5292 -1.9402 -2.9552 H 0 0 0 0 0 0 0 0 0 0 0 0 6.1814 -0.4090 -3.6253 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6593 -0.7213 0.3288 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8246 -3.1576 -1.4930 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7021 -2.9751 0.2487 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8766 -2.5737 0.6520 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0307 -3.3541 -0.9309 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1152 -2.3068 -0.5267 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8387 0.0591 1.4209 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3121 -1.5973 1.7240 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9329 0.6686 1.7678 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1093 -0.6250 2.3699 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5020 -0.2835 3.2008 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2709 -1.3757 0.3468 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1326 -2.5742 -0.3043 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5485 -0.7089 -1.8296 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2296 0.4804 -0.5597 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4647 1.5197 -2.1899 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3570 1.0124 -2.7844 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0820 2.0725 -1.4064 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1139 1.5003 0.6377 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4568 -0.1366 1.2223 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4305 1.1387 0.5608 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1311 2.1693 -0.2666 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9398 -2.6896 3.0740 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0523 2.2270 0.5546 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2468 2.0773 0.8234 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9250 2.6759 -0.7740 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0182 -0.3847 -2.0807 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8219 1.2188 -2.5434 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6023 1.1565 -1.5028 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7840 -1.4559 -3.9595 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7447 -0.7268 -2.0242 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7870 1.9513 2.9296 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4036 0.0983 2.3345 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4696 -3.4520 3.5792 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 12 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 22 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 30 33 1 0 29 34 1 0 28 35 1 0 27 36 1 0 21 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 6 41 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 6 46 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 1 54 56 1 0 56 57 1 0 58 57 1 1 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 1 59 63 1 0 58 64 1 0 64 65 2 0 64 66 1 0 54 67 1 0 67 68 2 0 43 69 1 0 69 70 1 0 69 71 1 0 11 72 1 0 10 73 1 0 5 74 1 0 4 75 1 0 3 76 1 0 7 2 1 0 16 9 1 0 23 18 1 0 33 26 1 0 69 38 1 0 48 41 1 0 61 51 1 0 61 46 1 0 51 66 1 6 58 52 1 0 1 77 1 0 1 78 1 0 1 79 1 0 2 80 1 6 3 81 1 1 4 82 1 6 5 83 1 6 6 84 1 6 9 85 1 6 10 86 1 1 11 87 1 6 12 88 1 6 13 89 1 0 13 90 1 0 14 91 1 0 16 92 1 1 18 93 1 1 19 94 1 0 19 95 1 0 21 96 1 1 22 97 1 6 23 98 1 1 24 99 1 0 26100 1 6 27101 1 1 28102 1 1 29103 1 1 30104 1 6 31105 1 0 31106 1 0 32107 1 0 34108 1 0 35109 1 0 36110 1 0 38111 1 1 39112 1 0 39113 1 0 40114 1 0 40115 1 0 42116 1 0 42117 1 0 42118 1 0 43119 1 1 44120 1 0 44121 1 0 45122 1 0 45123 1 0 47124 1 0 47125 1 0 47126 1 0 48127 1 1 49128 1 0 49129 1 0 50130 1 0 50131 1 0 52132 1 1 53133 1 0 53134 1 0 55135 1 0 55136 1 0 55137 1 0 56138 1 0 56139 1 0 57140 1 0 57141 1 0 59142 1 6 60143 1 0 60144 1 0 62145 1 0 62146 1 0 62147 1 0 63148 1 0 67149 1 0 70150 1 0 70151 1 0 70152 1 0 71153 1 0 71154 1 0 71155 1 0 72156 1 0 73157 1 0 74158 1 0 75159 1 0 76160 1 0 M END

Standard InCHIKey	SYINIHYNGYHPRE-KORAFSQNSA-N
Standard InCHI	InChI=1S/C53H84O23/c1-22-31(58)35(62)38(65)42(69-22)75-41-37(64)33(60)24(19-55)71-45(41)72-25-20-68-44(40(34(25)61)74-43-39(66)36(63)32(59)23(18-54)70-43)73-30-10-11-49(5)26(47(30,2)3)8-12-50(6)27(49)9-13-53-28-16-48(4,21-56)14-15-52(28,46(67)76-53)29(57)17-51(50,53)7/h21-45,54-55,57-66H,8-20H2,1-7H3/t22-,23+,24+,25-,26-,27+,28+,29+,30-,31-,32+,33+,34-,35+,36-,37-,38+,39+,40+,41+,42-,43-,44-,45-,48-,49-,50+,51-,52+,53-/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]1[C@H]([C@@H]([C@@H](CO)O[C@H]1O[C@H]1CO[C@H]([C@@H]([C@H]1O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@]3(C)[C@@H]2CC[C@]24[C@@H]5C[C@](C)(CC[C@@]5([C@@H](C[C@@]32C)O)C(=O)O4)C=O)C1(C)C)O)O)O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1088.54	Volume:	1036.581 ? Van der Waals volume.
Dense:	1.05	LogP:	-0.035 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.971 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.063 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	55.0
TPSA:	359.97 ? Topological Polar Surface Area.	H-Bond Acceptor:	23.0
H-Bond Donor:	12.0	Rings:	10.0
Heavy Atoms:	23.0

MedChem Properties

QED Drug-Likeness Score:	0.061	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.253	Fsp³:	0.962
MCE-18:	289.385 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.911	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.002 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.321	Promiscuous compounds:	0.048

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.501	MDCK Permeability:	-4.973
Pgp-inhibitor:	0.0	Pgp-substrate:	0.434
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.833
20% Bioavailability (F20%):	0.179	30% Bioavailability (F30%):	0.997
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.003	MRP1:	0.002
Plasma Protein Binding (PPB):	57.139%	Volume Distribution (VD):	-0.402
Fu:	32.289% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.016
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.025
HLM stability:	0.001 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.516

Half-life (T1/2):

4.745

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.012
Human Hepatotoxicity (H-HT):	0.759	Drug-induced Liver Injury (DILI):	0.933
AMES Toxicity:	0.99	Rat Oral Acute Toxicity:	0.003
Maximum Recommended Daily Dose:	0.002	Skin Sensitization:	1.0
Carcinogencity:	0.182	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.777	Drug-induced Nephrotoxicity:	0.998
Genotoxicity:	0.995	RPMI-8226 Immunitoxicity:	0.353
A549 Cytotoxicity:	0.556	Hek293 Cytotoxicity:	0.482
BCF:	0.516 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.373 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.02 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.96 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO3803	Ardisia japonica	Species	Primulaceae	Eukaryota	whole plants	Sendai, Miyagi Prefecture, Japan	2000-Sep	PMID[17243725]
NPO3803	Ardisia japonica	Species	Primulaceae	Eukaryota	n.a.	whole plant	n.a.	PMID[17243725]
NPO3803	Ardisia japonica	Species	Primulaceae	Eukaryota	n.a.	whole plant	n.a.	PMID[17397219]
NPO3803	Ardisia japonica	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[22940450]
NPO3803	Ardisia japonica	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO26639	Ardisia crenata	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO3803	Ardisia japonica	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO26639	Ardisia crenata	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO3803	Ardisia japonica	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO26639	Ardisia crenata	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO3803	Ardisia japonica	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO3803	Ardisia japonica	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO26639	Ardisia crenata	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO3803	Ardisia japonica	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO26639	Ardisia crenata	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	2

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT116	Cell line	HL-60	Homo sapiens	IC50	=	45600.0	nM	PMID[17243725]
NPT81	Cell line	A549	Homo sapiens	IC50	=	32900.0	nM	PMID[17243725]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC157571 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	24906
0.1-0.2	21432
0.2-0.3	2528
0.3-0.4	741
0.4-0.5	190
0.5-0.6	19
0.6-0.7	28
0.7-0.8	0
0.8-0.85	1
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9072	High Similarity	NPC207693
0.8235	Intermediate Similarity	NPC40716
0.757	Intermediate Similarity	NPC138219
0.757	Intermediate Similarity	NPC475234
0.7453	Intermediate Similarity	NPC267238
0.7358	Intermediate Similarity	NPC253611
0.7358	Intermediate Similarity	NPC488782
0.7282	Intermediate Similarity	NPC158051
0.7182	Intermediate Similarity	NPC473688
0.7091	Intermediate Similarity	NPC475630
0.7069	Intermediate Similarity	NPC231566
0.7064	Intermediate Similarity	NPC148593
0.7037	Intermediate Similarity	NPC158367
0.6964	Remote Similarity	NPC209798
0.6864	Remote Similarity	NPC22709
0.6842	Remote Similarity	NPC126753
0.6833	Remote Similarity	NPC471626
0.6818	Remote Similarity	NPC77717
0.6724	Remote Similarity	NPC262567
0.6696	Remote Similarity	NPC184805
0.6667	Remote Similarity	NPC51579
0.6579	Remote Similarity	NPC471375
0.6557	Remote Similarity	NPC471431
0.6542	Remote Similarity	NPC224003
0.6449	Remote Similarity	NPC18724
0.6417	Remote Similarity	NPC471429
0.6387	Remote Similarity	NPC471425
0.6339	Remote Similarity	NPC119628
0.6316	Remote Similarity	NPC87393
0.6306	Remote Similarity	NPC171741
0.6303	Remote Similarity	NPC470622
0.626	Remote Similarity	NPC471427
0.6207	Remote Similarity	NPC273189
0.6174	Remote Similarity	NPC471373
0.6154	Remote Similarity	NPC471374
0.6129	Remote Similarity	NPC471424
0.6087	Remote Similarity	NPC470623
0.6083	Remote Similarity	NPC205129
0.6063	Remote Similarity	NPC471428
0.6053	Remote Similarity	NPC123796
0.6	Remote Similarity	NPC471426
0.5873	Remote Similarity	NPC471430
0.5806	Remote Similarity	NPC189575
0.5669	Remote Similarity	NPC106701
0.5652	Remote Similarity	NPC323231
0.561	Remote Similarity	NPC151543
0.5546	Remote Similarity	NPC78034
0.544	Remote Similarity	NPC477465
0.5372	Remote Similarity	NPC606145
0.5354	Remote Similarity	NPC66513
0.5285	Remote Similarity	NPC609281
0.528	Remote Similarity	NPC610204
0.528	Remote Similarity	NPC610461
0.5254	Remote Similarity	NPC204392
0.5159	Remote Similarity	NPC607904
0.5133	Remote Similarity	NPC276758
0.512	Remote Similarity	NPC606553
0.5079	Remote Similarity	NPC185466
0.504	Remote Similarity	NPC207738
0.5039	Remote Similarity	NPC603137

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC157571 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7501
0.1-0.2	1601
0.2-0.3	47
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data