NPASS Compound

Natural Product: NPC471424

Natural Product ID	NPC471424
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	NMMYHIHPRVYSQO-SZPRDVAZSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL2442978
PubChem CID	46930487
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 200211 0 0 0 0 0 0 0 0999 V2000 -1.3829 -4.5243 -2.6940 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4602 -4.4650 -4.1038 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4666 -3.3778 -4.5425 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8765 -2.2116 -3.9521 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2012 -1.4428 -3.4700 C 0 0 1 0 0 0 0 0 0 0 0 0 0.4306 -1.8933 -2.1985 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1096 -0.9635 -1.1902 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.9569 -1.5560 -0.3110 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.3930 -2.7411 0.2250 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6205 -2.3999 1.1285 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8154 -1.8658 0.3316 C 0 0 1 0 0 0 0 0 0 0 0 0 1.3795 -0.6823 -0.4376 C 0 0 2 0 0 0 0 0 0 0 0 0 1.1827 0.4234 0.3938 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8301 -1.4899 1.2444 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8536 -2.3700 1.0597 C 0 0 2 0 0 0 0 0 0 0 0 0 3.8989 -3.1224 2.2875 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5960 -4.2684 2.0022 C 0 0 2 0 0 0 0 0 0 0 0 0 4.5699 -5.2326 3.1685 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2942 -6.3653 2.7997 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0585 -3.8769 1.7608 C 0 0 2 0 0 0 0 0 0 0 0 0 6.0870 -3.0064 0.4914 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2303 -1.7944 0.8624 C 0 0 1 0 0 0 0 0 0 0 0 0 5.2012 -0.8210 -0.0911 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5045 0.4502 0.3936 C 0 0 2 0 0 0 0 0 0 0 0 0 4.5354 1.4006 0.1574 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7899 2.1803 -0.9753 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0422 3.0205 -0.8203 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9284 2.4086 0.2852 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8961 0.9058 -0.0390 C 0 0 1 0 0 0 0 0 0 0 0 0 7.8161 0.2986 0.7733 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1696 2.9649 0.1735 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6085 3.6535 1.3239 C 0 0 2 0 0 0 0 0 0 0 0 0 8.7081 4.9830 1.1267 O 0 0 0 0 0 0 0 0 0 0 0 0 9.8604 5.6521 1.3069 C 0 0 2 0 0 0 0 0 0 0 0 0 10.7054 5.8157 0.0511 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8414 6.5234 0.4243 O 0 0 0 0 0 0 0 0 0 0 0 0 10.7463 5.0621 2.3884 C 0 0 2 0 0 0 0 0 0 0 0 0 10.9794 3.6073 2.1635 C 0 0 1 0 0 0 0 0 0 0 0 0 9.6938 2.8945 1.9755 C 0 0 1 0 0 0 0 0 0 0 0 0 9.3116 2.3854 3.2348 O 0 0 0 0 0 0 0 0 0 0 0 0 11.8758 3.3389 1.1263 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1478 5.2039 3.6463 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7311 4.3150 -0.4874 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3520 -2.6800 0.1333 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7208 -3.1208 -1.1347 C 0 0 2 0 0 0 0 0 0 0 0 0 8.7449 -4.0276 -0.9493 O 0 0 0 0 0 0 0 0 0 0 0 0 9.9431 -3.7072 -1.5326 C 0 0 1 0 0 0 0 0 0 0 0 0 10.9065 -4.8617 -1.3100 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6981 -3.6582 -3.0341 C 0 0 1 0 0 0 0 0 0 0 0 0 8.8654 -2.4286 -3.2801 C 0 0 2 0 0 0 0 0 0 0 0 0 8.0647 -2.0158 -2.0689 C 0 0 1 0 0 0 0 0 0 0 0 0 6.8823 -1.4415 -2.6126 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0461 -2.5955 -4.4040 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8453 -3.7168 -3.7795 O 0 0 0 0 0 0 0 0 0 0 0 0 6.7591 -5.0475 1.6009 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.5205 -0.7634 0.6178 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8737 -0.5902 0.5894 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6053 -1.1972 1.7637 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0326 -0.7876 1.8624 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2692 0.7068 1.8666 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6500 1.1948 0.6101 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.2244 0.8401 0.3479 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2595 1.6805 1.1961 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8663 1.1783 -1.0867 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9712 2.6599 0.4383 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4859 2.6897 0.1641 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2682 2.2157 1.3740 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.7633 0.8873 1.7751 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.5090 0.4293 2.9792 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9023 0.0503 2.4653 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5356 1.3016 1.9139 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.7328 2.1080 0.9835 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.7738 1.7727 -0.4789 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.3625 3.5196 1.0414 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.8421 3.4097 0.7038 C 0 0 2 0 0 0 0 0 0 0 0 0 -11.4986 2.3221 1.4702 C 0 0 2 0 0 0 0 0 0 0 0 0 -10.9095 0.9607 1.5342 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.2178 -0.0432 0.5311 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.4633 0.2065 -0.2846 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.0306 0.1046 -1.7595 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.4694 -0.9584 -0.1672 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.2050 1.4352 0.0046 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.9352 2.1673 1.2749 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.0564 2.6932 2.9075 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.7886 2.1246 3.0491 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.1582 3.5699 -0.6048 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.1552 3.3081 2.3884 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7396 1.2537 3.1393 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3557 -1.5152 -4.4183 C 0 0 1 0 0 0 0 0 0 0 0 0 1.9886 -2.9037 -4.4283 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8943 -3.8608 -4.0458 C 0 0 2 0 0 0 0 0 0 0 0 0 1.1485 -5.0737 -4.6930 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0797 -2.8939 -3.6000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8480 -1.2180 -5.7106 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7174 -5.3916 -2.3756 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1464 -5.4636 -4.4536 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4971 -4.1979 -4.3364 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4998 -3.3746 -5.6487 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1923 -0.4073 -3.4297 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2090 -0.0247 -1.6678 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7570 -1.9379 -0.9826 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2427 -1.5835 1.7526 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8875 -3.2482 1.7674 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1140 -2.7089 -0.3110 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1145 -0.3427 -1.2022 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2409 1.2587 -0.1567 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6902 -3.1138 0.2275 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2282 -4.7234 1.0798 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5010 -5.5844 3.2804 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8832 -4.7770 4.1071 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7533 -7.1758 2.7500 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4717 -3.3075 2.6161 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5092 -3.5589 -0.2785 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5261 -1.4042 1.8722 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6079 0.3310 1.5021 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8335 1.5545 -1.8956 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9416 2.8721 -1.0912 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5709 3.0050 -1.7888 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4289 2.5523 1.2566 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0685 0.8420 -1.1117 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6795 0.2260 0.3068 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7022 3.5284 2.0302 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6208 6.6910 1.6507 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9485 4.8617 -0.4332 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1283 6.4530 -0.6481 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6790 6.1118 0.0813 H 0 0 0 0 0 0 0 0 0 0 0 0 11.6877 5.6155 2.3947 H 0 0 0 0 0 0 0 0 0 0 0 0 11.4932 3.2270 3.0984 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8950 1.9789 1.3339 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8334 3.1207 3.6824 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3263 2.4808 1.2141 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0311 6.1776 3.8366 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7647 4.8828 -1.3234 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8774 -3.6893 -1.6229 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3589 -2.7455 -1.2289 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8862 -4.6772 -1.8031 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4885 -5.7536 -1.8408 H 0 0 0 0 0 0 0 0 0 0 0 0 11.0002 -5.1432 -0.2502 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0622 -4.5380 -3.2628 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5668 -1.6102 -3.5477 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6628 -1.2151 -1.5604 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1780 -0.6291 -3.0931 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6574 -3.5061 -4.4442 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9341 -2.8394 -4.2529 H 0 0 0 0 0 0 0 0 0 0 0 0 7.7179 -4.9750 1.8197 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2319 -1.2095 -0.2915 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1163 -0.9751 2.7339 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6035 -2.3188 1.6842 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4847 -1.3164 2.7166 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5640 -1.1835 0.9457 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2365 0.6817 -0.1976 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2909 1.6669 0.6589 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1204 1.1864 2.2012 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5601 2.7172 1.2965 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8848 1.6817 -1.1845 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7662 0.2048 -1.6300 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6760 1.7131 -1.6214 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5360 3.1113 -0.4720 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6977 3.2764 1.2994 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5588 1.9226 -0.6653 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7268 3.7039 -0.1356 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0585 0.1798 0.9359 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1290 -0.4336 3.5087 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6869 1.2227 3.7309 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8120 -0.7283 1.7110 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4755 -0.2543 3.3690 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3620 2.6948 -1.0016 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2754 0.8481 -0.7529 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7907 1.7461 -0.9270 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8276 4.2188 0.3923 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3224 3.7810 2.1232 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2694 4.3633 1.1808 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3450 0.5281 2.5115 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4146 -1.0665 1.0078 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3414 -0.3790 -0.1122 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8672 -0.2491 -2.3967 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1343 -0.5116 -1.8752 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7904 1.1285 -2.1048 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.3015 -0.7170 -0.8554 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9314 -1.8387 -0.5323 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7801 -1.0696 0.8864 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0120 2.1778 -0.8274 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.3274 1.2989 -0.0442 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4483 3.1530 1.1939 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.3916 1.6250 2.1115 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1046 3.7590 3.0947 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7521 2.1018 3.5592 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1949 4.5023 -0.9276 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7520 3.1964 3.2922 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3722 4.2722 1.8338 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1043 3.4760 2.7470 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1366 2.1593 3.0415 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6006 1.3853 3.8444 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0849 0.5253 3.6989 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1433 -0.7975 -4.2166 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2982 -3.0914 -5.4811 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8899 -4.0436 -2.9755 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0994 -5.2985 -4.7142 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9986 -3.6902 -2.9918 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2640 -1.8611 -6.3308 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 11 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 17 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 34 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 38 41 1 0 37 42 1 0 27 43 1 0 21 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 47 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 50 53 1 0 49 54 1 0 20 55 1 0 8 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 62 64 1 0 61 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 6 72 74 1 0 74 75 1 0 75 76 1 0 76 77 1 0 77 78 1 0 78 79 1 0 79 80 1 0 79 81 1 0 79 82 1 0 82 83 1 0 76 84 1 1 84 85 1 0 75 86 1 0 67 87 1 1 60 88 1 1 5 89 1 0 89 90 1 0 90 91 1 0 91 92 1 0 90 93 1 0 89 94 1 0 91 3 1 0 12 7 1 0 22 15 1 0 29 24 1 0 39 32 1 0 51 45 1 0 62 57 1 0 72 67 1 0 83 76 1 0 68 60 1 0 71 85 1 1 77 71 1 0 1 95 1 0 2 96 1 0 2 97 1 0 3 98 1 6 5 99 1 1 7100 1 6 8101 1 6 10102 1 0 10103 1 0 11104 1 6 12105 1 6 13106 1 0 15107 1 6 17108 1 6 18109 1 0 18110 1 0 19111 1 0 20112 1 1 21113 1 6 22114 1 1 24115 1 1 26116 1 0 26117 1 0 27118 1 6 28119 1 1 29120 1 6 30121 1 0 32122 1 1 34123 1 1 35124 1 0 35125 1 0 36126 1 0 37127 1 1 38128 1 1 39129 1 6 40130 1 0 41131 1 0 42132 1 0 43133 1 0 45134 1 6 47135 1 1 48136 1 0 48137 1 0 48138 1 0 49139 1 6 50140 1 6 51141 1 1 52142 1 0 53143 1 0 54144 1 0 55145 1 0 57146 1 6 58147 1 0 58148 1 0 59149 1 0 59150 1 0 61151 1 6 63152 1 0 63153 1 0 63154 1 0 64155 1 0 64156 1 0 64157 1 0 65158 1 0 65159 1 0 66160 1 0 66161 1 0 68162 1 6 69163 1 0 69164 1 0 70165 1 0 70166 1 0 73167 1 0 73168 1 0 73169 1 0 74170 1 0 74171 1 0 75172 1 1 77173 1 1 78174 1 0 78175 1 0 80176 1 0 80177 1 0 80178 1 0 81179 1 0 81180 1 0 81181 1 0 82182 1 0 82183 1 0 83184 1 0 83185 1 0 84186 1 0 84187 1 0 86188 1 0 87189 1 0 87190 1 0 87191 1 0 88192 1 0 88193 1 0 88194 1 0 89195 1 1 90196 1 6 91197 1 1 92198 1 0 93199 1 0 94200 1 0 M END

Standard InCHIKey	NMMYHIHPRVYSQO-SZPRDVAZSA-N
Standard InCHI	InChI=1S/C64H106O30/c1-25-36(70)41(75)44(78)53(85-25)92-49-39(73)29(21-67)88-57(51(49)94-52-47(81)48(26(68)22-82-52)91-54-45(79)42(76)37(71)27(19-65)86-54)89-30-23-83-56(50(40(30)74)93-55-46(80)43(77)38(72)28(20-66)87-55)90-35-11-12-60(6)31(59(35,4)5)9-13-61(7)32(60)10-14-64-33-17-58(2,3)15-16-63(33,24-84-64)34(69)18-62(61,64)8/h25-57,65-81H,9-24H2,1-8H3/t25-,26+,27+,28+,29+,30-,31-,32+,33+,34+,35-,36-,37+,38+,39+,40-,41+,42-,43-,44+,45+,46+,47+,48-,49-,50+,51+,52-,53-,54-,55-,56-,57-,60-,61+,62-,63+,64-/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2[C@@H](OC[C@@H]([C@@H]2O)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O[C@@H]2OC[C@H]([C@@H]([C@H]2O)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)O)O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)O)O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC[C@]34[C@@]2(C)C[C@H]([C@@]2([C@H]4CC(C)(C)CC2)CO3)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1354.68	Volume:	1276.529 ? Van der Waals volume.
Dense:	1.061	LogP:	-0.791 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.291 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.353 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	15.0	Rigid Bonds:	65.0
TPSA:	463.9 ? Topological Polar Surface Area.	H-Bond Acceptor:	30.0
H-Bond Donor:	17.0	Rings:	12.0
Heavy Atoms:	30.0

MedChem Properties

QED Drug-Likeness Score:	0.069	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.81	Fsp³:	1.0
MCE-18:	344.531 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.781	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.001 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.449	Promiscuous compounds:	0.008

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-7.399	MDCK Permeability:	-4.753
Pgp-inhibitor:	0.0	Pgp-substrate:	0.814
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.954
20% Bioavailability (F20%):	0.011	30% Bioavailability (F30%):	0.998
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.0
Plasma Protein Binding (PPB):	51.016%	Volume Distribution (VD):	-0.352
Fu:	27.568% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.004
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.008
HLM stability:	0.002 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-1.733

Half-life (T1/2):

5.422

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.004
Human Hepatotoxicity (H-HT):	0.517	Drug-induced Liver Injury (DILI):	0.831
AMES Toxicity:	0.962	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.005	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.474	Drug-induced Nephrotoxicity:	0.989
Genotoxicity:	0.016	RPMI-8226 Immunitoxicity:	0.297
A549 Cytotoxicity:	0.56	Hek293 Cytotoxicity:	0.321
BCF:	1.122 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.51 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.022 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.912 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32586	ardisia gigantifolia stapf.	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24095094]
NPO32586	ardisia gigantifolia stapf.	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	2
IC50	3

Activity Type	# Activity
Cell line	5

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT181	Cell line	Bel-7402	Homo sapiens	Activity	=	59.94	%	PMID[18959441]
NPT181	Cell line	Bel-7402	Homo sapiens	Activity	=	40.86	%	PMID[14510607]
NPT180	Cell line	HCT-8	Homo sapiens	IC50	=	10060.0	nM	PubChem BioAssay data set
NPT181	Cell line	Bel-7402	Homo sapiens	IC50	=	7830.0	nM	DOI[10.6019/CHEMBL1201861]
NPT81	Cell line	A549	Homo sapiens	IC50	=	8150.0	nM	DailyMed

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC471424 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	30701
0.1-0.2	16523
0.2-0.3	1752
0.3-0.4	668
0.4-0.5	164
0.5-0.6	9
0.6-0.7	21
0.7-0.8	0
0.8-0.85	6
0.85-0.9	3
0.9-0.95	1
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.9115	High Similarity	NPC471626
0.8957	High Similarity	NPC471428
0.8829	High Similarity	NPC471425
0.875	High Similarity	NPC189575
0.819	Intermediate Similarity	NPC471429
0.8136	Intermediate Similarity	NPC471426
0.812	Intermediate Similarity	NPC231566
0.8051	Intermediate Similarity	NPC106701
0.8	Intermediate Similarity	NPC253611
0.8	Intermediate Similarity	NPC488782
0.7983	Intermediate Similarity	NPC471427
0.7845	Intermediate Similarity	NPC205129
0.7778	Intermediate Similarity	NPC262567
0.7593	Intermediate Similarity	NPC18724
0.7561	Intermediate Similarity	NPC471431
0.7456	Intermediate Similarity	NPC77717
0.7436	Intermediate Similarity	NPC209798
0.7304	Intermediate Similarity	NPC267238
0.7241	Intermediate Similarity	NPC40716
0.6957	Remote Similarity	NPC171741
0.6903	Remote Similarity	NPC224003
0.6842	Remote Similarity	NPC158051
0.6833	Remote Similarity	NPC138219
0.6833	Remote Similarity	NPC475234
0.6807	Remote Similarity	NPC148593
0.6772	Remote Similarity	NPC22709
0.6748	Remote Similarity	NPC126753
0.6719	Remote Similarity	NPC471430
0.6667	Remote Similarity	NPC471373
0.6639	Remote Similarity	NPC473688
0.6475	Remote Similarity	NPC184805
0.6364	Remote Similarity	NPC158367
0.6311	Remote Similarity	NPC470623
0.6303	Remote Similarity	NPC323231
0.629	Remote Similarity	NPC475630
0.624	Remote Similarity	NPC471375
0.619	Remote Similarity	NPC51579
0.6179	Remote Similarity	NPC207693
0.6129	Remote Similarity	NPC157571
0.6032	Remote Similarity	NPC273189
0.576	Remote Similarity	NPC119628
0.5758	Remote Similarity	NPC470622
0.5736	Remote Similarity	NPC471374
0.5714	Remote Similarity	NPC66513
0.5285	Remote Similarity	NPC285253
0.5197	Remote Similarity	NPC157474
0.5154	Remote Similarity	NPC476305
0.5152	Remote Similarity	NPC87393
0.5079	Remote Similarity	NPC110494

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC471424 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	8133
0.1-0.2	981
0.2-0.3	35
0.3-0.4	1
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data