NPASS Compound

Natural Product: NPC159005

Natural Product ID	NPC159005
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	Notoginsenoside Fa
IUPAC Name	(2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R,6S)-6-[(2S)-2-[(3S,5R,8R,9R,10R,12R,13R,14R,17S)-3-[(2R,3R,4S,5S,6R)-3-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-12-hydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-5-en-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Synonyms	Notoginsenoside Fa
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL447915
PubChem CID	44592853
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 186194 0 0 0 0 0 0 0 0999 V2000 6.4994 6.0518 -4.8700 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4193 5.1276 -3.6290 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2313 4.9666 -3.1771 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7197 4.1877 -2.0437 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6424 3.3631 -1.2736 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3009 2.6294 -0.0541 C 0 0 1 0 0 0 0 0 0 0 0 0 4.8159 3.6935 1.0094 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2907 1.5513 0.0071 C 0 0 1 0 0 0 0 0 0 0 0 0 4.4436 1.0141 1.4808 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0972 0.8864 2.0657 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2695 0.7102 0.8294 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5889 -0.6118 0.2280 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8347 1.8470 -0.0391 C 0 0 2 0 0 0 0 0 0 0 0 0 2.0940 1.8291 -1.3009 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8038 1.0941 -1.4305 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1735 0.5223 -0.2508 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.3349 0.5071 -0.1945 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.0093 1.8093 -0.1586 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8121 -0.2241 -1.4520 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6485 -1.4189 -1.1866 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7653 -1.2141 -0.1805 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.1026 -0.8133 1.0897 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9807 0.1003 1.8729 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0372 -2.1092 1.9379 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6832 -0.3761 0.9603 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.1576 0.0675 2.2902 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3539 0.0929 2.1977 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8134 0.9762 1.0418 C 0 0 1 0 0 0 0 0 0 0 0 0 0.5190 2.3722 1.4465 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7580 -0.3825 -0.6504 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9448 -1.0072 -0.9536 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.1553 -0.4878 -0.2461 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4054 0.9588 -0.5192 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.0293 1.2299 -1.9614 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.9807 -0.0281 -2.7927 C 0 0 1 0 0 0 0 0 0 0 0 0 -6.5088 0.4106 -4.1850 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5122 -0.7268 -4.9882 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0888 -0.9702 -2.3452 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.9848 2.0742 -2.4943 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.5990 1.7338 0.3288 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2173 -1.3213 -0.6310 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7145 -2.0400 0.4442 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.1731 -1.8636 0.5692 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.6163 -2.5019 1.8821 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.6754 -3.6092 2.2295 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.9768 -4.2487 1.0792 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.8808 -5.2117 0.3111 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.5201 -6.0877 1.1843 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3388 -3.3707 0.2161 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.7501 -3.2191 3.2161 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.9237 -2.9656 1.6738 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.5009 -0.5194 0.6427 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.4576 -0.1724 -0.3107 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.7614 0.2383 0.3426 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.7558 1.6318 0.8856 C 0 0 2 0 0 0 0 0 0 0 0 0 -12.0300 2.5424 -0.0537 C 0 0 1 0 0 0 0 0 0 0 0 0 -11.7783 1.8711 -1.3724 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9882 0.7609 -1.1956 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.8442 3.6606 -0.3060 O 0 0 0 0 0 0 0 0 0 0 0 0 -12.1628 1.6221 2.1543 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.8055 0.0305 -0.5644 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7185 3.1827 -1.5900 O 0 0 0 0 0 0 0 0 0 0 0 0 6.4519 2.1724 0.6231 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3357 1.4100 -0.0379 C 0 0 1 0 0 0 0 0 0 0 0 0 8.6781 2.1531 0.0667 C 0 0 1 0 0 0 0 0 0 0 0 0 9.2959 1.8615 1.4157 C 0 0 2 0 0 0 0 0 0 0 0 0 9.7168 0.4048 1.4119 C 0 0 1 0 0 0 0 0 0 0 0 0 8.8006 -0.3111 0.4795 C 0 0 1 0 0 0 0 0 0 0 0 0 8.8065 -1.8031 0.8314 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1192 -2.3046 0.7100 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1701 -3.6598 0.9841 C 0 0 1 0 0 0 0 0 0 0 0 0 10.5658 -4.4003 -0.2642 C 0 0 1 0 0 0 0 0 0 0 0 0 11.4696 -5.5644 0.0833 C 0 0 2 0 0 0 0 0 0 0 0 0 12.6914 -4.9841 0.7665 C 0 0 1 0 0 0 0 0 0 0 0 0 12.3130 -3.9965 1.8394 C 0 0 1 0 0 0 0 0 0 0 0 0 12.9413 -2.6508 1.5749 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7720 -1.7816 2.6532 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9679 -3.9276 2.0748 O 0 0 0 0 0 0 0 0 0 0 0 0 13.5581 -5.9724 1.2320 O 0 0 0 0 0 0 0 0 0 0 0 0 11.7895 -6.2621 -1.0621 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4407 -4.7897 -0.9502 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5198 0.2032 0.6205 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0501 0.3788 1.0060 O 0 0 0 0 0 0 0 0 0 0 0 0 8.2473 1.9606 2.3492 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5201 1.9311 -0.9825 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7250 4.6293 -3.2004 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4547 5.9248 -5.3873 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3667 7.0607 -4.4527 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6492 5.7967 -5.5162 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4100 5.5231 -3.7471 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0570 3.4129 -2.6065 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9577 4.7443 -1.4522 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0871 2.5936 -2.0251 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5582 4.0245 -1.1191 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6890 3.9969 1.6097 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4361 4.5873 0.4756 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0896 3.2331 1.6692 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5100 0.6904 -0.6668 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0127 0.0500 1.4563 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0745 1.6787 2.0855 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0381 -0.1004 2.6247 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7655 1.6353 2.7745 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6130 -0.9401 0.5843 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9383 -1.4354 0.6195 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7036 -0.6258 -0.8741 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5930 2.8019 0.4791 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8013 1.5651 -2.1148 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9967 0.2778 -2.1945 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0440 1.7177 -2.0144 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3991 -0.5982 -0.2657 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1964 2.2622 0.8315 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0473 1.7082 -0.6030 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5626 2.6049 -0.7880 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3850 0.4587 -2.1239 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9513 -0.5745 -2.0780 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0738 -2.3087 -0.8154 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1288 -1.7225 -2.1247 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2574 -2.2402 -0.1361 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6539 0.2172 2.9359 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1862 1.0811 1.4019 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9686 -0.4047 1.9613 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1710 -1.8765 3.0130 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8665 -2.7891 1.6655 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0748 -2.6122 1.8107 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1059 -1.3388 0.7497 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6123 0.9755 2.6780 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4186 -0.7402 3.0145 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7277 -0.9251 2.1516 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7375 0.5771 3.1150 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3712 2.8477 2.0036 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3043 2.4262 2.2325 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2126 3.0738 0.6833 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8387 -2.1041 -0.7184 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0252 -0.6398 0.8359 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4710 1.1803 -0.3079 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0675 1.7492 -1.9938 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0068 -0.4407 -2.9627 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4813 0.8163 -4.0662 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2068 1.1725 -4.5343 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4062 -0.7051 -5.4579 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1165 2.8202 -1.8379 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0901 2.1430 1.0632 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1950 -1.7479 1.3829 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7606 -2.2952 -0.2796 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.6265 -1.7206 2.6625 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.2851 -4.4125 2.7203 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1588 -4.8915 1.5178 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5703 -4.6843 -0.3759 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2556 -5.8700 -0.3587 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3199 -6.4782 0.7627 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2279 -4.0220 3.4668 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4798 -2.8460 2.5016 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7219 -1.0889 -0.9167 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9430 -0.4611 1.1830 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.8250 1.9423 0.9860 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0625 2.8526 0.3708 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6855 1.6845 -1.9684 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1686 2.5967 -1.9810 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.7771 3.3701 -0.4176 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.8935 1.5207 2.8168 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.6715 -0.7740 -1.1085 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9042 3.7640 -0.8153 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1179 1.1486 -1.0907 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4786 3.2681 0.0947 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1181 2.5551 1.6595 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5728 -0.0071 2.4287 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1361 -0.2995 -0.5877 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3757 -1.9991 1.8177 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2024 -2.3356 0.0699 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1251 -4.0026 1.2449 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1240 -3.6866 -0.9130 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9376 -6.1696 0.8308 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2486 -4.4292 -0.0160 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7813 -4.3740 2.7931 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0480 -2.7331 1.4414 H 0 0 0 0 0 0 0 0 0 0 0 0 12.4488 -2.1974 0.7025 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3358 -0.9931 2.6028 H 0 0 0 0 0 0 0 0 0 0 0 0 14.0898 -5.6871 2.0013 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7559 -6.2981 -1.2618 H 0 0 0 0 0 0 0 0 0 0 0 0 9.6671 -5.3244 -1.7591 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1137 0.2799 0.0258 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5735 1.7356 3.2538 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1421 2.7061 -1.0546 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8320 3.5469 -3.0644 H 0 0 0 0 0 0 0 0 0 0 0 0 8.1600 5.1332 -2.3051 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5133 4.8744 -3.9998 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 6 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 1 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 22 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 1 21 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 35 38 1 0 34 39 1 0 33 40 1 0 32 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 45 50 1 0 44 51 1 0 43 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 56 59 1 0 55 60 1 0 54 61 1 0 14 62 1 0 6 63 1 1 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 68 69 1 0 69 70 1 0 70 71 1 0 71 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 1 0 76 77 1 0 75 78 1 0 74 79 1 0 73 80 1 0 72 81 1 0 68 82 1 0 67 83 1 0 66 84 1 0 65 85 1 0 2 86 1 0 13 8 1 0 28 16 1 0 38 31 1 0 49 42 1 0 58 53 1 0 82 64 1 0 28 11 1 0 78 71 1 0 25 17 1 0 1 87 1 0 1 88 1 0 1 89 1 0 3 90 1 0 4 91 1 0 4 92 1 0 5 93 1 0 5 94 1 0 7 95 1 0 7 96 1 0 7 97 1 0 8 98 1 6 9 99 1 0 9100 1 0 10101 1 0 10102 1 0 12103 1 0 12104 1 0 12105 1 0 13106 1 1 14107 1 6 15108 1 0 15109 1 0 16110 1 6 18111 1 0 18112 1 0 18113 1 0 19114 1 0 19115 1 0 20116 1 0 20117 1 0 21118 1 1 23119 1 0 23120 1 0 23121 1 0 24122 1 0 24123 1 0 24124 1 0 25125 1 6 26126 1 0 26127 1 0 27128 1 0 27129 1 0 29130 1 0 29131 1 0 29132 1 0 31133 1 1 32134 1 1 33135 1 6 34136 1 1 35137 1 6 36138 1 0 36139 1 0 37140 1 0 39141 1 0 40142 1 0 42143 1 1 43144 1 6 44145 1 1 45146 1 1 46147 1 1 47148 1 0 47149 1 0 48150 1 0 50151 1 0 51152 1 0 53153 1 6 54154 1 1 55155 1 1 56156 1 1 57157 1 0 57158 1 0 59159 1 0 60160 1 0 61161 1 0 62162 1 0 64163 1 6 65164 1 1 66165 1 1 67166 1 1 68167 1 6 69168 1 0 69169 1 0 71170 1 1 72171 1 6 73172 1 1 74173 1 6 75174 1 1 76175 1 0 76176 1 0 77177 1 0 79178 1 0 80179 1 0 81180 1 0 83181 1 0 84182 1 0 85183 1 0 86184 1 0 86185 1 0 86186 1 0 M END

Standard InCHIKey	HERICYNRBVMDFO-WVYXDZFESA-N
Standard InCHI	InChI=1S/C59H100O27/c1-24(2)10-9-14-59(8,86-52-47(76)42(71)40(69)31(82-52)23-78-50-46(75)41(70)37(66)28(19-60)79-50)25-11-16-58(7)35(25)26(63)18-33-56(5)15-13-34(55(3,4)32(56)12-17-57(33,58)6)83-53-48(43(72)38(67)29(20-61)80-53)85-54-49(44(73)39(68)30(21-62)81-54)84-51-45(74)36(65)27(64)22-77-51/h10,25-54,60-76H,9,11-23H2,1-8H3/t25-,26+,27+,28+,29+,30+,31+,32-,33+,34-,35-,36-,37+,38+,39+,40+,41-,42-,43-,44-,45+,46+,47+,48+,49+,50+,51-,52-,53-,54-,56-,57+,58+,59-/m0/s1
SMILES	CC(=CCC[C@@](C)([C@H]1CC[C@]2(C)[C@@H]1[C@@H](C[C@@H]1[C@@]3(C)CC[C@@H](C(C)(C)[C@@H]3CC[C@@]21C)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O1)O)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1240.65	Volume:	1186.711 ? Van der Waals volume.
Dense:	1.045	LogP:	0.526 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.505 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.822 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	18.0	Rigid Bonds:	51.0
TPSA:	436.21 ? Topological Polar Surface Area.	H-Bond Acceptor:	27.0
H-Bond Donor:	17.0	Rings:	9.0
Heavy Atoms:	27.0

MedChem Properties

QED Drug-Likeness Score:	0.046	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.31	Fsp³:	0.966
MCE-18:	198.862 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.694	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.404	Promiscuous compounds:	0.197

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.903	MDCK Permeability:	-4.996
Pgp-inhibitor:	0.0	Pgp-substrate:	0.873
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.991
20% Bioavailability (F20%):	0.18	30% Bioavailability (F30%):	1.0
50% Bioavailability (F50%):	0.999

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.001	MRP1:	0.026
Plasma Protein Binding (PPB):	57.597%	Volume Distribution (VD):	-0.328
Fu:	23.287% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.001	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.0
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.476
HLM stability:	0.007 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.74

Half-life (T1/2):

3.969

ADMET: Toxicity

hERG Blockers:	0.001	hERG Blockers (10um):	0.001
Human Hepatotoxicity (H-HT):	0.683	Drug-induced Liver Injury (DILI):	0.779
AMES Toxicity:	0.986	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.005	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.667	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.008	RPMI-8226 Immunitoxicity:	0.351
A549 Cytotoxicity:	0.957	Hek293 Cytotoxicity:	0.336
BCF:	1.201 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.399 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.653 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.679 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.jarmap.2018.11.004]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[12350149]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Flower buds	n.a.	n.a.	PMID[12880307]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Stems	n.a.	n.a.	PMID[17663584]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Roots	n.a.	n.a.	PMID[18186611]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	leaf	n.a.	PMID[18409045]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	flower buds	n.a.	n.a.	PMID[19926279]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	root	n.a.	PMID[2092947]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	berry	n.a.	n.a.	PMID[21216145]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	leaves	n.a.	n.a.	PMID[24290061]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24968750]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25152999]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	Steamed Roots	n.a.	n.a.	PMID[26200131]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	stems-leaves	n.a.	n.a.	PMID[26420067]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	stem	n.a.	PMID[27914541]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	Roots	n.a.	n.a.	PMID[28006911]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[28202328]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	Flower Buds	n.a.	n.a.	PMID[28345906]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32129622]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO14105.1	Panax pseudo - ginseng var. japonicus	Varieties	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO14105.2	Panax pseudo-ginseng var. notoginseng	Varieties	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[MetaboLights]
NPO14105.2	Panax pseudo-ginseng var. notoginseng	Varieties	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO14105.1	Panax pseudo - ginseng var. japonicus	Varieties	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO28005	Panax japonicus	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO21891	Panax notoginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	2

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT136	Cell line	SK-N-SH	Homo sapiens	Activity	=	147.0	%	PMID[12350149]
NPT136	Cell line	SK-N-SH	Homo sapiens	Activity	=	0.53	n.a.	PMID[12350149]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC159005 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	22955
0.1-0.2	22609
0.2-0.3	3052
0.3-0.4	885
0.4-0.5	280
0.5-0.6	31
0.6-0.7	20
0.7-0.8	0
0.8-0.85	4
0.85-0.9	0
0.9-0.95	2
0.95-1	2

Similarity Score	Similarity Level	Natural Product ID
0.9551	High Similarity	NPC14946
0.9551	High Similarity	NPC63368
0.9205	High Similarity	NPC208650
0.9	High Similarity	NPC220427
0.8438	Intermediate Similarity	NPC135369
0.8295	Intermediate Similarity	NPC208477
0.8229	Intermediate Similarity	NPC246124
0.8202	Intermediate Similarity	NPC69737
0.7941	Intermediate Similarity	NPC146868
0.7745	Intermediate Similarity	NPC241381
0.7692	Intermediate Similarity	NPC488294
0.7636	Intermediate Similarity	NPC488293
0.7431	Intermediate Similarity	NPC488291
0.7263	Intermediate Similarity	NPC269627
0.7191	Intermediate Similarity	NPC31907
0.7184	Intermediate Similarity	NPC6931
0.7053	Intermediate Similarity	NPC181467
0.7019	Intermediate Similarity	NPC180183
0.701	Intermediate Similarity	NPC194842
0.6931	Remote Similarity	NPC65167
0.6863	Remote Similarity	NPC160816
0.6789	Remote Similarity	NPC488292
0.6505	Remote Similarity	NPC472988
0.6505	Remote Similarity	NPC38217
0.6486	Remote Similarity	NPC146652
0.6392	Remote Similarity	NPC312553
0.6346	Remote Similarity	NPC476360
0.6346	Remote Similarity	NPC476361
0.6311	Remote Similarity	NPC234160
0.6296	Remote Similarity	NPC472718
0.625	Remote Similarity	NPC157659
0.6224	Remote Similarity	NPC8039
0.6224	Remote Similarity	NPC120123
0.6182	Remote Similarity	NPC472716
0.6176	Remote Similarity	NPC152584
0.6139	Remote Similarity	NPC131479
0.6129	Remote Similarity	NPC66654
0.602	Remote Similarity	NPC159036
0.6019	Remote Similarity	NPC127801
0.598	Remote Similarity	NPC213190
0.5794	Remote Similarity	NPC208594
0.5686	Remote Similarity	NPC472987
0.5644	Remote Similarity	NPC472897
0.5644	Remote Similarity	NPC472896
0.5586	Remote Similarity	NPC305418
0.5566	Remote Similarity	NPC472715
0.5472	Remote Similarity	NPC472719
0.5408	Remote Similarity	NPC234287
0.54	Remote Similarity	NPC160734
0.5385	Remote Similarity	NPC16573
0.5385	Remote Similarity	NPC610948
0.537	Remote Similarity	NPC472717
0.5294	Remote Similarity	NPC114874
0.5253	Remote Similarity	NPC88000
0.5253	Remote Similarity	NPC4831
0.5253	Remote Similarity	NPC472023
0.5238	Remote Similarity	NPC165033
0.5238	Remote Similarity	NPC273879
0.5229	Remote Similarity	NPC210759
0.5221	Remote Similarity	NPC469946
0.513	Remote Similarity	NPC323231
0.5126	Remote Similarity	NPC606145
0.5124	Remote Similarity	NPC471375
0.5122	Remote Similarity	NPC606950
0.5096	Remote Similarity	NPC611039
0.5051	Remote Similarity	NPC280825
0.5051	Remote Similarity	NPC473198
0.5042	Remote Similarity	NPC77717
0.5041	Remote Similarity	NPC609281
0.5041	Remote Similarity	NPC610461

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC159005 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7659
0.1-0.2	1438
0.2-0.3	45
0.3-0.4	8
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data