NPASS Compound

Natural Product: NPC488291

Natural Product ID	NPC488291
Common Name ? The InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.	XENTZWWGCWIEHN-HLJDGUNLSA-N
IUPAC Name	n.a.
Synonyms
Synthetic Gene Cluster	n.a.
ChEMBL Identifier	n.a.
PubChem CID	132576324
Chemical Classification	CHEMONTID:0000000 [Organic compounds]

The Chemical Classification was calculated by Classyfire, a software for chemical taxonomy calculation. Reference: DOI:10.1186/s13321-016-0174-y.

Chemical Representations

RDKit 3D 177184 0 0 0 0 0 0 0 0999 V2000 4.8538 -1.5299 -5.5065 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2395 -2.6827 -4.6450 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6418 -2.8709 -3.4863 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5547 -1.9561 -2.9668 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0498 -1.4202 -1.6704 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0360 -0.4571 -0.9935 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9027 0.6525 -2.0231 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7372 -1.1401 -0.8021 C 0 0 1 0 0 0 0 0 0 0 0 0 1.9708 -2.3863 0.0852 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5557 -2.8420 0.4417 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2985 -1.7028 0.0332 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.6886 -1.9435 -1.4173 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6913 -0.5185 0.0348 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0723 0.7433 -0.3907 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.1543 1.0224 0.5205 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0497 -0.1345 0.4001 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4994 0.0560 0.7540 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6446 0.0665 2.2419 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0301 1.3292 0.2110 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4922 1.4888 0.5466 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3295 0.3323 0.0426 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.6197 -0.8868 -0.3285 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7624 -1.0297 -1.8716 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3994 -2.1151 0.1813 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2068 -1.0856 0.0742 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.8718 -2.3094 0.8552 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4095 -2.5616 0.9109 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4717 -1.4137 0.9285 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.9116 -1.2760 2.3309 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3956 0.0604 0.8997 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.5881 0.5571 0.5084 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.7516 -0.3707 0.3566 C 0 0 1 0 0 0 0 0 0 0 0 0 -10.0000 -1.1716 1.6114 C 0 0 2 0 0 0 0 0 0 0 0 0 -9.3625 -0.5293 2.8097 C 0 0 1 0 0 0 0 0 0 0 0 0 -9.2030 0.9522 2.7270 C 0 0 1 0 0 0 0 0 0 0 0 0 -8.1843 1.4475 3.7669 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4831 0.8519 5.0169 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.9801 1.4870 1.4929 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.9884 -0.9030 3.9982 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.6133 -2.5027 1.4707 O 0 0 0 0 0 0 0 0 0 0 0 0 -10.8715 0.4597 0.1875 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.5400 0.2701 -0.9963 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.9588 -0.1630 -0.6718 C 0 0 1 0 0 0 0 0 0 0 0 0 -13.9114 1.0115 -0.5895 C 0 0 2 0 0 0 0 0 0 0 0 0 -13.9652 1.6557 -1.9457 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.5920 1.6623 -2.5377 C 0 0 1 0 0 0 0 0 0 0 0 0 -12.3926 3.0228 -3.1982 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.3612 3.3145 -4.1367 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.5684 1.5096 -1.6390 O 0 0 0 0 0 0 0 0 0 0 0 0 -14.8708 0.9052 -2.7294 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.5090 1.9491 0.3575 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.4626 -1.0475 -1.6254 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9030 1.8178 -0.0976 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6164 -0.0795 0.1860 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7729 0.6325 0.0629 C 0 0 1 0 0 0 0 0 0 0 0 0 4.7616 1.8493 0.9330 C 0 0 1 0 0 0 0 0 0 0 0 0 5.9720 2.6740 0.5308 C 0 0 2 0 0 0 0 0 0 0 0 0 7.1923 1.8323 0.6261 C 0 0 1 0 0 0 0 0 0 0 0 0 7.0492 0.4011 0.2815 C 0 0 1 0 0 0 0 0 0 0 0 0 8.1097 -0.3930 1.0304 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3721 0.1622 0.8283 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3464 -0.5726 1.4884 C 0 0 1 0 0 0 0 0 0 0 0 0 11.4023 -1.1400 0.6031 C 0 0 1 0 0 0 0 0 0 0 0 0 12.4347 -0.1515 0.1530 C 0 0 2 0 0 0 0 0 0 0 0 0 12.8464 0.8089 1.2188 C 0 0 1 0 0 0 0 0 0 0 0 0 11.7656 1.1230 2.2028 C 0 0 1 0 0 0 0 0 0 0 0 0 11.0713 2.4077 1.7762 C 0 0 0 0 0 0 0 0 0 0 0 0 12.0973 3.3442 1.5006 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9270 0.1067 2.5303 O 0 0 0 0 0 0 0 0 0 0 0 0 14.0544 0.4253 1.8870 O 0 0 0 0 0 0 0 0 0 0 0 0 15.2190 1.1753 1.8036 C 0 0 0 0 0 0 0 0 0 0 0 0 15.1663 2.2211 1.1048 O 0 0 0 0 0 0 0 0 0 0 0 0 16.4614 0.8030 2.4784 C 0 0 0 0 0 0 0 0 0 0 0 0 17.5048 1.8030 2.1833 C 0 0 0 0 0 0 0 0 0 0 0 0 17.2506 2.7782 1.4517 O 0 0 0 0 0 0 0 0 0 0 0 0 18.7656 1.6282 2.7370 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0508 0.5204 -1.0212 O 0 0 0 0 0 0 0 0 0 0 0 0 11.9990 -2.2360 1.2553 O 0 0 0 0 0 0 0 0 0 0 0 0 5.8215 -0.1888 0.5690 O 0 0 0 0 0 0 0 0 0 0 0 0 8.1110 2.3795 -0.3088 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1017 3.8135 1.3220 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6643 2.6627 0.8271 O 0 0 0 0 0 0 0 0 0 0 0 0 6.3049 -3.5968 -5.1290 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5185 -1.4411 -6.3714 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0070 -0.6075 -4.8866 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7968 -1.5918 -5.8248 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9519 -3.7255 -2.8866 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3710 -1.2320 -3.7605 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6433 -2.5860 -2.8932 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9707 -0.8637 -1.8616 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2918 -2.2560 -1.0066 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6083 0.5440 -2.8805 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8955 0.5675 -2.4712 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1159 1.6615 -1.6231 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3866 -1.4418 -1.8153 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5551 -3.1507 -0.4146 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3985 -2.0031 1.0373 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4563 -3.2361 1.4422 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3778 -3.7262 -0.2429 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0681 -2.7719 -1.8835 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7189 -2.3230 -1.5493 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5849 -1.0765 -2.0647 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1401 -0.3526 1.0349 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2302 0.8332 -1.4465 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8423 1.3100 1.5221 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6185 1.9140 0.0431 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1015 -0.3008 -0.7312 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3291 -0.8296 2.7629 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.6861 0.2527 2.5847 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0564 0.9247 2.6221 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5328 2.2392 0.6597 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9227 1.4230 -0.8834 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7011 1.6785 1.6150 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7806 2.4694 0.0587 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8527 0.7994 -0.8537 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9010 -2.0604 -2.1794 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7796 -0.7017 -2.2676 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5730 -0.4071 -2.2478 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3513 -2.2288 1.2602 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1445 -3.0271 -0.4102 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.4491 -1.8981 -0.1032 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6580 -1.2308 -0.9090 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3197 -3.1907 0.3038 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3737 -2.3555 1.8463 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2681 -3.1755 1.8624 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1216 -3.3406 0.1367 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1904 -1.4980 2.3852 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3261 -2.0706 3.0179 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0163 -0.2983 2.7835 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.5403 1.1419 -0.4519 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6597 -1.0410 -0.5214 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0934 -1.1974 1.7852 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3252 -0.9698 2.8760 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1780 1.3932 3.0997 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2736 2.5393 3.9372 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1521 1.2398 3.4644 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7936 0.1374 5.1947 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9236 -1.1651 3.8707 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3268 -2.9608 0.9610 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.1044 -0.5100 -1.6571 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0138 -0.6880 0.3070 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.8931 0.6005 -0.2736 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.4299 2.6653 -1.8726 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5818 0.9302 -3.3713 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3809 3.1046 -3.6678 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.4326 3.8384 -2.4338 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.6676 4.2484 -4.1171 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.7747 1.0886 -2.3200 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4737 1.5197 1.2544 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6958 -1.4500 -2.0886 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5940 2.6690 -0.5229 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0461 0.9309 -0.9741 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9245 1.5360 2.0124 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8175 3.0055 -0.5167 H 0 0 0 0 0 0 0 0 0 0 0 0 7.6538 1.9326 1.6407 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2856 0.2251 -0.8104 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8576 -0.4809 2.1189 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0974 -1.4448 0.6311 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8087 -1.4417 1.9594 H 0 0 0 0 0 0 0 0 0 0 0 0 10.9276 -1.5807 -0.3186 H 0 0 0 0 0 0 0 0 0 0 0 0 13.3468 -0.7398 -0.1412 H 0 0 0 0 0 0 0 0 0 0 0 0 13.1009 1.7715 0.6808 H 0 0 0 0 0 0 0 0 0 0 0 0 12.3038 1.4109 3.1601 H 0 0 0 0 0 0 0 0 0 0 0 0 10.4330 2.8462 2.5359 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5590 2.2494 0.8153 H 0 0 0 0 0 0 0 0 0 0 0 0 12.2392 3.9196 2.3008 H 0 0 0 0 0 0 0 0 0 0 0 0 16.2824 0.7323 3.5846 H 0 0 0 0 0 0 0 0 0 0 0 0 16.7641 -0.2195 2.1706 H 0 0 0 0 0 0 0 0 0 0 0 0 19.4352 2.3921 2.7874 H 0 0 0 0 0 0 0 0 0 0 0 0 11.2086 0.1936 -1.3820 H 0 0 0 0 0 0 0 0 0 0 0 0 11.3068 -2.7705 1.7182 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0928 3.3579 -0.2661 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6135 4.5626 0.8752 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8438 3.4665 0.2696 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9624 -3.8685 -4.2806 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9061 -4.5141 -5.5857 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9081 -3.0935 -5.9200 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 3 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 6 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 6 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 1 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 22 24 1 0 22 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 1 21 30 1 0 30 31 1 0 31 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 35 36 1 0 36 37 1 0 35 38 1 0 34 39 1 0 33 40 1 0 32 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 1 0 47 48 1 0 46 49 1 0 45 50 1 0 44 51 1 0 43 52 1 0 14 53 1 0 6 54 1 1 54 55 1 0 55 56 1 0 56 57 1 0 57 58 1 0 58 59 1 0 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 66 69 1 0 65 70 1 0 70 71 1 0 71 72 2 0 71 73 1 0 73 74 1 0 74 75 2 0 74 76 1 0 64 77 1 0 63 78 1 0 59 79 1 0 58 80 1 0 57 81 1 0 56 82 1 0 2 83 1 0 13 8 1 0 28 16 1 0 38 31 1 0 49 42 1 0 79 55 1 0 28 11 1 0 69 62 1 0 25 17 1 0 1 84 1 0 1 85 1 0 1 86 1 0 3 87 1 0 4 88 1 0 4 89 1 0 5 90 1 0 5 91 1 0 7 92 1 0 7 93 1 0 7 94 1 0 8 95 1 6 9 96 1 0 9 97 1 0 10 98 1 0 10 99 1 0 12100 1 0 12101 1 0 12102 1 0 13103 1 1 14104 1 6 15105 1 0 15106 1 0 16107 1 6 18108 1 0 18109 1 0 18110 1 0 19111 1 0 19112 1 0 20113 1 0 20114 1 0 21115 1 6 23116 1 0 23117 1 0 23118 1 0 24119 1 0 24120 1 0 24121 1 0 25122 1 6 26123 1 0 26124 1 0 27125 1 0 27126 1 0 29127 1 0 29128 1 0 29129 1 0 31130 1 6 32131 1 6 33132 1 1 34133 1 1 35134 1 1 36135 1 0 36136 1 0 37137 1 0 39138 1 0 40139 1 0 42140 1 6 43141 1 1 44142 1 1 45143 1 1 46144 1 6 47145 1 0 47146 1 0 48147 1 0 50148 1 0 51149 1 0 52150 1 0 53151 1 0 55152 1 6 56153 1 1 57154 1 6 58155 1 1 59156 1 6 60157 1 0 60158 1 0 62159 1 1 63160 1 6 64161 1 6 65162 1 6 66163 1 1 67164 1 0 67165 1 0 68166 1 0 73167 1 0 73168 1 0 76169 1 0 77170 1 0 78171 1 0 80172 1 0 81173 1 0 82174 1 0 83175 1 0 83176 1 0 83177 1 0 M END

Standard InCHIKey	XENTZWWGCWIEHN-HLJDGUNLSA-N
Standard InCHI	InChI=1S/C57H94O26/c1-24(2)10-9-14-57(8,83-51-45(73)41(69)39(67)30(79-51)23-75-49-46(74)43(71)47(29(22-60)78-49)81-35(64)19-34(62)63)25-11-16-56(7)36(25)26(61)18-32-54(5)15-13-33(53(3,4)31(54)12-17-55(32,56)6)80-52-48(42(70)38(66)28(21-59)77-52)82-50-44(72)40(68)37(65)27(20-58)76-50/h10,25-33,36-52,58-61,65-74H,9,11-23H2,1-8H3,(H,62,63)/t25-,26+,27+,28+,29+,30+,31-,32+,33-,36-,37+,38+,39+,40-,41-,42-,43+,44+,45+,46+,47+,48+,49+,50-,51-,52-,54-,55+,56+,57-/m0/s1
SMILES	CC(=CCC[C@@](C)([C@H]1CC[C@]2(C)[C@@H]1[C@@H](C[C@@H]1[C@@]3(C)CC[C@@H](C(C)(C)[C@@H]3CC[C@@]21C)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)OC(=O)CC(=O)O)O)O)O1)O)O)O)C

Calculated Properties

Physi-Chem Properties

Molecular Weight:	1194.6	Volume:	1146.612 ? Van der Waals volume.
Dense:	1.042	LogP:	0.769 ? The logarithm of the n-octanol/water distribution coefficients.
logD7.4:	1.871 ? The logarithm of the n-octanol/water distribution coefficient at pH=7.4.	LogS:	-3.77 ? The logarithm of aqueous solubility value.
Rotatable Bonds:	20.0	Rigid Bonds:	47.0
TPSA:	420.66 ? Topological Polar Surface Area.	H-Bond Acceptor:	26.0
H-Bond Donor:	15.0	Rings:	8.0
Heavy Atoms:	26.0

MedChem Properties

QED Drug-Likeness Score:	0.028	GASA:	1.0 ? GASA represents the probability of being difficult to synthesize, ranging from 0 to 1.
Synthetic Accessibility Score:	7.103	Fsp³:	0.93
MCE-18:	181.745 ? MCE-18 stands for medicinal chemistry evolution.MCE-18≥45 is considered a suitable value.	Lipinski Rule-of-5:	Accepted
Pfizer Rule:	Rejected	GSK Rule:	Accepted
Golden Triangle Rule:	Accepted	BMS Rule:	1
Chelating Alert:	0	PAINS Alert:	0
Colloidal aggregators:	0.707	Fluc inhibitor:	0.002 ? The fluc inhibitor value is the probability of being fLuc inhibitors, within the range of 0 to 1.
Blue fluorescence:	0.002 ? The blue fluorescence value is the probability of being blue fluorescence, within the range of 0 to 1	Green fluorescence:	0.001 ? The green fluorescence value is the probability of being green fluorescence, within the range of 0 to 1
Reactive compounds:	0.254	Promiscuous compounds:	0.353

ADMET Properties (ADMETlab3.0)

ADMET: Absorption

Caco-2 Permeability:	-6.688	MDCK Permeability:	-4.98
Pgp-inhibitor:	0.0	Pgp-substrate:	0.059
PAMPA:	1.0 ? The experimental data for Peff was logarithmically transformed (logPeff). Molecules with log Peff values below 2.0 were classified as low-permeability (Category 0), while those with log Peff values exceeding 2.5 were classified as high-permeability (Category 1).	Human Intestinal Absorption (HIA):	0.952
20% Bioavailability (F20%):	0.043	30% Bioavailability (F30%):	0.998
50% Bioavailability (F50%):	0.997

ADMET: Distribution

Blood-Brain-Barrier Penetration (BBB):	0.0	MRP1:	0.31
Plasma Protein Binding (PPB):	58.241%	Volume Distribution (VD):	-0.436
Fu:	25.46% ? The fraction unbound in plasms.	OATP1B1 inhibitor:	1.0
OATP1B3 inhibitor:	1.0	BCRP inhibitor:	0.0
BSEP inhibitor:	0.0

ADMET: Metabolism

CYP1A2-inhibitor:	0.0	CYP1A2-substrate:	0.0
CYP2C19-inhibitor:	0.0	CYP2C19-substrate:	0.0
CYP2C9-inhibitor:	0.0	CYP2C9-substrate:	0.0
CYP2D6-inhibitor:	0.0	CYP2D6-substrate:	0.0
CYP3A4-inhibitor:	0.0	CYP3A4-substrate:	0.001
CYP2B6-substrate:	0.0	CYP2C8-inhibitor:	0.678
HLM stability:	0.0 ? Human liver microsomal (HLM) stability. Category 0: stable+ (HLM > 30 min); Category 1: unstable- (HLM ≤ 30 min). The output value is the probability of human liver microsomal instability, where a value closer to 1 indicates a higher likelihood of instability.

ADMET: Excretion

Clearance (CL):

-0.401

Half-life (T1/2):

3.779

ADMET: Toxicity

hERG Blockers:	0.0	hERG Blockers (10um):	0.0
Human Hepatotoxicity (H-HT):	0.715	Drug-induced Liver Injury (DILI):	0.94
AMES Toxicity:	0.97	Rat Oral Acute Toxicity:	0.0
Maximum Recommended Daily Dose:	0.0	Skin Sensitization:	1.0
Carcinogencity:	0.02	Eye Corrosion:	0.0
Eye Irritation:	0.0	Respiratory Toxicity:	0.0
Drug-induced Neurotoxicity:	0.0	Ototoxicity:	1.0
Hematotoxicity:	0.902	Drug-induced Nephrotoxicity:	0.999
Genotoxicity:	0.205	RPMI-8226 Immunitoxicity:	0.209
A549 Cytotoxicity:	0.803	Hek293 Cytotoxicity:	0.137
BCF:	0.466 ? Bioconcentration factors are used for considering secondary poisoning potential and assessing risks to human health via the food chain. The unit is -log10[(mg/L)/(1000*MW)].	IGC50:	3.324 ? 48 hour Tetrahymena pyriformis IGC50. The unit of IGC50 is -log10[(mg/L)/(1000*MW)].
LC50DM:	4.907 ? 48 hour Daphnia magna LC50. The unit of LC50DM is -log10[(mg/L)/(1000*MW)].	LC50FM:	3.749 ? 96 hour fathead minnow LC50. The unit of LC50FM is -log10[(mg/L)/(1000*MW)].

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	DOI[10.1016/j.jarmap.2018.11.004]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	leaf	n.a.	PMID[18409045]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	flower buds	n.a.	n.a.	PMID[19926279]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	root	n.a.	PMID[2092947]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	berry	n.a.	n.a.	PMID[21216145]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	leaves	n.a.	n.a.	PMID[24290061]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[24968750]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[25152999]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	stems-leaves	n.a.	n.a.	PMID[26420067]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	stem	n.a.	PMID[27914541]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	Flower Buds	n.a.	n.a.	PMID[28345906]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	PMID[32129622]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[COCONUT]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[HerDing]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[MetaboLights]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCMID]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TCM_Taiwan]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[TM-MC]
NPO29141	Panax ginseng	Species	Araliaceae	Eukaryota	n.a.	n.a.	n.a.	Database[UNPD]

Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

NP Quantity Composition/Concentration

Organism ID	Organism Name	Organism Material Preparation	Organism Part	NP Quantity (Standard)	NP Quantity (Minimum)	NP Quantity (Maximum)	Quantity Unit	Reference

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].

Biological Activity

Activity Type	# Activity
EC50	1
FC	1

Activity Type	# Activity
Protein complex	2

Molecular-level activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

In vitro activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT23107	Protein complex	AMPK alpha2/beta1/gamma1	Homo sapiens	EC50	=	16.8	nM	PMID[28345906]
NPT23107	Protein complex	AMPK alpha2/beta1/gamma1	Homo sapiens	FC	=	1.7	n.a.	PMID[28345906]

In vivo activity

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference

Experimental ADME

Experiment Model	Experiment Tissue	ADME Type	ADME Relation	ADME Value	ADME Unit	Reference

Experimental Toxicity

Quantitative toxicity

Experiment Model	Experiment Organism	Toxicity Type	Toxicity Relation	Toxicity Value	Toxicity Unit	Reference

Common Abbreviations:
LC: Lethal Concentration; LD: Lethal Dose; LT:Lethal Time; NOAEL: No-observed-adverse-effect Level; BMDL: Benchmark Dose Lower Confidence Limit; BMD: Benchmark Dose; BMC:Benchmark Concentration; LOAEL: Lowest Observed Adverse Effect Level; RfD:Reference Dose; RfC:Reference Concentration; MRL: Minimal Risk Level; MEG: Maximum Exposure Guideline; PAC: Protective Action Criteria

Categorical toxicity labels

Hepatotoxicity	Carcinogenicity	Mutagenicity	Cardiotoxicity	Respiratory Toxicity	Eye Irritation	Endocrine Disruption

Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP toxicity records from domain-specific databases. These databases include:
☉ ToxValDB: a curated database that compiles quantitative toxicity values for chemicals from diverse public sources to support toxicological research and risk assessment.
☉ TOXRIC: a comprehensive, free-to-access, online database providing toxicological/feature data. The toxicity labels are retrieved from this database. [PMID: 36400569]

Chemically structural similarity

Similar Active Natural Products in NPASS

Top-200 similar NPs were calculated against the active-NP-set (includes approximately 50,000 NPs with experimentally-derived bioactivity available in NPASS)

Similarity is measured using the Tanimoto coefficient (Tc) , which compares the binary fingerprints of two molecules. Tc is calculated as the intersection divided by the union of '1' bits in the fingerprints, ranging from 0 to 1, with 1 indicating highest similarity.

● The left chart: Distribution of similarity level between NPC488291 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	20838
0.1-0.2	24533
0.2-0.3	3316
0.3-0.4	874
0.4-0.5	254
0.5-0.6	18
0.6-0.7	8
0.7-0.8	0
0.8-0.85	0
0.85-0.9	3
0.9-0.95	2
0.95-1	0

Similarity Score	Similarity Level	Natural Product ID
0.932	High Similarity	NPC488292
0.9266	High Similarity	NPC488293
0.8774	High Similarity	NPC146868
0.8692	High Similarity	NPC488294
0.8585	High Similarity	NPC241381
0.7981	Intermediate Similarity	NPC220427
0.7961	Intermediate Similarity	NPC208650
0.7545	Intermediate Similarity	NPC135369
0.7431	Intermediate Similarity	NPC14946
0.7431	Intermediate Similarity	NPC159005
0.7431	Intermediate Similarity	NPC63368
0.7184	Intermediate Similarity	NPC208477
0.7115	Intermediate Similarity	NPC69737
0.6466	Remote Similarity	NPC246124
0.6356	Remote Similarity	NPC180183
0.6261	Remote Similarity	NPC65167
0.625	Remote Similarity	NPC31907
0.6216	Remote Similarity	NPC269627
0.6182	Remote Similarity	NPC181467
0.6034	Remote Similarity	NPC472988
0.6034	Remote Similarity	NPC38217
0.5766	Remote Similarity	NPC312553
0.5738	Remote Similarity	NPC472718
0.5726	Remote Similarity	NPC234160
0.5625	Remote Similarity	NPC8039
0.5625	Remote Similarity	NPC120123
0.5565	Remote Similarity	NPC6931
0.547	Remote Similarity	NPC152584
0.5426	Remote Similarity	NPC146652
0.5397	Remote Similarity	NPC472716
0.5357	Remote Similarity	NPC157659
0.5339	Remote Similarity	NPC194842
0.5339	Remote Similarity	NPC127801
0.531	Remote Similarity	NPC159036
0.5299	Remote Similarity	NPC213190
0.5285	Remote Similarity	NPC160816
0.5229	Remote Similarity	NPC66654
0.5164	Remote Similarity	NPC208594
0.5043	Remote Similarity	NPC472987

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC488291 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.5 or Top200).

range	Tanimoto Coefficient
0-0.1	6610
0.1-0.2	2472
0.2-0.3	65
0.3-0.4	3
0.4-0.5	0
0.5-0.6	0
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
		NPD

Bioactivity similarity

Similar Natural Products in NPASS

Similarity level is defined by Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.

A: chemistry similarity

B: biological targets similarity

C: networks similarity

D: cell-based bioactivity similarity

E: similarity based on clinical data