NPASS Compound

Natural Product: NPC231566

Natural Product ID	NPC231566
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	GKUDQPRHGFTRHK-LYKFGKFTSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2442985
PubChem CID	25147100
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 178188 0 0 0 0 0 0 0 0999 V2000 -10.5546 3.1007 -3.4656 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2784 3.2644 -4.2990 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6046 4.5761 -4.0569 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.5280 4.5448 -3.0193 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7837 3.2277 -2.9543 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.8432 2.1272 -2.9193 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4606 2.1669 -4.1729 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2834 0.8982 -2.6726 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7991 0.3372 -1.5280 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4836 -1.0032 -1.8388 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4097 -1.9563 -2.2638 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7323 -2.6535 -3.5815 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7178 -3.6152 -3.7602 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.1481 -1.3696 -2.3840 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.7012 -0.9333 -1.1124 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7085 0.0037 -0.5082 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.2692 -0.5697 0.6107 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1020 0.1895 1.7451 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.4654 0.6649 2.2244 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.6242 0.4154 3.7111 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.4004 0.7731 4.4872 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.1418 0.3994 3.7629 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4378 -0.4997 2.7531 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3859 2.1296 4.8145 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.0080 -0.9216 3.9200 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.6603 2.0238 1.9914 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4358 -0.3812 -1.2171 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5187 -1.2020 -0.5935 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.4498 -1.5954 -1.6180 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3014 -0.8176 -1.4211 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6633 -1.3813 -0.2851 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.5951 -1.4183 0.8798 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.7775 -0.5179 0.5333 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2747 0.7109 0.0735 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.1426 -2.6883 1.0850 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0013 -3.0929 2.3969 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3672 -3.3163 3.0341 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1548 -4.3080 4.1689 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7852 -4.1513 4.7710 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6879 -4.3023 3.7385 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0220 -5.6372 3.8891 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9437 -6.6394 3.7108 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2365 -4.2541 2.4688 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7342 -2.8506 5.3232 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3575 -5.5812 3.6488 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9066 -2.1303 3.4808 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4923 -0.7065 0.0110 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6361 -1.4491 -0.2168 C 0 0 1 0 0 0 0 0 0 0 0 0 2.3199 -0.8031 -1.4113 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0707 0.4416 -1.1206 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8986 0.4516 0.1439 C 0 0 1 0 0 0 0 0 0 0 0 0 3.2515 1.4816 1.0330 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8871 -0.9256 0.6804 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8241 -1.2382 1.7872 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2184 -1.0514 1.2175 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4053 0.3373 0.6599 C 0 0 2 0 0 0 0 0 0 0 0 0 6.5912 1.2030 1.8756 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3121 0.8214 -0.2239 C 0 0 2 0 0 0 0 0 0 0 0 0 5.5047 2.2764 -0.5535 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8500 2.4668 -1.2063 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9850 1.7290 -0.5829 C 0 0 1 0 0 0 0 0 0 0 0 0 9.1948 1.9738 -1.3732 C 0 0 2 0 0 0 0 0 0 0 0 0 9.3983 1.5565 -2.7334 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6234 2.3511 -3.2400 C 0 0 2 0 0 0 0 0 0 0 0 0 11.3284 1.5581 -4.3372 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5264 2.7750 -2.1420 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5534 1.9407 -0.9105 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2580 1.4962 -0.3793 C 0 0 1 0 0 0 0 0 0 0 0 0 9.7061 2.2536 0.8053 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3438 2.4241 0.6031 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1572 0.0373 -0.0707 C 0 0 1 0 0 0 0 0 0 0 0 0 8.8289 -0.3375 0.4927 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6718 0.2996 -0.2176 C 0 0 1 0 0 0 0 0 0 0 0 0 7.4377 -0.5018 -1.4688 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5746 -0.7796 -1.1320 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1022 3.5867 -3.8876 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3696 4.7207 -3.5367 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5087 -1.4900 0.9778 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8030 -2.9912 1.2173 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8857 -1.0061 2.2274 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1237 -1.4982 -0.7113 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9717 3.2146 -1.8383 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9759 4.8517 -1.7433 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.1046 5.1373 -5.2398 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.4602 3.5077 -2.4610 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7955 2.0147 -3.4952 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3871 3.6243 -3.9926 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6290 3.2762 -5.3742 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3947 5.3051 -3.7132 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7761 5.3236 -3.2949 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1585 3.0967 -3.8760 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5839 2.4207 -2.1606 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5484 0.9607 -1.0177 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2738 -0.8749 -2.6154 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3094 -2.7502 -1.5057 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6963 -1.9552 -4.4369 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7002 -3.1606 -3.4462 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5471 -4.1077 -2.9225 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6635 -1.8607 -0.5102 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2083 0.9645 -0.2850 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5278 1.1135 1.5223 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2532 0.0872 1.7022 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4716 1.0512 4.0647 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4359 0.1801 5.4414 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4036 -0.0517 4.4580 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7112 1.3454 3.3300 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8878 2.2002 5.6761 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.9874 -0.9860 3.8021 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2316 2.2093 1.2088 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9915 -2.1149 -0.1544 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2264 -2.6667 -1.5075 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8290 -1.3672 -2.6329 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3764 -2.4354 -0.5726 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1817 -1.0797 1.8437 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3697 -0.3850 1.4398 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0332 1.2821 -0.1362 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4817 -2.3152 2.9999 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0642 -3.7613 2.3176 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8949 -4.0273 4.9538 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6560 -4.9166 5.5516 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0439 -3.4833 3.8799 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5338 -5.7383 4.8618 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7482 -5.7594 3.0799 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6283 -7.3741 3.1310 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9122 -2.7193 5.8426 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9092 -6.1384 4.2741 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5250 -1.7791 4.3053 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2820 -2.4657 -0.5625 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5838 -0.6874 -2.2443 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0417 -1.5534 -1.7978 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3156 1.2654 -1.1477 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7918 0.5765 -1.9860 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1564 1.3552 0.9963 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5827 1.5209 2.0538 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4085 2.4783 0.5208 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2486 -1.5785 -0.1808 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6473 -0.7705 2.7449 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7476 -2.3516 1.9685 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9221 -1.1826 2.0712 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4043 -1.8588 0.5250 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8744 0.8336 2.6777 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3539 2.2515 1.7738 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5665 1.1160 2.3722 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4662 0.3215 -1.2310 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2972 2.9903 0.2356 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7590 2.5012 -1.3712 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0887 3.5516 -1.1757 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7976 2.1838 -2.2765 H 0 0 0 0 0 0 0 0 0 0 0 0 9.3348 3.1048 -1.3374 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5566 1.8186 -3.3692 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6590 0.5036 -2.9436 H 0 0 0 0 0 0 0 0 0 0 0 0 10.6697 1.6521 -5.2347 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4076 0.4872 -4.1076 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2949 2.0689 -4.5051 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3413 3.8356 -1.8402 H 0 0 0 0 0 0 0 0 0 0 0 0 12.5749 2.8016 -2.5586 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2670 1.0812 -1.0533 H 0 0 0 0 0 0 0 0 0 0 0 0 12.0591 2.5649 -0.1156 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1688 3.2748 0.8879 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9123 1.7207 1.7355 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9243 -0.1477 0.7390 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8422 -0.2277 1.5719 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7331 -1.4541 0.3288 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6621 -1.2809 -1.4035 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1471 0.1434 -2.3482 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3570 -1.1085 -1.7465 H 0 0 0 0 0 0 0 0 0 0 0 0 11.5798 -0.8334 -1.1321 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4384 3.4677 -4.7310 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8850 -3.5730 0.9206 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9268 -3.1931 2.2983 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6265 -3.3452 0.5857 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4742 -1.8422 2.8718 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5832 -0.4806 2.9172 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0107 -0.3500 2.0724 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0692 -1.1635 -0.6856 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7946 4.1371 -1.5286 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8699 5.2733 -1.8367 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7429 6.0383 -5.0001 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 11 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 21 24 1 0 20 25 1 0 19 26 1 0 15 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 32 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 39 44 1 0 38 45 1 0 37 46 1 0 31 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 1 51 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 1 56 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 6 64 66 1 0 66 67 1 0 68 67 1 6 68 69 1 0 69 70 1 0 68 71 1 0 71 72 1 0 72 73 1 0 73 74 1 6 71 75 1 0 64 76 1 0 76 77 2 0 53 78 1 0 78 79 1 0 78 80 1 0 10 81 1 0 5 82 1 0 4 83 1 0 3 84 1 0 7 2 1 0 16 9 1 0 23 18 1 0 33 28 1 0 43 36 1 0 78 48 1 0 58 51 1 0 73 61 1 0 73 56 1 0 61 70 1 1 68 62 1 0 1 85 1 0 1 86 1 0 1 87 1 0 2 88 1 6 3 89 1 1 4 90 1 6 5 91 1 6 6 92 1 1 9 93 1 1 10 94 1 6 11 95 1 1 12 96 1 0 12 97 1 0 13 98 1 0 15 99 1 1 16100 1 1 18101 1 6 19102 1 6 20103 1 1 21104 1 1 22105 1 0 22106 1 0 24107 1 0 25108 1 0 26109 1 0 28110 1 1 29111 1 0 29112 1 0 31113 1 6 32114 1 1 33115 1 1 34116 1 0 36117 1 1 37118 1 6 38119 1 1 39120 1 1 40121 1 6 41122 1 0 41123 1 0 42124 1 0 44125 1 0 45126 1 0 46127 1 0 48128 1 6 49129 1 0 49130 1 0 50131 1 0 50132 1 0 52133 1 0 52134 1 0 52135 1 0 53136 1 6 54137 1 0 54138 1 0 55139 1 0 55140 1 0 57141 1 0 57142 1 0 57143 1 0 58144 1 6 59145 1 0 59146 1 0 60147 1 0 60148 1 0 62149 1 6 63150 1 0 63151 1 0 65152 1 0 65153 1 0 65154 1 0 66155 1 0 66156 1 0 67157 1 0 67158 1 0 69159 1 0 69160 1 0 71161 1 1 72162 1 0 72163 1 0 74164 1 0 74165 1 0 74166 1 0 75167 1 0 76168 1 0 79169 1 0 79170 1 0 79171 1 0 80172 1 0 80173 1 0 80174 1 0 81175 1 0 82176 1 0 83177 1 0 84178 1 0 M END

Standard InCHIKey	GKUDQPRHGFTRHK-LYKFGKFTSA-N
Standard InCHI	InChI=1S/C58H94O26/c1-24-34(64)39(69)42(72)48(77-24)82-44-37(67)27(19-60)79-51(46(44)84-47-41(71)35(65)25(62)20-74-47)80-28-21-75-50(45(38(28)68)83-49-43(73)40(70)36(66)26(18-59)78-49)81-33-10-11-54(5)29(52(33,2)3)8-12-55(6)30(54)9-13-58-31-16-53(4,22-61)14-15-57(31,23-76-58)32(63)17-56(55,58)7/h22,24-51,59-60,62-73H,8-21,23H2,1-7H3/t24-,25+,26+,27+,28-,29-,30+,31+,32+,33-,34-,35-,36+,37+,38-,39+,40-,41+,42+,43+,44-,45+,46+,47-,48-,49-,50-,51-,53-,54-,55+,56-,57+,58-/m0/s1
SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]1[C@@H]([C@@H](CO)O[C@H]([C@@H]1O[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O[C@H]1CO[C@H]([C@@H]([C@H]1O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@]3(C)[C@@H]2CC[C@]24[C@@H]5C[C@](C)(CC[C@]5(CO4)[C@@H](C[C@@]32C)O)C=O)C1(C)C)O)O)O)O

Calculated Properties

Physi-Chem Properties

MedChem Properties

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

ADMET: Distribution

ADMET: Metabolism

ADMET: Excretion

ADMET: Toxicity

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32586	ardisia gigantifolia stapf.	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24095094]
NPO32586	ardisia gigantifolia stapf.	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
IC50	7

Activity Type	# Activity
Cell line	6
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT65	Cell line	HepG2	Homo sapiens	IC50	=	1900.0	nM	PMID[24571273]
NPT3508	Cell line	EJ	Homo sapiens	IC50	=	2000.0	nM	PMID[24571273]
NPT165	Cell line	HeLa	Homo sapiens	IC50	=	1800.0	nM	PMID[23368966]
NPT180	Cell line	HCT-8	Homo sapiens	IC50	>	100000.0	nM	PMID[22472691]
NPT181	Cell line	Bel-7402	Homo sapiens	IC50	=	1580.0	nM	PMID[17315965]
NPT81	Cell line	A549	Homo sapiens	IC50	>	100000.0	nM	PMID[25136754]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	IC50	=	2100.0	nM	PMID[24095094]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC231566 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	27780
0.1-0.2	19138
0.2-0.3	2005
0.3-0.4	705
0.4-0.5	177
0.5-0.6	8
0.6-0.7	12
0.7-0.8	0
0.8-0.85	5
0.85-0.9	6
0.9-0.95	3
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.9619	High Similarity	NPC262567
0.9279	High Similarity	NPC471431
0.9167	High Similarity	NPC471425
0.9	High Similarity	NPC471429
0.8929	High Similarity	NPC471427
0.8772	High Similarity	NPC471626
0.8636	High Similarity	NPC205129
0.8596	High Similarity	NPC471426
0.8519	High Similarity	NPC138219
0.8519	High Similarity	NPC475234
0.8407	Intermediate Similarity	NPC189575
0.8333	Intermediate Similarity	NPC40716
0.8273	Intermediate Similarity	NPC473688
0.819	Intermediate Similarity	NPC106701
0.812	Intermediate Similarity	NPC471424
0.7925	Intermediate Similarity	NPC158051
0.7857	Intermediate Similarity	NPC475630
0.7851	Intermediate Similarity	NPC471428
0.7748	Intermediate Similarity	NPC77717
0.7658	Intermediate Similarity	NPC253611
0.7658	Intermediate Similarity	NPC488782
0.7521	Intermediate Similarity	NPC471430
0.7434	Intermediate Similarity	NPC267238
0.7345	Intermediate Similarity	NPC158367
0.7265	Intermediate Similarity	NPC209798
0.7257	Intermediate Similarity	NPC119628
0.7248	Intermediate Similarity	NPC18724
0.7107	Intermediate Similarity	NPC66513
0.7069	Intermediate Similarity	NPC157571
0.7027	Intermediate Similarity	NPC224003
0.7016	Intermediate Similarity	NPC22709
0.6975	Remote Similarity	NPC51579
0.6923	Remote Similarity	NPC148593
0.6923	Remote Similarity	NPC471373
0.6891	Remote Similarity	NPC471375
0.6721	Remote Similarity	NPC126753
0.6638	Remote Similarity	NPC171741
0.6552	Remote Similarity	NPC323231
0.6417	Remote Similarity	NPC207693
0.6417	Remote Similarity	NPC470623
0.6393	Remote Similarity	NPC273189
0.6341	Remote Similarity	NPC471374
0.6311	Remote Similarity	NPC184805
0.5968	Remote Similarity	NPC87393
0.5846	Remote Similarity	NPC470622
0.5188	Remote Similarity	NPC185466
0.5185	Remote Similarity	NPC477465
0.5149	Remote Similarity	NPC607904
0.5115	Remote Similarity	NPC606145
0.5039	Remote Similarity	NPC157474
0.5038	Remote Similarity	NPC609281

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC231566 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7845
0.1-0.2	1269
0.2-0.3	34
0.3-0.4	2
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data