NPASS Compound

Natural Product: NPC475234

Natural Product ID	NPC475234
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Deglucocyclamin
IUPAC Name	n.a.
Synonyms	Deglucocyclamin
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL501615
PubChem CID	44566607
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0001553] Triterpenoids

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 158167 0 0 0 0 0 0 0 0999 V2000 2.9363 -7.7953 -1.2958 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0036 -7.2449 -2.2068 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7035 -5.9946 -2.7639 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9482 -5.1929 -1.6595 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4474 -3.9597 -2.0298 C 0 0 1 0 0 0 0 0 0 0 0 0 3.6439 -3.2673 -0.8191 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8811 -2.0689 -0.8351 C 0 0 1 0 0 0 0 0 0 0 0 0 1.9624 -2.2146 0.3619 C 0 0 1 0 0 0 0 0 0 0 0 0 2.7991 -2.4132 1.4871 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4037 -1.1922 1.7481 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4697 -0.9481 0.7239 C 0 0 1 0 0 0 0 0 0 0 0 0 3.8487 -0.9454 -0.6739 C 0 0 2 0 0 0 0 0 0 0 0 0 3.2105 0.2667 -0.8351 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1819 0.2439 0.9292 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5392 0.0285 0.9937 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9295 0.2164 2.3537 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1361 -0.3751 2.5840 C 0 0 2 0 0 0 0 0 0 0 0 0 8.8703 0.3790 3.6828 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0968 1.6923 3.3473 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0221 -0.4747 1.3972 C 0 0 2 0 0 0 0 0 0 0 0 0 8.8059 0.5516 0.3516 C 0 0 1 0 0 0 0 0 0 0 0 0 7.3715 0.9805 0.1724 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9491 1.0675 -1.1355 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5480 2.3603 -1.4672 C 0 0 2 0 0 0 0 0 0 0 0 0 5.1906 2.3656 -1.8233 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7710 3.6564 -2.0873 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8375 4.6942 -1.9267 C 0 0 1 0 0 0 0 0 0 0 0 0 7.0961 4.3773 -2.7096 C 0 0 1 0 0 0 0 0 0 0 0 0 7.2872 2.8526 -2.6847 C 0 0 1 0 0 0 0 0 0 0 0 0 8.6423 2.6093 -2.6408 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9725 4.8275 -4.0150 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3342 5.9047 -2.4582 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5313 1.7012 0.7528 O 0 0 0 0 0 0 0 0 0 0 0 0 8.9464 -1.7862 0.8980 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1505 -1.1658 0.6333 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2173 -1.4592 0.7264 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.7132 -1.4043 2.1360 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1278 -0.9690 2.3131 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4738 0.2841 1.5347 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2168 0.0049 0.0997 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.9658 -0.7122 -0.2833 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0038 0.3115 -0.9036 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2423 -1.6723 -1.4722 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4921 1.2275 -0.6979 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9174 1.6906 -0.5545 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5219 1.5684 0.7989 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.9762 0.4711 1.6423 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.5668 0.3986 2.9902 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0739 0.1213 2.8337 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7067 1.1766 1.9508 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.0162 1.2556 0.5913 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.1598 -0.0603 -0.1061 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6972 2.3022 -0.2294 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7575 3.1124 0.3651 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.4007 2.6492 1.6209 C 0 0 2 0 0 0 0 0 0 0 0 0 -8.1562 1.1504 1.8895 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.9332 0.4368 0.8891 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4008 0.5442 1.3621 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.1991 -0.3547 0.4458 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5448 0.1575 2.7790 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9693 0.8726 3.6655 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.7970 1.9898 1.1661 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.8366 2.9496 1.7967 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5343 3.1283 2.7815 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.4350 2.3650 2.6730 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.8070 3.3142 -0.5691 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3538 2.9429 1.4326 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6697 1.3982 2.1306 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7628 -4.1008 -2.7726 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8046 -5.2288 -3.7456 C 0 0 2 0 0 0 0 0 0 0 0 0 4.0895 -6.4635 -3.2317 C 0 0 2 0 0 0 0 0 0 0 0 0 4.0284 -7.4915 -4.1382 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1490 -5.4784 -4.0373 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0596 -2.9167 -3.4879 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2741 -7.1011 -0.6775 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9111 -8.0011 -3.0061 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0495 -6.9973 -1.7249 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1507 -5.5173 -3.5690 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7595 -3.4412 -2.7022 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3600 -1.9874 -1.7947 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3352 -3.1278 0.2822 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8024 -1.1337 2.7857 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6399 -0.3543 1.6660 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2046 -1.7722 0.7589 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6836 -0.9699 -1.3935 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1251 0.5610 -1.7744 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7869 -1.0437 0.7951 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8779 -1.4192 2.9870 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8554 -0.1261 3.7891 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2862 0.3574 4.6261 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9089 2.0672 3.7821 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1081 -0.3714 1.7114 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2727 0.2825 -0.6304 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2347 2.0089 0.6383 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6888 3.0708 -0.6495 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3812 3.7646 -3.1393 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9171 3.9559 -1.4485 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0572 4.9576 -0.8517 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9128 4.9155 -2.2106 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8160 2.4867 -3.6296 H 0 0 0 0 0 0 0 0 0 0 0 0 8.9265 2.4250 -3.5857 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4766 5.6837 -3.9902 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9421 6.4840 -1.7338 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0474 2.5010 0.4307 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7276 -1.9483 0.3000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2390 -2.5680 0.4725 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6599 -2.4256 2.6312 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0293 -0.8200 2.7495 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8075 -1.7962 2.0189 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2248 -0.7857 3.4309 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0353 -0.7266 -0.2009 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4866 0.9848 -1.6197 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6161 0.7916 -0.1413 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7123 -0.2851 -1.5558 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3073 -1.9967 -1.9418 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9162 -1.1631 -2.1759 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7832 -2.5641 -1.0768 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4130 0.9418 -1.7944 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7729 2.0537 -0.5509 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8486 2.7849 -0.8820 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5771 1.3075 -1.3800 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3468 -0.4886 1.1506 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2263 -0.5471 3.5128 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3581 1.2075 3.6839 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3049 -0.9028 2.5911 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4879 0.3188 3.8607 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3186 -0.4097 -0.7081 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0137 -0.0628 -0.8534 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3981 -0.9071 0.5749 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0679 1.8755 -1.2151 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8744 2.9882 -0.6039 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4178 4.1709 0.5540 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5630 0.9668 2.9023 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7618 -0.6180 0.7115 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.9757 1.0351 -0.0728 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8741 -1.3986 0.6828 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2760 -0.3242 0.6136 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8934 -0.1845 -0.5991 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2467 -0.8553 3.0590 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.8146 2.2133 1.5008 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7399 2.1758 0.0512 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0261 3.0816 2.8968 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0212 3.9602 1.3511 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1315 3.0094 3.7044 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2602 4.1963 2.6972 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5250 3.9002 -1.2947 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1683 2.9070 2.5153 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4563 3.4772 1.0075 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1858 3.6225 1.1711 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1171 1.8255 3.0486 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4781 2.2327 1.4466 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6596 1.0557 2.4564 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6220 -4.2271 -2.0662 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3117 -4.9171 -4.6864 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6259 -6.7693 -2.2925 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1866 -7.4490 -4.6557 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5635 -4.5931 -4.2148 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3948 -2.7570 -4.1934 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 11 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 17 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 1 0 28 31 1 0 27 32 1 0 21 33 1 0 20 34 1 0 8 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 1 0 41 43 1 0 40 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 6 51 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 6 58 60 1 0 60 61 2 0 58 62 1 0 62 63 1 0 55 64 1 1 64 65 1 0 54 66 1 0 46 67 1 1 39 68 1 1 5 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 70 73 1 0 69 74 1 0 71 3 1 0 12 7 1 0 22 15 1 0 29 24 1 0 41 36 1 0 51 46 1 0 63 55 1 0 47 39 1 0 50 65 1 1 56 50 1 0 1 75 1 0 2 76 1 0 2 77 1 0 3 78 1 6 5 79 1 6 7 80 1 6 8 81 1 6 10 82 1 0 10 83 1 0 11 84 1 6 12 85 1 6 13 86 1 0 15 87 1 6 17 88 1 1 18 89 1 0 18 90 1 0 19 91 1 0 20 92 1 1 21 93 1 6 22 94 1 1 24 95 1 1 26 96 1 0 26 97 1 0 27 98 1 1 28 99 1 1 29100 1 6 30101 1 0 31102 1 0 32103 1 0 33104 1 0 34105 1 0 36106 1 6 37107 1 0 37108 1 0 38109 1 0 38110 1 0 40111 1 6 42112 1 0 42113 1 0 42114 1 0 43115 1 0 43116 1 0 43117 1 0 44118 1 0 44119 1 0 45120 1 0 45121 1 0 47122 1 6 48123 1 0 48124 1 0 49125 1 0 49126 1 0 52127 1 0 52128 1 0 52129 1 0 53130 1 0 53131 1 0 54132 1 1 56133 1 1 57134 1 0 57135 1 0 59136 1 0 59137 1 0 59138 1 0 60139 1 0 62140 1 0 62141 1 0 63142 1 0 63143 1 0 64144 1 0 64145 1 0 66146 1 0 67147 1 0 67148 1 0 67149 1 0 68150 1 0 68151 1 0 68152 1 0 69153 1 1 70154 1 6 71155 1 1 72156 1 0 73157 1 0 74158 1 0 M END

Standard InCHIKey	JXTOWLUQSHIIDP-TYIURIOSSA-N
Standard InCHI	InChI=1S/C52H84O22/c1-46(2)27-7-11-49(5)28(8-12-52-29-15-47(3,21-55)13-14-51(29,22-68-52)30(57)16-50(49,52)6)48(27,4)10-9-31(46)72-44-40(74-43-39(65)36(62)33(59)24(17-53)69-43)35(61)26(20-67-44)71-45-41(37(63)34(60)25(18-54)70-45)73-42-38(64)32(58)23(56)19-66-42/h21,23-45,53-54,56-65H,7-20,22H2,1-6H3/t23-,24+,25+,26-,27-,28+,29+,30+,31-,32-,33+,34+,35-,36-,37-,38+,39+,40+,41+,42-,43-,44-,45-,47-,48-,49+,50-,51+,52-/m0/s1
SMILES	OC[C@H]1O[C@@H](O[C@H]2[C@@H](OC[C@@H]([C@@H]2O)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O[C@@H]2OC[C@@H]([C@@H]([C@H]2O)O)O)O)O)O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC[C@]34[C@@]2(C)C[C@H]([C@@]2([C@H]4C[C@@](C)(C=O)CC2)CO3)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1060.55	Volume:	1013.132 ? Van der Waals volume.
Dense:	1.047	LogP:	-0.149 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	0.691 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-2.89 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	11.0	Rigid Bonds:	54.0
TPSA:	342.9 ? Topological Polar Surface Area.	H-Bond Acceptor:	22.0
H-Bond Donor:	12.0	Rings:	10.0
Heavy Atoms:	22.0

MedChem Properties

QED Drug-Likeness Score:	0.079	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	5.286	Fsp³:	0.981
MCE-18:	283.786 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.891	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.003 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.277	Promiscuous compounds:	0.02

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.589	MDCK Permeability:	-5.044
Pgp-inhibitor:	0.0	Pgp-substrate:	0.69
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.812
20% Bioavailability (F20%):	0.558	30% Bioavailability (F30%):	0.999
50% Bioavailability (F50%):	1.0

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.142	MRP1:	0.008
Plasma Protein Binding (PPB):	60.541%	Volume Distribution (VD):	-0.387
Fu:	29.499% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.09
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	1.0	CYP3A4-substrate:	1.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.038
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.28

Half-life (T1/2):

3.1

ADMET: Toxicity

hERG Blockers:	0.003	hERG Blockers (10um):	0.005
Human Hepatotoxicity (H-HT):	0.762	Drug-induced Liver Injury (DILI):	0.914
AMES Toxicity:	0.999	Rat Oral Acute Toxicity:	0.006
Maximum Recommended Daily Dose:	0.001	Skin Sensitization:	1.0
Carcinogencity:	0.246	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.001
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	0.999
Hematotoxicity:	0.884	Drug-induced Nephrotoxicity:	0.968
Genotoxicity:	0.955	RPMI-8226 Immunitoxicity:	0.367
A549 Cytotoxicity:	0.985	Hek293 Cytotoxicity:	0.885
BCF:	0.981 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.489 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	5.146 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	4.204 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO15237	Cyclamen mirabile	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[9090874]
NPO15237	Cyclamen mirabile	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO15237	Cyclamen mirabile	Species	Primulaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	1
MIC	11

Activity Type	# Activity
Organism	11
Non-molecular	1

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT188	Organism	Candida parapsilosis	Candida parapsilosis	MIC	=	80.0	ug.mL-1	PMID[22472691]
NPT20529	Non-molecular	NON-PROTEIN TARGET	n.a.	Activity	=	36.7	10'-6M	PMID[9090874]
NPT20	Organism	Candida albicans	Candida albicans	MIC	=	160.0	ug.mL-1	PMID[19783432]
NPT3153	Organism	Kluyveromyces marxianus	Kluyveromyces marxianus	MIC	=	160.0	ug.mL-1	PMID[22472691]
NPT85	Organism	Filobasidiella neoformans	Cryptococcus neoformans	MIC	=	80.0	ug.mL-1	PMID[20739103]
NPT187	Organism	Issatchenkia orientalis	Pichia kudriavzevii	MIC	>	320.0	ug.mL-1	PMID[19921834]
NPT18	Organism	Pseudomonas aeruginosa	Pseudomonas aeruginosa	MIC	>	400.0	ug.mL-1	PMID[20017491]
NPT19	Organism	Escherichia coli	Escherichia coli	MIC	>	400.0	ug.mL-1	PMID[24479418]
NPT175	Organism	Enterococcus faecalis	Enterococcus faecalis	MIC	>	400.0	ug.mL-1	PMID[18077363]
NPT16	Organism	Staphylococcus aureus	Staphylococcus aureus	MIC	>	400.0	ug.mL-1	PubChem BioAssay data set
NPT186	Organism	Candida tropicalis	Candida tropicalis	MIC	=	160.0	ug.mL-1	PMID[12662097]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC475234 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	26057
0.1-0.2	20567
0.2-0.3	2335
0.3-0.4	664
0.4-0.5	174
0.5-0.6	14
0.6-0.7	9
0.7-0.8	0
0.8-0.85	5
0.85-0.9	5
0.9-0.95	3
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
1.0	High Similarity	NPC138219
0.949	High Similarity	NPC473688
0.9192	High Similarity	NPC475630
0.9082	High Similarity	NPC77717
0.899	High Similarity	NPC40716
0.8846	High Similarity	NPC262567
0.875	High Similarity	NPC158051
0.8519	High Similarity	NPC231566
0.85	High Similarity	NPC119628
0.8235	Intermediate Similarity	NPC253611
0.8235	Intermediate Similarity	NPC488782
0.8113	Intermediate Similarity	NPC51579
0.8077	Intermediate Similarity	NPC471373
0.8019	Intermediate Similarity	NPC471375
0.7981	Intermediate Similarity	NPC267238
0.798	Intermediate Similarity	NPC18724
0.7895	Intermediate Similarity	NPC471431
0.789	Intermediate Similarity	NPC205129
0.7885	Intermediate Similarity	NPC158367
0.7778	Intermediate Similarity	NPC209798
0.7748	Intermediate Similarity	NPC471425
0.7723	Intermediate Similarity	NPC224003
0.7679	Intermediate Similarity	NPC189575
0.767	Intermediate Similarity	NPC323231
0.7611	Intermediate Similarity	NPC471429
0.757	Intermediate Similarity	NPC157571
0.7565	Intermediate Similarity	NPC471427
0.7478	Intermediate Similarity	NPC106701
0.7436	Intermediate Similarity	NPC471626
0.7431	Intermediate Similarity	NPC273189
0.7407	Intermediate Similarity	NPC148593
0.7364	Intermediate Similarity	NPC471374
0.7265	Intermediate Similarity	NPC471426
0.7168	Intermediate Similarity	NPC126753
0.7103	Intermediate Similarity	NPC171741
0.6847	Remote Similarity	NPC207693
0.6847	Remote Similarity	NPC470623
0.6833	Remote Similarity	NPC471424
0.6726	Remote Similarity	NPC184805
0.6613	Remote Similarity	NPC471428
0.6348	Remote Similarity	NPC87393
0.6341	Remote Similarity	NPC22709
0.629	Remote Similarity	NPC471430
0.6198	Remote Similarity	NPC470622
0.5887	Remote Similarity	NPC66513
0.5868	Remote Similarity	NPC185466
0.582	Remote Similarity	NPC607904
0.5798	Remote Similarity	NPC606145
0.5702	Remote Similarity	NPC609281
0.5691	Remote Similarity	NPC610204
0.5691	Remote Similarity	NPC610461
0.568	Remote Similarity	NPC603137
0.5678	Remote Similarity	NPC267637
0.5556	Remote Similarity	NPC609305
0.5528	Remote Similarity	NPC606553
0.5289	Remote Similarity	NPC123796
0.5271	Remote Similarity	NPC475140
0.5079	Remote Similarity	NPC207738

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC475234 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7599
0.1-0.2	1517
0.2-0.3	31
0.3-0.4	3
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data