NPASS Compound

Natural Product: NPC157659

Natural Product ID	NPC157659
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	AVTXSAWPGCSYFO-ZCHNTGFUSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	CHEMBL3357160
PubChem CID	NA
Chemical Classification	CHEMONTID:0000000 [Organic compounds] [CHEMONTID:0000012] Lipids and lipid-like molecules [CHEMONTID:0000259] Prenol lipids [CHEMONTID:0002049] Terpene glycosides [CHEMONTID:0001580] Triterpene glycosides [CHEMONTID:0002358] Triterpene saponins

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 128133 0 0 0 0 0 0 0 0999 V2000 -6.3562 2.8681 -0.7430 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3658 2.5299 -2.2131 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5015 1.6296 -2.6092 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5214 0.9370 -1.6665 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8017 -0.5108 -1.7434 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0658 -1.4799 -0.8916 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.6267 -2.8793 -1.2678 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5961 -1.6145 -1.0898 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.2898 -1.9807 -2.5117 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1348 -1.0805 -2.9404 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4612 -0.8496 -1.6284 C 0 0 2 0 0 0 0 0 0 0 0 0 0.2923 -2.0906 -1.2951 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6494 -0.5884 -0.7064 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.1483 -0.6084 0.7109 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0693 0.4392 0.8776 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 0.3201 -0.1553 C 0 0 2 0 0 0 0 0 0 0 0 0 2.2332 1.1225 0.0565 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0097 2.5746 0.3066 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9660 0.5979 1.2958 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9843 -0.4397 0.9634 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1416 0.1949 0.2226 C 0 0 1 0 0 0 0 0 0 0 0 0 4.5937 1.1038 -0.8555 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9136 2.5531 -0.6097 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3728 0.7194 -2.1176 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1650 0.8077 -1.0977 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5584 1.3195 -2.3496 C 0 0 2 0 0 0 0 0 0 0 0 0 1.3699 0.3937 -2.6570 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3806 0.4030 -1.5264 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.4239 1.6567 -1.7450 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3591 1.2013 -3.4869 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0100 0.8507 1.1021 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2407 0.2080 1.2057 C 0 0 1 0 0 0 0 0 0 0 0 0 8.4246 1.0657 0.9330 C 0 0 1 0 0 0 0 0 0 0 0 0 9.6784 0.2994 1.2516 C 0 0 2 0 0 0 0 0 0 0 0 0 9.4586 -1.1495 1.5616 C 0 0 1 0 0 0 0 0 0 0 0 0 8.2499 -1.4203 2.3984 C 0 0 1 0 0 0 0 0 0 0 0 0 8.7034 -1.9076 3.7604 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6253 -2.2787 4.5591 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4143 -0.3104 2.5121 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4330 -1.8387 0.3440 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3879 0.8678 2.3342 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5279 1.5000 -0.3815 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2207 -0.1477 1.5233 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3338 -1.2626 0.4744 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6195 -1.3475 0.8803 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.8430 -2.4082 1.9777 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.3574 -2.4769 2.1650 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.7542 -1.1493 2.7766 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.2616 -0.0526 1.8606 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.4733 1.2517 2.6007 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6540 1.1909 3.7496 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.9311 -0.1404 1.5331 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.1437 -1.1150 2.8088 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6818 -3.4734 3.0850 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.3666 -3.6397 1.6160 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.3235 3.2117 -3.1152 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3827 3.3478 -0.5265 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4436 1.8871 -0.2352 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1817 3.5470 -0.5404 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4638 1.3490 -3.6469 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4780 1.4034 -0.6910 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5489 1.2222 -2.1917 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7007 -0.7703 -2.8521 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9381 -0.6656 -1.6246 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7165 -2.9314 -1.1571 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4523 -3.0441 -2.3737 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0727 -3.6741 -0.7798 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3679 -2.5888 -0.4369 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0048 -3.0526 -2.5529 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0744 -1.8265 -3.2419 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4357 -0.2202 -3.5142 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4935 -1.7123 -3.5916 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2661 -2.4374 -0.2675 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3640 -2.0542 -1.5963 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0939 -2.9729 -1.8933 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0210 0.4119 -0.8614 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9076 -1.5814 1.1257 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3198 0.2237 1.9195 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5447 1.4092 0.9789 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3683 -0.7502 -0.0558 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8107 3.2096 -0.5456 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8085 2.9970 0.9879 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0865 2.6370 0.9586 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3190 0.2033 2.0687 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5386 1.4395 1.7907 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6242 -1.3519 0.4974 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4206 -0.7597 1.9565 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7126 -0.6788 -0.1745 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8895 2.8494 -1.0996 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1700 3.2566 -0.9764 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1357 2.6660 0.4900 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4284 0.4494 -1.8009 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9972 -0.1800 -2.5968 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5353 1.5980 -2.7817 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1173 -0.3264 -1.1767 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2498 2.3785 -2.3362 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8965 0.7988 -3.5675 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7960 -0.5691 -2.9092 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2261 2.4769 -2.1841 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2108 1.5324 -2.5177 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8901 2.1003 -0.8788 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7588 1.2300 -4.2644 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2310 -0.6799 0.5471 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3999 1.9380 1.6365 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4240 0.3284 0.4021 H 0 0 0 0 0 0 0 0 0 0 0 0 10.3938 -1.5093 2.0795 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6640 -2.2249 1.8957 H 0 0 0 0 0 0 0 0 0 0 0 0 9.4060 -2.7499 3.5939 H 0 0 0 0 0 0 0 0 0 0 0 0 9.2661 -1.1175 4.2959 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3134 -1.4609 5.0281 H 0 0 0 0 0 0 0 0 0 0 0 0 9.5250 -2.8017 0.4311 H 0 0 0 0 0 0 0 0 0 0 0 0 9.7845 1.1572 3.0569 H 0 0 0 0 0 0 0 0 0 0 0 0 8.5374 2.4910 -0.3813 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2991 0.8210 1.5086 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3844 -1.5871 0.1167 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4286 -2.0172 2.9356 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8880 -2.5824 1.2042 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3464 -0.9925 3.7817 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8681 -0.0560 0.9302 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5132 1.3563 2.9704 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1984 2.1428 2.0238 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1368 1.5363 4.5420 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4972 -0.7082 3.6291 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6455 -3.4297 3.2432 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9847 -4.0710 2.4297 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2081 3.5113 -2.5199 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8809 4.1155 -3.5784 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6003 2.5373 -3.9535 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 1 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 1 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 22 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 1 26 30 1 0 21 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 37 38 1 0 36 39 1 0 35 40 1 0 34 41 1 0 33 42 1 0 14 43 1 0 6 44 1 1 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 49 52 1 0 48 53 1 0 47 54 1 0 46 55 1 0 2 56 1 0 13 8 1 0 28 16 1 0 39 32 1 0 52 45 1 0 28 11 1 0 25 17 1 0 1 57 1 0 1 58 1 0 1 59 1 0 3 60 1 0 4 61 1 0 4 62 1 0 5 63 1 0 5 64 1 0 7 65 1 0 7 66 1 0 7 67 1 0 8 68 1 1 9 69 1 0 9 70 1 0 10 71 1 0 10 72 1 0 12 73 1 0 12 74 1 0 12 75 1 0 13 76 1 6 14 77 1 1 15 78 1 0 15 79 1 0 16 80 1 6 18 81 1 0 18 82 1 0 18 83 1 0 19 84 1 0 19 85 1 0 20 86 1 0 20 87 1 0 21 88 1 6 23 89 1 0 23 90 1 0 23 91 1 0 24 92 1 0 24 93 1 0 24 94 1 0 25 95 1 6 26 96 1 1 27 97 1 0 27 98 1 0 29 99 1 0 29100 1 0 29101 1 0 30102 1 0 32103 1 6 33104 1 1 34105 1 6 35106 1 1 36107 1 6 37108 1 0 37109 1 0 38110 1 0 40111 1 0 41112 1 0 42113 1 0 43114 1 0 45115 1 6 46116 1 1 47117 1 6 48118 1 1 49119 1 6 50120 1 0 50121 1 0 51122 1 0 53123 1 0 54124 1 0 55125 1 0 56126 1 0 56127 1 0 56128 1 0 M END

Standard InCHIKey	AVTXSAWPGCSYFO-ZCHNTGFUSA-N
Standard InCHI	InChI=1S/C42H72O14/c1-20(2)10-9-13-42(8,56-37-34(52)32(50)30(48)25(19-44)54-37)21-11-15-40(6)28(21)22(45)16-26-39(5)14-12-27(38(3,4)35(39)23(46)17-41(26,40)7)55-36-33(51)31(49)29(47)24(18-43)53-36/h10,21-37,43-52H,9,11-19H2,1-8H3/t21-,22+,23-,24+,25+,26+,27-,28-,29+,30+,31-,32-,33+,34+,35-,36-,37-,39+,40+,41+,42-/m0/s1
SMILES	CC(=CCC[C@@](C)([C@H]1CC[C@]2(C)[C@@H]1[C@@H](C[C@@H]1[C@@]3(C)CC[C@@H](C(C)(C)[C@@H]3[C@H](C[C@@]21C)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	800.49	Volume:	804.076 ? Van der Waals volume.
Dense:	0.996	LogP:	2.928 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	3.171 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-4.49 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	10.0	Rigid Bonds:	33.0
TPSA:	239.22 ? Topological Polar Surface Area.	H-Bond Acceptor:	14.0
H-Bond Donor:	10.0	Rings:	6.0
Heavy Atoms:	14.0

MedChem Properties

QED Drug-Likeness Score:	0.11	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	6.03	Fsp³:	0.952
MCE-18:	135.585 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.755	Fluc inhibitor:	0.0 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.005 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.0 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.241	Promiscuous compounds:	0.204

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.356	MDCK Permeability:	-5.068
Pgp-inhibitor:	0.001	Pgp-substrate:	0.808
PAMPA:	0.998 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.158
20% Bioavailability (F20%):	0.101	30% Bioavailability (F30%):	0.924
50% Bioavailability (F50%):	0.989

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.154	MRP1:	0.348
Plasma Protein Binding (PPB):	66.853%	Volume Distribution (VD):	-0.426
Fu:	24.648% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.004
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.004	CYP2C19-substrate:	0.001
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.028
CYP3A4-inhibitor:	0.019	CYP3A4-substrate:	0.536
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.149
HLM stability:	0.101 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

0.835

Half-life (T1/2):

3.001

ADMET: Toxicity

hERG Blockers:	0.008	hERG Blockers (10um):	0.012
Human Hepatotoxicity (H-HT):	0.635	Drug-induced Liver Injury (DILI):	0.615
AMES Toxicity:	0.922	Rat Oral Acute Toxicity:	0.003
Maximum Recommended Daily Dose:	0.002	Skin Sensitization:	1.0
Carcinogencity:	0.103	Eye Corrosion:	0.0
Eye Irritation:	0.003	Respiratory Toxicity:	0.002
Drug-induced Neurotoxicity:	0.002	Ototoxicity:	0.999
Hematotoxicity:	0.757	Drug-induced Nephrotoxicity:	0.985
Genotoxicity:	0.097	RPMI-8226 Immunitoxicity:	0.164
A549 Cytotoxicity:	0.778	Hek293 Cytotoxicity:	0.327
BCF:	1.171 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.402 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.712 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.953 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[ 12877918]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.jarmap.2018.11.004]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.jarmap.2018.11.004]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	leaf	n.a.	PMID[18409045]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	flower buds	n.a.	n.a.	PMID[19926279]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	root	n.a.	PMID[2092947]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	berry	n.a.	n.a.	PMID[21216145]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	leaves	n.a.	n.a.	PMID[24290061]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24968750]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25152999]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	leaves and stems	n.a.	n.a.	PMID[25442304]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	stems-leaves	n.a.	n.a.	PMID[26420067]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	stem	n.a.	PMID[27914541]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	Flower Buds	n.a.	n.a.	PMID[28345906]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32129622]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[MetaboLights]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO20712	Panax quinquefolius	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
Activity	2

Activity Type	# Activity
Cell line	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT380	Cell line	U-251	Homo sapiens	Activity	=	92.55	%	PMID[25442304]
NPT76	Cell line	C6	Rattus norvegicus	Activity	=	65.57	%	PMID[25442304]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC157659 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20351
0.1-0.2	24721
0.2-0.3	3868
0.3-0.4	813
0.4-0.5	57
0.5-0.6	25
0.6-0.7	17
0.7-0.8	0
0.8-0.85	1
0.85-0.9	1
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.8718	High Similarity	NPC269627
0.8243	Intermediate Similarity	NPC31907
0.7895	Intermediate Similarity	NPC160734
0.7349	Intermediate Similarity	NPC69737
0.7229	Intermediate Similarity	NPC208477
0.6962	Remote Similarity	NPC473200
0.6923	Remote Similarity	NPC66654
0.6889	Remote Similarity	NPC476360
0.6889	Remote Similarity	NPC476361
0.6744	Remote Similarity	NPC181467
0.6667	Remote Similarity	NPC213190
0.6627	Remote Similarity	NPC114874
0.6593	Remote Similarity	NPC208650
0.6452	Remote Similarity	NPC220427
0.6421	Remote Similarity	NPC14946
0.6421	Remote Similarity	NPC63368
0.6292	Remote Similarity	NPC131479
0.6265	Remote Similarity	NPC43912
0.625	Remote Similarity	NPC159005
0.6235	Remote Similarity	NPC8431
0.6224	Remote Similarity	NPC135369
0.602	Remote Similarity	NPC246124
0.598	Remote Similarity	NPC241381
0.5978	Remote Similarity	NPC127801
0.5978	Remote Similarity	NPC152584
0.593	Remote Similarity	NPC309425
0.59	Remote Similarity	NPC180183
0.5865	Remote Similarity	NPC146868
0.5833	Remote Similarity	NPC234287
0.5833	Remote Similarity	NPC88000
0.5833	Remote Similarity	NPC4831
0.5833	Remote Similarity	NPC472023
0.5773	Remote Similarity	NPC65167
0.5729	Remote Similarity	NPC208594
0.5714	Remote Similarity	NPC488292
0.566	Remote Similarity	NPC488294
0.5595	Remote Similarity	NPC280825
0.5595	Remote Similarity	NPC473198
0.5556	Remote Similarity	NPC160816
0.5357	Remote Similarity	NPC488291
0.5278	Remote Similarity	NPC146652
0.5217	Remote Similarity	NPC274833
0.5172	Remote Similarity	NPC488293
0.5161	Remote Similarity	NPC312553
0.5161	Remote Similarity	NPC8039
0.5161	Remote Similarity	NPC120123
0.5143	Remote Similarity	NPC6931

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC157659 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	7419
0.1-0.2	1658
0.2-0.3	68
0.3-0.4	5
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data